🚀 Launch SolarAgent Technology Preview

💄 Somewhere optimization

README.md

@@ -1,16 +1,3 @@
-# goatagent
+# SolarAgent
 
-The official Application of Goatworks Global Hydrogen Network
+The official Solar Network moblie application.
-
-## Getting Started
-
-This project is a starting point for a Flutter application.
-
-A few resources to get you started if this is your first Flutter project:
-
-- [Lab: Write your first Flutter app](https://docs.flutter.dev/get-started/codelab)
-- [Cookbook: Useful Flutter samples](https://docs.flutter.dev/cookbook)
-
-For help getting started with Flutter development, view the
-[online documentation](https://docs.flutter.dev/), which offers tutorials,
-samples, guidance on mobile development, and a full API reference.

android/app/build.gradle

@@ -23,7 +23,7 @@ if (flutterVersionName == null) {
 }
 
 android {
-    namespace "studio.smartsheep.goatagent"
+    namespace "dev.solsynth.solaragent"
     compileSdkVersion flutter.compileSdkVersion
     ndkVersion flutter.ndkVersion
 
@@ -41,7 +41,7 @@ android {
     }
 
     defaultConfig {
-        applicationId "studio.smartsheep.goatagent"
+        applicationId "dev.solsynth.solaragent"
         // You can update the following values to match your application needs.
         // For more information, see: https://docs.flutter.dev/deployment/android#reviewing-the-gradle-build-configuration.
         minSdkVersion flutter.minSdkVersion
@@ -50,7 +50,7 @@ android {
         versionName flutterVersionName
         manifestPlaceholders = [
                 applicationName      : 'android.app.Application',
-                appAuthRedirectScheme: 'goatagent'
+                appAuthRedirectScheme: 'solaragent'
         ]
     }
 

android/app/google-services.json

@@ -1,39 +0,0 @@
-{
-  "project_info": {
-    "project_number": "659822066072",
-    "project_id": "smartsheep-hydrogen",
-    "storage_bucket": "smartsheep-hydrogen.appspot.com"
-  },
-  "client": [
-    {
-      "client_info": {
-        "mobilesdk_app_id": "1:659822066072:android:39e699282c97a7cfc013ed",
-        "android_client_info": {
-          "package_name": "studio.smartsheep.goatagent"
-        }
-      },
-      "oauth_client": [
-        {
-          "client_id": "659822066072-dde0aqiocn28bc1gk9p5k8oaqe1jpi0l.apps.googleusercontent.com",
-          "client_type": 3
-        }
-      ],
-      "api_key": [
-        {
-          "current_key": "AIzaSyBLPaAK4CVW9umXIdUoGOGHO42jKnwZkKo"
-        }
-      ],
-      "services": {
-        "appinvite_service": {
-          "other_platform_oauth_client": [
-            {
-              "client_id": "659822066072-dde0aqiocn28bc1gk9p5k8oaqe1jpi0l.apps.googleusercontent.com",
-              "client_type": 3
-            }
-          ]
-        }
-      }
-    }
-  ],
-  "configuration_version": "1"
-}

android/app/src/main/AndroidManifest.xml

@@ -1,8 +1,8 @@
 <manifest xmlns:android="http://schemas.android.com/apk/res/android">
     <application
-        android:label="GoatAgent"
+        android:label="Solian"
         android:name="${applicationName}"
-        android:icon="@mipmap/launcher_icon">
+        android:icon="@mipmap/ic_launcher">
         <activity
             android:name=".MainActivity"
             android:exported="true"

android/app/src/main/kotlin/studio/smartsheep/goatagent/MainActivity.kt

@@ -1,4 +1,4 @@
-package studio.smartsheep.goatagent
+package dev.solsynth.solaragent
 
 import io.flutter.embedding.android.FlutterActivity
 

android/google-services.json

@@ -1,39 +0,0 @@
-{
-  "project_info": {
-    "project_number": "659822066072",
-    "project_id": "smartsheep-hydrogen",
-    "storage_bucket": "smartsheep-hydrogen.appspot.com"
-  },
-  "client": [
-    {
-      "client_info": {
-        "mobilesdk_app_id": "1:659822066072:android:39e699282c97a7cfc013ed",
-        "android_client_info": {
-          "package_name": "studio.smartsheep.goatagent"
-        }
-      },
-      "oauth_client": [
-        {
-          "client_id": "659822066072-dde0aqiocn28bc1gk9p5k8oaqe1jpi0l.apps.googleusercontent.com",
-          "client_type": 3
-        }
-      ],
-      "api_key": [
-        {
-          "current_key": "AIzaSyBLPaAK4CVW9umXIdUoGOGHO42jKnwZkKo"
-        }
-      ],
-      "services": {
-        "appinvite_service": {
-          "other_platform_oauth_client": [
-            {
-              "client_id": "659822066072-dde0aqiocn28bc1gk9p5k8oaqe1jpi0l.apps.googleusercontent.com",
-              "client_type": 3
-            }
-          ]
-        }
-      }
-    }
-  ],
-  "configuration_version": "1"
-}

ios/App/App.xcodeproj/project.xcworkspace/contents.xcworkspacedata

@@ -0,0 +1,4 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<Workspace
+   version = "1.0">
+</Workspace>

ios/GoogleService-Info.plist

@@ -1,30 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>API_KEY</key>
-	<string>AIzaSyBQB4u2KKe1P5jMG_zWGiUFtpcjQKhG3jY</string>
-	<key>GCM_SENDER_ID</key>
-	<string>659822066072</string>
-	<key>PLIST_VERSION</key>
-	<string>1</string>
-	<key>BUNDLE_ID</key>
-	<string>studio.smartsheep.goatagent</string>
-	<key>PROJECT_ID</key>
-	<string>smartsheep-hydrogen</string>
-	<key>STORAGE_BUCKET</key>
-	<string>smartsheep-hydrogen.appspot.com</string>
-	<key>IS_ADS_ENABLED</key>
-	<false></false>
-	<key>IS_ANALYTICS_ENABLED</key>
-	<false></false>
-	<key>IS_APPINVITE_ENABLED</key>
-	<true></true>
-	<key>IS_GCM_ENABLED</key>
-	<true></true>
-	<key>IS_SIGNIN_ENABLED</key>
-	<true></true>
-	<key>GOOGLE_APP_ID</key>
-	<string>1:659822066072:ios:90dff099ef47fc8fc013ed</string>
-</dict>
-</plist>

ios/Podfile.lock

@@ -1,187 +1,126 @@
 PODS:
-  - AppAuth (1.6.2):
+  - DKImagePickerController/Core (4.3.4):
-    - AppAuth/Core (= 1.6.2)
+    - DKImagePickerController/ImageDataManager
-    - AppAuth/ExternalUserAgent (= 1.6.2)
+    - DKImagePickerController/Resource
-  - AppAuth/Core (1.6.2)
+  - DKImagePickerController/ImageDataManager (4.3.4)
-  - AppAuth/ExternalUserAgent (1.6.2):
+  - DKImagePickerController/PhotoGallery (4.3.4):
-    - AppAuth/Core
+    - DKImagePickerController/Core
-  - Firebase/CoreOnly (10.20.0):
+    - DKPhotoGallery
-    - FirebaseCore (= 10.20.0)
+  - DKImagePickerController/Resource (4.3.4)
-  - Firebase/Crashlytics (10.20.0):
+  - DKPhotoGallery (0.0.17):
-    - Firebase/CoreOnly
+    - DKPhotoGallery/Core (= 0.0.17)
-    - FirebaseCrashlytics (~> 10.20.0)
+    - DKPhotoGallery/Model (= 0.0.17)
-  - Firebase/Messaging (10.20.0):
+    - DKPhotoGallery/Preview (= 0.0.17)
-    - Firebase/CoreOnly
+    - DKPhotoGallery/Resource (= 0.0.17)
-    - FirebaseMessaging (~> 10.20.0)
+    - SDWebImage
-  - firebase_core (2.25.4):
+    - SwiftyGif
-    - Firebase/CoreOnly (= 10.20.0)
+  - DKPhotoGallery/Core (0.0.17):
+    - DKPhotoGallery/Model
+    - DKPhotoGallery/Preview
+    - SDWebImage
+    - SwiftyGif
+  - DKPhotoGallery/Model (0.0.17):
+    - SDWebImage
+    - SwiftyGif
+  - DKPhotoGallery/Preview (0.0.17):
+    - DKPhotoGallery/Model
+    - DKPhotoGallery/Resource
+    - SDWebImage
+    - SwiftyGif
+  - DKPhotoGallery/Resource (0.0.17):
+    - SDWebImage
+    - SwiftyGif
+  - file_picker (0.0.1):
+    - DKImagePickerController/PhotoGallery
     - Flutter
-  - firebase_crashlytics (3.4.14):
-    - Firebase/Crashlytics (= 10.20.0)
-    - firebase_core
-    - Flutter
-  - firebase_messaging (14.7.15):
-    - Firebase/Messaging (= 10.20.0)
-    - firebase_core
-    - Flutter
-  - FirebaseCore (10.20.0):
-    - FirebaseCoreInternal (~> 10.0)
-    - GoogleUtilities/Environment (~> 7.12)
-    - GoogleUtilities/Logger (~> 7.12)
-  - FirebaseCoreExtension (10.21.0):
-    - FirebaseCore (~> 10.0)
-  - FirebaseCoreInternal (10.21.0):
-    - "GoogleUtilities/NSData+zlib (~> 7.8)"
-  - FirebaseCrashlytics (10.20.0):
-    - FirebaseCore (~> 10.5)
-    - FirebaseInstallations (~> 10.0)
-    - FirebaseSessions (~> 10.5)
-    - GoogleDataTransport (~> 9.2)
-    - GoogleUtilities/Environment (~> 7.8)
-    - nanopb (< 2.30910.0, >= 2.30908.0)
-    - PromisesObjC (~> 2.1)
-  - FirebaseInstallations (10.21.0):
-    - FirebaseCore (~> 10.0)
-    - GoogleUtilities/Environment (~> 7.8)
-    - GoogleUtilities/UserDefaults (~> 7.8)
-    - PromisesObjC (~> 2.1)
-  - FirebaseMessaging (10.20.0):
-    - FirebaseCore (~> 10.0)
-    - FirebaseInstallations (~> 10.0)
-    - GoogleDataTransport (~> 9.3)
-    - GoogleUtilities/AppDelegateSwizzler (~> 7.8)
-    - GoogleUtilities/Environment (~> 7.8)
-    - GoogleUtilities/Reachability (~> 7.8)
-    - GoogleUtilities/UserDefaults (~> 7.8)
-    - nanopb (< 2.30910.0, >= 2.30908.0)
-  - FirebaseSessions (10.21.0):
-    - FirebaseCore (~> 10.5)
-    - FirebaseCoreExtension (~> 10.0)
-    - FirebaseInstallations (~> 10.0)
-    - GoogleDataTransport (~> 9.2)
-    - GoogleUtilities/Environment (~> 7.10)
-    - nanopb (< 2.30910.0, >= 2.30908.0)
-    - PromisesSwift (~> 2.1)
   - Flutter (1.0.0)
-  - flutter_appauth (0.0.1):
-    - AppAuth (= 1.6.2)
-    - Flutter
   - flutter_secure_storage (6.0.0):
     - Flutter
-  - GoogleDataTransport (9.3.0):
+  - image_picker_ios (0.0.1):
-    - GoogleUtilities/Environment (~> 7.7)
+    - Flutter
-    - nanopb (< 2.30910.0, >= 2.30908.0)
-    - PromisesObjC (< 3.0, >= 1.2)
-  - GoogleUtilities/AppDelegateSwizzler (7.12.0):
-    - GoogleUtilities/Environment
-    - GoogleUtilities/Logger
-    - GoogleUtilities/Network
-  - GoogleUtilities/Environment (7.12.0):
-    - PromisesObjC (< 3.0, >= 1.2)
-  - GoogleUtilities/Logger (7.12.0):
-    - GoogleUtilities/Environment
-  - GoogleUtilities/Network (7.12.0):
-    - GoogleUtilities/Logger
-    - "GoogleUtilities/NSData+zlib"
-    - GoogleUtilities/Reachability
-  - "GoogleUtilities/NSData+zlib (7.12.0)"
-  - GoogleUtilities/Reachability (7.12.0):
-    - GoogleUtilities/Logger
-  - GoogleUtilities/UserDefaults (7.12.0):
-    - GoogleUtilities/Logger
-  - nanopb (2.30909.1):
-    - nanopb/decode (= 2.30909.1)
-    - nanopb/encode (= 2.30909.1)
-  - nanopb/decode (2.30909.1)
-  - nanopb/encode (2.30909.1)
   - package_info_plus (0.4.5):
     - Flutter
   - path_provider_foundation (0.0.1):
     - Flutter
     - FlutterMacOS
-  - PromisesObjC (2.3.1)
+  - SDWebImage (5.19.0):
-  - PromisesSwift (2.3.1):
+    - SDWebImage/Core (= 5.19.0)
-    - PromisesObjC (= 2.3.1)
+  - SDWebImage/Core (5.19.0)
+  - Sentry/HybridSDK (8.21.0):
+    - SentryPrivate (= 8.21.0)
+  - sentry_flutter (0.0.1):
+    - Flutter
+    - FlutterMacOS
+    - Sentry/HybridSDK (= 8.21.0)
+  - SentryPrivate (8.21.0)
+  - shared_preferences_foundation (0.0.1):
+    - Flutter
+    - FlutterMacOS
+  - SwiftyGif (5.4.4)
   - url_launcher_ios (0.0.1):
     - Flutter
   - webview_flutter_wkwebview (0.0.1):
     - Flutter
 
 DEPENDENCIES:
-  - firebase_core (from `.symlinks/plugins/firebase_core/ios`)
+  - file_picker (from `.symlinks/plugins/file_picker/ios`)
-  - firebase_crashlytics (from `.symlinks/plugins/firebase_crashlytics/ios`)
-  - firebase_messaging (from `.symlinks/plugins/firebase_messaging/ios`)
   - Flutter (from `Flutter`)
-  - flutter_appauth (from `.symlinks/plugins/flutter_appauth/ios`)
   - flutter_secure_storage (from `.symlinks/plugins/flutter_secure_storage/ios`)
+  - image_picker_ios (from `.symlinks/plugins/image_picker_ios/ios`)
   - package_info_plus (from `.symlinks/plugins/package_info_plus/ios`)
   - path_provider_foundation (from `.symlinks/plugins/path_provider_foundation/darwin`)
+  - sentry_flutter (from `.symlinks/plugins/sentry_flutter/ios`)
+  - shared_preferences_foundation (from `.symlinks/plugins/shared_preferences_foundation/darwin`)
   - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
   - webview_flutter_wkwebview (from `.symlinks/plugins/webview_flutter_wkwebview/ios`)
 
 SPEC REPOS:
   trunk:
-    - AppAuth
+    - DKImagePickerController
-    - Firebase
+    - DKPhotoGallery
-    - FirebaseCore
+    - SDWebImage
-    - FirebaseCoreExtension
+    - Sentry
-    - FirebaseCoreInternal
+    - SentryPrivate
-    - FirebaseCrashlytics
+    - SwiftyGif
-    - FirebaseInstallations
-    - FirebaseMessaging
-    - FirebaseSessions
-    - GoogleDataTransport
-    - GoogleUtilities
-    - nanopb
-    - PromisesObjC
-    - PromisesSwift
 
 EXTERNAL SOURCES:
-  firebase_core:
+  file_picker:
-    :path: ".symlinks/plugins/firebase_core/ios"
+    :path: ".symlinks/plugins/file_picker/ios"
-  firebase_crashlytics:
-    :path: ".symlinks/plugins/firebase_crashlytics/ios"
-  firebase_messaging:
-    :path: ".symlinks/plugins/firebase_messaging/ios"
   Flutter:
     :path: Flutter
-  flutter_appauth:
-    :path: ".symlinks/plugins/flutter_appauth/ios"
   flutter_secure_storage:
     :path: ".symlinks/plugins/flutter_secure_storage/ios"
+  image_picker_ios:
+    :path: ".symlinks/plugins/image_picker_ios/ios"
   package_info_plus:
     :path: ".symlinks/plugins/package_info_plus/ios"
   path_provider_foundation:
     :path: ".symlinks/plugins/path_provider_foundation/darwin"
+  sentry_flutter:
+    :path: ".symlinks/plugins/sentry_flutter/ios"
+  shared_preferences_foundation:
+    :path: ".symlinks/plugins/shared_preferences_foundation/darwin"
   url_launcher_ios:
     :path: ".symlinks/plugins/url_launcher_ios/ios"
   webview_flutter_wkwebview:
     :path: ".symlinks/plugins/webview_flutter_wkwebview/ios"
 
 SPEC CHECKSUMS:
-  AppAuth: 3bb1d1cd9340bd09f5ed189fb00b1cc28e1e8570
+  DKImagePickerController: b512c28220a2b8ac7419f21c491fc8534b7601ac
-  Firebase: 10c8cb12fb7ad2ae0c09ffc86cd9c1ab392a0031
+  DKPhotoGallery: fdfad5125a9fdda9cc57df834d49df790dbb4179
-  firebase_core: a46c312d8bae4defa3d009b2aa7b5b413aeb394e
+  file_picker: 09aa5ec1ab24135ccd7a1621c46c84134bfd6655
-  firebase_crashlytics: 3d12285fcbd865d576b9965bd4090cd8b68e11fd
-  firebase_messaging: 40d7dd2f3e88a6367c7326cf601f84633d477582
-  FirebaseCore: 28045c1560a2600d284b9c45a904fe322dc890b6
-  FirebaseCoreExtension: 1c044fd46e95036cccb29134757c499613f3f564
-  FirebaseCoreInternal: 43c1788eaeee9d1b97caaa751af567ce11010d00
-  FirebaseCrashlytics: 81530595edb6d99f1918f723a6c33766a24a4c86
-  FirebaseInstallations: 390ea1d10a4d02b20c965cbfd527ee9b3b412acb
-  FirebaseMessaging: 06c414a21b122396a26847c523d5c370f8325df5
-  FirebaseSessions: 80c2bbdd28166267b3d132debe5f7531efdb00bc
   Flutter: e0871f40cf51350855a761d2e70bf5af5b9b5de7
-  flutter_appauth: 0863b1f33110b410213e736aead4a6727303f509
   flutter_secure_storage: 23fc622d89d073675f2eaa109381aefbcf5a49be
-  GoogleDataTransport: 57c22343ab29bc686febbf7cbb13bad167c2d8fe
+  image_picker_ios: b545a5f16c0fa88e3ecbbce3ed4de45567a8ec18
-  GoogleUtilities: 0759d1a57ebb953965c2dfe0ba4c82e95ccc2e34
-  nanopb: d4d75c12cd1316f4a64e3c6963f879ecd4b5e0d5
   package_info_plus: 115f4ad11e0698c8c1c5d8a689390df880f47e85
   path_provider_foundation: 3784922295ac71e43754bd15e0653ccfd36a147c
-  PromisesObjC: c50d2056b5253dadbd6c2bea79b0674bd5a52fa4
+  SDWebImage: 981fd7e860af070920f249fd092420006014c3eb
-  PromisesSwift: 28dca69a9c40779916ac2d6985a0192a5cb4a265
+  Sentry: ebc12276bd17613a114ab359074096b6b3725203
-  url_launcher_ios: bbd758c6e7f9fd7b5b1d4cde34d2b95fcce5e812
+  sentry_flutter: dff1df05dc39c83d04f9330b36360fc374574c5e
+  SentryPrivate: d651efb234cf385ec9a1cdd3eff94b5e78a0e0fe
+  shared_preferences_foundation: b4c3b4cddf1c21f02770737f147a3f5da9d39695
+  SwiftyGif: 93a1cc87bf3a51916001cf8f3d63835fb64c819f
+  url_launcher_ios: 6116280ddcfe98ab8820085d8d76ae7449447586
   webview_flutter_wkwebview: be0f0d33777f1bfd0c9fdcb594786704dbf65f36
 
 PODFILE CHECKSUM: 819463e6a0290f5a72f145ba7cde16e8b6ef0796

ios/Runner.xcodeproj/project.pbxproj

@@ -16,7 +16,6 @@
 		97C146FC1CF9000F007C117D /* Main.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FA1CF9000F007C117D /* Main.storyboard */; };
 		97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FD1CF9000F007C117D /* Assets.xcassets */; };
 		97C147011CF9000F007C117D /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */; };
-		E82D4FD7CF8610AE06A29945 /* GoogleService-Info.plist in Resources */ = {isa = PBXBuildFile; fileRef = B3FD85540C530EB623F244F0 /* GoogleService-Info.plist */; };
 /* End PBXBuildFile section */
 
 /* Begin PBXContainerItemProxy section */
@@ -65,7 +64,6 @@
 		97C147021CF9000F007C117D /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; path = Info.plist; sourceTree = "<group>"; };
 		AFF7DBFDB082C74F82791AB2 /* Pods-RunnerTests.release.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.release.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.release.xcconfig"; sourceTree = "<group>"; };
 		B2ED47C18F55E48A0603226E /* Pods-RunnerTests.profile.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.profile.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.profile.xcconfig"; sourceTree = "<group>"; };
-		B3FD85540C530EB623F244F0 /* GoogleService-Info.plist */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.plist.xml; name = "GoogleService-Info.plist"; path = "Runner/GoogleService-Info.plist"; sourceTree = "<group>"; };
 		B86346ED17835849683BBD52 /* Pods_Runner.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; includeInIndex = 0; path = Pods_Runner.framework; sourceTree = BUILT_PRODUCTS_DIR; };
 		D0F7456C6B52E05DA9E946D2 /* Pods-Runner.debug.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.debug.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.debug.xcconfig"; sourceTree = "<group>"; };
 /* End PBXFileReference section */
@@ -127,7 +125,6 @@
 				331C8082294A63A400263BE5 /* RunnerTests */,
 				B986742A69F7079E8EB387D9 /* Pods */,
 				3D7BB3AACE7D51DB2A1773FD /* Frameworks */,
-				B3FD85540C530EB623F244F0 /* GoogleService-Info.plist */,
 			);
 			sourceTree = "<group>";
 		};
@@ -203,7 +200,6 @@
 				9705A1C41CF9048500538489 /* Embed Frameworks */,
 				3B06AD1E1E4923F5004D2608 /* Thin Binary */,
 				6735FEBC571714546BA26AEA /* [CP] Embed Pods Frameworks */,
-				B4B724ADD0BB41C68032B791 /* [firebase_crashlytics] Crashlytics Upload Symbols */,
 			);
 			buildRules = (
 			);
@@ -221,7 +217,7 @@
 			isa = PBXProject;
 			attributes = {
 				BuildIndependentTargetsInParallel = YES;
-				LastUpgradeCheck = 1430;
+				LastUpgradeCheck = 1510;
 				ORGANIZATIONNAME = "";
 				TargetAttributes = {
 					331C8080294A63A400263BE5 = {
@@ -269,7 +265,6 @@
 				3B3967161E833CAA004F5970 /* AppFrameworkInfo.plist in Resources */,
 				97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */,
 				97C146FC1CF9000F007C117D /* Main.storyboard in Resources */,
-				E82D4FD7CF8610AE06A29945 /* GoogleService-Info.plist in Resources */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -368,29 +363,6 @@
 			shellScript = "diff \"${PODS_PODFILE_DIR_PATH}/Podfile.lock\" \"${PODS_ROOT}/Manifest.lock\" > /dev/null\nif [ $? != 0 ] ; then\n    # print error to STDERR\n    echo \"error: The sandbox is not in sync with the Podfile.lock. Run 'pod install' or update your CocoaPods installation.\" >&2\n    exit 1\nfi\n# This output is used by Xcode 'outputs' to avoid re-running this script phase.\necho \"SUCCESS\" > \"${SCRIPT_OUTPUT_FILE_0}\"\n";
 			showEnvVarsInLog = 0;
 		};
-		B4B724ADD0BB41C68032B791 /* [firebase_crashlytics] Crashlytics Upload Symbols */ = {
-			isa = PBXShellScriptBuildPhase;
-			buildActionMask = 2147483647;
-			files = (
-			);
-			inputFileListPaths = (
-			);
-			inputPaths = (
-				"\"${DWARF_DSYM_FOLDER_PATH}/${DWARF_DSYM_FILE_NAME}\"",
-				"\"${DWARF_DSYM_FOLDER_PATH}/${DWARF_DSYM_FILE_NAME}/Contents/\"",
-				"\"${DWARF_DSYM_FOLDER_PATH}/${DWARF_DSYM_FILE_NAME}/Contents/Info.plist\"",
-				"\"$(TARGET_BUILD_DIR)/$(EXECUTABLE_PATH)\"",
-				"\"$(PROJECT_DIR)/firebase_app_id_file.json\"",
-			);
-			name = "[firebase_crashlytics] Crashlytics Upload Symbols";
-			outputFileListPaths = (
-			);
-			outputPaths = (
-			);
-			runOnlyForDeploymentPostprocessing = 0;
-			shellPath = /bin/sh;
-			shellScript = "\"$PODS_ROOT/FirebaseCrashlytics/upload-symbols\" --flutter-project \"$PROJECT_DIR/firebase_app_id_file.json\" ";
-		};
 /* End PBXShellScriptBuildPhase section */
 
 /* Begin PBXSourcesBuildPhase section */
@@ -505,14 +477,14 @@
 				DEVELOPMENT_TEAM = W7HPZ53V6B;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
-				INFOPLIST_KEY_CFBundleDisplayName = GoatAgent;
+				INFOPLIST_KEY_CFBundleDisplayName = Solian;
-				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.utilities";
+				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.social-networking";
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 1.0.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
@@ -529,7 +501,7 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG;
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
@@ -547,7 +519,7 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_VERSION = 5.0;
 				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner";
@@ -563,7 +535,7 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_VERSION = 5.0;
 				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner";
@@ -574,7 +546,7 @@
 			isa = XCBuildConfiguration;
 			buildSettings = {
 				ALWAYS_SEARCH_USER_PATHS = NO;
-				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = AppIcon;
 				CLANG_ANALYZER_NONNULL = YES;
 				CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x";
 				CLANG_CXX_LIBRARY = "libc++";
@@ -632,7 +604,7 @@
 			isa = XCBuildConfiguration;
 			buildSettings = {
 				ALWAYS_SEARCH_USER_PATHS = NO;
-				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES;
+				ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = AppIcon;
 				CLANG_ANALYZER_NONNULL = YES;
 				CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x";
 				CLANG_CXX_LIBRARY = "libc++";
@@ -694,14 +666,14 @@
 				DEVELOPMENT_TEAM = W7HPZ53V6B;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
-				INFOPLIST_KEY_CFBundleDisplayName = GoatAgent;
+				INFOPLIST_KEY_CFBundleDisplayName = Solian;
-				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.utilities";
+				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.social-networking";
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 1.0.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
@@ -721,14 +693,14 @@
 				DEVELOPMENT_TEAM = W7HPZ53V6B;
 				ENABLE_BITCODE = NO;
 				INFOPLIST_FILE = Runner/Info.plist;
-				INFOPLIST_KEY_CFBundleDisplayName = GoatAgent;
+				INFOPLIST_KEY_CFBundleDisplayName = Solian;
-				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.utilities";
+				INFOPLIST_KEY_LSApplicationCategoryType = "public.app-category.social-networking";
 				LD_RUNPATH_SEARCH_PATHS = (
 					"$(inherited)",
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 1.0.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;

ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme

@@ -1,6 +1,6 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <Scheme
-   LastUpgradeVersion = "1430"
+   LastUpgradeVersion = "1510"
    version = "1.3">
    <BuildAction
       parallelizeBuildables = "YES"

ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json

@@ -1,122 +1,122 @@
 {
   "images" : [
     {
-      "size" : "20x20",
-      "idiom" : "iphone",
       "filename" : "Icon-App-20x20@2x.png",
-      "scale" : "2x"
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "20x20"
     },
     {
-      "size" : "20x20",
-      "idiom" : "iphone",
       "filename" : "Icon-App-20x20@3x.png",
-      "scale" : "3x"
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "20x20"
     },
     {
-      "size" : "29x29",
-      "idiom" : "iphone",
       "filename" : "Icon-App-29x29@1x.png",
-      "scale" : "1x"
+      "idiom" : "iphone",
+      "scale" : "1x",
+      "size" : "29x29"
     },
     {
-      "size" : "29x29",
-      "idiom" : "iphone",
       "filename" : "Icon-App-29x29@2x.png",
-      "scale" : "2x"
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "29x29"
     },
     {
-      "size" : "29x29",
-      "idiom" : "iphone",
       "filename" : "Icon-App-29x29@3x.png",
-      "scale" : "3x"
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "29x29"
     },
     {
-      "size" : "40x40",
-      "idiom" : "iphone",
       "filename" : "Icon-App-40x40@2x.png",
-      "scale" : "2x"
+      "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "40x40"
     },
     {
-      "size" : "40x40",
-      "idiom" : "iphone",
       "filename" : "Icon-App-40x40@3x.png",
-      "scale" : "3x"
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "40x40"
     },
     {
-      "size" : "60x60",
-      "idiom" : "iphone",
       "filename" : "Icon-App-60x60@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "60x60",
       "idiom" : "iphone",
+      "scale" : "2x",
+      "size" : "60x60"
+    },
+    {
       "filename" : "Icon-App-60x60@3x.png",
-      "scale" : "3x"
+      "idiom" : "iphone",
+      "scale" : "3x",
+      "size" : "60x60"
     },
     {
-      "size" : "20x20",
-      "idiom" : "ipad",
       "filename" : "Icon-App-20x20@1x.png",
-      "scale" : "1x"
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "20x20"
     },
     {
-      "size" : "20x20",
-      "idiom" : "ipad",
       "filename" : "Icon-App-20x20@2x.png",
-      "scale" : "2x"
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "20x20"
     },
     {
-      "size" : "29x29",
-      "idiom" : "ipad",
       "filename" : "Icon-App-29x29@1x.png",
-      "scale" : "1x"
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "29x29"
     },
     {
-      "size" : "29x29",
-      "idiom" : "ipad",
       "filename" : "Icon-App-29x29@2x.png",
-      "scale" : "2x"
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "29x29"
     },
     {
-      "size" : "40x40",
-      "idiom" : "ipad",
       "filename" : "Icon-App-40x40@1x.png",
-      "scale" : "1x"
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "40x40"
     },
     {
-      "size" : "40x40",
-      "idiom" : "ipad",
       "filename" : "Icon-App-40x40@2x.png",
-      "scale" : "2x"
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "40x40"
     },
     {
-      "size" : "76x76",
-      "idiom" : "ipad",
       "filename" : "Icon-App-76x76@1x.png",
-      "scale" : "1x"
+      "idiom" : "ipad",
+      "scale" : "1x",
+      "size" : "76x76"
     },
     {
-      "size" : "76x76",
-      "idiom" : "ipad",
       "filename" : "Icon-App-76x76@2x.png",
-      "scale" : "2x"
-    },
-    {
-      "size" : "83.5x83.5",
       "idiom" : "ipad",
-      "filename" : "Icon-App-83.5x83.5@2x.png",
+      "scale" : "2x",
-      "scale" : "2x"
+      "size" : "76x76"
+    },
+    {
+      "filename" : "Icon-App-83.5x83.5@2x.png",
+      "idiom" : "ipad",
+      "scale" : "2x",
+      "size" : "83.5x83.5"
     },
     {
-      "size" : "1024x1024",
-      "idiom" : "ios-marketing",
       "filename" : "Icon-App-1024x1024@1x.png",
-      "scale" : "1x"
+      "idiom" : "ios-marketing",
+      "scale" : "1x",
+      "size" : "1024x1024"
     }
   ],
   "info" : {
-    "version" : 1,
+    "author" : "xcode",
-    "author" : "xcode"
+    "version" : 1
   }
 }

ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json

@@ -1,23 +1,23 @@
 {
   "images" : [
     {
+      "filename" : "iPhone_15_Pro_Max__iPhone_15_Plus__iPhone_14_Pro_Max_portrait 2.png",
       "idiom" : "universal",
-      "filename" : "LaunchImage.png",
       "scale" : "1x"
     },
     {
+      "filename" : "iPhone_15_Pro_Max__iPhone_15_Plus__iPhone_14_Pro_Max_portrait 1.png",
       "idiom" : "universal",
-      "filename" : "LaunchImage@2x.png",
       "scale" : "2x"
     },
     {
+      "filename" : "iPhone_15_Pro_Max__iPhone_15_Plus__iPhone_14_Pro_Max_portrait.png",
       "idiom" : "universal",
-      "filename" : "LaunchImage@3x.png",
       "scale" : "3x"
     }
   ],
   "info" : {
-    "version" : 1,
+    "author" : "xcode",
-    "author" : "xcode"
+    "version" : 1
   }
 }

ios/Runner/GoogleService-Info.plist

@@ -1,30 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
-<plist version="1.0">
-<dict>
-	<key>API_KEY</key>
-	<string>AIzaSyBQB4u2KKe1P5jMG_zWGiUFtpcjQKhG3jY</string>
-	<key>GCM_SENDER_ID</key>
-	<string>659822066072</string>
-	<key>PLIST_VERSION</key>
-	<string>1</string>
-	<key>BUNDLE_ID</key>
-	<string>studio.smartsheep.goatagent</string>
-	<key>PROJECT_ID</key>
-	<string>smartsheep-hydrogen</string>
-	<key>STORAGE_BUCKET</key>
-	<string>smartsheep-hydrogen.appspot.com</string>
-	<key>IS_ADS_ENABLED</key>
-	<false></false>
-	<key>IS_ANALYTICS_ENABLED</key>
-	<false></false>
-	<key>IS_APPINVITE_ENABLED</key>
-	<true></true>
-	<key>IS_GCM_ENABLED</key>
-	<true></true>
-	<key>IS_SIGNIN_ENABLED</key>
-	<true></true>
-	<key>GOOGLE_APP_ID</key>
-	<string>1:659822066072:ios:90dff099ef47fc8fc013ed</string>
-</dict>
-</plist>

ios/Runner/Info.plist

@@ -7,7 +7,7 @@
 	<key>CFBundleDevelopmentRegion</key>
 	<string>$(DEVELOPMENT_LANGUAGE)</string>
 	<key>CFBundleDisplayName</key>
-	<string>GoatAgent</string>
+	<string>Solian</string>
 	<key>CFBundleExecutable</key>
 	<string>$(EXECUTABLE_NAME)</string>
 	<key>CFBundleIdentifier</key>
@@ -15,7 +15,7 @@
 	<key>CFBundleInfoDictionaryVersion</key>
 	<string>6.0</string>
 	<key>CFBundleName</key>
-	<string>GoatAgent</string>
+	<string>Solian</string>
 	<key>CFBundlePackageType</key>
 	<string>APPL</string>
 	<key>CFBundleShortVersionString</key>
@@ -29,10 +29,10 @@
 	<key>UIApplicationSupportsIndirectInputEvents</key>
 	<true/>
 	<key>LSApplicationQueriesSchemes</key>
-    <array>
+	<array>
-      <string>sms</string>
+		<string>sms</string>
-      <string>tel</string>
+		<string>tel</string>
-    </array>
+	</array>
 	<key>UIBackgroundModes</key>
 	<array>
 		<string>fetch</string>
@@ -55,5 +55,11 @@
 		<string>UIInterfaceOrientationLandscapeLeft</string>
 		<string>UIInterfaceOrientationLandscapeRight</string>
 	</array>
+	<key>NSCameraUsageDescription</key>
+	<string>Allow Solar access to your camera to take photo, so that you can attach image in your post.</string>
+	<key>NSMicrophoneUsageDescription</key>
+	<string>Allow Solar access to your microphone to record audio, so that you can attach image in your post.</string>
+	<key>NSPhotoLibraryUsageDescription</key>
+	<string>Allow Solar access to your photo library, so that you can attach image in your post.</string>
 </dict>
 </plist>

ios/Runner/Runner.entitlements

@@ -1,5 +1,8 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
-<dict/>
+<dict>
+	<key>aps-environment</key>
+	<string>development</string>
+</dict>
 </plist>

ios/firebase_app_id_file.json

@@ -1,7 +0,0 @@
-{
-  "file_generated_by": "FlutterFire CLI",
-  "purpose": "FirebaseAppID & ProjectID for this Firebase app in this directory",
-  "GOOGLE_APP_ID": "1:659822066072:ios:90dff099ef47fc8fc013ed",
-  "FIREBASE_PROJECT_ID": "smartsheep-hydrogen",
-  "GCM_SENDER_ID": "659822066072"
-}

lib/auth.dart

@@ -3,35 +3,31 @@ import 'dart:io';
 
 import 'package:flutter/material.dart';
 import 'package:flutter_secure_storage/flutter_secure_storage.dart';
-import 'package:goatagent/firebase.dart';
+import 'package:solaragent/screens/auth.dart';
-import 'package:goatagent/screens/auth.dart';
 import 'package:oauth2/oauth2.dart' as oauth2;
 
+final authClient = AuthGuard();
+
 class AuthGuard {
-  static final AuthGuard _singleton = AuthGuard._internal();
+  AuthGuard();
 
   final deviceEndpoint =
-      Uri.parse('https://id.smartsheep.studio/api/notifications/subscribe');
+      Uri.parse('https://id.solsynth.dev/api/notifications/subscribe');
   final authorizationEndpoint =
-      Uri.parse('https://id.smartsheep.studio/auth/o/connect');
+      Uri.parse('https://id.solsynth.dev/auth/o/connect');
-  final tokenEndpoint =
+  final tokenEndpoint = Uri.parse('https://id.solsynth.dev/api/auth/token');
-      Uri.parse('https://id.smartsheep.studio/api/auth/token');
+  final userinfoEndpoint = Uri.parse('https://id.solsynth.dev/api/users/me');
-  final userinfoEndpoint =
+  final redirectUrl = Uri.parse('solaragent://auth');
-      Uri.parse('https://id.smartsheep.studio/api/users/me');
-  final redirectUrl = Uri.parse('goatagent://auth');
 
-  static const clientId = "goatagent";
+  static const clientId = "solaragent";
   static const clientSecret = "_F4%q2Eea3";
 
   static const storage = FlutterSecureStorage();
   static const storageKey = "identity";
   static const profileKey = "profiles";
 
-  factory AuthGuard() {
-    return _singleton;
-  }
-
   oauth2.Client? client;
+  DateTime? lastRefreshedAt;
 
   Future<bool> pickClient() async {
     if (await storage.containsKey(key: storageKey)) {
@@ -43,7 +39,7 @@ class AuthGuard {
         await pullProfiles();
         return true;
       } catch (e) {
-        logout();
+        signoff();
         return false;
       }
     } else {
@@ -68,11 +64,6 @@ class AuthGuard {
     var authorizationUrl = grant.getAuthorizationUrl(redirectUrl);
 
     if (Platform.isAndroid || Platform.isIOS) {
-      // Let Goatpass know it is embed in an app
-      authorizationUrl = authorizationUrl.replace(
-          queryParameters: {"embedded": "yes"}
-            ..addAll(authorizationUrl.queryParameters));
-
       // Use WebView to get authorization url
       var responseUrl = await Navigator.of(context, rootNavigator: true).push(
         MaterialPageRoute(
@@ -95,57 +86,47 @@ class AuthGuard {
     }
   }
 
-  Future<void> login(BuildContext context) async {
+  Future<void> refreshToken() async {
-    try {
+    if (client != null) {
-      client = await createClient(context);
+      var credentials = await client?.credentials.refresh(
-      storage.write(key: storageKey, value: client!.credentials.toJson());
+          identifier: clientId, secret: clientSecret, basicAuth: false);
 
-      await pullProfiles();
+      storage.write(key: storageKey, value: credentials!.toJson());
-      await subscribeNotify();
-    } catch (e) {
-      print(e);
     }
   }
 
-  Future<void> subscribeNotify() async {
+  Future<void> signin(BuildContext context) async {
-    if (client == null) {
+    client = await createClient(context);
-      return;
+    storage.write(key: storageKey, value: client!.credentials.toJson());
-    }
 
-    var token = await initializeFirebaseMessaging();
+    await pullProfiles();
-    if (token == null) {
-      print("failed to initialize firebase messaging...");
-      return;
-    }
-
-    var response = await client!.post(
-      deviceEndpoint,
-      headers: {"Content-Type": "application/json"},
-      body: jsonEncode({"device_id": token, "provider": "firebase"}),
-    );
-    if (response.statusCode != 200) {
-      print(response.body);
-    }
   }
 
-  void logout() {
+  void signoff() {
-    try {
+    storage.delete(key: profileKey);
-      storage.delete(key: profileKey);
+    storage.delete(key: storageKey);
-      storage.delete(key: storageKey);
-    } catch (e) {
-      print(e);
-    }
   }
 
   Future<bool> isAuthorized() async {
     const storage = FlutterSecureStorage();
-    return await storage.containsKey(key: storageKey);
+    if (await storage.containsKey(key: storageKey)) {
+      if (client != null) {
+        if (lastRefreshedAt == null ||
+            lastRefreshedAt!
+                .add(const Duration(minutes: 3))
+                .isAfter(DateTime.now())) {
+          await refreshToken();
+          lastRefreshedAt = DateTime.now();
+        }
+      }
+      return true;
+    } else {
+      return false;
+    }
   }
 
-  Future<dynamic> readProfiles() async {
+  Future<dynamic> getProfiles() async {
     const storage = FlutterSecureStorage();
     return jsonDecode(await storage.read(key: profileKey) ?? "{}");
   }
-
-  AuthGuard._internal();
 }

lib/firebase.dart

@@ -1,43 +0,0 @@
-import 'dart:ui';
-
-import 'package:firebase_crashlytics/firebase_crashlytics.dart';
-import 'package:firebase_messaging/firebase_messaging.dart';
-import 'package:firebase_core/firebase_core.dart';
-import 'package:flutter/material.dart';
-import 'firebase_options.dart';
-
-Future<bool> initializeFirebase() async {
-  await Firebase.initializeApp(
-    options: DefaultFirebaseOptions.currentPlatform,
-  );
-
-  await FirebaseMessaging.instance.requestPermission(
-    alert: true,
-    announcement: false,
-    badge: true,
-    carPlay: false,
-    criticalAlert: false,
-    provisional: false,
-    sound: true,
-  );
-
-  FlutterError.onError = (errorDetails) {
-    FirebaseCrashlytics.instance.recordFlutterFatalError(errorDetails);
-  };
-  PlatformDispatcher.instance.onError = (error, stack) {
-    FirebaseCrashlytics.instance.recordError(error, stack, fatal: true);
-    return true;
-  };
-
-  return true;
-}
-
-Future<String?> initializeFirebaseMessaging() async {
-  try {
-    final fcmToken = await FirebaseMessaging.instance.getToken();
-    return fcmToken;
-  } catch (e) {
-    print("failed to setup firebase messaging: $e");
-    return null;
-  }
-}

lib/firebase_options.dart

@@ -1,81 +0,0 @@
-// File generated by FlutterFire CLI.
-// ignore_for_file: lines_longer_than_80_chars, avoid_classes_with_only_static_members
-import 'package:firebase_core/firebase_core.dart' show FirebaseOptions;
-import 'package:flutter/foundation.dart'
-    show defaultTargetPlatform, kIsWeb, TargetPlatform;
-
-/// Default [FirebaseOptions] for use with your Firebase apps.
-///
-/// Example:
-/// ```dart
-/// import 'firebase_options.dart';
-/// // ...
-/// await Firebase.initializeApp(
-///   options: DefaultFirebaseOptions.currentPlatform,
-/// );
-/// ```
-class DefaultFirebaseOptions {
-  static FirebaseOptions get currentPlatform {
-    if (kIsWeb) {
-      return web;
-    }
-    switch (defaultTargetPlatform) {
-      case TargetPlatform.android:
-        return android;
-      case TargetPlatform.iOS:
-        return ios;
-      case TargetPlatform.macOS:
-        return macos;
-      case TargetPlatform.windows:
-        throw UnsupportedError(
-          'DefaultFirebaseOptions have not been configured for windows - '
-          'you can reconfigure this by running the FlutterFire CLI again.',
-        );
-      case TargetPlatform.linux:
-        throw UnsupportedError(
-          'DefaultFirebaseOptions have not been configured for linux - '
-          'you can reconfigure this by running the FlutterFire CLI again.',
-        );
-      default:
-        throw UnsupportedError(
-          'DefaultFirebaseOptions are not supported for this platform.',
-        );
-    }
-  }
-
-  static const FirebaseOptions web = FirebaseOptions(
-    apiKey: 'AIzaSyCjTtCsk3Jo98gDiU2Zh8hX2Y-r2CCsT6g',
-    appId: '1:659822066072:web:2fbe2e4dc1186e00c013ed',
-    messagingSenderId: '659822066072',
-    projectId: 'smartsheep-hydrogen',
-    authDomain: 'smartsheep-hydrogen.firebaseapp.com',
-    storageBucket: 'smartsheep-hydrogen.appspot.com',
-    measurementId: 'G-8HVJ5TVQG8',
-  );
-
-  static const FirebaseOptions android = FirebaseOptions(
-    apiKey: 'AIzaSyBLPaAK4CVW9umXIdUoGOGHO42jKnwZkKo',
-    appId: '1:659822066072:android:39e699282c97a7cfc013ed',
-    messagingSenderId: '659822066072',
-    projectId: 'smartsheep-hydrogen',
-    storageBucket: 'smartsheep-hydrogen.appspot.com',
-  );
-
-  static const FirebaseOptions ios = FirebaseOptions(
-    apiKey: 'AIzaSyBQB4u2KKe1P5jMG_zWGiUFtpcjQKhG3jY',
-    appId: '1:659822066072:ios:90dff099ef47fc8fc013ed',
-    messagingSenderId: '659822066072',
-    projectId: 'smartsheep-hydrogen',
-    storageBucket: 'smartsheep-hydrogen.appspot.com',
-    iosBundleId: 'studio.smartsheep.goatagent',
-  );
-
-  static const FirebaseOptions macos = FirebaseOptions(
-    apiKey: 'AIzaSyBQB4u2KKe1P5jMG_zWGiUFtpcjQKhG3jY',
-    appId: '1:659822066072:ios:17efa96a78467043c013ed',
-    messagingSenderId: '659822066072',
-    projectId: 'smartsheep-hydrogen',
-    storageBucket: 'smartsheep-hydrogen.appspot.com',
-    iosBundleId: 'studio.smartsheep.goatagent.RunnerTests',
-  );
-}

lib/layouts/navigation.dart

@@ -1,114 +0,0 @@
-import 'package:firebase_messaging/firebase_messaging.dart';
-import 'package:flutter/material.dart';
-import 'package:goatagent/screens/account.dart';
-import 'package:goatagent/screens/dashboard.dart';
-import 'package:goatagent/screens/notifications.dart';
-
-class AgentNavigation extends StatefulWidget {
-  AgentNavigation({super.key});
-
-  static const items = [
-    {'label': 'Dashboard', 'icon': Icon(Icons.home)},
-    {'label': 'Notifications', 'icon': Icon(Icons.notifications)},
-    {'label': 'Account', 'icon': Icon(Icons.account_circle)},
-  ];
-
-  final bottomDestinations = items
-      .map((element) => BottomNavigationBarItem(
-            icon: element["icon"] as Widget,
-            label: element["label"] as String,
-          ))
-      .toList();
-  final railDestinations = items
-      .map((element) => NavigationRailDestination(
-            icon: element["icon"] as Widget,
-            label: Text(element["label"] as String),
-          ))
-      .toList();
-
-  @override
-  State<AgentNavigation> createState() => _AgentNavigationState();
-}
-
-class _AgentNavigationState extends State<AgentNavigation> {
-  int _view = 0;
-
-  Future<void> initMessage(BuildContext context) async {
-    void navigate() {
-      setState(() {
-        _view = 1;
-      });
-    }
-
-    RemoteMessage? initialMessage =
-        await FirebaseMessaging.instance.getInitialMessage();
-
-    if (initialMessage != null) {
-      navigate();
-    }
-
-    FirebaseMessaging.onMessageOpenedApp.listen((event) {
-      navigate();
-    });
-  }
-
-  @override
-  void initState() {
-    super.initState();
-    initMessage(context);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    final isLargeScreen = MediaQuery.of(context).size.width > 640;
-
-    final content = Stack(
-      children: [
-        Offstage(
-          offstage: _view != 0,
-          child: const DashboardScreen(),
-        ),
-        Offstage(
-          offstage: _view != 1,
-          child: const NotificationScreen(),
-        ),
-        Offstage(
-          offstage: _view != 2,
-          child: const AccountScreen(),
-        )
-      ],
-    );
-
-    if (isLargeScreen) {
-      return Row(children: <Widget>[
-        NavigationRail(
-          selectedIndex: _view,
-          groupAlignment: 0,
-          onDestinationSelected: (int index) {
-            setState(() {
-              _view = index;
-            });
-          },
-          labelType: NavigationRailLabelType.all,
-          destinations: widget.railDestinations,
-        ),
-        const VerticalDivider(thickness: 1, width: 1),
-        Expanded(child: content),
-      ]);
-    } else {
-      return Scaffold(
-        body: content,
-        bottomNavigationBar: BottomNavigationBar(
-          currentIndex: _view,
-          showUnselectedLabels: false,
-          items: widget.bottomDestinations,
-          onTap: (index) {
-            setState(() {
-              _view = index;
-            });
-          },
-        ),
-      );
-    }
-  }
-}

lib/main.dart

@@ -1,51 +1,59 @@
 import 'package:flutter/material.dart';
-import 'package:goatagent/auth.dart';
+import 'package:solaragent/auth.dart';
-import 'package:goatagent/firebase.dart';
+import 'package:solaragent/router.dart';
+import 'package:solaragent/widgets/navigation.dart';
+import 'package:sentry_flutter/sentry_flutter.dart';
 
-import 'layouts/navigation.dart';
+Future<void> main() async {
+  await SentryFlutter.init(
+    (options) {
+      options.dsn =
+          'https://a629d9164a60a28ac855c52f4f543722@o4506965897117696.ingest.us.sentry.io/4506965900001280';
+      options.tracesSampleRate = 1.0;
+    },
+    appRunner: () async {
+      WidgetsFlutterBinding.ensureInitialized();
 
-void main() async {
+      await authClient.pickClient();
-  WidgetsFlutterBinding.ensureInitialized();
 
-  try {
+      runApp(const SolarAgent());
-    await initializeFirebase();
+    },
-  } catch (e) {
+  );
-    print(e);
-  }
-
-  await AuthGuard().pickClient();
-
-  runApp(const GoatAgent());
 }
 
-class GoatAgent extends StatelessWidget {
+class SolarAgent extends StatelessWidget {
-  const GoatAgent({super.key});
+  const SolarAgent({super.key});
 
   @override
   Widget build(BuildContext context) {
-    return MaterialApp(
+    return MaterialApp.router(
-      title: 'GoatAgent',
+      title: 'SolarAgent',
       theme: ThemeData(
-        brightness: Brightness.light,
         colorScheme: ColorScheme.fromSwatch(
-            primarySwatch: Colors.indigo,
+          primarySwatch: Colors.indigo,
-            accentColor: Colors.indigoAccent,
+          accentColor: Colors.indigoAccent,
-            backgroundColor: Colors.white,
+          backgroundColor: Colors.white,
-            brightness: Brightness.light,
+          brightness: Brightness.light,
         ),
         useMaterial3: true,
       ),
-      darkTheme: ThemeData(
+      routerConfig: router,
-        brightness: Brightness.dark,
+      builder: (context, child) => Overlay(
-        colorScheme: ColorScheme.fromSwatch(
+        initialEntries: [
-            primarySwatch: Colors.indigo,
+          OverlayEntry(
-            accentColor: Colors.indigoAccent,
+            builder: (context) => Container(
-            backgroundColor: Colors.black,
+              color: Colors.white,
-            brightness: Brightness.dark,
+              child: SafeArea(
-        ),
+                bottom: false,
-        useMaterial3: true,
+                child: Scaffold(
+                  body: child,
+                  bottomNavigationBar: const AgentNavigation(),
+                ),
+              ),
+            ),
+          )
+        ],
       ),
-      home: AgentNavigation(),
     );
   }
 }

lib/models/author.dart

@@ -0,0 +1,59 @@
+class Author {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String name;
+  String nick;
+  String avatar;
+  String banner;
+  String description;
+  String emailAddress;
+  int powerLevel;
+  int externalId;
+
+  Author({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.name,
+    required this.nick,
+    required this.avatar,
+    required this.banner,
+    required this.description,
+    required this.emailAddress,
+    required this.powerLevel,
+    required this.externalId,
+  });
+
+  factory Author.fromJson(Map<String, dynamic> json) => Author(
+        id: json["id"],
+        createdAt: DateTime.parse(json["created_at"]),
+        updatedAt: DateTime.parse(json["updated_at"]),
+        deletedAt: json["deleted_at"],
+        name: json["name"],
+        nick: json["nick"],
+        avatar: json["avatar"],
+        banner: json["banner"],
+        description: json["description"],
+        emailAddress: json["email_address"],
+        powerLevel: json["power_level"],
+        externalId: json["external_id"],
+      );
+
+  Map<String, dynamic> toJson() => {
+        "id": id,
+        "created_at": createdAt.toIso8601String(),
+        "updated_at": updatedAt.toIso8601String(),
+        "deleted_at": deletedAt,
+        "name": name,
+        "nick": nick,
+        "avatar": avatar,
+        "banner": banner,
+        "description": description,
+        "email_address": emailAddress,
+        "power_level": powerLevel,
+        "external_id": externalId,
+      };
+}

lib/models/feed.dart

@@ -0,0 +1,154 @@
+import 'package:solaragent/models/author.dart';
+
+class Feed {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String alias;
+  String title;
+  String description;
+  String content;
+  String modelType;
+  int commentCount;
+  int reactionCount;
+  int authorId;
+  int? realmId;
+  Author author;
+  List<Attachment>? attachments;
+  Map<String, dynamic>? reactionList;
+
+  Feed({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.alias,
+    required this.title,
+    required this.description,
+    required this.content,
+    required this.modelType,
+    required this.commentCount,
+    required this.reactionCount,
+    required this.authorId,
+    this.realmId,
+    required this.author,
+    this.attachments,
+    this.reactionList,
+  });
+
+  factory Feed.fromJson(Map<String, dynamic> json) => Feed(
+        id: json["id"],
+        createdAt: DateTime.parse(json["created_at"]),
+        updatedAt: DateTime.parse(json["updated_at"]),
+        deletedAt: json["deleted_at"],
+        alias: json["alias"],
+        title: json["title"],
+        description: json["description"],
+        content: json["content"],
+        modelType: json["model_type"],
+        commentCount: json["comment_count"],
+        reactionCount: json["reaction_count"],
+        authorId: json["author_id"],
+        realmId: json["realm_id"],
+        author: Author.fromJson(json["author"]),
+        attachments: json["attachments"] != null
+            ? List<Attachment>.from(
+                json["attachments"].map((x) => Attachment.fromJson(x)))
+            : List.empty(),
+        reactionList: json["reaction_list"],
+      );
+
+  Map<String, dynamic> toJson() => {
+        "id": id,
+        "created_at": createdAt.toIso8601String(),
+        "updated_at": updatedAt.toIso8601String(),
+        "deleted_at": deletedAt,
+        "alias": alias,
+        "title": title,
+        "description": description,
+        "content": content,
+        "model_type": modelType,
+        "comment_count": commentCount,
+        "reaction_count": reactionCount,
+        "author_id": authorId,
+        "realm_id": realmId,
+        "author": author.toJson(),
+        "attachments": attachments == null
+            ? List.empty()
+            : List<dynamic>.from(attachments!.map((x) => x.toJson())),
+        "reaction_list": reactionList,
+      };
+}
+
+class Attachment {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String fileId;
+  int filesize;
+  String filename;
+  String mimetype;
+  int type;
+  String externalUrl;
+  Author author;
+  int? articleId;
+  int? momentId;
+  int? commentId;
+  int? authorId;
+
+  Attachment({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.fileId,
+    required this.filesize,
+    required this.filename,
+    required this.mimetype,
+    required this.type,
+    required this.externalUrl,
+    required this.author,
+    this.articleId,
+    this.momentId,
+    this.commentId,
+    this.authorId,
+  });
+
+  factory Attachment.fromJson(Map<String, dynamic> json) => Attachment(
+        id: json["id"],
+        createdAt: DateTime.parse(json["created_at"]),
+        updatedAt: DateTime.parse(json["updated_at"]),
+        deletedAt: json["deleted_at"],
+        fileId: json["file_id"],
+        filesize: json["filesize"],
+        filename: json["filename"],
+        mimetype: json["mimetype"],
+        type: json["type"],
+        externalUrl: json["external_url"],
+        author: Author.fromJson(json["author"]),
+        articleId: json["article_id"],
+        momentId: json["moment_id"],
+        commentId: json["comment_id"],
+        authorId: json["author_id"],
+      );
+
+  Map<String, dynamic> toJson() => {
+        "id": id,
+        "created_at": createdAt.toIso8601String(),
+        "updated_at": updatedAt.toIso8601String(),
+        "deleted_at": deletedAt,
+        "file_id": fileId,
+        "filesize": filesize,
+        "filename": filename,
+        "mimetype": mimetype,
+        "type": type,
+        "external_url": externalUrl,
+        "author": author.toJson(),
+        "article_id": articleId,
+        "moment_id": momentId,
+        "comment_id": commentId,
+        "author_id": authorId,
+      };
+}

lib/models/notification.dart

@@ -0,0 +1,79 @@
+class Notification {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String subject;
+  String content;
+  List<Link>? links;
+  bool isImportant;
+  DateTime? readAt;
+  int senderId;
+  int recipientId;
+
+  Notification({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.subject,
+    required this.content,
+    this.links,
+    required this.isImportant,
+    this.readAt,
+    required this.senderId,
+    required this.recipientId,
+  });
+
+  factory Notification.fromJson(Map<String, dynamic> json) => Notification(
+        id: json["id"],
+        createdAt: DateTime.parse(json["created_at"]),
+        updatedAt: DateTime.parse(json["updated_at"]),
+        deletedAt: json["deleted_at"],
+        subject: json["subject"],
+        content: json["content"],
+        links: json["links"] != null
+            ? List<Link>.from(json["links"].map((x) => Link.fromJson(x)))
+            : List.empty(),
+        isImportant: json["is_important"],
+        readAt: json["read_at"],
+        senderId: json["sender_id"],
+        recipientId: json["recipient_id"],
+      );
+
+  Map<String, dynamic> toJson() => {
+        "id": id,
+        "created_at": createdAt.toIso8601String(),
+        "updated_at": updatedAt.toIso8601String(),
+        "deleted_at": deletedAt,
+        "subject": subject,
+        "content": content,
+        "links": links != null
+            ? List<dynamic>.from(links!.map((x) => x.toJson()))
+            : List.empty(),
+        "is_important": isImportant,
+        "read_at": readAt,
+        "sender_id": senderId,
+        "recipient_id": recipientId,
+      };
+}
+
+class Link {
+  String label;
+  String url;
+
+  Link({
+    required this.label,
+    required this.url,
+  });
+
+  factory Link.fromJson(Map<String, dynamic> json) => Link(
+        label: json["label"],
+        url: json["url"],
+      );
+
+  Map<String, dynamic> toJson() => {
+        "label": label,
+        "url": url,
+      };
+}

lib/models/pagination.dart

@@ -0,0 +1,17 @@
+class PaginationResult {
+  int count;
+  List<dynamic>? data;
+
+  PaginationResult({
+    required this.count,
+    this.data,
+  });
+
+  factory PaginationResult.fromJson(Map<String, dynamic> json) =>
+      PaginationResult(count: json["count"], data: json["data"]);
+
+  Map<String, dynamic> toJson() => {
+        "count": count,
+        "data": data,
+      };
+}

lib/preferences.dart

@@ -0,0 +1,5 @@
+import 'package:shared_preferences/shared_preferences.dart';
+
+getPreferences() async {
+  return await SharedPreferences.getInstance();
+}

lib/router.dart

@@ -0,0 +1,43 @@
+import 'package:go_router/go_router.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/screens/account.dart';
+import 'package:solaragent/screens/explore.dart';
+import 'package:solaragent/screens/notifications.dart';
+import 'package:solaragent/screens/posts/screen.dart';
+import 'package:solaragent/screens/publish/comment_editor.dart';
+import 'package:solaragent/screens/publish/moment_editor.dart';
+
+final router = GoRouter(
+  routes: [
+    GoRoute(
+      path: '/',
+      builder: (context, state) => const ExploreScreen(),
+    ),
+    GoRoute(
+      path: '/notifications',
+      builder: (context, state) => const NotificationScreen(),
+    ),
+    GoRoute(
+      path: '/account',
+      builder: (context, state) => const AccountScreen(),
+    ),
+
+    GoRoute(
+      path: '/post/new/moments',
+      builder: (context, state) => const MomentEditorScreen(),
+    ),
+    GoRoute(
+      path: '/post/new/comments',
+      builder: (context, state) =>
+          CommentEditorScreen(parent: state.extra as Feed),
+    ),
+
+    GoRoute(
+      path: '/post/:modelType/:alias',
+      builder: (context, state) => PostScreen(
+        modelType: state.pathParameters['modelType'] as String,
+        alias: state.pathParameters['alias'] as String,
+      ),
+    ),
+  ],
+);

lib/screens/about.dart

@@ -16,10 +16,10 @@ class AboutScreen extends StatelessWidget {
           mainAxisAlignment: MainAxisAlignment.center,
           crossAxisAlignment: CrossAxisAlignment.center,
           children: [
-            Text('GoatAgent',
+            Text('Solian',
                 style: Theme.of(context).textTheme.headlineMedium),
-            Text('Goatworks Official Mobile Helper',
+            Text('Solar Networks Official Mobile Application',
-                style: Theme.of(context).textTheme.bodyLarge),
+                style: Theme.of(context).textTheme.bodyMedium),
             const SizedBox(height: 20),
             FutureBuilder(
               future: PackageInfo.fromPlatform(),
@@ -37,7 +37,7 @@ class AboutScreen extends StatelessWidget {
             const SizedBox(height: 10),
             MaterialButton(
               onPressed: () async {
-                await launchUrl(Uri.parse('https://smartsheep.studio'));
+                await launchUrl(Uri.parse('https://solsynth.dev'));
               },
               child: const Text('Official Website'),
             ),

lib/screens/account.dart

@@ -1,8 +1,7 @@
 import 'package:flutter/material.dart';
-import 'package:go_router/go_router.dart';
+import 'package:solaragent/auth.dart';
-import 'package:goatagent/auth.dart';
+import 'package:solaragent/screens/about.dart';
-import 'package:goatagent/screens/about.dart';
+import 'package:solaragent/widgets/name_card.dart';
-import 'package:goatagent/widgets/name_card.dart';
 
 class AccountScreen extends StatefulWidget {
   const AccountScreen({super.key});
@@ -17,7 +16,7 @@ class _AccountScreenState extends State<AccountScreen> {
   @override
   void initState() {
     super.initState();
-    AuthGuard().isAuthorized().then((value) {
+    authClient.isAuthorized().then((value) {
       setState(() {
         isAuthorized = value;
       });
@@ -27,38 +26,38 @@ class _AccountScreenState extends State<AccountScreen> {
   @override
   Widget build(BuildContext context) {
     return Scaffold(
-      body: SafeArea(
+      body: Padding(
-        child: Padding(
+        padding: const EdgeInsets.symmetric(vertical: 5, horizontal: 20),
-          padding: const EdgeInsets.symmetric(vertical: 5, horizontal: 20),
+        child: Column(children: [
-          child: Column(children: [
+          Padding(
-            Padding(
+            padding: const EdgeInsets.only(top: 20),
-              padding: const EdgeInsets.only(top: 20),
+            child: NameCard(
-              child: NameCard(
+              onLogin: () async {
-                onLogin: () async {
+                await authClient.signin(context);
-                  await AuthGuard().login(context);
+                var authorized = await authClient.isAuthorized();
-                  var authorized = await AuthGuard().isAuthorized();
+                setState(() {
-                  setState(() {
+                  isAuthorized = authorized;
-                    isAuthorized = authorized;
+                });
-                  });
+              },
-                },
-              ),
             ),
-            Padding(
+          ),
-              padding: const EdgeInsets.only(top: 5),
+          Padding(
-              child: Wrap(
+            padding: const EdgeInsets.only(top: 5),
-                spacing: 5,
+            child: Wrap(
-                children: [
+              spacing: 5,
-                  FutureBuilder(
+              children: [
-                    future: AuthGuard().isAuthorized(),
+                FutureBuilder(
-                    builder: (BuildContext context, AsyncSnapshot<bool> snapshot) {
+                  future: authClient.isAuthorized(),
-                      if (snapshot.hasData && snapshot.data == true) {
+                  builder:
-                        return Card(
+                      (BuildContext context, AsyncSnapshot<bool> snapshot) {
-                          elevation: 0,
+                    return (snapshot.hasData && snapshot.data == true)
-                          child: InkWell(
+                        ? InkWell(
+                            borderRadius:
+                                const BorderRadius.all(Radius.circular(40)),
                             splashColor: Colors.indigo.withAlpha(30),
                             onTap: () async {
-                              AuthGuard().logout();
+                              authClient.signoff();
-                              var authorized = await AuthGuard().isAuthorized();
+                              var authorized = await authClient.isAuthorized();
                               setState(() {
                                 isAuthorized = authorized;
                               });
@@ -67,33 +66,29 @@ class _AccountScreenState extends State<AccountScreen> {
                               leading: Icon(Icons.logout),
                               title: Text('Logout'),
                             ),
-                          ),
+                          )
-                        );
+                        : Container();
-                      } else {
+                  },
-                        return Container();
+                ),
-                      }
+                InkWell(
-                    },
+                  borderRadius: const BorderRadius.all(Radius.circular(40)),
-                  ),
+                  splashColor: Colors.indigo.withAlpha(30),
-                  Card(
+                  onTap: () {
-                    elevation: 0,
+                    Navigator.push(
-                    child: InkWell(
+                        context,
-                      splashColor: Colors.indigo.withAlpha(30),
+                        MaterialPageRoute(
-                      onTap: () {
-                        Navigator.push(context, MaterialPageRoute(
                           builder: (context) => const AboutScreen(),
                         ));
-                      },
+                  },
-                      child: const ListTile(
+                  child: const ListTile(
-                        leading: Icon(Icons.info_outline),
+                    leading: Icon(Icons.info_outline),
-                        title: Text('About'),
+                    title: Text('About'),
-                      ),
-                    ),
                   ),
-                ],
+                ),
-              ),
+              ],
             ),
-          ]),
+          ),
-        ),
+        ]),
       ),
     );
   }

lib/screens/application.dart

@@ -1,32 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:webview_flutter/webview_flutter.dart';
-
-class ApplicationScreen extends StatelessWidget {
-  final Uri link;
-  final String title;
-
-  const ApplicationScreen({super.key, required this.link, required this.title});
-
-  @override
-  Widget build(BuildContext context) {
-    ScaffoldMessenger.of(context).showSnackBar(const SnackBar(
-      content: Text("Swipe from left to back to dashboard."),
-    ));
-
-    return Scaffold(
-      body: SafeArea(
-        child: Stack(
-          children: [
-            WebViewWidget(
-              controller: WebViewController()
-                ..setJavaScriptMode(JavaScriptMode.unrestricted)
-                ..setBackgroundColor(Colors.white)
-                ..loadRequest(link)
-                ..clearCache(),
-            ),
-          ],
-        ),
-      ),
-    );
-  }
-}

lib/screens/auth.dart

@@ -11,7 +11,7 @@ class AuthorizationScreen extends StatelessWidget {
   Widget build(BuildContext context) {
     return Scaffold(
       appBar: AppBar(
-        title: const Text('Connect with Goatpass'),
+        title: const Text('Sign in'),
       ),
       body: Stack(children: [
         WebViewWidget(
@@ -20,10 +20,10 @@ class AuthorizationScreen extends StatelessWidget {
             ..setBackgroundColor(Colors.white)
             ..setNavigationDelegate(NavigationDelegate(
               onNavigationRequest: (NavigationRequest request) {
-                if (request.url.startsWith('goatagent://auth')) {
+                if (request.url.startsWith('solaragent://auth')) {
                   Navigator.of(context).pop(request.url);
                   return NavigationDecision.prevent;
-                } else if (request.url.startsWith("https://id.smartsheep.studio/auth/register")) {
+                } else if (request.url.startsWith("https://solsynth.dev/auth/sign-up")) {
                   launchUrl(Uri.parse(request.url));
                   return NavigationDecision.prevent;
                 }

lib/screens/dashboard.dart

@@ -1,90 +0,0 @@
-import 'dart:convert';
-
-import 'package:flutter/material.dart';
-import 'package:goatagent/screens/application.dart';
-import 'package:http/http.dart' as http;
-
-class DashboardScreen extends StatefulWidget {
-  const DashboardScreen({super.key});
-
-  @override
-  State<DashboardScreen> createState() => _DashboardScreenState();
-}
-
-class _DashboardScreenState extends State<DashboardScreen> {
-  final client = http.Client();
-  final directoryEndpoint =
-      Uri.parse('https://id.smartsheep.studio/.well-known');
-
-  List<dynamic> directory = List.empty();
-
-  @override
-  void initState() {
-    super.initState();
-    _pullDirectory();
-  }
-
-  Future<void> _pullDirectory() async {
-    var response = await client.get(directoryEndpoint);
-    if (response.statusCode == 200) {
-      setState(() {
-        directory = jsonDecode(utf8.decode(response.bodyBytes))["directory"];
-      });
-    }
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      body: SafeArea(
-        child: Padding(
-          padding: const EdgeInsets.only(left: 20, right: 20, top: 30),
-          child: GridView.count(
-            crossAxisCount: 2,
-            children: directory.map((element) {
-              return Card(
-                child: InkWell(
-                  onTap: () async {
-                    var link = element["link"];
-                    Navigator.of(context, rootNavigator: true)
-                        .push(MaterialPageRoute(
-                      builder: (context) => ApplicationScreen(
-                        link: Uri.parse(link),
-                        title: element["name"],
-                      ),
-                    ));
-                  },
-                  splashColor: Colors.indigo.withAlpha(30),
-                  child: Padding(
-                    padding: const EdgeInsets.all(10),
-                    child: Wrap(
-                      spacing: 8.0,
-                      children: [
-                        Padding(
-                          padding: const EdgeInsets.only(left: 6, top: 2),
-                          child: Card(
-                            shape: const CircleBorder(),
-                            elevation: 0,
-                            color: Colors.indigo.withAlpha(70),
-                            child: const Padding(
-                              padding: EdgeInsets.all(16),
-                              child: Icon(Icons.apps),
-                            ),
-                          ),
-                        ),
-                        ListTile(
-                          title: Text(element['name']),
-                          subtitle: Text(element['description']),
-                        ),
-                      ],
-                    ),
-                  ),
-                ),
-              );
-            }).toList(),
-          ),
-        ),
-      ),
-    );
-  }
-}

lib/screens/explore.dart

@@ -0,0 +1,103 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/models/pagination.dart';
+import 'package:http/http.dart' as http;
+import 'package:solaragent/router.dart';
+import 'package:solaragent/widgets/feed.dart';
+
+class ExploreScreen extends StatefulWidget {
+  const ExploreScreen({super.key});
+
+  @override
+  State<ExploreScreen> createState() => _ExploreScreenState();
+}
+
+class _ExploreScreenState extends State<ExploreScreen> {
+  static const pageSize = 5;
+
+  final client = http.Client();
+
+  final PagingController<int, Feed> paginationController =
+      PagingController(firstPageKey: 0);
+
+  List<Feed> feed = List.empty();
+
+  @override
+  void initState() {
+    super.initState();
+    paginationController.addPageRequestListener((pageKey) {
+      pullFeed(pageKey);
+    });
+  }
+
+  Future<void> pullFeed(int pageKey) async {
+    var offset = pageKey;
+    var take = pageSize;
+
+    var uri =
+        Uri.parse('https://co.solsynth.dev/api/feed?take=$take&offset=$offset');
+
+    var res = await client.get(uri);
+    if (res.statusCode == 200) {
+      final result =
+          PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+      final isLastPage = (result.count - pageKey) < pageSize;
+      final items =
+          result.data?.map((x) => Feed.fromJson(x)).toList() ?? List.empty();
+      if (isLastPage || result.data == null) {
+        paginationController.appendLastPage(items);
+      } else {
+        final nextPageKey = pageKey + items.length;
+        paginationController.appendPage(items, nextPageKey);
+      }
+    } else {
+      paginationController.error = utf8.decode(res.bodyBytes);
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: RefreshIndicator(
+        onRefresh: () async {
+          paginationController.refresh();
+        },
+        child: PagedListView<int, Feed>(
+          pagingController: paginationController,
+          builderDelegate: PagedChildBuilderDelegate<Feed>(
+            itemBuilder: (context, item, index) => FeedItem(
+              item: item,
+              brief: true,
+            ),
+          ),
+        ),
+      ),
+      floatingActionButton: FutureBuilder(
+          future: authClient.isAuthorized(),
+          builder: (context, snapshot) {
+            if (snapshot.hasData && snapshot.data == true) {
+              return FloatingActionButton(
+                child: const Icon(Icons.edit),
+                onPressed: () {
+                  router.push("/post/new/moments").then((value) {
+                    if (value == true) paginationController.refresh();
+                  });
+                },
+              );
+            } else {
+              return Container();
+            }
+          }),
+    );
+  }
+
+  @override
+  void dispose() {
+    paginationController.dispose();
+    super.dispose();
+  }
+}

lib/screens/notifications.dart

@@ -1,7 +1,10 @@
 import 'dart:convert';
 
 import 'package:flutter/material.dart';
-import 'package:goatagent/auth.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/notification.dart' as model;
+import 'package:solaragent/models/pagination.dart';
+import 'package:solaragent/widgets/notification.dart';
 
 class NotificationScreen extends StatefulWidget {
   const NotificationScreen({super.key});
@@ -11,84 +14,90 @@ class NotificationScreen extends StatefulWidget {
 }
 
 class _NotificationScreenState extends State<NotificationScreen> {
-  final notificationEndpoint = Uri.parse(
-      'https://id.smartsheep.studio/api/notifications?skip=0&take=20');
-
   List<dynamic> notifications = List.empty();
 
   @override
   void initState() {
     super.initState();
-    _pullNotifications();
+    pullNotifications();
   }
 
-  Future<void> _pullNotifications() async {
+  Future<void> pullNotifications() async {
-    if (await AuthGuard().isAuthorized()) {
+    if (await authClient.isAuthorized()) {
-      await AuthGuard().pullProfiles();
-      var profiles = await AuthGuard().readProfiles();
-      setState(() {
-        notifications = profiles['notifications'];
-      });
-    }
-  }
-
-  Future<void> _markAsRead(element) async {
-    if (AuthGuard().client != null) {
-      var id = element['id'];
       var uri =
-          Uri.parse('https://id.smartsheep.studio/api/notifications/$id/read');
+          Uri.parse('https://id.solsynth.dev/api/notifications?skip=0&take=25');
-      await AuthGuard().client!.put(uri);
+      var res = await authClient.client!.get(uri);
+      if (res.statusCode == 200) {
+        final result =
+            PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+        setState(() {
+          notifications =
+              result.data?.map((x) => model.Notification.fromJson(x)).toList() ??
+                  List.empty();
+        });
+      }
     }
   }
 
   @override
   Widget build(BuildContext context) {
     return Scaffold(
-      body: SafeArea(
+      body: RefreshIndicator(
-        child: Padding(
+        onRefresh: pullNotifications,
-          padding: const EdgeInsets.only(left: 20, right: 20, top: 30),
+        child: CustomScrollView(
-          child: RefreshIndicator(
+          slivers: [
-            onRefresh: _pullNotifications,
+            // Title
-            child: CustomScrollView(
+            SliverToBoxAdapter(
-              slivers: [
+              child: Padding(
-                notifications.isEmpty
+                padding: const EdgeInsets.only(left: 10, right: 10, top: 20),
-                    ? const SliverToBoxAdapter(
+                child: ListTile(
-                        child: Card(
+                  title: Text(
-                          child: Padding(
+                    'Notifications',
-                            padding: EdgeInsets.all(10),
+                    style: Theme.of(context).textTheme.headlineSmall,
-                            child: ListTile(
+                  ),
-                              leading: Icon(Icons.check),
+                ),
-                              title: Text('You\'re done!'),
+              ),
-                              subtitle: Text(
-                                  'There are no notifications unread for you.'),
-                            ),
-                          ),
-                        ),
-                      )
-                    : SliverList.builder(
-                        itemCount: notifications.length,
-                        itemBuilder: (BuildContext context, int index) {
-                          var element = notifications[index];
-                          return Dismissible(
-                              key: Key('notification-$index'),
-                              onDismissed: (direction) {
-                                var subject = element["subject"];
-                                _markAsRead(element).then((value) {
-                                  ScaffoldMessenger.of(context).showSnackBar(
-                                      SnackBar(
-                                          content:
-                                              Text('「$subject」 mark as read')));
-                                });
-                              },
-                              child: ListTile(
-                                title: Text(element["subject"]),
-                                subtitle: Text(element["content"]),
-                              ));
-                        },
-                      ),
-              ],
             ),
-          ),
+            // Content
+            notifications.isEmpty
+                ? SliverToBoxAdapter(
+                    child: Container(
+                      padding: const EdgeInsets.symmetric(horizontal: 10),
+                      color: Colors.grey[50],
+                      child: const ListTile(
+                        leading: Icon(Icons.check),
+                        title: Text('You\'re done!'),
+                        subtitle: Text(
+                          'There are no notifications unread for you.',
+                        ),
+                      ),
+                    ),
+                  )
+                : SliverList.builder(
+                    itemCount: notifications.length,
+                    itemBuilder: (BuildContext context, int index) {
+                      var element = notifications[index];
+                      return NotificationItem(
+                        index: index,
+                        item: element,
+                        onDismiss: () => setState(() {
+                          notifications.removeAt(index);
+                        }),
+                      );
+                    },
+                  ),
+            // Tips
+            SliverToBoxAdapter(
+              child: Container(
+                padding: const EdgeInsets.only(top: 12),
+                child: Text(
+                  "Pull to refresh, swipe to dismiss",
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.bodySmall,
+                ),
+              ),
+            ),
+          ],
         ),
       ),
     );

lib/screens/posts/screen.dart

@@ -0,0 +1,64 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:http/http.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/widgets/feed.dart';
+
+class PostScreen extends StatefulWidget {
+  final Client client = Client();
+
+  final String modelType;
+  final String alias;
+
+  PostScreen({super.key, required this.modelType, required this.alias});
+
+  @override
+  State<PostScreen> createState() => _PostScreenState();
+}
+
+class _PostScreenState extends State<PostScreen> {
+  Future<Feed?> pullPost(BuildContext context) async {
+    var uri = Uri.parse(
+      "https://co.solsynth.dev/api/p/${widget.modelType}s/${widget.alias}",
+    );
+    var res = await widget.client.get(uri);
+    if (res.statusCode != 200) {
+      var err = utf8.decode(res.bodyBytes);
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $err")),
+      );
+      return null;
+    } else {
+      return Feed.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+    }
+  }
+
+  Widget buildItem(BuildContext context, Feed item) {
+    return FeedItem(
+      item: item,
+      brief: false,
+    );
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(title: const Text("Post")),
+      body: FutureBuilder(
+        future: pullPost(context),
+        builder: (context, snapshot) {
+          if (snapshot.hasData && snapshot.data != null) {
+            return SingleChildScrollView(
+              child: buildItem(context, snapshot.data!),
+            );
+          } else {
+            return const Center(
+              child: CircularProgressIndicator(),
+            );
+          }
+        },
+      ),
+    );
+  }
+}

lib/screens/publish/attachment_list.dart

@@ -0,0 +1,212 @@
+import 'dart:convert';
+import 'dart:io';
+import 'dart:math' as math;
+
+import 'package:crypto/crypto.dart';
+import 'package:flutter/material.dart';
+import 'package:http/http.dart';
+import 'package:image_picker/image_picker.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+
+class AttachmentList extends StatefulWidget {
+  final List<Attachment> current;
+  final void Function(List<Attachment> data) onUpdate;
+
+  const AttachmentList(
+      {super.key, required this.current, required this.onUpdate});
+
+  @override
+  State<AttachmentList> createState() => _AttachmentListState();
+}
+
+class _AttachmentListState extends State<AttachmentList> {
+  final imagePicker = ImagePicker();
+
+  bool isSubmitting = false;
+
+  List<Attachment> attachments = List.empty(growable: true);
+
+  Future<void> pickImageToUpload(BuildContext context) async {
+    if (!await authClient.isAuthorized()) return;
+
+    final image = await imagePicker.pickImage(source: ImageSource.gallery);
+    if (image == null) return;
+
+    final file = File(image.path);
+    final hashcode = await calculateSha256(file);
+
+    try {
+      await uploadAttachment(file, hashcode);
+    } catch (err) {
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $err")),
+      );
+    }
+  }
+
+  Future<void> uploadAttachment(File file, String hashcode) async {
+    var req = MultipartRequest(
+      'POST',
+      Uri.parse('https://co.solsynth.dev/api/attachments'),
+    );
+    req.files.add(await MultipartFile.fromPath('attachment', file.path));
+    req.fields['hashcode'] = hashcode;
+
+    setState(() => isSubmitting = true);
+    var res = await authClient.client!.send(req);
+    if (res.statusCode == 200) {
+      var result = Attachment.fromJson(
+        jsonDecode(utf8.decode(await res.stream.toBytes()))["info"],
+      );
+      setState(() => attachments.add(result));
+      widget.onUpdate(attachments);
+    } else {
+      throw Exception(utf8.decode(await res.stream.toBytes()));
+    }
+    setState(() => isSubmitting = false);
+  }
+
+  Future<void> disposeAttachment(
+      BuildContext context, Attachment item, int index) async {
+    var req = MultipartRequest(
+      'DELETE',
+      Uri.parse('https://co.solsynth.dev/api/attachments/${item.id}'),
+    );
+
+    setState(() => isSubmitting = true);
+    var res = await authClient.client!.send(req);
+    if (res.statusCode == 200) {
+      setState(() => attachments.removeAt(index));
+      widget.onUpdate(attachments);
+    } else {
+      final err = utf8.decode(await res.stream.toBytes());
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $err")),
+      );
+    }
+    setState(() => isSubmitting = false);
+  }
+
+  Future<String> calculateSha256(File file) async {
+    final bytes = await file.readAsBytes();
+    final digest = sha256.convert(bytes);
+    return digest.toString();
+  }
+
+  String getFileName(Attachment item) {
+    return item.filename.replaceAll(RegExp(r'\.[^/.]+$'), '');
+  }
+
+  String getFileType(Attachment item) {
+    switch (item.type) {
+      case 1:
+        return 'Photo';
+      case 2:
+        return 'Video';
+      case 3:
+        return 'Audio';
+      default:
+        return 'Others';
+    }
+  }
+
+  String formatBytes(int bytes, {int decimals = 2}) {
+    if (bytes == 0) return '0 Bytes';
+    const k = 1024;
+    final dm = decimals < 0 ? 0 : decimals;
+    final sizes = [
+      'Bytes',
+      'KiB',
+      'MiB',
+      'GiB',
+      'TiB',
+      'PiB',
+      'EiB',
+      'ZiB',
+      'YiB'
+    ];
+    final i = (math.log(bytes) / math.log(k)).floor().toInt();
+    return '${(bytes / math.pow(k, i)).toStringAsFixed(dm)} ${sizes[i]}';
+  }
+
+  @override
+  void initState() {
+    attachments = widget.current;
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        Container(
+          padding: const EdgeInsets.only(left: 10, right: 10, top: 20),
+          child: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Padding(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 8.0,
+                  vertical: 12.0,
+                ),
+                child: Text(
+                  'Attachments',
+                  style: Theme.of(context).textTheme.headlineSmall,
+                ),
+              ),
+              FutureBuilder(
+                future: authClient.isAuthorized(),
+                builder: (context, snapshot) {
+                  if (snapshot.hasData && snapshot.data == true) {
+                    return Tooltip(
+                      message: "Add a photo",
+                      child: TextButton(
+                        onPressed: isSubmitting
+                            ? null
+                            : () => pickImageToUpload(context),
+                        style: TextButton.styleFrom(
+                          shape: const CircleBorder(),
+                        ),
+                        child: const Icon(Icons.add_photo_alternate),
+                      ),
+                    );
+                  } else {
+                    return Container();
+                  }
+                },
+              ),
+            ],
+          ),
+        ),
+        isSubmitting ? const LinearProgressIndicator() : Container(),
+        Expanded(
+          child: ListView.separated(
+            itemCount: attachments.length,
+            itemBuilder: (context, index) {
+              var element = attachments[index];
+              return Container(
+                padding: const EdgeInsets.only(left: 8.0),
+                child: ListTile(
+                  title: Text(getFileName(element)),
+                  subtitle: Text(
+                    "${getFileType(element)} · ${formatBytes(element.filesize)}",
+                  ),
+                  trailing: TextButton(
+                    style: TextButton.styleFrom(
+                      shape: const CircleBorder(),
+                      foregroundColor: Colors.red,
+                    ),
+                    child: const Icon(Icons.delete),
+                    onPressed: () => disposeAttachment(context, element, index),
+                  ),
+                ),
+              );
+            },
+            separatorBuilder: (context, index) => const Divider(),
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/screens/publish/comment_editor.dart

@@ -0,0 +1,169 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/router.dart';
+import 'package:url_launcher/url_launcher.dart';
+
+class CommentEditorScreen extends StatefulWidget {
+  final Feed parent;
+
+  const CommentEditorScreen({super.key, required this.parent});
+
+  @override
+  State<CommentEditorScreen> createState() => _CommentEditorScreenState();
+}
+
+class _CommentEditorScreenState extends State<CommentEditorScreen> {
+  final contentController = TextEditingController();
+
+  bool isSubmitting = false;
+
+  bool showRecommendationBanner = true;
+
+  Future<void> postComment() async {
+    if (!await authClient.isAuthorized()) return;
+
+    var dataset = "${widget.parent.modelType}s";
+    var alias = widget.parent.alias;
+
+    var uri = Uri.parse(
+      "https://co.solsynth.dev/api/p/$dataset/$alias/comments",
+    );
+
+    setState(() => isSubmitting = true);
+    var res = await authClient.client!.post(
+      uri,
+      headers: <String, String>{
+        'Content-Type': 'application/json',
+      },
+      body: jsonEncode(<String, dynamic>{
+        'content': contentController.value.text,
+      }),
+    );
+    if (res.statusCode != 200) {
+      var message = utf8.decode(res.bodyBytes);
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $message")),
+      );
+    } else {
+      if (router.canPop()) {
+        router.pop(true);
+      }
+    }
+    setState(() => isSubmitting = false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        title: const Text("Leave a comment"),
+        actions: <Widget>[
+          TextButton(
+            onPressed: !isSubmitting ? postComment : null,
+            child: const Text('POST'),
+          ),
+        ],
+      ),
+      body: Column(
+        children: [
+          // Loading indicator
+          isSubmitting ? const LinearProgressIndicator() : Container(),
+          // Userinfo
+          FutureBuilder(
+              future: authClient.getProfiles(),
+              builder: (context, snapshot) {
+                if (snapshot.hasData) {
+                  var userinfo = snapshot.data;
+                  return Container(
+                    color: Colors.grey[50],
+                    margin: const EdgeInsets.only(bottom: 12),
+                    child: ListTile(
+                      title: Text(userinfo["nick"]),
+                      subtitle: const Text("You will post this post as"),
+                      leading: CircleAvatar(
+                        backgroundImage: NetworkImage(userinfo["picture"]),
+                      ),
+                    ),
+                  );
+                } else {
+                  return Container();
+                }
+              }),
+          // Editor
+          Expanded(
+            child: Container(
+              padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 8),
+              child: TextField(
+                maxLines: null,
+                autofocus: true,
+                autocorrect: true,
+                keyboardType: TextInputType.multiline,
+                controller: contentController,
+                decoration: const InputDecoration.collapsed(
+                  hintText: "What do you want to say?",
+                ),
+              ),
+            ),
+          ),
+          // Recommend website banner
+          showRecommendationBanner
+              ? FutureBuilder(
+                  future: SharedPreferences.getInstance(),
+                  builder: (context, snapshot) {
+                    if (snapshot.hasData &&
+                        snapshot.data?.getBool(
+                                "editor.hide_website_recommendation") ==
+                            null) {
+                      snapshot.data
+                          ?.remove("editor.hide_website_recommendation");
+                      return MaterialBanner(
+                        padding: const EdgeInsets.all(20),
+                        content: const Text(
+                          'Solian still in early stage development. Some features isn\'t available. We recommend use our website, also optimized for moblie!',
+                        ),
+                        leading: const Icon(Icons.construction),
+                        backgroundColor: const Color(0xFFE0E0E0),
+                        actions: <Widget>[
+                          TextButton(
+                            child: const Text('OPEN'),
+                            onPressed: () async {
+                              await launchUrl(
+                                Uri.parse("https://co.solsynth.dev"),
+                                mode: LaunchMode.externalApplication,
+                              );
+                            },
+                          ),
+                          TextButton(
+                            child: const Text('DISMISS'),
+                            onPressed: () async {
+                              await snapshot.data?.setBool(
+                                "editor.hide_website_recommendation",
+                                true,
+                              );
+                              setState(() {
+                                showRecommendationBanner = false;
+                              });
+                            },
+                          ),
+                        ],
+                      );
+                    } else {
+                      return Container();
+                    }
+                  })
+              : Container(),
+        ],
+      ),
+    );
+  }
+
+  @override
+  void dispose() {
+    contentController.dispose();
+    super.dispose();
+  }
+}

lib/screens/publish/moment_editor.dart

@@ -0,0 +1,191 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/router.dart';
+import 'package:solaragent/screens/publish/attachment_list.dart';
+import 'package:url_launcher/url_launcher.dart';
+
+class MomentEditorScreen extends StatefulWidget {
+  const MomentEditorScreen({super.key});
+
+  @override
+  State<MomentEditorScreen> createState() => _MomentEditorScreenState();
+}
+
+class _MomentEditorScreenState extends State<MomentEditorScreen> {
+  final contentController = TextEditingController();
+
+  bool isSubmitting = false;
+
+  bool showRecommendationBanner = true;
+
+  List<Attachment> attachments = List.empty(growable: true);
+
+  Future<void> postMoment() async {
+    if (!await authClient.isAuthorized()) return;
+
+    setState(() => isSubmitting = true);
+    var res = await authClient.client!.post(
+      Uri.parse("https://co.solsynth.dev/api/p/moments"),
+      headers: <String, String>{
+        'Content-Type': 'application/json',
+      },
+      body: jsonEncode(<String, dynamic>{
+        'content': contentController.value.text,
+        'attachments': attachments,
+      }),
+    );
+    if (res.statusCode != 200) {
+      var message = utf8.decode(res.bodyBytes);
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $message")),
+      );
+    } else {
+      if (router.canPop()) {
+        router.pop(true);
+      }
+    }
+    setState(() => isSubmitting = false);
+  }
+
+  void viewAttachments(BuildContext context) {
+    showModalBottomSheet(
+      context: context,
+      builder: (context) => AttachmentList(
+        current: attachments,
+        onUpdate: (value) => attachments = value,
+      ),
+    );
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        title: const Text("Record a moment"),
+        actions: <Widget>[
+          TextButton(
+            onPressed: !isSubmitting ? postMoment : null,
+            child: const Text('POST'),
+          ),
+        ],
+      ),
+      body: Column(
+        children: [
+          // Loading indicator
+          isSubmitting ? const LinearProgressIndicator() : Container(),
+          // Userinfo
+          FutureBuilder(
+              future: authClient.getProfiles(),
+              builder: (context, snapshot) {
+                if (snapshot.hasData) {
+                  var userinfo = snapshot.data;
+                  return Container(
+                    color: Colors.grey[50],
+                    margin: const EdgeInsets.only(bottom: 12),
+                    child: ListTile(
+                      title: Text(userinfo["nick"]),
+                      subtitle: const Text("You will post this post as"),
+                      leading: CircleAvatar(
+                        backgroundImage: NetworkImage(userinfo["picture"]),
+                      ),
+                    ),
+                  );
+                } else {
+                  return Container();
+                }
+              }),
+          // Editor
+          Expanded(
+            child: Container(
+              padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 8),
+              child: TextField(
+                maxLines: null,
+                autofocus: true,
+                autocorrect: true,
+                keyboardType: TextInputType.multiline,
+                controller: contentController,
+                decoration: const InputDecoration.collapsed(
+                  hintText: "What's happened?!",
+                ),
+              ),
+            ),
+          ),
+          // Toolbar
+          Container(
+            decoration: const BoxDecoration(
+              border: Border(
+                top: BorderSide(width: 0.3, color: Color(0xffdedede)),
+              ),
+            ),
+            child: Row(
+              children: [
+                TextButton(
+                  style: TextButton.styleFrom(shape: const CircleBorder()),
+                  child: const Icon(Icons.camera_alt),
+                  onPressed: () => viewAttachments(context),
+                )
+              ],
+            ),
+          ),
+          // Recommend website banner
+          showRecommendationBanner
+              ? FutureBuilder(
+                  future: SharedPreferences.getInstance(),
+                  builder: (context, snapshot) {
+                    if (snapshot.hasData &&
+                        snapshot.data?.getBool(
+                                "editor.hide_website_recommendation") ==
+                            null) {
+                      snapshot.data
+                          ?.remove("editor.hide_website_recommendation");
+                      return MaterialBanner(
+                        padding: const EdgeInsets.all(20),
+                        content: const Text(
+                          'Solian still in early stage development. Some features isn\'t available. We recommend use our website, also optimized for moblie!',
+                        ),
+                        leading: const Icon(Icons.construction),
+                        backgroundColor: const Color(0xFFE0E0E0),
+                        actions: <Widget>[
+                          TextButton(
+                            child: const Text('OPEN'),
+                            onPressed: () async {
+                              await launchUrl(
+                                Uri.parse("https://co.solsynth.dev"),
+                                mode: LaunchMode.externalApplication,
+                              );
+                            },
+                          ),
+                          TextButton(
+                            child: const Text('DISMISS'),
+                            onPressed: () async {
+                              await snapshot.data?.setBool(
+                                "editor.hide_website_recommendation",
+                                true,
+                              );
+                              setState(() {
+                                showRecommendationBanner = false;
+                              });
+                            },
+                          ),
+                        ],
+                      );
+                    } else {
+                      return Container();
+                    }
+                  })
+              : Container(),
+        ],
+      ),
+    );
+  }
+
+  @override
+  void dispose() {
+    contentController.dispose();
+    super.dispose();
+  }
+}

lib/widgets/feed.dart

@@ -0,0 +1,177 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_carousel_widget/flutter_carousel_widget.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:go_router/go_router.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/router.dart';
+import 'package:solaragent/widgets/image.dart';
+import 'package:solaragent/widgets/posts/comments.dart';
+import 'package:solaragent/widgets/posts/content/article.dart';
+import 'package:solaragent/widgets/posts/content/moment.dart';
+import 'package:solaragent/widgets/posts/reactions.dart';
+
+class FeedItem extends StatefulWidget {
+  final Feed item;
+  final bool? brief;
+
+  const FeedItem({super.key, required this.item, this.brief});
+
+  @override
+  State<FeedItem> createState() => _FeedItemState();
+}
+
+class _FeedItemState extends State<FeedItem> {
+  int reactionCount = 0;
+  Map<String, dynamic>? reactionList;
+
+  void viewComments(BuildContext context) {
+    showModalBottomSheet(
+      context: context,
+      isScrollControlled: true,
+      builder: (context) => CommentList(parent: widget.item),
+    );
+  }
+
+  void viewReactions(BuildContext context) {
+    showModalBottomSheet(
+      context: context,
+      builder: (context) => ReactionList(
+        parent: widget.item,
+        onReact: (symbol, num) {
+          setState(() {
+            if (!reactionList!.containsKey(symbol)) {
+              reactionList![symbol] = 0;
+            }
+
+            reactionCount += num;
+            reactionList![symbol] += num;
+          });
+        },
+      ),
+    );
+  }
+
+  bool hasAttachments() =>
+      widget.item.modelType == "moment" &&
+      widget.item.attachments != null &&
+      widget.item.attachments!.isNotEmpty;
+
+  String getDescription(String desc) =>
+      desc.isEmpty ? "No description yet." : desc;
+
+  String getFileUrl(String fileId) =>
+      'https://co.solsynth.dev/api/attachments/o/$fileId';
+
+  Widget buildContent() {
+    switch (widget.item.modelType) {
+      case "article":
+        return ArticleContent(item: widget.item, brief: widget.brief ?? false);
+      default:
+        return MomentContent(item: widget.item, brief: widget.brief ?? false);
+    }
+  }
+
+  Widget buildItem(BuildContext context) {
+    return Column(
+      children: [
+        Container(
+          color: Colors.grey[50],
+          child: ListTile(
+            title: Text(widget.item.author.name),
+            leading: CircleAvatar(
+              backgroundImage: NetworkImage(widget.item.author.avatar),
+            ),
+            subtitle: Text(
+              getDescription(widget.item.author.description),
+              overflow: TextOverflow.ellipsis,
+              maxLines: 1,
+              softWrap: false,
+            ),
+          ),
+        ),
+        buildContent(),
+        hasAttachments()
+            ? Container(
+                decoration: const BoxDecoration(
+                  border: Border(
+                      top: BorderSide(width: 0.3, color: Color(0xffdedede))),
+                ),
+                child: FlutterCarousel(
+                  options: CarouselOptions(
+                    height: 360.0,
+                    viewportFraction: 1.0,
+                    showIndicator: true,
+                    slideIndicator: const CircularSlideIndicator(),
+                  ),
+                  items: widget.item.attachments?.map((x) {
+                    return Builder(
+                      builder: (BuildContext context) {
+                        return SizedBox(
+                          width: MediaQuery.of(context).size.width,
+                          child: InkWell(
+                            child: Image.network(
+                              getFileUrl(x.fileId),
+                              fit: BoxFit.cover,
+                            ),
+                            onTap: () {
+                              Navigator.push(context,
+                                  MaterialPageRoute(builder: (_) {
+                                return ImageLightbox(
+                                  url: getFileUrl(x.fileId),
+                                );
+                              }));
+                            },
+                          ),
+                        );
+                      },
+                    );
+                  }).toList(),
+                ),
+              )
+            : Container(),
+        Container(
+          padding: const EdgeInsets.symmetric(horizontal: 8),
+          decoration: const BoxDecoration(
+            border: Border(
+              top: BorderSide(width: 0.3, color: Color(0xffdedede)),
+            ),
+          ),
+          child: Row(
+            children: [
+              TextButton.icon(
+                icon: const Icon(Icons.comment),
+                label: Text(widget.item.commentCount.toString()),
+                onPressed: () => viewComments(context),
+              ),
+              TextButton.icon(
+                icon: const Icon(Icons.emoji_emotions),
+                label: Text(reactionCount.toString()),
+                style: TextButton.styleFrom(foregroundColor: Colors.teal),
+                onPressed: () => viewReactions(context),
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+
+  @override
+  void initState() {
+    reactionCount = widget.item.reactionCount;
+    reactionList = widget.item.reactionList ?? <String, dynamic>{};
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return (widget.brief ?? false)
+        ? GestureDetector(
+            child: buildItem(context),
+            onTap: () => router.push(
+              "/post/${widget.item.modelType}/${widget.item.alias}",
+            ),
+          )
+        : buildItem(context);
+  }
+}

lib/widgets/image.dart

@@ -0,0 +1,30 @@
+import 'package:flutter/material.dart';
+
+class ImageLightbox extends StatelessWidget {
+  final String url;
+
+  const ImageLightbox({super.key, required this.url});
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: GestureDetector(
+        child: Center(
+          child: SizedBox(
+            height: MediaQuery.of(context).size.height,
+            width: MediaQuery.of(context).size.width,
+            child: InteractiveViewer(
+              boundaryMargin: const EdgeInsets.all(128),
+              minScale: 0.1,
+              maxScale: 16.0,
+              child: Image.network(url, fit: BoxFit.contain),
+            ),
+          ),
+        ),
+        onTap: () {
+          Navigator.pop(context);
+        },
+      ),
+    );
+  }
+}

lib/widgets/name_card.dart

@@ -1,9 +1,5 @@
-import 'dart:convert';
-
 import 'package:flutter/material.dart';
-import 'package:flutter_secure_storage/flutter_secure_storage.dart';
+import 'package:solaragent/auth.dart';
-
-import '../auth.dart';
 
 class NameCard extends StatelessWidget {
   const NameCard({super.key, this.onLogin, this.onCheck});
@@ -12,8 +8,8 @@ class NameCard extends StatelessWidget {
   final void Function()? onCheck;
 
   Future<CircleAvatar> _getAvatar() async {
-    if (await AuthGuard().isAuthorized()) {
+    if (await authClient.isAuthorized()) {
-      final profiles = await AuthGuard().readProfiles();
+      final profiles = await authClient.getProfiles();
       return CircleAvatar(backgroundImage: NetworkImage(profiles["picture"]));
     } else {
       return const CircleAvatar(child: Icon(Icons.account_circle));
@@ -21,8 +17,8 @@ class NameCard extends StatelessWidget {
   }
 
   Future<Column> _getDescribe() async {
-    if (await AuthGuard().isAuthorized()) {
+    if (await authClient.isAuthorized()) {
-      final profiles = await AuthGuard().readProfiles();
+      final profiles = await authClient.getProfiles();
       return Column(
         crossAxisAlignment: CrossAxisAlignment.start,
         children: [
@@ -59,7 +55,7 @@ class NameCard extends StatelessWidget {
       child: InkWell(
         splashColor: Colors.indigo.withAlpha(30),
         onTap: () async {
-          if (await AuthGuard().isAuthorized() && onCheck != null) {
+          if (await authClient.isAuthorized() && onCheck != null) {
             onCheck!();
           } else if (onLogin != null) {
             onLogin!();

lib/widgets/navigation.dart

@@ -0,0 +1,38 @@
+import 'package:flutter/material.dart';
+import 'package:solaragent/router.dart';
+
+class AgentNavigation extends StatefulWidget {
+  const AgentNavigation({super.key});
+
+  static const List<(String, NavigationDestination)> destinations = [
+    ('/', NavigationDestination(icon: Icon(Icons.explore), label: 'Explore')),
+    ('/notifications', NavigationDestination(icon: Icon(Icons.notifications), label: 'Notifications')),
+    ('/account', NavigationDestination(icon: Icon(Icons.account_circle), label: 'Account')),
+  ];
+
+  @override
+  State<AgentNavigation> createState() => _AgentNavigationState();
+}
+
+class _AgentNavigationState extends State<AgentNavigation> {
+  int currentPage = 0;
+
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return NavigationBar(
+      selectedIndex: currentPage,
+      destinations: AgentNavigation.destinations
+          .map(((String, NavigationDestination) e) => e.$2)
+          .toList(),
+      onDestinationSelected: (index) {
+        router.go(AgentNavigation.destinations[index].$1);
+        setState(() => currentPage = index);
+      },
+    );
+  }
+}

lib/widgets/notification.dart

@@ -0,0 +1,94 @@
+import 'package:flutter/material.dart';
+import 'package:solaragent/models/notification.dart' as model;
+import 'package:solaragent/auth.dart';
+import 'package:url_launcher/url_launcher.dart';
+
+class NotificationItem extends StatelessWidget {
+  final int index;
+  final model.Notification item;
+  final void Function()? onDismiss;
+
+  const NotificationItem(
+      {super.key, required this.index, required this.item, this.onDismiss});
+
+  bool hasLinks() => item.links != null && item.links!.isNotEmpty;
+
+  void showLinks(BuildContext context) {
+    if (!hasLinks()) return;
+
+    showModalBottomSheet<void>(
+      context: context,
+      builder: (BuildContext context) {
+        return ListView.builder(
+            padding: const EdgeInsets.all(8),
+            itemCount: item.links!.length,
+            itemBuilder: (BuildContext context, int index) {
+              var element = item.links![index];
+              return InkWell(
+                borderRadius: const BorderRadius.all(
+                  Radius.circular(64),
+                ),
+                onTap: () async {
+                  await launchUrl(Uri.parse(element.url));
+                },
+                child: ListTile(title: Text(element.label)),
+              );
+            });
+      },
+    );
+  }
+
+  Future<void> markAsRead(model.Notification element) async {
+    if (authClient.client != null) {
+      var id = element.id;
+      var uri = Uri.parse('https://id.solsynth.dev/api/notifications/$id/read');
+      await authClient.client!.put(uri);
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Dismissible(
+      key: Key('notification-$index'),
+      onDismissed: (direction) {
+        markAsRead(item).then((value) {
+          ScaffoldMessenger.of(context).showSnackBar(
+            SnackBar(
+              content: RichText(
+                text: TextSpan(children: [
+                  TextSpan(
+                    text: item.subject,
+                    style: const TextStyle(fontWeight: FontWeight.bold),
+                  ),
+                  const TextSpan(
+                    text: " is marked as read",
+                  )
+                ]),
+              ),
+            ),
+          );
+        });
+        if (onDismiss != null) {
+          onDismiss!();
+        }
+      },
+      background: Container(
+        color: Colors.grey,
+      ),
+      child: Container(
+        padding: const EdgeInsets.only(left: 10),
+        child: ListTile(
+          title: Text(item.subject),
+          subtitle: Text(item.content),
+          trailing: hasLinks()
+              ? TextButton(
+                  onPressed: () => showLinks(context),
+                  style: TextButton.styleFrom(shape: const CircleBorder()),
+                  child: const Icon(Icons.more_vert),
+                )
+              : null,
+        ),
+      ),
+    );
+  }
+}

lib/widgets/posts/comments.dart

@@ -0,0 +1,130 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:http/http.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:solaragent/models/pagination.dart';
+import 'package:solaragent/router.dart';
+import 'package:solaragent/widgets/feed.dart';
+
+class CommentList extends StatefulWidget {
+  final Feed parent;
+
+  const CommentList({super.key, required this.parent});
+
+  @override
+  State<CommentList> createState() => _CommentListState();
+}
+
+class _CommentListState extends State<CommentList> {
+  static const pageSize = 5;
+
+  final client = Client();
+
+  final PagingController<int, Feed> paginationController =
+      PagingController(firstPageKey: 0);
+
+  List<Feed> feed = List.empty();
+
+  @override
+  void initState() {
+    super.initState();
+    paginationController.addPageRequestListener((pageKey) {
+      pullFeed(pageKey);
+    });
+  }
+
+  Future<void> pullFeed(int pageKey) async {
+    var offset = pageKey;
+    var take = pageSize;
+
+    var dataset = "${widget.parent.modelType}s";
+    var alias = widget.parent.alias;
+
+    var uri = Uri.parse(
+      'https://co.solsynth.dev/api/p/$dataset/$alias/comments?take=$take&offset=$offset',
+    );
+
+    var res = await client.get(uri);
+    if (res.statusCode == 200) {
+      final result =
+          PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+      final isLastPage = (result.count - pageKey) < pageSize;
+      final items =
+          result.data?.map((x) => Feed.fromJson(x)).toList() ?? List.empty();
+      if (isLastPage || result.data == null) {
+        paginationController.appendLastPage(items);
+      } else {
+        final nextPageKey = pageKey + items.length;
+        paginationController.appendPage(items, nextPageKey);
+      }
+    } else {
+      paginationController.error = utf8.decode(res.bodyBytes);
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        Container(
+          padding: const EdgeInsets.only(left: 10, right: 10, top: 20),
+          child: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Padding(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 8.0,
+                  vertical: 12.0,
+                ),
+                child: Text(
+                  'Comments',
+                  style: Theme.of(context).textTheme.headlineSmall,
+                ),
+              ),
+              FutureBuilder(
+                future: authClient.isAuthorized(),
+                builder: (context, snapshot) {
+                  if (snapshot.hasData && snapshot.data == true) {
+                    return TextButton.icon(
+                      icon: const Icon(Icons.edit),
+                      label: const Text("LEAVE COMMENT"),
+                      onPressed: () {
+                        router
+                            .push("/post/new/comments", extra: widget.parent)
+                            .then((value) {
+                          if (value == true) paginationController.refresh();
+                        });
+                      },
+                    );
+                  } else {
+                    return Container();
+                  }
+                },
+              ),
+            ],
+          ),
+        ),
+        Expanded(
+          child: PagedListView<int, Feed>(
+            pagingController: paginationController,
+            builderDelegate: PagedChildBuilderDelegate<Feed>(
+              itemBuilder: (context, item, index) => FeedItem(
+                item: item,
+                brief: true,
+              ),
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+
+  @override
+  void dispose() {
+    paginationController.dispose();
+    super.dispose();
+  }
+}

lib/widgets/posts/content/article.dart

@@ -0,0 +1,47 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:solaragent/models/feed.dart';
+import 'package:markdown/markdown.dart' as md;
+import 'package:url_launcher/url_launcher.dart';
+import 'package:url_launcher/url_launcher_string.dart';
+
+class ArticleContent extends StatelessWidget {
+  final Feed item;
+  final bool brief;
+
+  const ArticleContent({super.key, required this.item, required this.brief});
+
+  @override
+  Widget build(BuildContext context) {
+    return brief
+        ? ListTile(
+            title: Text(item.title),
+            subtitle: Text(item.description),
+          )
+        : Column(
+            children: [
+              ListTile(
+                title: Text(item.title),
+                subtitle: Text(item.description),
+              ),
+              const Divider(color: Color(0xffefefef)),
+              Markdown(
+                  selectable: !brief,
+                  data: item.content,
+                  shrinkWrap: true,
+                  physics: const NeverScrollableScrollPhysics(),
+                  extensionSet: md.ExtensionSet(
+                    md.ExtensionSet.gitHubFlavored.blockSyntaxes,
+                    md.ExtensionSet.gitHubFlavored.inlineSyntaxes,
+                  ),
+                  onTapLink: (text, href, title) async {
+                    if (href == null) return;
+                    await launchUrlString(
+                      href,
+                      mode: LaunchMode.externalApplication,
+                    );
+                  }),
+            ],
+          );
+  }
+}

lib/widgets/posts/content/moment.dart

@@ -0,0 +1,20 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:solaragent/models/feed.dart';
+
+class MomentContent extends StatelessWidget {
+  final Feed item;
+  final bool brief;
+
+  const MomentContent({super.key, required this.brief, required this.item});
+
+  @override
+  Widget build(BuildContext context) {
+    return Markdown(
+      selectable: !brief,
+      data: item.content,
+      shrinkWrap: true,
+      physics: const NeverScrollableScrollPhysics(),
+    );
+  }
+}

lib/widgets/posts/reactions.dart

@@ -0,0 +1,175 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:solaragent/auth.dart';
+import 'package:solaragent/models/feed.dart';
+
+class ReactionList extends StatefulWidget {
+  static const Map<String, Map<String, dynamic>> emojis = {
+    'thumb_up': {'icon': '👍', 'attitude': 1},
+    'clap': {'icon': '👏', 'attitude': 1}
+  };
+
+  final Feed parent;
+  final void Function(String symbol, int num) onReact;
+
+  const ReactionList({super.key, required this.parent, required this.onReact});
+
+  @override
+  State<ReactionList> createState() => _ReactionListState();
+}
+
+class _ReactionListState extends State<ReactionList> {
+  bool isSubmitting = false;
+
+  void viewReactMenu(BuildContext context) {
+    showModalBottomSheet(
+      context: context,
+      builder: (context) {
+        return ListView.builder(
+            padding: const EdgeInsets.all(8),
+            itemCount: ReactionList.emojis.length,
+            itemBuilder: (BuildContext context, int index) {
+              var element = ReactionList.emojis.entries.toList()[index];
+              return InkWell(
+                borderRadius: const BorderRadius.all(
+                  Radius.circular(64),
+                ),
+                onTap: () async {
+                  await doReact(element.key, element.value['attitude']);
+                },
+                child: ListTile(
+                  title: Text(element.value['icon']),
+                  subtitle: Text(
+                    ":${element.key}:",
+                    style: const TextStyle(fontFamily: "monospace"),
+                  ),
+                ),
+              );
+            });
+      },
+    );
+  }
+
+  Future<void> doReact(String symbol, int attitude) async {
+    if (!await authClient.isAuthorized()) return;
+
+    var dataset = "${widget.parent.modelType}s";
+    var alias = widget.parent.id;
+
+    var uri = Uri.parse(
+      "https://co.solsynth.dev/api/p/$dataset/$alias/react",
+    );
+
+    setState(() => isSubmitting = true);
+    var res = await authClient.client!.post(
+      uri,
+      headers: <String, String>{
+        'Content-Type': 'application/json',
+      },
+      body: jsonEncode(<String, dynamic>{
+        'symbol': symbol,
+        'attitude': attitude,
+      }),
+    );
+    if (res.statusCode == 201) {
+      widget.onReact(symbol, 1);
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(
+          content: Text("Your reaction has been added onto this post."),
+        ),
+      );
+    } else if (res.statusCode == 204) {
+      widget.onReact(symbol, -1);
+      ScaffoldMessenger.of(context).showSnackBar(
+        const SnackBar(
+          content: Text("Your reaction has been removed from this post."),
+        ),
+      );
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      ScaffoldMessenger.of(context).showSnackBar(
+        SnackBar(content: Text("Something went wrong... $message")),
+      );
+    }
+    setState(() => isSubmitting = false);
+  }
+
+  List<MapEntry<String, dynamic>> getReactionEntries() =>
+      widget.parent.reactionList?.entries.toList() ?? List.empty();
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        // Title
+        Container(
+          padding: const EdgeInsets.only(left: 10, right: 10, top: 20),
+          child: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Padding(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 8.0,
+                  vertical: 12.0,
+                ),
+                child: Text(
+                  'Reactions',
+                  style: Theme.of(context).textTheme.headlineSmall,
+                ),
+              ),
+              FutureBuilder(
+                future: authClient.isAuthorized(),
+                builder: (context, snapshot) {
+                  if (snapshot.hasData && snapshot.data == true) {
+                    return TextButton.icon(
+                      icon: const Icon(Icons.add_reaction),
+                      label: const Text("REACT"),
+                      onPressed:
+                          isSubmitting ? null : () => viewReactMenu(context),
+                    );
+                  } else {
+                    return Container();
+                  }
+                },
+              ),
+            ],
+          ),
+        ),
+        // Loading indicator
+        isSubmitting ? const LinearProgressIndicator() : Container(),
+        // Data list
+        Expanded(
+          child: ListView.separated(
+            itemCount: getReactionEntries().length,
+            itemBuilder: (BuildContext context, int index) {
+              var element = getReactionEntries()[index];
+              return InkWell(
+                  onTap: isSubmitting
+                      ? null
+                      : () {
+                          doReact(
+                            element.key,
+                            ReactionList.emojis[element.key]!['attitude'],
+                          );
+                        },
+                  child: Container(
+                    padding: const EdgeInsets.symmetric(horizontal: 6.0),
+                    child: ListTile(
+                      title: Text(
+                        "${ReactionList.emojis[element.key]!['icon']} x${element.value.toString()}",
+                      ),
+                      subtitle: Text(
+                        ":${element.key}:",
+                        style: const TextStyle(fontFamily: "monospace"),
+                      ),
+                    ),
+                  ));
+            },
+            separatorBuilder: (context, index) => const Divider(),
+          ),
+        ),
+      ],
+    );
+  }
+}

linux/CMakeLists.txt

@@ -4,10 +4,10 @@ project(runner LANGUAGES CXX)
 
 # The name of the executable created for the application. Change this to change
 # the on-disk name of your application.
-set(BINARY_NAME "goatagent")
+set(BINARY_NAME "solaragent")
 # The unique GTK application identifier for this application. See:
 # https://wiki.gnome.org/HowDoI/ChooseApplicationID
-set(APPLICATION_ID "studio.smartsheep.goatagent")
+set(APPLICATION_ID "dev.solsynth.solaragent")
 
 # Explicitly opt in to modern CMake behaviors to avoid warnings with recent
 # versions of CMake.

linux/flutter/generated_plugin_registrant.cc

@@ -6,13 +6,21 @@
 
 #include "generated_plugin_registrant.h"
 
+#include <file_selector_linux/file_selector_plugin.h>
 #include <flutter_secure_storage_linux/flutter_secure_storage_linux_plugin.h>
+#include <sentry_flutter/sentry_flutter_plugin.h>
 #include <url_launcher_linux/url_launcher_plugin.h>
 
 void fl_register_plugins(FlPluginRegistry* registry) {
+  g_autoptr(FlPluginRegistrar) file_selector_linux_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "FileSelectorPlugin");
+  file_selector_plugin_register_with_registrar(file_selector_linux_registrar);
   g_autoptr(FlPluginRegistrar) flutter_secure_storage_linux_registrar =
       fl_plugin_registry_get_registrar_for_plugin(registry, "FlutterSecureStorageLinuxPlugin");
   flutter_secure_storage_linux_plugin_register_with_registrar(flutter_secure_storage_linux_registrar);
+  g_autoptr(FlPluginRegistrar) sentry_flutter_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "SentryFlutterPlugin");
+  sentry_flutter_plugin_register_with_registrar(sentry_flutter_registrar);
   g_autoptr(FlPluginRegistrar) url_launcher_linux_registrar =
       fl_plugin_registry_get_registrar_for_plugin(registry, "UrlLauncherPlugin");
   url_launcher_plugin_register_with_registrar(url_launcher_linux_registrar);

linux/flutter/generated_plugins.cmake

@@ -3,7 +3,9 @@
 #
 
 list(APPEND FLUTTER_PLUGIN_LIST
+  file_selector_linux
   flutter_secure_storage_linux
+  sentry_flutter
   url_launcher_linux
 )
 

linux/my_application.cc

@@ -40,11 +40,11 @@ static void my_application_activate(GApplication* application) {
   if (use_header_bar) {
     GtkHeaderBar* header_bar = GTK_HEADER_BAR(gtk_header_bar_new());
     gtk_widget_show(GTK_WIDGET(header_bar));
-    gtk_header_bar_set_title(header_bar, "goatagent");
+    gtk_header_bar_set_title(header_bar, "solaragent");
     gtk_header_bar_set_show_close_button(header_bar, TRUE);
     gtk_window_set_titlebar(window, GTK_WIDGET(header_bar));
   } else {
-    gtk_window_set_title(window, "goatagent");
+    gtk_window_set_title(window, "solaragent");
   }
 
   gtk_window_set_default_size(window, 1280, 720);

macos/Flutter/GeneratedPluginRegistrant.swift

@@ -5,22 +5,20 @@
 import FlutterMacOS
 import Foundation
 
-import firebase_core
+import file_selector_macos
-import firebase_crashlytics
-import firebase_messaging
-import flutter_appauth
 import flutter_secure_storage_macos
 import package_info_plus
 import path_provider_foundation
+import sentry_flutter
+import shared_preferences_foundation
 import url_launcher_macos
 
 func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
-  FLTFirebaseCorePlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseCorePlugin"))
+  FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
-  FLTFirebaseCrashlyticsPlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseCrashlyticsPlugin"))
-  FLTFirebaseMessagingPlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseMessagingPlugin"))
-  FlutterAppauthPlugin.register(with: registry.registrar(forPlugin: "FlutterAppauthPlugin"))
   FlutterSecureStoragePlugin.register(with: registry.registrar(forPlugin: "FlutterSecureStoragePlugin"))
   FPPPackageInfoPlusPlugin.register(with: registry.registrar(forPlugin: "FPPPackageInfoPlusPlugin"))
   PathProviderPlugin.register(with: registry.registrar(forPlugin: "PathProviderPlugin"))
+  SentryFlutterPlugin.register(with: registry.registrar(forPlugin: "SentryFlutterPlugin"))
+  SharedPreferencesPlugin.register(with: registry.registrar(forPlugin: "SharedPreferencesPlugin"))
   UrlLauncherPlugin.register(with: registry.registrar(forPlugin: "UrlLauncherPlugin"))
 }

macos/Runner.xcodeproj/project.pbxproj

@@ -65,7 +65,7 @@
 		331C80D7294CF71000263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = "<group>"; };
 		333000ED22D3DE5D00554162 /* Warnings.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Warnings.xcconfig; sourceTree = "<group>"; };
 		335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = GeneratedPluginRegistrant.swift; sourceTree = "<group>"; };
-		33CC10ED2044A3C60003C045 /* goatagent.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = goatagent.app; sourceTree = BUILT_PRODUCTS_DIR; };
+		33CC10ED2044A3C60003C045 /* solaragent.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = solaragent.app; sourceTree = BUILT_PRODUCTS_DIR; };
 		33CC10F02044A3C60003C045 /* AppDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = "<group>"; };
 		33CC10F22044A3C60003C045 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Assets.xcassets; path = Runner/Assets.xcassets; sourceTree = "<group>"; };
 		33CC10F52044A3C60003C045 /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.xib; name = Base; path = Base.lproj/MainMenu.xib; sourceTree = "<group>"; };
@@ -134,7 +134,7 @@
 		33CC10EE2044A3C60003C045 /* Products */ = {
 			isa = PBXGroup;
 			children = (
-				33CC10ED2044A3C60003C045 /* goatagent.app */,
+				33CC10ED2044A3C60003C045 /* solaragent.app */,
 				331C80D5294CF71000263BE5 /* RunnerTests.xctest */,
 			);
 			name = Products;
@@ -220,7 +220,7 @@
 			);
 			name = Runner;
 			productName = Runner;
-			productReference = 33CC10ED2044A3C60003C045 /* goatagent.app */;
+			productReference = 33CC10ED2044A3C60003C045 /* solaragent.app */;
 			productType = "com.apple.product-type.application";
 		};
 /* End PBXNativeTarget section */
@@ -388,10 +388,10 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_VERSION = 5.0;
-				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/goatagent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/goatagent";
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/solaragent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/solaragent";
 			};
 			name = Debug;
 		};
@@ -402,10 +402,10 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_VERSION = 5.0;
-				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/goatagent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/goatagent";
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/solaragent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/solaragent";
 			};
 			name = Release;
 		};
@@ -416,10 +416,10 @@
 				CURRENT_PROJECT_VERSION = 1;
 				GENERATE_INFOPLIST_FILE = YES;
 				MARKETING_VERSION = 1.0;
-				PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent.RunnerTests;
+				PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent.RunnerTests;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_VERSION = 5.0;
-				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/goatagent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/goatagent";
+				TEST_HOST = "$(BUILT_PRODUCTS_DIR)/solaragent.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/solaragent";
 			};
 			name = Profile;
 		};

macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme

@@ -15,7 +15,7 @@
             <BuildableReference
                BuildableIdentifier = "primary"
                BlueprintIdentifier = "33CC10EC2044A3C60003C045"
-               BuildableName = "goatagent.app"
+               BuildableName = "solaragent.app"
                BlueprintName = "Runner"
                ReferencedContainer = "container:Runner.xcodeproj">
             </BuildableReference>
@@ -31,7 +31,7 @@
          <BuildableReference
             BuildableIdentifier = "primary"
             BlueprintIdentifier = "33CC10EC2044A3C60003C045"
-            BuildableName = "goatagent.app"
+            BuildableName = "solaragent.app"
             BlueprintName = "Runner"
             ReferencedContainer = "container:Runner.xcodeproj">
          </BuildableReference>
@@ -65,7 +65,7 @@
          <BuildableReference
             BuildableIdentifier = "primary"
             BlueprintIdentifier = "33CC10EC2044A3C60003C045"
-            BuildableName = "goatagent.app"
+            BuildableName = "solaragent.app"
             BlueprintName = "Runner"
             ReferencedContainer = "container:Runner.xcodeproj">
          </BuildableReference>
@@ -82,7 +82,7 @@
          <BuildableReference
             BuildableIdentifier = "primary"
             BlueprintIdentifier = "33CC10EC2044A3C60003C045"
-            BuildableName = "goatagent.app"
+            BuildableName = "solaragent.app"
             BlueprintName = "Runner"
             ReferencedContainer = "container:Runner.xcodeproj">
          </BuildableReference>

macos/Runner/Configs/AppInfo.xcconfig

@@ -5,10 +5,10 @@
 // 'flutter create' template.
 
 // The application's name. By default this is also the title of the Flutter window.
-PRODUCT_NAME = goatagent
+PRODUCT_NAME = solaragent
 
 // The application's bundle identifier
-PRODUCT_BUNDLE_IDENTIFIER = studio.smartsheep.goatagent
+PRODUCT_BUNDLE_IDENTIFIER = dev.solsynth.solaragent
 
 // The copyright displayed in application information
-PRODUCT_COPYRIGHT = Copyright © 2024 studio.smartsheep. All rights reserved.
+PRODUCT_COPYRIGHT = Copyright © 2024 dev.solsynth. All rights reserved.

macos/Runner/GoogleService-Info.plist

@@ -9,7 +9,7 @@
 	<key>PLIST_VERSION</key>
 	<string>1</string>
 	<key>BUNDLE_ID</key>
-	<string>studio.smartsheep.goatagent.RunnerTests</string>
+	<string>dev.solsynth.solaragent.RunnerTests</string>
 	<key>PROJECT_ID</key>
 	<string>smartsheep-hydrogen</string>
 	<key>STORAGE_BUCKET</key>

pubspec.lock

@@ -1,14 +1,6 @@
 # Generated by pub
 # See https://dart.dev/tools/pub/glossary#lockfile
 packages:
-  _flutterfire_internals:
-    dependency: transitive
-    description:
-      name: _flutterfire_internals
-      sha256: "1a52f1afae8ab7ac4741425114713bdbba802f1ce1e0648e167ffcc6e05e96cf"
-      url: "https://pub.dev"
-    source: hosted
-    version: "1.3.21"
   archive:
     dependency: transitive
     description:
@@ -89,8 +81,16 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.1.1"
-  crypto:
+  cross_file:
     dependency: transitive
+    description:
+      name: cross_file
+      sha256: fedaadfa3a6996f75211d835aaeb8fede285dae94262485698afd832371b9a5e
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.3.3+8"
+  crypto:
+    dependency: "direct main"
     description:
       name: crypto
       sha256: ff625774173754681d66daaf4a448684fb04b78f902da9cb3d308c19cc5e8bab
@@ -117,95 +117,79 @@ packages:
     dependency: transitive
     description:
       name: ffi
-      sha256: "7bf0adc28a23d395f19f3f1eb21dd7cfd1dd9f8e1c50051c069122e6853bc878"
+      sha256: "493f37e7df1804778ff3a53bd691d8692ddf69702cf4c1c1096a2e41b4779e21"
       url: "https://pub.dev"
     source: hosted
-    version: "2.1.0"
+    version: "2.1.2"
-  firebase_core:
+  file:
+    dependency: transitive
+    description:
+      name: file
+      sha256: "5fc22d7c25582e38ad9a8515372cd9a93834027aacf1801cf01164dac0ffa08c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.0.0"
+  file_picker:
     dependency: "direct main"
     description:
-      name: firebase_core
+      name: file_picker
-      sha256: "7e049e32a9d347616edb39542cf92cd53fdb4a99fb6af0a0bff327c14cd76445"
+      sha256: d1d0ac3966b36dc3e66eeefb40280c17feb87fa2099c6e22e6a1fc959327bd03
       url: "https://pub.dev"
     source: hosted
-    version: "2.25.4"
+    version: "8.0.0+1"
-  firebase_core_platform_interface:
+  file_selector_linux:
     dependency: transitive
     description:
-      name: firebase_core_platform_interface
+      name: file_selector_linux
-      sha256: c437ae5d17e6b5cc7981cf6fd458a5db4d12979905f9aafd1fea930428a9fe63
+      sha256: "045d372bf19b02aeb69cacf8b4009555fb5f6f0b7ad8016e5f46dd1387ddd492"
       url: "https://pub.dev"
     source: hosted
-    version: "5.0.0"
+    version: "0.9.2+1"
-  firebase_core_web:
+  file_selector_macos:
     dependency: transitive
     description:
-      name: firebase_core_web
+      name: file_selector_macos
-      sha256: "57e61d6010e253b36d38191cefd6199d7849152cdcd234b61ca290cdb278a0ba"
+      sha256: b15c3da8bd4908b9918111fa486903f5808e388b8d1c559949f584725a6594d6
       url: "https://pub.dev"
     source: hosted
-    version: "2.11.4"
+    version: "0.9.3+3"
-  firebase_crashlytics:
+  file_selector_platform_interface:
-    dependency: "direct main"
-    description:
-      name: firebase_crashlytics
-      sha256: efd096e4c3d2c568e128505b6e4ce5f5d5a1629f700a4d6fee6bd25b85937dde
-      url: "https://pub.dev"
-    source: hosted
-    version: "3.4.14"
-  firebase_crashlytics_platform_interface:
     dependency: transitive
     description:
-      name: firebase_crashlytics_platform_interface
+      name: file_selector_platform_interface
-      sha256: "225a54d834a118be262c1f1096d407515e35b99d9b474c987abdcff7663f2b81"
+      sha256: a3994c26f10378a039faa11de174d7b78eb8f79e4dd0af2a451410c1a5c3f66b
       url: "https://pub.dev"
     source: hosted
-    version: "3.6.21"
+    version: "2.6.2"
-  firebase_messaging:
+  file_selector_windows:
-    dependency: "direct main"
-    description:
-      name: firebase_messaging
-      sha256: "9c97b20c012542252a8853f11334efd833ddae83551fe37d27f87d885c655038"
-      url: "https://pub.dev"
-    source: hosted
-    version: "14.7.15"
-  firebase_messaging_platform_interface:
     dependency: transitive
     description:
-      name: firebase_messaging_platform_interface
+      name: file_selector_windows
-      sha256: d464b255e922c7915dc4b0ebc305ebad4e1f130519bee3d6e568ef2ea1613a4b
+      sha256: d3547240c20cabf205c7c7f01a50ecdbc413755814d6677f3cb366f04abcead0
       url: "https://pub.dev"
     source: hosted
-    version: "4.5.23"
+    version: "0.9.3+1"
-  firebase_messaging_web:
+  fixnum:
     dependency: transitive
     description:
-      name: firebase_messaging_web
+      name: fixnum
-      sha256: f3f71aeec719ec1fe2c99f75cd74d00d33f1c240cf1e402cc9d43883e84f935a
+      sha256: "25517a4deb0c03aa0f32fd12db525856438902d9c16536311e76cdc57b31d7d1"
       url: "https://pub.dev"
     source: hosted
-    version: "3.6.4"
+    version: "1.1.0"
   flutter:
     dependency: "direct main"
     description: flutter
     source: sdk
     version: "0.0.0"
-  flutter_appauth:
+  flutter_carousel_widget:
     dependency: "direct main"
     description:
-      name: flutter_appauth
+      name: flutter_carousel_widget
-      sha256: "4ad7d446888b1486642226db6aa04ffb4651d76388715aba6e6e572ebeb915c3"
+      sha256: "37b9e55e4cafffe358152b016db24153e756152aa07c4214cfe6ee902cd69a01"
       url: "https://pub.dev"
     source: hosted
-    version: "6.0.4"
+    version: "2.2.0"
-  flutter_appauth_platform_interface:
-    dependency: transitive
-    description:
-      name: flutter_appauth_platform_interface
-      sha256: "44feaa7058191b5d3cd7c9ff195262725773643121bcada172d49c2ddcff71cb"
-      url: "https://pub.dev"
-    source: hosted
-    version: "6.0.0"
   flutter_launcher_icons:
     dependency: "direct dev"
     description:
@@ -222,6 +206,22 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.0.3"
+  flutter_markdown:
+    dependency: "direct main"
+    description:
+      name: flutter_markdown
+      sha256: "87e11b9df25a42e2db315b8b7a51fae8e66f57a4b2f50ec4b822d0fa155e6b52"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.6.22"
+  flutter_plugin_android_lifecycle:
+    dependency: transitive
+    description:
+      name: flutter_plugin_android_lifecycle
+      sha256: b068ffc46f82a55844acfa4fdbb61fad72fa2aef0905548419d97f0f95c456da
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.17"
   flutter_secure_storage:
     dependency: "direct main"
     description:
@@ -270,6 +270,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.0.0"
+  flutter_staggered_grid_view:
+    dependency: transitive
+    description:
+      name: flutter_staggered_grid_view
+      sha256: "19e7abb550c96fbfeb546b23f3ff356ee7c59a019a651f8f102a4ba9b7349395"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.7.0"
   flutter_test:
     dependency: "direct dev"
     description: flutter
@@ -284,10 +292,10 @@ packages:
     dependency: "direct main"
     description:
       name: go_router
-      sha256: "07ee2436909f749d606f53521dc1725dd738dc5196e5ff815bc254253c594075"
+      sha256: "7ecb2f391edbca5473db591b48555a8912dde60edd0fb3013bd6743033b2d3f8"
       url: "https://pub.dev"
     source: hosted
-    version: "13.1.0"
+    version: "13.2.1"
   http:
     dependency: "direct main"
     description:
@@ -308,10 +316,82 @@ packages:
     dependency: transitive
     description:
       name: image
-      sha256: "49a0d4b0c12402853d3f227fe7c315601b238d126aa4caa5dbb2dcf99421aa4a"
+      sha256: "4c68bfd5ae83e700b5204c1e74451e7bf3cf750e6843c6e158289cf56bda018e"
       url: "https://pub.dev"
     source: hosted
-    version: "4.1.6"
+    version: "4.1.7"
+  image_picker:
+    dependency: "direct main"
+    description:
+      name: image_picker
+      sha256: "26222b01a0c9a2c8fe02fc90b8208bd3325da5ed1f4a2acabf75939031ac0bdd"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.7"
+  image_picker_android:
+    dependency: transitive
+    description:
+      name: image_picker_android
+      sha256: "39f2bfe497e495450c81abcd44b62f56c2a36a37a175da7d137b4454977b51b1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.8.9+3"
+  image_picker_for_web:
+    dependency: transitive
+    description:
+      name: image_picker_for_web
+      sha256: e2423c53a68b579a7c37a1eda967b8ae536c3d98518e5db95ca1fe5719a730a3
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.2"
+  image_picker_ios:
+    dependency: transitive
+    description:
+      name: image_picker_ios
+      sha256: "917a5cadd67d052554cfb258595e54217de53fac5b52939426e26319a02e6297"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.8.9+2"
+  image_picker_linux:
+    dependency: transitive
+    description:
+      name: image_picker_linux
+      sha256: "4ed1d9bb36f7cd60aa6e6cd479779cc56a4cb4e4de8f49d487b1aaad831300fa"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+1"
+  image_picker_macos:
+    dependency: transitive
+    description:
+      name: image_picker_macos
+      sha256: "3f5ad1e8112a9a6111c46d0b57a7be2286a9a07fc6e1976fdf5be2bd31d4ff62"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+1"
+  image_picker_platform_interface:
+    dependency: transitive
+    description:
+      name: image_picker_platform_interface
+      sha256: "3d2c323daea9d60608f1caf30be32a938916f4975434b8352e6f73dae496da38"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.9.4"
+  image_picker_windows:
+    dependency: transitive
+    description:
+      name: image_picker_windows
+      sha256: "6ad07afc4eb1bc25f3a01084d28520496c4a3bb0cb13685435838167c9dcedeb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1+1"
+  infinite_scroll_pagination:
+    dependency: "direct main"
+    description:
+      name: infinite_scroll_pagination
+      sha256: b68bce20752fcf36c7739e60de4175494f74e99e9a69b4dd2fe3a1dd07a7f16a
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.0"
   js:
     dependency: transitive
     description:
@@ -328,6 +408,30 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "4.8.1"
+  leak_tracker:
+    dependency: transitive
+    description:
+      name: leak_tracker
+      sha256: "7f0df31977cb2c0b88585095d168e689669a2cc9b97c309665e3386f3e9d341a"
+      url: "https://pub.dev"
+    source: hosted
+    version: "10.0.4"
+  leak_tracker_flutter_testing:
+    dependency: transitive
+    description:
+      name: leak_tracker_flutter_testing
+      sha256: b46c5e37c19120a8a01918cfaf293547f47269f7cb4b0058f21531c2465d6ef0
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.1"
+  leak_tracker_testing:
+    dependency: transitive
+    description:
+      name: leak_tracker_testing
+      sha256: d4c8f568c60af6b6daa74c80fc04411765769882600f6bf9cd4b391c96de42ce
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.3"
   lints:
     dependency: transitive
     description:
@@ -344,30 +448,46 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "1.2.0"
+  markdown:
+    dependency: "direct main"
+    description:
+      name: markdown
+      sha256: ef2a1298144e3f985cc736b22e0ccdaf188b5b3970648f2d9dc13efd1d9df051
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.2.2"
   matcher:
     dependency: transitive
     description:
       name: matcher
-      sha256: "1803e76e6653768d64ed8ff2e1e67bea3ad4b923eb5c56a295c3e634bad5960e"
+      sha256: d2323aa2060500f906aa31a895b4030b6da3ebdcc5619d14ce1aada65cd161cb
       url: "https://pub.dev"
     source: hosted
-    version: "0.12.16"
+    version: "0.12.16+1"
   material_color_utilities:
     dependency: transitive
     description:
       name: material_color_utilities
-      sha256: "9528f2f296073ff54cb9fee677df673ace1218163c3bc7628093e7eed5203d41"
+      sha256: "0e0a020085b65b6083975e499759762399b4475f766c21668c4ecca34ea74e5a"
       url: "https://pub.dev"
     source: hosted
-    version: "0.5.0"
+    version: "0.8.0"
   meta:
     dependency: transitive
     description:
       name: meta
-      sha256: a6e590c838b18133bb482a2745ad77c5bb7715fb0451209e1a7567d416678b8e
+      sha256: "7687075e408b093f36e6bbf6c91878cc0d4cd10f409506f7bc996f68220b9136"
       url: "https://pub.dev"
     source: hosted
-    version: "1.10.0"
+    version: "1.12.0"
+  mime:
+    dependency: transitive
+    description:
+      name: mime
+      sha256: "2e123074287cc9fd6c09de8336dae606d1ddb88d9ac47358826db698c176a1f2"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.0.5"
   oauth2:
     dependency: "direct main"
     description:
@@ -396,10 +516,10 @@ packages:
     dependency: transitive
     description:
       name: path
-      sha256: "8829d8a55c13fc0e37127c29fedf290c102f4e40ae94ada574091fe0ff96c917"
+      sha256: "087ce49c3f0dc39180befefc60fdb4acd8f8620e5682fe2476afd0b3688bb4af"
       url: "https://pub.dev"
     source: hosted
-    version: "1.8.3"
+    version: "1.9.0"
   path_provider:
     dependency: transitive
     description:
@@ -480,11 +600,91 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.7.4"
+  sentry:
+    dependency: transitive
+    description:
+      name: sentry
+      sha256: a460aa48568d47140dd0557410b624d344ffb8c05555107ac65035c1097cf1ad
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.18.0"
+  sentry_flutter:
+    dependency: "direct main"
+    description:
+      name: sentry_flutter
+      sha256: "3d0d1d4e0e407d276ae8128d123263ccbc37e988bae906765efd6f37d544f4c6"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.18.0"
+  shared_preferences:
+    dependency: "direct main"
+    description:
+      name: shared_preferences
+      sha256: "81429e4481e1ccfb51ede496e916348668fd0921627779233bd24cc3ff6abd02"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.2"
+  shared_preferences_android:
+    dependency: transitive
+    description:
+      name: shared_preferences_android
+      sha256: "8568a389334b6e83415b6aae55378e158fbc2314e074983362d20c562780fb06"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.1"
+  shared_preferences_foundation:
+    dependency: transitive
+    description:
+      name: shared_preferences_foundation
+      sha256: "7708d83064f38060c7b39db12aefe449cb8cdc031d6062280087bc4cdb988f5c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.5"
+  shared_preferences_linux:
+    dependency: transitive
+    description:
+      name: shared_preferences_linux
+      sha256: "9f2cbcf46d4270ea8be39fa156d86379077c8a5228d9dfdb1164ae0bb93f1faa"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.2"
+  shared_preferences_platform_interface:
+    dependency: transitive
+    description:
+      name: shared_preferences_platform_interface
+      sha256: "22e2ecac9419b4246d7c22bfbbda589e3acf5c0351137d87dd2939d984d37c3b"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.2"
+  shared_preferences_web:
+    dependency: transitive
+    description:
+      name: shared_preferences_web
+      sha256: "7b15ffb9387ea3e237bb7a66b8a23d2147663d391cafc5c8f37b2e7b4bde5d21"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.2.2"
+  shared_preferences_windows:
+    dependency: transitive
+    description:
+      name: shared_preferences_windows
+      sha256: "841ad54f3c8381c480d0c9b508b89a34036f512482c407e6df7a9c4aa2ef8f59"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.2"
   sky_engine:
     dependency: transitive
     description: flutter
     source: sdk
     version: "0.0.99"
+  sliver_tools:
+    dependency: transitive
+    description:
+      name: sliver_tools
+      sha256: eae28220badfb9d0559207badcbbc9ad5331aac829a88cb0964d330d2a4636a6
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.12"
   source_span:
     dependency: transitive
     description:
@@ -493,6 +693,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "1.10.0"
+  sprintf:
+    dependency: transitive
+    description:
+      name: sprintf
+      sha256: "1fc9ffe69d4df602376b52949af107d8f5703b77cda567c4d7d86a0693120f23"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.0.0"
   stack_trace:
     dependency: transitive
     description:
@@ -545,26 +753,26 @@ packages:
     dependency: "direct main"
     description:
       name: url_launcher
-      sha256: c512655380d241a337521703af62d2c122bf7b77a46ff7dd750092aa9433499c
+      sha256: "0ecc004c62fd3ed36a2ffcbe0dd9700aee63bd7532d0b642a488b1ec310f492e"
       url: "https://pub.dev"
     source: hosted
-    version: "6.2.4"
+    version: "6.2.5"
   url_launcher_android:
     dependency: transitive
     description:
       name: url_launcher_android
-      sha256: "507dc655b1d9cb5ebc756032eb785f114e415f91557b73bf60b7e201dfedeb2f"
+      sha256: d4ed0711849dd8e33eb2dd69c25db0d0d3fdc37e0a62e629fe32f57a22db2745
       url: "https://pub.dev"
     source: hosted
-    version: "6.2.2"
+    version: "6.3.0"
   url_launcher_ios:
     dependency: transitive
     description:
       name: url_launcher_ios
-      sha256: "75bb6fe3f60070407704282a2d295630cab232991eb52542b18347a8a941df03"
+      sha256: "9149d493b075ed740901f3ee844a38a00b33116c7c5c10d7fb27df8987fb51d5"
       url: "https://pub.dev"
     source: hosted
-    version: "6.2.4"
+    version: "6.2.5"
   url_launcher_linux:
     dependency: transitive
     description:
@@ -585,10 +793,10 @@ packages:
     dependency: transitive
     description:
       name: url_launcher_platform_interface
-      sha256: a932c3a8082e118f80a475ce692fde89dc20fddb24c57360b96bc56f7035de1f
+      sha256: "552f8a1e663569be95a8190206a38187b531910283c3e982193e4f2733f01029"
       url: "https://pub.dev"
     source: hosted
-    version: "2.3.1"
+    version: "2.3.2"
   url_launcher_web:
     dependency: transitive
     description:
@@ -605,6 +813,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.1.1"
+  uuid:
+    dependency: transitive
+    description:
+      name: uuid
+      sha256: cd210a09f7c18cbe5a02511718e0334de6559871052c90a90c0cca46a4aa81c8
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.3.3"
   vector_math:
     dependency: transitive
     description:
@@ -613,30 +829,38 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.1.4"
+  vm_service:
+    dependency: transitive
+    description:
+      name: vm_service
+      sha256: b3d56ff4341b8f182b96aceb2fa20e3dcb336b9f867bc0eafc0de10f1048e957
+      url: "https://pub.dev"
+    source: hosted
+    version: "13.0.0"
   web:
     dependency: transitive
     description:
       name: web
-      sha256: afe077240a270dcfd2aafe77602b4113645af95d0ad31128cc02bce5ac5d5152
+      sha256: "4188706108906f002b3a293509234588823c8c979dc83304e229ff400c996b05"
       url: "https://pub.dev"
     source: hosted
-    version: "0.3.0"
+    version: "0.4.2"
   webview_flutter:
     dependency: "direct main"
     description:
       name: webview_flutter
-      sha256: d81b68e88cc353e546afb93fb38958e3717282c5ac6e5d3be4a4aef9fc3c1413
+      sha256: "25e1b6e839e8cbfbd708abc6f85ed09d1727e24e08e08c6b8590d7c65c9a8932"
       url: "https://pub.dev"
     source: hosted
-    version: "4.5.0"
+    version: "4.7.0"
   webview_flutter_android:
     dependency: transitive
     description:
       name: webview_flutter_android
-      sha256: "4ea3c4e1b8ed590162b15b8a61b41b1ef3ff179a314627c16ce40c086d94b8af"
+      sha256: f038ee2fae73b509dde1bc9d2c5a50ca92054282de17631a9a3d515883740934
       url: "https://pub.dev"
     source: hosted
-    version: "3.14.0"
+    version: "3.16.0"
   webview_flutter_platform_interface:
     dependency: transitive
     description:
@@ -649,18 +873,18 @@ packages:
     dependency: transitive
     description:
       name: webview_flutter_wkwebview
-      sha256: b99ca8d8bae9c6b43d568218691aa537fb0aeae1d7d34eadf112a6aa36d26506
+      sha256: f12f8d8a99784b863e8b85e4a9a5e3cf1839d6803d2c0c3e0533a8f3c5a992a7
       url: "https://pub.dev"
     source: hosted
-    version: "3.11.0"
+    version: "3.13.0"
   win32:
     dependency: transitive
     description:
       name: win32
-      sha256: "464f5674532865248444b4c3daca12bd9bf2d7c47f759ce2617986e7229494a8"
+      sha256: "8cb58b45c47dcb42ab3651533626161d6b67a2921917d8d429791f76972b3480"
       url: "https://pub.dev"
     source: hosted
-    version: "5.2.0"
+    version: "5.3.0"
   xdg_directories:
     dependency: transitive
     description:
@@ -686,5 +910,5 @@ packages:
     source: hosted
     version: "3.1.2"
 sdks:
-  dart: ">=3.2.6 <4.0.0"
+  dart: ">=3.3.0 <4.0.0"
-  flutter: ">=3.16.6"
+  flutter: ">=3.19.0"

pubspec.yaml

@@ -1,5 +1,5 @@
-name: goatagent
+name: solaragent
-description: "The official Application of Goatworks Global Hydrogen Network"
+description: "The official Application of Solarworks Global Hydrogen Network"
 # The following line prevents the package from being accidentally published to
 # pub.dev using `flutter pub publish`. This is preferred for private packages.
 publish_to: 'none' # Remove this line if you wish to publish to pub.dev
@@ -16,7 +16,7 @@ publish_to: 'none' # Remove this line if you wish to publish to pub.dev
 # https://developer.apple.com/library/archive/documentation/General/Reference/InfoPlistKeyReference/Articles/CoreFoundationKeys.html
 # In Windows, build-name is used as the major, minor, and patch parts
 # of the product and file versions while build-number is used as the build suffix.
-version: 1.0.0+1
+version: 2.0.0+1
 
 environment:
   sdk: '>=3.2.6 <4.0.0'
@@ -35,17 +35,22 @@ dependencies:
   # The following adds the Cupertino Icons font to your application.
   # Use with the CupertinoIcons class for iOS style icons.
   cupertino_icons: ^1.0.2
-  firebase_messaging: ^14.7.15
-  firebase_core: ^2.25.4
-  firebase_crashlytics: ^3.4.14
-  flutter_appauth: ^6.0.4
   flutter_secure_storage: ^9.0.0
   oauth2: ^2.0.2
   http: ^1.2.0
   webview_flutter: ^4.5.0
-  go_router: ^13.1.0
+  go_router: ^13.2.1
   package_info_plus: ^5.0.1
   url_launcher: ^6.2.4
+  shared_preferences: ^2.2.2
+  flutter_markdown: ^0.6.22
+  infinite_scroll_pagination: ^4.0.0
+  flutter_carousel_widget: ^2.2.0
+  image_picker: ^1.0.7
+  sentry_flutter: ^7.18.0
+  crypto: ^3.0.3
+  file_picker: ^8.0.0+1
+  markdown: ^7.2.2
 
 dev_dependencies:
   flutter_test:
@@ -60,10 +65,11 @@ dev_dependencies:
   flutter_launcher_icons: "^0.13.1"
 
 flutter_launcher_icons:
-  android: "launcher_icon"
+  android: true
   ios: true
   image_path: "image.png"
   min_sdk_android: 21 # android min sdk min:16, default 21
+  remove_alpha_ios: true
   web:
     generate: true
     image_path: "image.png"

test/widget_test.dart

@@ -8,12 +8,12 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_test/flutter_test.dart';
 
-import 'package:goatagent/main.dart';
+import 'package:solaragent/main.dart';
 
 void main() {
   testWidgets('Counter increments smoke test', (WidgetTester tester) async {
     // Build our app and trigger a frame.
-    await tester.pumpWidget(const GoatAgent());
+    await tester.pumpWidget(const SolarAgent());
 
     // Verify that our counter starts at 0.
     expect(find.text('0'), findsOneWidget);