🐛 Bug fixes

💄 Optimize content rendering

.roadsignrc

@@ -0,0 +1,13 @@
+{
+  "sync": {
+    "region": "solian",
+    "configPath": "roadsign.toml"
+  },
+  "deployments": [
+    {
+      "region": "solian",
+      "site": "solian-web",
+      "path": "build/web"
+    }
+  ]
+}

.vscode/settings.json

@@ -0,0 +1,5 @@
+{
+    "cSpell.words": [
+        "annvisery"
+    ]
+}

android/gradle.properties

@@ -4,3 +4,4 @@ android.enableJetifier=true
 android.defaults.buildfeatures.buildconfig=true
 android.nonTransitiveRClass=false
 android.nonFinalResIds=false
+kotlin.jvm.target.validation.mode = IGNORE

assets/highlighting/cpp.json

@@ -0,0 +1,358 @@
+{
+  "name": "C++",
+  "version": "1.0.0",
+  "fileTypes": ["cpp", "hpp", "cc", "h"],
+  "scopeName": "source.cpp",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.cpp",
+      "match": "^\\s*#\\s*(include|define|if|ifdef|ifndef|else|endif|pragma)\\b"
+    },
+    {
+      "name": "meta.declaration.cpp",
+      "begin": "^\\w*\\b(namespace|class|struct|enum|typedef|template)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.declaration.cpp"
+        }
+      },
+      "end": "(\\{|;)",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.cpp",
+          "match": "\\b(public|private|protected|virtual|override|final)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.cpp",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.cpp"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#comments-inline"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "(//.*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.cpp",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.cpp",
+          "match": "__attribute__\\(\\w+\\)"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.cpp",
+          "match": "\\b(true|false|nullptr)\\b"
+        },
+        {
+          "name": "variable.language.cpp",
+          "match": "\\b(this|super)\\b"
+        },
+        {
+          "name": "constant.numeric.cpp",
+          "match": "\\b((0(x|X)[0-9a-fA-F]+)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "\\b(bool|int|char|double|float|long|short|signed|unsigned|void)\\b",
+          "name": "storage.type.primitive.cpp"
+        },
+        {
+          "begin": "(\\b[A-Z]\\w*\\b)",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.cpp"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "\\b([a-z_][a-zA-Z0-9_]*)\\s*\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.cpp",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(if|else|for|while|do|switch|case|break|continue|goto|return)\\b"
+        },
+        {
+          "name": "keyword.operator.cpp",
+          "match": "\\b(sizeof|typeid|decltype|new|delete)\\b"
+        },
+        {
+          "name": "keyword.control.try.cpp",
+          "match": "\\b(try|catch|throw)\\b"
+        },
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(static|inline|virtual|override|const|volatile|explicit|friend|constexpr)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.comparison.cpp",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.cpp",
+          "match": "(\\+|\\-|\\*|\\/|%)"
+        },
+        {
+          "name": "keyword.operator.assignment.cpp",
+          "match": "(=|\\+=|-=|\\*=|/=|%=)"
+        },
+        {
+          "name": "keyword.operator.logical.cpp",
+          "match": "(\\&\\&|\\|\\||!)"
+        },
+        {
+          "name": "keyword.operator.bitwise.cpp",
+          "match": "(<<|>>|\\&|\\||\\^|~)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.cpp"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.cpp",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.cpp"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.cpp",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.cpp",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.double.cpp",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.cpp",
+          "begin": "'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.cpp",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.cpp",
+          "match": ";"
+        }
+      ]
+    }
+  }
+}

assets/highlighting/dart.json

@@ -0,0 +1,531 @@
+{
+  "name": "Dart",
+  "version": "1.2.3",
+  "fileTypes": ["dart"],
+  "scopeName": "source.dart",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.dart",
+      "match": "^(#!.*)$"
+    },
+    {
+      "name": "meta.declaration.dart",
+      "begin": "^\\w*\\b(library|import|part of|part|export)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.import.dart"
+        }
+      },
+      "end": ";",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.import.dart",
+          "match": "\\b(as|show|hide)\\b"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "\\b(if)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "dartdoc": {
+      "patterns": [
+        {
+          "match": "(\\[.*?\\])",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "match": "^ {4,}(?![ \\*]).*",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "contentName": "variable.other.source.dart",
+          "begin": "```.*?$",
+          "end": "```"
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(\\* ((    ).*))$",
+          "captures": {
+            "2": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.dart",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.dart"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            },
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "((//).*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.dart",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.dart",
+          "match": "@[a-zA-Z]+"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.dart",
+          "match": "(?<!\\$)\\b(true|false|null)\\b(?!\\$)"
+        },
+        {
+          "name": "variable.language.dart",
+          "match": "(?<!\\$)\\b(this|super)\\b(?!\\$)"
+        },
+        {
+          "name": "constant.numeric.dart",
+          "match": "(?<!\\$)\\b((0(x|X)[0-9a-fA-F]*)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b(?!\\$)"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "(?<!\\$)\\b(bool|num|int|double|dynamic)\\b(?!\\$)",
+          "name": "support.class.dart"
+        },
+        {
+          "match": "(?<!\\$)\\bvoid\\b(?!\\$)",
+          "name": "storage.type.primitive.dart"
+        },
+        {
+          "begin": "(?<![a-zA-Z0-9_$])([_$]*[A-Z][a-zA-Z0-9_$]*)\\b",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.dart"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "([_$]*[a-z][a-zA-Z0-9_$]*)(<(?:[a-zA-Z0-9_$<>?]|,\\s*|\\s+extends\\s+)+>)?[!?]?\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.dart"
+            },
+            "2": {
+              "patterns": [
+                {
+                  "include": "#type-args"
+                }
+              ]
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.cast.dart",
+          "match": "(?<!\\$)\\bas\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.catch-exception.dart",
+          "match": "(?<!\\$)\\b(try|on|catch|finally|throw|rethrow)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(break|case|continue|default|do|else|for|if|in|return|switch|while|when)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(sync(\\*)?|async(\\*)?|await|yield(\\*)?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\bassert\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.new.dart",
+          "match": "(?<!\\$)\\b(new)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "(?<!\\$)\\b(abstract|sealed|base|interface|class|enum|extends|extension type|extension|external|factory|implements|get(?!\\()|mixin|native|operator|set(?!\\()|typedef|with|covariant)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.modifier.dart",
+          "match": "(?<!\\$)\\b(static|final|const|required|late)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.type.primitive.dart",
+          "match": "(?<!\\$)\\b(?:void|var)\\b(?!\\$)"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.dart",
+          "match": "(?<!\\$)\\b(is\\!?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.operator.ternary.dart",
+          "match": "\\?|:"
+        },
+        {
+          "name": "keyword.operator.bitwise.dart",
+          "match": "(<<|>>>?|~|\\^|\\||&)"
+        },
+        {
+          "name": "keyword.operator.assignment.bitwise.dart",
+          "match": "((&|\\^|\\||<<|>>>?)=)"
+        },
+        {
+          "name": "keyword.operator.closure.dart",
+          "match": "(=>)"
+        },
+        {
+          "name": "keyword.operator.comparison.dart",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.assignment.arithmetic.dart",
+          "match": "(([+*/%-]|\\~)=)"
+        },
+        {
+          "name": "keyword.operator.assignment.dart",
+          "match": "(=)"
+        },
+        {
+          "name": "keyword.operator.increment-decrement.dart",
+          "match": "(\\-\\-|\\+\\+)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.dart",
+          "match": "(\\-|\\+|\\*|\\/|\\~\\/|%)"
+        },
+        {
+          "name": "keyword.operator.logical.dart",
+          "match": "(!|&&|\\|\\|)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.dart"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.dart",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.dart"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.dart",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.dart",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.interpolated.triple.double.dart",
+          "begin": "(?<!r)\"\"\"",
+          "end": "\"\"\"(?!\")",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.triple.single.dart",
+          "begin": "(?<!r)'''",
+          "end": "'''(?!')",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.triple.double.dart",
+          "begin": "r\"\"\"",
+          "end": "\"\"\"(?!\")"
+        },
+        {
+          "name": "string.quoted.triple.single.dart",
+          "begin": "r'''",
+          "end": "'''(?!')"
+        },
+        {
+          "name": "string.interpolated.double.dart",
+          "begin": "(?<!\\|r)\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.double.dart",
+          "begin": "r\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.single.dart",
+          "begin": "(?<!\\|r)'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.dart",
+          "begin": "r'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.dart",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.dart",
+          "match": ";"
+        },
+        {
+          "name": "punctuation.dot.dart",
+          "match": "\\."
+        }
+      ]
+    }
+  }
+}

assets/highlighting/json.json

@@ -0,0 +1,212 @@
+{
+  "fileTypes": ["json"],
+  "foldingStartMarker": "^\\s*[{\\[](?!.*[}\\]],?\\s*$)|[{\\[]\\s*$",
+  "foldingStopMarker": "^\\s*[}\\]]",
+  "keyEquivalent": "^~J",
+  "name": "JSON (Javascript Next)",
+  "patterns": [
+    {
+      "include": "#value"
+    }
+  ],
+  "repository": {
+    "array": {
+      "begin": "\\[",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.begin.json"
+        }
+      },
+      "end": "\\]",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.end.json"
+        }
+      },
+      "name": "meta.structure.array.json",
+      "patterns": [
+        {
+          "include": "#value"
+        },
+        {
+          "match": ",",
+          "name": "punctuation.separator.array.json"
+        },
+        {
+          "match": "[^\\s\\]]",
+          "name": "invalid.illegal.expected-array-separator.json"
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "begin": "/\\*\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.documentation.json"
+        },
+        {
+          "begin": "/\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.json"
+        },
+        {
+          "captures": {
+            "1": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "match": "(//).*$\\n?",
+          "name": "comment.line.double-slash.js"
+        }
+      ]
+    },
+    "constant": {
+      "match": "\\b(?:true|false|null)\\b",
+      "name": "constant.language.json"
+    },
+    "number": {
+      "match": "-?(?:0|[1-9]\\d*)\n(?:\n(?:\n\\.\\d+)?\n(?:\n[eE][+-]?\\d+)?)?",
+      "name": "constant.numeric.json"
+    },
+    "object": {
+      "begin": "\\{",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.begin.json"
+        }
+      },
+      "end": "\\}",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.end.json"
+        }
+      },
+      "name": "meta.structure.dictionary.json",
+      "patterns": [
+        {
+          "comment": "the JSON object key",
+          "include": "#objectkey"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "begin": ":",
+          "beginCaptures": {
+            "0": {
+              "name": "punctuation.separator.dictionary.key-value.json"
+            }
+          },
+          "end": "(,)|(?=\\})",
+          "endCaptures": {
+            "1": {
+              "name": "punctuation.separator.dictionary.pair.json"
+            }
+          },
+          "name": "meta.structure.dictionary.value.json",
+          "patterns": [
+            {
+              "comment": "the JSON object value",
+              "include": "#value"
+            },
+            {
+              "match": "[^\\s,]",
+              "name": "invalid.illegal.expected-dictionary-separator.json"
+            }
+          ]
+        },
+        {
+          "match": "[^\\s\\}]",
+          "name": "invalid.illegal.expected-dictionary-separator.json"
+        }
+      ]
+    },
+    "string": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.end.json"
+        }
+      },
+      "name": "string.quoted.double.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "objectkey": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.end.json"
+        }
+      },
+      "name": "support.type.property-name.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "stringcontent": {
+      "patterns": [
+        {
+          "match": "\\\\(?:[\"\\\\/bfnrt]|u[0-9a-fA-F]{4})",
+          "name": "constant.character.escape.json"
+        },
+        {
+          "match": "\\\\.",
+          "name": "invalid.illegal.unrecognized-string-escape.json"
+        }
+      ]
+    },
+    "value": {
+      "patterns": [
+        {
+          "include": "#constant"
+        },
+        {
+          "include": "#number"
+        },
+        {
+          "include": "#string"
+        },
+        {
+          "include": "#array"
+        },
+        {
+          "include": "#object"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    }
+  },
+  "scopeName": "source.json",
+  "uuid": "8f97457b-516e-48ce-83c7-08ae12fb327a"
+}

assets/highlighting/python.json

@@ -0,0 +1,98 @@
+{
+  "name": "Python",
+  "version": "1.0.0",
+  "fileTypes": ["py"],
+  "scopeName": "source.python",
+  "foldingStartMarker": "\\b(?:def|class)\\s*[^:]*:\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+  "patterns": [
+    { "include": "#comments" },
+    { "include": "#keywords" },
+    { "include": "#constants-and-special-vars" },
+    { "include": "#operators" },
+    { "include": "#strings" }
+  ],
+  "repository": {
+    "comments": {
+      "patterns": [
+        { "name": "comment.line.hash.python", "match": "#.*$" },
+        { "name": "comment.block.python", "begin": "'''", "end": "'''" },
+        { "name": "comment.block.python", "begin": "\"\"\"", "end": "\"\"\"" }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.python",
+          "match": "\\b(?:if|else|while|for|in|break|continue|return)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        },
+        { "name": "keyword.operator.assignment.python", "match": "=" },
+        { "name": "storage.modifier.python", "match": "\\b(?:def|class)\\b" }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.python",
+          "match": "\\b(?:True|False|None)\\b"
+        },
+        { "name": "variable.language.python", "match": "\\b(?:self)\\b" },
+        {
+          "name": "constant.numeric.python",
+          "match": "\\b(?:\\d+\\.?\\d*|\\.\\d+)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.arithmetic.python",
+          "match": "\\b(?:\\+|-|\\*|/|%|//)\\b"
+        },
+        {
+          "name": "keyword.operator.comparison.python",
+          "match": "\\b(?:==|!=|<|<=|>|>=)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.triple.double.python",
+          "begin": "\"\"\"",
+          "end": "\"\"\""
+        },
+        {
+          "name": "string.quoted.triple.single.python",
+          "begin": "'''",
+          "end": "'''"
+        },
+        {
+          "name": "string.quoted.double.python",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [{ "include": "#string-escape" }]
+        },
+        {
+          "name": "string.quoted.single.python",
+          "begin": "'",
+          "end": "'",
+          "patterns": [{ "include": "#string-escape" }]
+        }
+      ]
+    },
+    "string-escape": {
+      "patterns": [
+        { "name": "constant.character.escape.python", "match": "\\\\[\"']" }
+      ]
+    }
+  }
+}

assets/highlighting/sql.json

@@ -0,0 +1,145 @@
+{
+  "fileTypes": ["sql", "ddl", "dml"],
+  "foldingStartMarker": "(?i)^\\s*(begin|if|loop)\\b",
+  "foldingStopMarker": "(?i)^\\s*(end)\\b",
+  "keyEquivalent": "^~S",
+  "name": "PL/pgSQL (Postgres)",
+  "patterns": [
+    {
+      "begin": "/\\*",
+      "end": "\\*/",
+      "name": "comment.block.postgres"
+    },
+    {
+      "match": "--.*$",
+      "name": "comment.line.double-dash.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        }
+      },
+      "match": "(?i)^\\s*(create)(\\s+or\\s+replace)?\\s+",
+      "name": "meta.create.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        },
+        "3": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(package)(\\s+body)?\\s+(\\S+)",
+      "name": "meta.package.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(type)\\s+\"([^\"]+)\"",
+      "name": "meta.type.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.function.postgres"
+        }
+      },
+      "match": "(?i)\\s*(function|procedure)\\s+([-a-z0-9_.]+)",
+      "name": "meta.procedure.postgres"
+    },
+    {
+      "match": "[!<>:]?=|<>|<|>|\\+|(?<!\\.)\\*|-|(?<!^)/|@@|\\|\\|",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(true|false|null|found)\\b",
+      "name": "constant.language.postgres"
+    },
+    {
+      "match": "\\b\\d+(\\.\\d+)?\\b",
+      "name": "constant.numeric.postgres"
+    },
+    {
+      "match": "(?i)\\b(if|elsif|else|end\\s+if|loop|end\\s+loop|for|foreach|array|case|end\\s+case|continue|return|goto|alias)\\b",
+      "name": "keyword.control.postgres"
+    },
+    {
+      "match": "(?i)\\b(or|and|not|like)\\b",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(sysdate|%(isopen|found|notfound|rowcount)|commit|rollback|sqlerrm|substr|cast|decode|length|lower|upper|coalesce)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "match": "(?i)\\b(avg|count|sum|max|min|nvl|trim|to_date|to_char|lpad|ltrim|rpad|rtrim|trunc|to_number|regexp_split_to_array|regexp_replace)\\b",
+      "name": "support.function.builtin.postgres"
+    },
+    {
+      "match": "(?i)\\b(sql|sqlcode)\\b",
+      "name": "variable.language.postgres"
+    },
+    {
+      "match": "(?i)\\b(p(i|o|io)_[-a-z0-9_]+)\\b",
+      "name": "variable.parameter.postgres"
+    },
+    {
+      "match": "(?i)\\b(l_[-a-z0-9_]+)\\b",
+      "name": "variable.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(immutable|volatile|stable|serial|primary|key|references|comment|column|schema|authorization|get|diagnostics|returning|drop|all|raise|notice|warning|exception|external|security|definer|language|grant|execute|on|to|function|procedure|returns|end|then|deterministic|exception|when|others|subtype|constant|range|binary_integer|declare|begin|in|out|is|as|exit|open|fetch|into|close|type|rowtype|default|\\.(extend|count|first|last|next|nextval|currval)|cost|alter|owner)\\b",
+      "name": "keyword.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(select|perform|from|where|order\\s+by|group\\s+by|asc|desc|update|set|insert|into|values|delete|from|distinct|union|having|limit|table|of|prepare|(inner|left|outer) join)\\b",
+      "name": "keyword.other.sql.postgres"
+    },
+    {
+      "match": "[$][0-9]+",
+      "name": "storage.type.postgres"
+    },
+    {
+      "match": "(?i)\\b(dbms_lock|dbms_output)\\b",
+      "name": "support.class.postgres"
+    },
+    {
+      "match": "(?i)\\b(put_line)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "begin": "'",
+      "end": "'",
+      "name": "string.quoted.single.postgres"
+    },
+    {
+      "begin": "\"",
+      "end": "\"",
+      "name": "string.quoted.double.postgres"
+    },
+    {
+      "match": "(?i)\\b(number|integer|bigint|varchar2|varchar|boolean|date|setof|record|query|numeric|void|character varying|text|([-a-z0-9_.]+%(row)?type))\\b",
+      "name": "storage.type.postgres"
+    }
+  ],
+  "scopeName": "source.plpgsql.postgres",
+  "uuid": "28DCE4DD-F5E1-4ED3-8847-64DA6B1F9163"
+}

assets/highlighting/yaml.json

@@ -0,0 +1,66 @@
+{
+  "name": "YAML",
+  "fileTypes": ["yaml", "yml"],
+  "scopeName": "source.yaml",
+  "patterns": [
+    {
+      "name": "comment.line.number-sign.yaml",
+      "match": "#.*",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.comment.yaml"
+        }
+      }
+    },
+    {
+      "name": "entity.name.tag.yaml",
+      "match": "^\\s*\\w+",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.tag.yaml"
+        }
+      }
+    },
+    {
+      "name": "punctuation.separator.key-value.yaml",
+      "match": ":",
+      "captures": {
+        "0": {
+          "name": "punctuation.separator.key-value.yaml"
+        }
+      }
+    },
+    {
+      "name": "string.quoted.double.yaml",
+      "begin": "\"",
+      "end": "\"",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "\\\\(x[0-9A-Fa-f]{2}|u[0-9A-Fa-f]{4}|U[0-9A-Fa-f]{6}|.)"
+        }
+      ]
+    },
+    {
+      "name": "string.quoted.single.yaml",
+      "begin": "'",
+      "end": "'",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "''"
+        }
+      ]
+    }
+  ],
+  "repository": {
+    "scalar-plain": {
+      "patterns": [
+        {
+          "match": "\\b(\\w+)\\b",
+          "name": "scalar.plain.yaml"
+        }
+      ]
+    }
+  }
+}

assets/locales/en_us.json

@@ -22,9 +22,9 @@
   "explore": "Explore",
   "posts": "Posts",
   "unlink": "Unlink",
-  "feedSearch": "Search Feed",
-  "feedSearchWithTag": "Searching with tag #@key",
-  "feedSearchWithCategory": "Searching in category @category",
+  "postSearch": "Search Post",
+  "postSearchWithTag": "Searching with tag #@key",
+  "postSearchWithCategory": "Searching in category @category",
   "feedUnreadCount": "@count posts you may missed",
   "messages": "Messages",
   "messagesUnreadCount": "@count messages unread",
@@ -54,6 +54,7 @@
   "about": "About",
   "edit": "Edit",
   "delete": "Delete",
+  "insert": "Insert",
   "settings": "Settings",
   "settingsNotificationBgService": "Background notification service",
   "settingsNotificationBgServiceDesc": "A notification service is always installed on the device, so that some devices that do not support push notifications can receive notifications in the background. When this feature is enabled, push notifications will not be registered with the server, and you will always appear to be online in the eyes of others (except for invisible). You may need to turn off power and traffic optimization in the settings.",
@@ -98,6 +99,8 @@
   "accountFriendBlocked": "Friend blocklist",
   "accountFriendListHint": "Swipe left to decline, right to approve",
   "accountFriendRequestSent": "Friend request sent, waiting for processing...",
+  "accountBlocked": "Account has been blocked",
+  "accountUnblocked": "Account has been unblocked",
   "accountSuspended": "Account was suspended",
   "accountSuspendedAt": "Account was suspended since @date",
   "aspectRatio": "Aspect Ratio",
@@ -138,7 +141,7 @@
   "clear": "Clear",
   "pinPost": "Pin this post",
   "unpinPost": "Unpin this post",
-  "postRestoreFromLocal": "Restore from local",
+  "postRestoreFromLocal": "Restored",
   "postAutoSaveAt": "Auto saved at @date",
   "postCategoriesAndTags": "Categories n' Tags",
   "postPublishDate": "Publish Date",
@@ -364,8 +367,9 @@
   "bsPreparingData": "Preparing User Data",
   "bsRegisteringPushNotify": "Enabling Push Notifications",
   "bsDismissibleErrorHint": "Click anywhere to ignore this error",
+  "bsContinuable": "Click anywhere to continue",
   "postShareContent": "@content\n\n@username on the Solar Network\nCheck it out: @link",
-  "postShareSubject": "@username posted a post on the Solar Network",
+  "postShareSubject": "@title by @username on Solar Network",
   "themeColor": "Global Theme Color",
   "themeColorRed": "Modern Red",
   "themeColorBlue": "Classic Blue",
@@ -433,6 +437,7 @@
   "updateCheckStrictly": "Strict mode",
   "updateCheckStrictlyDesc": "If enabled, the app will ask for updating once the local version is different from remote one.",
   "updateMayAvailable": "App version @version is available, you can update from app store or our website.",
+  "updateNow": "Update now",
   "termAccept": "I've read and agree to Solar Network's Terms",
   "termAcceptDesc": "Including but not limited to \"User Agreement\" and \"Privacy Policy\"",
   "termAcceptLink": "View terms",
@@ -452,5 +457,42 @@
   "accountDeletionConfirm": "Confirm request account deletion",
   "accountDeletionConfirmDesc": "Are you sure to delete account @account? You will receive a confirmation email with a link to confirm the deletion of the account within 24 hours. Note that this action is irreversible, and all data associated with the account will be deleted, and you should be careful about it.",
   "accountDeletionRequested": "Account deletion requested, check your inbox to confirm the request.",
-  "slideToConfirm": "Slide to confirm"
+  "slideToConfirm": "Slide to confirm",
+  "serviceStatus": "Status of Service",
+  "firstBootTime": "First boot at @time",
+  "rateTheApp": "Rate the app",
+  "rateTheAppDesc": "Rate Solar Network on the App Store to let us serve you better!",
+  "friendAdd": "Add as friend",
+  "blockUser": "Block user",
+  "unblockUser": "Unblock user",
+  "learnMoreAboutPerson": "Learn more about that person",
+  "global": "Global",
+  "all": "All",
+  "unablePreview": "Unable to preview",
+  "dashboardNav": "Dash",
+  "accountNav": "You",
+  "performance": "Performance",
+  "animatedMessageList": "Non-animated message list",
+  "animatedMessageListDesc": "Remove animation effects in message list, to reduce cause lag",
+  "theme": "Theme",
+  "globalTheme": "Global theme",
+  "agedTheme": "Old school style theme",
+  "agedThemeDesc": "Downgrade the global theme to Material Design 2. Unexpected issues may occur. For experimental use only.",
+  "appBackgroundImage": "Global background image",
+  "appBackgroundImageDesc": "The global background image will be displayed on all pages",
+  "authPreferences": "Auth preferences",
+  "authPreferencesDesc": "Set the security behavior of your account",
+  "authMaximumAuthSteps": "Maximum authentication steps",
+  "authMaximumAuthStepsDesc": "The maximum number of authentication steps when logging in, higher value is more secure, lower value is more convenient; default is 2",
+  "auditLog": "Audit log",
+  "shareImage": "Share as image",
+  "shareImageFooter": "Only on the Solar Network",
+  "fileSavedAt": "File saved at @path",
+  "showIp": "Show IP Address",
+  "shotOn": "Shot on @device",
+  "unread": "Unread",
+  "searchTook": "Took @time",
+  "searchResult": "@count Matches",
+  "happyBirthday": "Happy birthday @name!",
+  "happyBirthdayDesc": "Today is your @count birthday"
 }

assets/locales/zh_cn.json

@@ -14,6 +14,7 @@
   "about": "关于",
   "edit": "编辑",
   "delete": "删除",
+  "insert": "插入",
   "settings": "设置",
   "settingsNotificationBgService": "常驻通知服务",
   "settingsNotificationBgServiceDesc": "在设备常驻一个通知服务，使得部分不支持推送通知的设备可以在后台收到通知；启用该功能的情况下不会向服务器注册推送通知，并且你会始终在他人眼中成为在线（隐身除外）；可能需要在设置中关闭电量与流量优化。",
@@ -32,9 +33,9 @@
   "dashboard": "仪表盘",
   "today": "今日",
   "yesterday": "昨日",
-  "feedSearch": "搜索资讯",
-  "feedSearchWithTag": "检索带有 #@key 标签的资讯",
-  "feedSearchWithCategory": "检索位于分类 @category 的资讯",
+  "postSearch": "搜索帖子",
+  "postSearchWithTag": "检索带有 #@key 标签的资讯",
+  "postSearchWithCategory": "检索位于分类 @category 的资讯",
   "feedUnreadCount": "@count 条你可能错过的帖子",
   "messages": "消息",
   "messagesUnreadCount": "@count 条未读的消息",
@@ -98,6 +99,8 @@
   "accountFriendBlocked": "好友黑名单",
   "accountFriendListHint": "左滑来拒绝，右滑来接受",
   "accountFriendRequestSent": "好友请求已发送，等待处理对方中……",
+  "accountBlocked": "已屏蔽账号",
+  "accountUnblocked": "已解除屏蔽账号",
   "accountSuspended": "帐号被停用",
   "accountSuspendedAt": "该帐号自 @date 起被停用",
   "aspectRatio": "纵横比",
@@ -264,7 +267,7 @@
   "channelMembersAddHint": "到 @channel",
   "channelType": "频道类型",
   "channelTypeCommon": "普通频道",
-  "channelTypeDirect": "私信聊天",
+  "channelTypeDirect": "私信",
   "channelAdjust": "调整频道",
   "channelDetail": "频道详情",
   "channelSettings": "频道设置",
@@ -360,8 +363,9 @@
   "bsPreparingData": "正在准备用户资料",
   "bsRegisteringPushNotify": "正在启用推送通知",
   "bsDismissibleErrorHint": "点击任意地方忽略此错误",
+  "bsContinuable": "点击任意处继续",
   "postShareContent": "@content\n\n@username 在 Solar Network\n原帖地址：@link",
-  "postShareSubject": "@username 在 Solar Network 上发布了一篇帖子",
+  "postShareSubject": "@username 在 Solar Network 发表的 @title",
   "themeColor": "全局主题色",
   "themeColorRed": "现代红",
   "themeColorBlue": "经典蓝",
@@ -428,6 +432,7 @@
   "update": "更新",
   "updateCheckStrictly": "严格模式",
   "updateCheckStrictlyDesc": "如果启用，应用程序将会在本地版本与远程版本不同时询问更新，而不会检查版本号大小。",
+  "updateNow": "立即更新",
   "updateMayAvailable": "版本 @version 现已可用，你可以前往应用商店或是我们的官网下载更新。",
   "termAccept": "我已阅读并同意 Solar Network 各项条款",
   "termAcceptDesc": "包括但不限于《用户守则》和《隐私政策》",
@@ -448,5 +453,42 @@
   "accountDeletionConfirm": "确认账号删除请求",
   "accountDeletionConfirmDesc": "你确定要删除账号 @account 吗？你将会在其绑定的主要邮件地址收到一封包含着确认删除账号连接的邮件，在二十四小时内使用该连接即可完成删除账号。注意，本操作不可撤销，并且账号创建或关联的所有数据都将被删除，请三思而后行。",
   "accountDeletionRequested": "已请求删除账号，检查你的收件箱来确认请求。",
-  "slideToConfirm": "滑动来确认"
+  "slideToConfirm": "滑动来确认",
+  "serviceStatus": "服务状态",
+  "firstBootTime": "首次启动于 @time",
+  "rateTheApp": "给应用评分",
+  "rateTheAppDesc": "在 App Store 上给 Solar Network 评分，让我们更好地为您服务吧！",
+  "friendAdd": "添加好友",
+  "blockUser": "屏蔽用户",
+  "unblockUser": "解除屏蔽用户",
+  "learnMoreAboutPerson": "了解关于 TA 的更多",
+  "global": "全局",
+  "all": "全部",
+  "unablePreview": "无法预览",
+  "dashboardNav": "仪表盘",
+  "accountNav": "您",
+  "performance": "性能",
+  "animatedMessageList": "无动画消息列表",
+  "animatedMessageListDesc": "在消息列表中禁用动画效果",
+  "theme": "主题",
+  "globalTheme": "全局应用主题",
+  "agedTheme": "过时主题",
+  "agedThemeDesc": "将全局主题降级为 Material Design 2，可能发生意料之外的问题，仅供实验使用",
+  "appBackgroundImage": "全局背景图片",
+  "appBackgroundImageDesc": "全局背景图片将会在所有页面中展示",
+  "authPreferences": "安全偏好设置",
+  "authPreferencesDesc": "调整账号的安全行为模式",
+  "authMaximumAuthSteps": "最大认证步数",
+  "authMaximumAuthStepsDesc": "登陆时最多的验证步数，值越高则越安全，反之则会相对方便；默认设置为 2",
+  "auditLog": "活动日志",
+  "shareImage": "分享图片",
+  "shareImageFooter": "上 Solar Network 看更多有趣帖子",
+  "fileSavedAt": "文件保存于 @path",
+  "showIp": "显示 IP 地址",
+  "shotOn": "由 @device 拍摄",
+  "unread": "未读",
+  "searchTook": "耗时 @time",
+  "searchResult": "匹配到 @count 条结果",
+  "happyBirthday": "生日快乐，@name!",
+  "happyBirthdayDesc": "今天是你的第 @count 个生日"
 }

ios/Podfile.lock

@@ -38,45 +38,47 @@ PODS:
   - file_picker (0.0.1):
     - DKImagePickerController/PhotoGallery
     - Flutter
-  - Firebase/Analytics (11.0.0):
+  - file_saver (0.0.1):
+    - Flutter
+  - Firebase/Analytics (11.2.0):
     - Firebase/Core
-  - Firebase/Core (11.0.0):
+  - Firebase/Core (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseAnalytics (~> 11.0.0)
-  - Firebase/CoreOnly (11.0.0):
-    - FirebaseCore (= 11.0.0)
-  - Firebase/Crashlytics (11.0.0):
+    - FirebaseAnalytics (~> 11.2.0)
+  - Firebase/CoreOnly (11.2.0):
+    - FirebaseCore (= 11.2.0)
+  - Firebase/Crashlytics (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseCrashlytics (~> 11.0.0)
-  - Firebase/Messaging (11.0.0):
+    - FirebaseCrashlytics (~> 11.2.0)
+  - Firebase/Messaging (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseMessaging (~> 11.0.0)
-  - Firebase/Performance (11.0.0):
+    - FirebaseMessaging (~> 11.2.0)
+  - Firebase/Performance (11.2.0):
     - Firebase/CoreOnly
-    - FirebasePerformance (~> 11.0.0)
-  - firebase_analytics (11.3.2):
-    - Firebase/Analytics (= 11.0.0)
+    - FirebasePerformance (~> 11.2.0)
+  - firebase_analytics (11.3.3):
+    - Firebase/Analytics (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_core (3.5.0):
-    - Firebase/CoreOnly (= 11.0.0)
+  - firebase_core (3.6.0):
+    - Firebase/CoreOnly (= 11.2.0)
     - Flutter
-  - firebase_crashlytics (4.1.2):
-    - Firebase/Crashlytics (= 11.0.0)
+  - firebase_crashlytics (4.1.3):
+    - Firebase/Crashlytics (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_messaging (15.1.2):
-    - Firebase/Messaging (= 11.0.0)
+  - firebase_messaging (15.1.3):
+    - Firebase/Messaging (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_performance (0.10.0-7):
-    - Firebase/Performance (= 11.0.0)
+  - firebase_performance (0.10.0-8):
+    - Firebase/Performance (= 11.2.0)
     - firebase_core
     - Flutter
-  - FirebaseABTesting (11.2.0):
+  - FirebaseABTesting (11.3.0):
     - FirebaseCore (~> 11.0)
-  - FirebaseAnalytics (11.0.0):
-    - FirebaseAnalytics/AdIdSupport (= 11.0.0)
+  - FirebaseAnalytics (11.2.0):
+    - FirebaseAnalytics/AdIdSupport (= 11.2.0)
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
@@ -84,24 +86,24 @@ PODS:
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - FirebaseAnalytics/AdIdSupport (11.0.0):
+  - FirebaseAnalytics/AdIdSupport (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
-    - GoogleAppMeasurement (= 11.0.0)
+    - GoogleAppMeasurement (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - FirebaseCore (11.0.0):
+  - FirebaseCore (11.2.0):
     - FirebaseCoreInternal (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - GoogleUtilities/Logger (~> 8.0)
-  - FirebaseCoreExtension (11.2.0):
+  - FirebaseCoreExtension (11.3.0):
     - FirebaseCore (~> 11.0)
-  - FirebaseCoreInternal (11.2.0):
+  - FirebaseCoreInternal (11.3.0):
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseCrashlytics (11.0.0):
+  - FirebaseCrashlytics (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - FirebaseRemoteConfigInterop (~> 11.0)
@@ -110,12 +112,12 @@ PODS:
     - GoogleUtilities/Environment (~> 8.0)
     - nanopb (~> 3.30910.0)
     - PromisesObjC (~> 2.4)
-  - FirebaseInstallations (11.2.0):
+  - FirebaseInstallations (11.3.0):
     - FirebaseCore (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - PromisesObjC (~> 2.4)
-  - FirebaseMessaging (11.0.0):
+  - FirebaseMessaging (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - GoogleDataTransport (~> 10.0)
@@ -124,7 +126,7 @@ PODS:
     - GoogleUtilities/Reachability (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
-  - FirebasePerformance (11.0.0):
+  - FirebasePerformance (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - FirebaseRemoteConfig (~> 11.0)
@@ -134,7 +136,7 @@ PODS:
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
-  - FirebaseRemoteConfig (11.2.0):
+  - FirebaseRemoteConfig (11.3.0):
     - FirebaseABTesting (~> 11.0)
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
@@ -142,8 +144,8 @@ PODS:
     - FirebaseSharedSwift (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseRemoteConfigInterop (11.2.0)
-  - FirebaseSessions (11.2.0):
+  - FirebaseRemoteConfigInterop (11.3.0)
+  - FirebaseSessions (11.3.0):
     - FirebaseCore (~> 11.0)
     - FirebaseCoreExtension (~> 11.0)
     - FirebaseInstallations (~> 11.0)
@@ -152,7 +154,7 @@ PODS:
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
     - PromisesSwift (~> 2.1)
-  - FirebaseSharedSwift (11.2.0)
+  - FirebaseSharedSwift (11.3.0)
   - Flutter (1.0.0)
   - flutter_app_update (0.0.1):
     - Flutter
@@ -166,27 +168,30 @@ PODS:
     - Flutter
   - flutter_secure_storage (6.0.0):
     - Flutter
+  - flutter_udid (0.0.1):
+    - Flutter
+    - SAMKeychain
   - flutter_webrtc (0.11.3):
     - Flutter
     - WebRTC-SDK (= 125.6422.04)
   - gal (1.0.0):
     - Flutter
     - FlutterMacOS
-  - GoogleAppMeasurement (11.0.0):
-    - GoogleAppMeasurement/AdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement (11.2.0):
+    - GoogleAppMeasurement/AdIdSupport (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/AdIdSupport (11.0.0):
-    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement/AdIdSupport (11.2.0):
+    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/WithoutAdIdSupport (11.0.0):
+  - GoogleAppMeasurement/WithoutAdIdSupport (11.2.0):
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
@@ -227,6 +232,8 @@ PODS:
     - TOCropViewController (~> 2.7.4)
   - image_picker_ios (0.0.1):
     - Flutter
+  - in_app_review (0.2.0):
+    - Flutter
   - livekit_client (2.2.6):
     - Flutter
     - WebRTC-SDK (= 125.6422.04)
@@ -257,6 +264,7 @@ PODS:
     - PromisesObjC (= 2.4.0)
   - protocol_handler_ios (0.0.1):
     - Flutter
+  - SAMKeychain (1.5.3)
   - screen_brightness_ios (0.1.0):
     - Flutter
   - SDWebImage (5.19.7):
@@ -267,7 +275,7 @@ PODS:
   - shared_preferences_foundation (0.0.1):
     - Flutter
     - FlutterMacOS
-  - sqflite (0.0.3):
+  - sqflite_darwin (0.0.4):
     - Flutter
     - FlutterMacOS
   - "sqlite3 (3.46.1+1)":
@@ -302,6 +310,7 @@ DEPENDENCIES:
   - connectivity_plus (from `.symlinks/plugins/connectivity_plus/darwin`)
   - device_info_plus (from `.symlinks/plugins/device_info_plus/ios`)
   - file_picker (from `.symlinks/plugins/file_picker/ios`)
+  - file_saver (from `.symlinks/plugins/file_saver/ios`)
   - firebase_analytics (from `.symlinks/plugins/firebase_analytics/ios`)
   - firebase_core (from `.symlinks/plugins/firebase_core/ios`)
   - firebase_crashlytics (from `.symlinks/plugins/firebase_crashlytics/ios`)
@@ -314,10 +323,12 @@ DEPENDENCIES:
   - flutter_local_notifications (from `.symlinks/plugins/flutter_local_notifications/ios`)
   - flutter_native_splash (from `.symlinks/plugins/flutter_native_splash/ios`)
   - flutter_secure_storage (from `.symlinks/plugins/flutter_secure_storage/ios`)
+  - flutter_udid (from `.symlinks/plugins/flutter_udid/ios`)
   - flutter_webrtc (from `.symlinks/plugins/flutter_webrtc/ios`)
   - gal (from `.symlinks/plugins/gal/darwin`)
   - image_cropper (from `.symlinks/plugins/image_cropper/ios`)
   - image_picker_ios (from `.symlinks/plugins/image_picker_ios/ios`)
+  - in_app_review (from `.symlinks/plugins/in_app_review/ios`)
   - livekit_client (from `.symlinks/plugins/livekit_client/ios`)
   - media_kit_libs_ios_video (from `.symlinks/plugins/media_kit_libs_ios_video/ios`)
   - media_kit_native_event_loop (from `.symlinks/plugins/media_kit_native_event_loop/ios`)
@@ -331,7 +342,7 @@ DEPENDENCIES:
   - screen_brightness_ios (from `.symlinks/plugins/screen_brightness_ios/ios`)
   - share_plus (from `.symlinks/plugins/share_plus/ios`)
   - shared_preferences_foundation (from `.symlinks/plugins/shared_preferences_foundation/darwin`)
-  - sqflite (from `.symlinks/plugins/sqflite/darwin`)
+  - sqflite_darwin (from `.symlinks/plugins/sqflite_darwin/darwin`)
   - sqlite3_flutter_libs (from `.symlinks/plugins/sqlite3_flutter_libs/ios`)
   - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
   - volume_controller (from `.symlinks/plugins/volume_controller/ios`)
@@ -361,6 +372,7 @@ SPEC REPOS:
     - nanopb
     - PromisesObjC
     - PromisesSwift
+    - SAMKeychain
     - SDWebImage
     - sqlite3
     - SwiftyGif
@@ -374,6 +386,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/device_info_plus/ios"
   file_picker:
     :path: ".symlinks/plugins/file_picker/ios"
+  file_saver:
+    :path: ".symlinks/plugins/file_saver/ios"
   firebase_analytics:
     :path: ".symlinks/plugins/firebase_analytics/ios"
   firebase_core:
@@ -398,6 +412,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/flutter_native_splash/ios"
   flutter_secure_storage:
     :path: ".symlinks/plugins/flutter_secure_storage/ios"
+  flutter_udid:
+    :path: ".symlinks/plugins/flutter_udid/ios"
   flutter_webrtc:
     :path: ".symlinks/plugins/flutter_webrtc/ios"
   gal:
@@ -406,6 +422,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/image_cropper/ios"
   image_picker_ios:
     :path: ".symlinks/plugins/image_picker_ios/ios"
+  in_app_review:
+    :path: ".symlinks/plugins/in_app_review/ios"
   livekit_client:
     :path: ".symlinks/plugins/livekit_client/ios"
   media_kit_libs_ios_video:
@@ -432,8 +450,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/share_plus/ios"
   shared_preferences_foundation:
     :path: ".symlinks/plugins/shared_preferences_foundation/darwin"
-  sqflite:
-    :path: ".symlinks/plugins/sqflite/darwin"
+  sqflite_darwin:
+    :path: ".symlinks/plugins/sqflite_darwin/darwin"
   sqlite3_flutter_libs:
     :path: ".symlinks/plugins/sqlite3_flutter_libs/ios"
   url_launcher_ios:
@@ -444,30 +462,31 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/wakelock_plus/ios"
 
 SPEC CHECKSUMS:
-  connectivity_plus: ddd7f30999e1faaef5967c23d5b6d503d10434db
-  device_info_plus: 97af1d7e84681a90d0693e63169a5d50e0839a0d
+  connectivity_plus: 4c41c08fc6d7c91f63bc7aec70ffe3730b04f563
+  device_info_plus: bf2e3232933866d73fe290f2942f2156cdd10342
   DKImagePickerController: 946cec48c7873164274ecc4624d19e3da4c1ef3c
   DKPhotoGallery: b3834fecb755ee09a593d7c9e389d8b5d6deed60
   file_picker: 09aa5ec1ab24135ccd7a1621c46c84134bfd6655
-  Firebase: 9f574c08c2396885b5e7e100ed4293d956218af9
-  firebase_analytics: 4fd10182fd08bb8358f26ac8aca8dad7b6d0f592
-  firebase_core: 2ec6b789859c7c24766344ec71fdf78639402d56
-  firebase_crashlytics: 60630a0f91ee432275fa1660fd8593079761448a
-  firebase_messaging: a18e1e02b2e8e69097c8173e0c851be223b21c50
-  firebase_performance: 12d45fdf120992fa879d990929bf73d4a5ced053
-  FirebaseABTesting: 2104d957ce33888a3d6f3bde298cdee376dde8f1
-  FirebaseAnalytics: 27eb78b97880ea4a004839b9bac0b58880f5a92a
-  FirebaseCore: 3cf438f431f18c12cdf2aaf64434648b63f7e383
-  FirebaseCoreExtension: cda74ddfb001224bd8fd1d6e74698b4ed07803de
-  FirebaseCoreInternal: 0c569513412da9f3b31bd0b340013bbee8f295c5
-  FirebaseCrashlytics: 745d8f0221fe49c62865391d1bf56f5a12eeec0b
-  FirebaseInstallations: 771177d89d6c451dc6e50085ec82e2fc77ed0a4a
-  FirebaseMessaging: d2d1d9c62c46dd2db49a952f7deb5b16ad2c9742
-  FirebasePerformance: efdc02bacb1b4710588c9f867011605c081cdf79
-  FirebaseRemoteConfig: fca0b2d017fc1de52b28a4e5bcf2007c1a840457
-  FirebaseRemoteConfigInterop: 477b26fdeb8fb5fbaf22fa9db5343b42289dc7db
-  FirebaseSessions: adcec8b72d0066a385e3affcd1bcb1ebb3908ce6
-  FirebaseSharedSwift: 7a0d78d155ede78407f0fdc89fbc914014c7c540
+  file_saver: 503e386464dbe118f630e17b4c2e1190fa0cf808
+  Firebase: 98e6bf5278170668a7983e12971a66b2cd57fc8c
+  firebase_analytics: fbc57838bdb94eef1e0ff504f127d974ff2981ad
+  firebase_core: 2bedc3136ec7c7b8561c6123ed0239387b53f2af
+  firebase_crashlytics: 37d104d457b51760b48504a93a12b3bf70995d77
+  firebase_messaging: 15d114e1a41fc31e4fbabcd48d765a19eec94a38
+  firebase_performance: 26ad47755d3e8d7b04b9bb36bdfbf1cec8d8dfcc
+  FirebaseABTesting: c4559fcd2eba9f6bdaf0599e2c37ded01c343e4c
+  FirebaseAnalytics: c36efd5710c60c17558650fa58c2066eca7e9265
+  FirebaseCore: a282032ae9295c795714ded2ec9c522fc237f8da
+  FirebaseCoreExtension: 30bb063476ef66cd46925243d64ad8b2c8ac3264
+  FirebaseCoreInternal: ac26d09a70c730e497936430af4e60fb0c68ec4e
+  FirebaseCrashlytics: cfc69af5b53565dc6a5e563788809b5778ac4eac
+  FirebaseInstallations: 58cf94dabf1e2bb2fa87725a9be5c2249171cda0
+  FirebaseMessaging: c9ec7b90c399c7a6100297e9d16f8a27fc7f7152
+  FirebasePerformance: c39138c0700b8ef6040f0b80b5707320808e2862
+  FirebaseRemoteConfig: 5be2ca4f9870d475b39214210955fdaeecf7e5ca
+  FirebaseRemoteConfigInterop: c3a5c31b3c22079f41ba1dc645df889d9ce38cb9
+  FirebaseSessions: 655ff17f3cc1a635cbdc2d69b953878001f9e25b
+  FirebaseSharedSwift: d39c2ad64a11a8d936ce25a42b00df47078bb59c
   Flutter: e0871f40cf51350855a761d2e70bf5af5b9b5de7
   flutter_app_update: 65f61da626cb111d1b24674abc4b01728d7723bc
   flutter_background_service_ios: e30e0d3ee69e4cee66272d0c78eacd48c2e94aac
@@ -475,19 +494,21 @@ SPEC CHECKSUMS:
   flutter_local_notifications: 4cde75091f6327eb8517fa068a0a5950212d2086
   flutter_native_splash: edf599c81f74d093a4daf8e17bd7a018854bc778
   flutter_secure_storage: d33dac7ae2ea08509be337e775f6b59f1ff45f12
+  flutter_udid: a2482c67a61b9c806ef59dd82ed8d007f1b7ac04
   flutter_webrtc: 75b868e4f9e817c7a9a42ca4b6169063de4eec9f
   gal: 61e868295d28fe67ffa297fae6dacebf56fd53e1
-  GoogleAppMeasurement: 6e49ffac7d3f2c3ded9cc663f912a13b67bbd0de
+  GoogleAppMeasurement: 76d4f8b36b03bd8381fa9a7fe2cc7f99c0a2e93a
   GoogleDataTransport: aae35b7ea0c09004c3797d53c8c41f66f219d6a7
   GoogleUtilities: 26a3abef001b6533cf678d3eb38fd3f614b7872d
   image_cropper: 37d40f62177c101ff4c164906d259ea2c3aa70cf
   image_picker_ios: c560581cceedb403a6ff17f2f816d7fea1421fc1
+  in_app_review: 318597b3a06c22bb46dc454d56828c85f444f99d
   livekit_client: 20e01637431bc108dad451c8a11c1d206e1dd2cd
   media_kit_libs_ios_video: a5fe24bc7875ccd6378a0978c13185e1344651c1
   media_kit_native_event_loop: e6b2ab20cf0746eb1c33be961fcf79667304fa2a
   media_kit_video: 5da63f157170e5bf303bf85453b7ef6971218a2e
   nanopb: fad817b59e0457d11a5dfbde799381cd727c1275
-  package_info_plus: 58f0028419748fad15bf008b270aaa8e54380b1c
+  package_info_plus: c0502532a26c7662a62a356cebe2692ec5fe4ec4
   pasteboard: 982969ebaa7c78af3e6cc7761e8f5e77565d9ce0
   path_provider_foundation: 2b6b4c569c0fb62ec74538f866245ac84301af46
   permission_handler_apple: 9878588469a2b0d0fc1e048d9f43605f92e6cec2
@@ -495,11 +516,12 @@ SPEC CHECKSUMS:
   PromisesObjC: f5707f49cb48b9636751c5b2e7d227e43fba9f47
   PromisesSwift: 9d77319bbe72ebf6d872900551f7eeba9bce2851
   protocol_handler_ios: a5db8abc38526ee326988b808be621e5fd568990
+  SAMKeychain: 483e1c9f32984d50ca961e26818a534283b4cd5c
   screen_brightness_ios: 715ca807df953bf676d339f11464e438143ee625
   SDWebImage: 8a6b7b160b4d710e2a22b6900e25301075c34cb3
-  share_plus: 8875f4f2500512ea181eef553c3e27dba5135aad
+  share_plus: 8b6f8b3447e494cca5317c8c3073de39b3600d1f
   shared_preferences_foundation: fcdcbc04712aee1108ac7fda236f363274528f78
-  sqflite: 673a0e54cc04b7d6dba8d24fb8095b31c3a99eec
+  sqflite_darwin: a553b1fd6fe66f53bbb0fe5b4f5bab93f08d7a13
   sqlite3: 0bb0e6389d824e40296f531b858a2a0b71c0d2fb
   sqlite3_flutter_libs: c00457ebd31e59fa6bb830380ddba24d44fbcd3b
   SwiftyGif: 706c60cf65fa2bc5ee0313beece843c8eb8194d4

ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme

@@ -59,6 +59,7 @@
       ignoresPersistentStateOnLaunch = "NO"
       debugDocumentVersioning = "YES"
       debugServiceExtension = "internal"
+      showGraphicsOverview = "Yes"
       allowLocationSimulation = "YES">
       <BuildableProductRunnable
          runnableDebuggingMode = "0">

ios/Runner/Info.plist

@@ -1,87 +1,91 @@
 <?xml version="1.0" encoding="UTF-8"?>
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
-	<dict>
-		<key>CFBundleURLTypes</key>
-		<array>
-			<dict>
-				<key>CFBundleURLName</key>
-				<string></string>
-				<key>CFBundleTypeRole</key>
-				<string>Editor</string>
-				<key>CFBundleURLSchemes</key>
-				<array>
-					<string>solink</string>
-				</array>
-			</dict>
-		</array>
-		<key>FirebaseMessagingAutoInitEnabled</key>
-		<false/>
-		<key>CADisableMinimumFrameDurationOnPhone</key>
-		<true/>
-		<key>CFBundleDevelopmentRegion</key>
-		<string>$(DEVELOPMENT_LANGUAGE)</string>
-		<key>CFBundleDisplayName</key>
-		<string>Solian</string>
-		<key>CFBundleExecutable</key>
-		<string>$(EXECUTABLE_NAME)</string>
-		<key>CFBundleIdentifier</key>
-		<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
-		<key>CFBundleInfoDictionaryVersion</key>
-		<string>6.0</string>
-		<key>CFBundleName</key>
-		<string>solian</string>
-		<key>CFBundlePackageType</key>
-		<string>APPL</string>
-		<key>CFBundleShortVersionString</key>
-		<string>$(FLUTTER_BUILD_NAME)</string>
-		<key>CFBundleSignature</key>
-		<string>????</string>
-		<key>CFBundleVersion</key>
-		<string>$(FLUTTER_BUILD_NUMBER)</string>
-		<key>ITSAppUsesNonExemptEncryption</key>
-		<false/>
-		<key>LSRequiresIPhoneOS</key>
-		<true/>
-		<key>NSCameraUsageDescription</key>
-		<string>Allow you take photo/video for your message or post</string>
-		<key>NSMicrophoneUsageDescription</key>
-		<string>Allow you record audio for your message or post</string>
-		<key>NSPhotoLibraryUsageDescription</key>
-		<string>Allow you add photo to your message or post</string>
-		<key>UIApplicationSupportsIndirectInputEvents</key>
-		<true/>
-		<key>UIBackgroundModes</key>
-		<array>
-			<string>audio</string>
-			<string>fetch</string>
-			<string>remote-notification</string>
-			<string>voip</string>
-		</array>
-		<key>UILaunchStoryboardName</key>
-		<string>LaunchScreen</string>
-		<key>UIMainStoryboardFile</key>
-		<string>Main</string>
-		<key>UISupportedInterfaceOrientations</key>
-		<array>
-			<string>UIInterfaceOrientationPortrait</string>
-			<string>UIInterfaceOrientationLandscapeLeft</string>
-			<string>UIInterfaceOrientationLandscapeRight</string>
-		</array>
-		<key>FlutterDeepLinkingEnabled</key>
-		<true/>
-		<key>NSUserActivityTypes</key>
-		<array>
-			<string>INSendMessageIntent</string>
-		</array>
-		<key>UISupportedInterfaceOrientations~ipad</key>
-		<array>
-			<string>UIInterfaceOrientationPortrait</string>
-			<string>UIInterfaceOrientationPortraitUpsideDown</string>
-			<string>UIInterfaceOrientationLandscapeLeft</string>
-			<string>UIInterfaceOrientationLandscapeRight</string>
-		</array>
-		<key>UIStatusBarHidden</key>
-		<false/>
-	</dict>
+<dict>
+	<key>CFBundleURLTypes</key>
+	<array>
+		<dict>
+			<key>CFBundleURLName</key>
+			<string></string>
+			<key>CFBundleTypeRole</key>
+			<string>Editor</string>
+			<key>CFBundleURLSchemes</key>
+			<array>
+				<string>solink</string>
+			</array>
+		</dict>
+	</array>
+	<key>FirebaseMessagingAutoInitEnabled</key>
+	<false/>
+	<key>CADisableMinimumFrameDurationOnPhone</key>
+	<true/>
+	<key>CFBundleDevelopmentRegion</key>
+	<string>$(DEVELOPMENT_LANGUAGE)</string>
+	<key>CFBundleDisplayName</key>
+	<string>Solian</string>
+	<key>CFBundleExecutable</key>
+	<string>$(EXECUTABLE_NAME)</string>
+	<key>CFBundleIdentifier</key>
+	<string>$(PRODUCT_BUNDLE_IDENTIFIER)</string>
+	<key>CFBundleInfoDictionaryVersion</key>
+	<string>6.0</string>
+	<key>CFBundleName</key>
+	<string>solian</string>
+	<key>CFBundlePackageType</key>
+	<string>APPL</string>
+	<key>CFBundleShortVersionString</key>
+	<string>$(FLUTTER_BUILD_NAME)</string>
+	<key>CFBundleSignature</key>
+	<string>????</string>
+	<key>CFBundleVersion</key>
+	<string>$(FLUTTER_BUILD_NUMBER)</string>
+	<key>ITSAppUsesNonExemptEncryption</key>
+	<false/>
+	<key>LSRequiresIPhoneOS</key>
+	<true/>
+	<key>NSCameraUsageDescription</key>
+	<string>Allow you take photo/video for your message or post</string>
+	<key>NSMicrophoneUsageDescription</key>
+	<string>Allow you record audio for your message or post</string>
+	<key>NSPhotoLibraryUsageDescription</key>
+	<string>Allow you add photo to your message or post</string>
+	<key>UIApplicationSupportsIndirectInputEvents</key>
+	<true/>
+	<key>UIBackgroundModes</key>
+	<array>
+		<string>audio</string>
+		<string>fetch</string>
+		<string>remote-notification</string>
+		<string>voip</string>
+	</array>
+	<key>UILaunchStoryboardName</key>
+	<string>LaunchScreen</string>
+	<key>UIMainStoryboardFile</key>
+	<string>Main</string>
+	<key>UISupportedInterfaceOrientations</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>FlutterDeepLinkingEnabled</key>
+	<true/>
+	<key>NSUserActivityTypes</key>
+	<array>
+		<string>INSendMessageIntent</string>
+	</array>
+	<key>UISupportedInterfaceOrientations~ipad</key>
+	<array>
+		<string>UIInterfaceOrientationPortrait</string>
+		<string>UIInterfaceOrientationPortraitUpsideDown</string>
+		<string>UIInterfaceOrientationLandscapeLeft</string>
+		<string>UIInterfaceOrientationLandscapeRight</string>
+	</array>
+	<key>CFBundleLocalizations</key>
+	<array>
+		<string>en</string>
+	</array>
+	<key>UIStatusBarHidden</key>
+	<false/>
+</dict>
 </plist>

lib/bootstrapper.dart

@@ -1,25 +1,35 @@
 import 'dart:async';
+import 'dart:developer';
 
+import 'package:confetti/confetti.dart';
 import 'package:flutter/material.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:in_app_review/in_app_review.dart';
 import 'package:package_info_plus/package_info_plus.dart';
 import 'package:provider/provider.dart';
 import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/account.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/channel.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:flutter_app_update/flutter_app_update.dart';
 import 'package:version/version.dart';
 
+enum BootstrapperSpecialState {
+  userBirthday,
+  appAnniversary,
+}
+
 class BootstrapperShell extends StatefulWidget {
   final Widget child;
 
@@ -40,8 +50,54 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
 
   int _periodCursor = 0;
 
+  // Special state is some special event triggered after bootstrapping
+  BootstrapperSpecialState? _specialState;
+
   final Completer _bootCompleter = Completer();
 
+  void _requestRating() async {
+    final prefs = await SharedPreferences.getInstance();
+    if (prefs.containsKey('first_boot_time')) {
+      final rawTime = prefs.getString('first_boot_time');
+      final time = DateTime.tryParse(rawTime ?? '');
+      if (time != null &&
+          time.isBefore(DateTime.now().subtract(const Duration(days: 3)))) {
+        final inAppReview = InAppReview.instance;
+        if (prefs.getBool('rating_requested') == true) return;
+        if (await inAppReview.isAvailable()) {
+          await inAppReview.requestReview();
+          prefs.setBool('rating_requested', true);
+        } else {
+          log('Unable request app review, unavailable');
+        }
+      }
+    } else {
+      prefs.setString('first_boot_time', DateTime.now().toIso8601String());
+    }
+  }
+
+  void _updateNow(String localVersionString, String remoteVersionString) {
+    context
+        .showConfirmDialog(
+      'updateAvailable'.tr,
+      'updateAvailableDesc'.trParams({
+        'from': localVersionString,
+        'to': remoteVersionString,
+      }),
+    )
+        .then((result) {
+      if (result) {
+        final model = UpdateModel(
+          'https://files.solsynth.dev/d/production01/solian/app-arm64-v8a-release.apk',
+          'solian-app-arm64-v8a-release.apk',
+          'ic_launcher',
+          'https://testflight.apple.com/join/YJ0lmN6O',
+        );
+        AzhonAppUpdate.update(model);
+      }
+    });
+  }
+
   Future<void> _checkForUpdate() async {
     if (PlatformInfo.isWeb) return;
     try {
@@ -70,25 +126,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
               remoteBuildNumber > localBuildNumber) ||
           (remoteVersionString != localVersionString && strictUpdate)) {
         if (PlatformInfo.isAndroid) {
-          context
-              .showConfirmDialog(
-            'updateAvailable'.tr,
-            'updateAvailableDesc'.trParams({
-              'from': localVersionString,
-              'to': remoteVersionString,
-            }),
-          )
-              .then((result) {
-            if (result) {
-              final model = UpdateModel(
-                'https://files.solsynth.dev/d/production01/solian/app-arm64-v8a-release.apk',
-                'solian-app-arm64-v8a-release.apk',
-                'ic_launcher',
-                'https://testflight.apple.com/join/YJ0lmN6O',
-              );
-              AzhonAppUpdate.update(model);
-            }
-          });
+          _updateNow(localVersionString, remoteVersionString);
         } else {
           context.showInfoDialog(
             'updateAvailable'.tr,
@@ -97,9 +135,19 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
         }
       } else if (remoteVersionString != localVersionString) {
         _bootCompleter.future.then((_) {
-          context.showSnackbar('updateMayAvailable'.trParams({
-            'version': remoteVersionString,
-          }));
+          context.showSnackbar(
+            'updateMayAvailable'.trParams({
+              'version': remoteVersionString,
+            }),
+            action: PlatformInfo.isAndroid
+                ? SnackBarAction(
+                    label: 'updateNow'.tr,
+                    onPressed: () {
+                      _updateNow(localVersionString, remoteVersionString);
+                    },
+                  )
+                : null,
+          );
         });
       }
     } catch (e) {
@@ -162,12 +210,25 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
         try {
           await Future.wait([
             if (auth.isAuthorized.isTrue)
-              Get.find<ChannelProvider>().refreshAvailableChannel(),
+              Get.find<NotificationProvider>().fetchNotification(),
             if (auth.isAuthorized.isTrue)
               Get.find<RelationshipProvider>().refreshRelativeList(),
             if (auth.isAuthorized.isTrue)
               Get.find<RealmProvider>().refreshAvailableRealms(),
           ]);
+
+          if (auth.isAuthorized.isTrue && auth.userProfile.value != null) {
+            final account = Account.fromJson(auth.userProfile.value!);
+            if (account.profile?.birthday != null) {
+              final birthDate = account.profile!.birthday!.toLocal();
+              final isBirthday = birthDate.day == DateTime.now().day;
+              if (isBirthday) {
+                setState(
+                  () => _specialState = BootstrapperSpecialState.userBirthday,
+                );
+              }
+            }
+          }
         } catch (e) {
           context.showErrorDialog(e);
         }
@@ -179,7 +240,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
         final AuthProvider auth = Get.find();
         if (auth.isAuthorized.isTrue) {
           try {
-            Get.find<WebSocketProvider>().registerPushNotifications();
+            Get.find<NotificationProvider>().registerPushNotifications();
           } catch (err) {
             context.showSnackbar(
               'pushNotifyRegisterFailed'.trParams({'reason': err.toString()}),
@@ -212,14 +273,16 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
     super.initState();
     _runPeriods();
     _checkForUpdate();
+    _bootCompleter.future.then((_) {
+      _requestRating();
+    });
   }
 
   @override
   Widget build(BuildContext context) {
     if (_isBusy || _isErrored) {
       return GestureDetector(
-        child: Material(
-          color: Theme.of(context).colorScheme.surface,
+        child: RootContainer(
           child: Column(
             mainAxisSize: MainAxisSize.max,
             mainAxisAlignment: MainAxisAlignment.spaceAround,
@@ -315,8 +378,142 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
           }
         },
       );
+    } else if (_specialState != null) {
+      return GestureDetector(
+        child: RootContainer(
+          child: switch (_specialState) {
+            BootstrapperSpecialState.appAnniversary => const Placeholder(),
+            _ => _BirthdaySpecialScreen(),
+          },
+        ),
+        onTap: () {
+          setState(() => _specialState = null);
+        },
+      );
     }
 
     return widget.child;
   }
 }
+
+class _BirthdaySpecialScreen extends StatefulWidget {
+  const _BirthdaySpecialScreen();
+
+  @override
+  State<_BirthdaySpecialScreen> createState() => _BirthdaySpecialScreenState();
+}
+
+class _BirthdaySpecialScreenState extends State<_BirthdaySpecialScreen> {
+  late final ConfettiController _confettiController =
+      ConfettiController(duration: const Duration(seconds: 10));
+
+  @override
+  void initState() {
+    _confettiController.play();
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController.dispose();
+    super.dispose();
+  }
+
+  Color get _unFocusColor =>
+      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+  String _toOrdinal(int num) {
+    if (num >= 11 && num <= 13) {
+      return '${num}th';
+    }
+
+    switch (num % 10) {
+      case 1:
+        return '${num}st';
+      case 2:
+        return '${num}nd';
+      case 3:
+        return '${num}rd';
+      default:
+        return '${num}th';
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+    final account = Account.fromJson(auth.userProfile.value!);
+
+    final birthDate = account.profile!.birthday!.toLocal();
+    final birthdayCount = DateTime.now().difference(birthDate).inDays ~/ 365;
+
+    return Stack(
+      children: <Widget>[
+        Align(
+          alignment: Alignment.center,
+          child: ConfettiWidget(
+            confettiController: _confettiController,
+            blastDirectionality: BlastDirectionality.explosive,
+            shouldLoop: true,
+            colors: const [
+              Colors.green,
+              Colors.blue,
+              Colors.pink,
+              Colors.orange,
+              Colors.purple
+            ],
+            maxBlastForce: 30,
+            minBlastForce: 15,
+            emissionFrequency: 0.05,
+            numberOfParticles: 20,
+            gravity: 0.2,
+          ),
+        ),
+        Align(
+          child: CenteredContainer(
+            maxWidth: 320,
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.center,
+              mainAxisAlignment: MainAxisAlignment.center,
+              children: [
+                Text(
+                  '🎂',
+                  style: TextStyle(fontSize: 60),
+                ),
+                const Gap(8),
+                Text(
+                  'happyBirthday'.trParams({
+                    'name': account.profile?.firstName != null
+                        ? [
+                            account.profile?.firstName,
+                            account.profile?.lastName
+                          ].join(' ')
+                        : '@${account.name}',
+                  }),
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.titleLarge,
+                ),
+                Text(
+                  'happyBirthdayDesc'.trParams({
+                    'count': _toOrdinal(birthdayCount),
+                  }),
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.bodyMedium,
+                ),
+                const Gap(8),
+                Text(
+                  'bsContinuable'.tr,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontSize: 13,
+                    color: _unFocusColor,
+                  ),
+                ).paddingOnly(bottom: 5),
+              ],
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/controllers/post_editor_controller.dart

@@ -43,14 +43,17 @@ class PostEditorController extends GetxController {
 
   RxBool isRestoreFromLocal = false.obs;
   Rx<DateTime?> lastSaveTime = Rx(null);
-  Timer? _saveTimer;
+  Future? _saveFuture;
 
   PostEditorController() {
     SharedPreferences.getInstance().then((inst) {
       _prefs = inst;
-      _saveTimer = Timer.periodic(
-        const Duration(seconds: 3),
-        (Timer t) {
+    });
+    contentController.addListener(() {
+      contentLength.value = contentController.text.length;
+      _saveFuture ??= Future.delayed(
+        const Duration(seconds: 1),
+        () {
           if (isNotEmpty) {
             localSave();
             lastSaveTime.value = DateTime.now();
@@ -59,12 +62,10 @@ class PostEditorController extends GetxController {
             localClear();
             lastSaveTime.value = null;
           }
+          _saveFuture = null;
         },
       );
     });
-    contentController.addListener(() {
-      contentLength.value = contentController.text.length;
-    });
   }
 
   Future<void> editOverview(BuildContext context) {
@@ -124,6 +125,21 @@ class PostEditorController extends GetxController {
         onRemove: (String value) {
           attachments.remove(value);
         },
+        onInsert: (String str) {
+          final text = contentController.text;
+          final selection = contentController.selection;
+          final newText = text.replaceRange(
+            selection.start,
+            selection.end,
+            str,
+          );
+          contentController.value = TextEditingValue(
+            text: newText,
+            selection: TextSelection.collapsed(
+              offset: selection.baseOffset + str.length,
+            ),
+          );
+        },
       ),
     );
   }
@@ -355,8 +371,6 @@ class PostEditorController extends GetxController {
 
   @override
   void dispose() {
-    _saveTimer?.cancel();
-
     titleController.dispose();
     descriptionController.dispose();
     contentController.dispose();

lib/controllers/post_list_controller.dart

@@ -1,9 +1,12 @@
+import 'dart:async';
 import 'dart:math';
 
 import 'package:get/get.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';
 
@@ -31,9 +34,18 @@ class PostListController extends GetxController {
     pagingController.addPageRequestListener(_onPagingControllerRequest);
   }
 
+  Completer<void>? _pagingLoadCompleter;
+
   Future<void> _onPagingControllerRequest(int pageKey) async {
     try {
+      if (_pagingLoadCompleter != null) {
+        await _pagingLoadCompleter!.future;
+        return;
+      }
+      _pagingLoadCompleter = Completer();
       final result = await loadMore();
+      _pagingLoadCompleter!.complete();
+      _pagingLoadCompleter = null;
 
       if (result != null && hasMore.value) {
         pagingController.appendPage(result, nextPageKey.value);
@@ -97,9 +109,6 @@ class PostListController extends GetxController {
       hasMore.value = false;
     }
 
-    final idx = <dynamic>{};
-    postList.retainWhere((x) => idx.add(x.id));
-
     if (postList.isNotEmpty) {
       var lastId = postList.map((x) => x.id).reduce(max);
       Get.find<LastReadProvider>().feedLastReadAt = lastId;
@@ -111,35 +120,39 @@ class PostListController extends GetxController {
   Future<List<Post>?> _loadPosts(int pageKey) async {
     isBusy.value = true;
 
-    final PostProvider provider = Get.find();
+    final PostProvider posts = Get.find();
 
     Response resp;
     try {
       if (author != null) {
-        resp = await provider.listPost(
+        resp = await posts.listPost(
           pageKey,
           author: author,
+          take: 10,
         );
       } else {
         switch (mode.value) {
           case 2:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               channel: 'shuffle',
               realm: realm,
+              take: 10,
             );
             break;
           case 1:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               channel: 'friends',
               realm: realm,
+              take: 10,
             );
             break;
           default:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               realm: realm,
+              take: 10,
             );
             break;
         }
@@ -153,6 +166,27 @@ class PostListController extends GetxController {
     final result = PaginationResult.fromJson(resp.body);
     final out = result.data?.map((e) => Post.fromJson(e)).toList();
 
+    final AttachmentProvider attach = Get.find();
+
+    if (out != null) {
+      final attachmentIds = out
+          .mapMany((x) => x.body['attachments'] ?? [])
+          .cast<String>()
+          .toSet()
+          .toList();
+      final attachmentOut = await attach.listMetadata(attachmentIds);
+
+      for (var idx = 0; idx < out.length; idx++) {
+        final rids = List<String>.from(out[idx].body['attachments'] ?? []);
+        out[idx].preload = PostPreload(
+          attachments: attachmentOut
+              .where((x) => x != null && rids.contains(x.rid))
+              .cast<Attachment>()
+              .toList(),
+        );
+      }
+    }
+
     postTotal.value = result.count;
 
     return out;

lib/main.dart

@@ -18,6 +18,7 @@ import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/providers/navigation.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/stickers.dart';
 import 'package:solian/providers/subscription.dart';
 import 'package:solian/providers/theme_switcher.dart';
@@ -57,13 +58,16 @@ void main() async {
 
 Future<void> _initializeFirebase() async {
   await Firebase.initializeApp(options: DefaultFirebaseOptions.currentPlatform);
-  FlutterError.onError = (errorDetails) {
-    FirebaseCrashlytics.instance.recordFlutterFatalError(errorDetails);
-  };
-  PlatformDispatcher.instance.onError = (error, stack) {
-    FirebaseCrashlytics.instance.recordError(error, stack, fatal: true);
-    return true;
-  };
+  if (PlatformInfo.isIOS || PlatformInfo.isAndroid || PlatformInfo.isMacOS) {
+    // Initialize firebase crashlytics for the platform that supported
+    FlutterError.onError = (errorDetails) {
+      FirebaseCrashlytics.instance.recordFlutterFatalError(errorDetails);
+    };
+    PlatformDispatcher.instance.onError = (error, stack) {
+      FirebaseCrashlytics.instance.recordError(error, stack, fatal: true);
+      return true;
+    };
+  }
 }
 
 Future<void> _initializeBackgroundNotificationService() async {
@@ -135,11 +139,12 @@ class SolianApp extends StatelessWidget {
     Get.put(NavigationStateProvider());
 
     Get.lazyPut(() => AuthProvider());
+    Get.lazyPut(() => WebSocketProvider());
     Get.lazyPut(() => RelationshipProvider());
     Get.lazyPut(() => PostProvider());
     Get.lazyPut(() => StickerProvider());
     Get.lazyPut(() => AttachmentProvider());
-    Get.lazyPut(() => WebSocketProvider());
+    Get.lazyPut(() => NotificationProvider());
     Get.lazyPut(() => StatusProvider());
     Get.lazyPut(() => ChannelProvider());
     Get.lazyPut(() => RealmProvider());
@@ -151,6 +156,6 @@ class SolianApp extends StatelessWidget {
     Get.lazyPut(() => LastReadProvider());
     Get.lazyPut(() => SubscriptionProvider());
 
-    Get.find<WebSocketProvider>().requestPermissions();
+    Get.find<NotificationProvider>().requestPermissions();
   }
 }

lib/models/audit_log.dart

@@ -0,0 +1,38 @@
+import 'package:json_annotation/json_annotation.dart';
+import 'package:solian/models/account.dart';
+
+part 'audit_log.g.dart';
+
+@JsonSerializable()
+class AuditEvent {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String type;
+  String target;
+  String location;
+  String ipAddress;
+  String userAgent;
+  Account account;
+  int accountId;
+
+  AuditEvent({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    required this.deletedAt,
+    required this.type,
+    required this.target,
+    required this.location,
+    required this.ipAddress,
+    required this.userAgent,
+    required this.account,
+    required this.accountId,
+  });
+
+  static AuditEvent fromJson(Map<String, dynamic> json) =>
+      _$AuditEventFromJson(json);
+
+  Map<String, dynamic> toJson() => _$AuditEventToJson(this);
+}

lib/models/audit_log.g.dart

@@ -0,0 +1,38 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'audit_log.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+AuditEvent _$AuditEventFromJson(Map<String, dynamic> json) => AuditEvent(
+      id: (json['id'] as num).toInt(),
+      createdAt: DateTime.parse(json['created_at'] as String),
+      updatedAt: DateTime.parse(json['updated_at'] as String),
+      deletedAt: json['deleted_at'] == null
+          ? null
+          : DateTime.parse(json['deleted_at'] as String),
+      type: json['type'] as String,
+      target: json['target'] as String,
+      location: json['location'] as String,
+      ipAddress: json['ip_address'] as String,
+      userAgent: json['user_agent'] as String,
+      account: Account.fromJson(json['account'] as Map<String, dynamic>),
+      accountId: (json['account_id'] as num).toInt(),
+    );
+
+Map<String, dynamic> _$AuditEventToJson(AuditEvent instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'created_at': instance.createdAt.toIso8601String(),
+      'updated_at': instance.updatedAt.toIso8601String(),
+      'deleted_at': instance.deletedAt?.toIso8601String(),
+      'type': instance.type,
+      'target': instance.target,
+      'location': instance.location,
+      'ip_address': instance.ipAddress,
+      'user_agent': instance.userAgent,
+      'account': instance.account.toJson(),
+      'account_id': instance.accountId,
+    };

lib/models/notification.dart

@@ -1,18 +1,29 @@
+import 'package:flutter/material.dart';
 import 'package:json_annotation/json_annotation.dart';
 
 part 'notification.g.dart';
 
+const Map<String, IconData> NotificationTopicIcons = {
+  'passport.security.alert': Icons.gpp_maybe,
+  'interactive.subscription': Icons.subscriptions,
+  'interactive.feedback': Icons.add_reaction,
+  'messaging.callStart': Icons.call_received,
+};
+
 @JsonSerializable()
 class Notification {
   int id;
   DateTime createdAt;
   DateTime updatedAt;
   DateTime? deletedAt;
+  DateTime? readAt;
+  String topic;
   String title;
   String? subtitle;
   String body;
   String? avatar;
   String? picture;
+  Map<String, dynamic>? metadata;
   int? senderId;
   int accountId;
 
@@ -21,11 +32,14 @@ class Notification {
     required this.createdAt,
     required this.updatedAt,
     required this.deletedAt,
+    required this.readAt,
+    required this.topic,
     required this.title,
     required this.subtitle,
     required this.body,
     required this.avatar,
     required this.picture,
+    required this.metadata,
     required this.senderId,
     required this.accountId,
   });

lib/models/notification.g.dart

@@ -13,11 +13,16 @@ Notification _$NotificationFromJson(Map<String, dynamic> json) => Notification(
       deletedAt: json['deleted_at'] == null
           ? null
           : DateTime.parse(json['deleted_at'] as String),
+      readAt: json['read_at'] == null
+          ? null
+          : DateTime.parse(json['read_at'] as String),
+      topic: json['topic'] as String,
       title: json['title'] as String,
       subtitle: json['subtitle'] as String?,
       body: json['body'] as String,
       avatar: json['avatar'] as String?,
       picture: json['picture'] as String?,
+      metadata: json['metadata'] as Map<String, dynamic>?,
       senderId: (json['sender_id'] as num?)?.toInt(),
       accountId: (json['account_id'] as num).toInt(),
     );
@@ -28,11 +33,14 @@ Map<String, dynamic> _$NotificationToJson(Notification instance) =>
       'created_at': instance.createdAt.toIso8601String(),
       'updated_at': instance.updatedAt.toIso8601String(),
       'deleted_at': instance.deletedAt?.toIso8601String(),
+      'read_at': instance.readAt?.toIso8601String(),
+      'topic': instance.topic,
       'title': instance.title,
       'subtitle': instance.subtitle,
       'body': instance.body,
       'avatar': instance.avatar,
       'picture': instance.picture,
+      'metadata': instance.metadata,
       'sender_id': instance.senderId,
       'account_id': instance.accountId,
     };

lib/models/post.dart

@@ -1,10 +1,19 @@
 import 'package:json_annotation/json_annotation.dart';
 import 'package:solian/models/account.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/post_categories.dart';
 import 'package:solian/models/realm.dart';
 
 part 'post.g.dart';
 
+class PostPreload {
+  List<Attachment> attachments;
+
+  PostPreload({
+    required this.attachments,
+  });
+}
+
 @JsonSerializable()
 class Post {
   int id;
@@ -15,6 +24,7 @@ class Post {
   String? alias;
   String? areaAlias;
   dynamic body;
+  int visibility;
   List<Tag>? tags;
   List<Category>? categories;
   List<Post>? replies;
@@ -33,6 +43,9 @@ class Post {
   Account author;
   PostMetric? metric;
 
+  @JsonKey(includeFromJson: false, includeToJson: false)
+  PostPreload? preload;
+
   Post({
     required this.id,
     required this.createdAt,
@@ -43,6 +56,7 @@ class Post {
     required this.areaAlias,
     required this.type,
     required this.body,
+    required this.visibility,
     required this.tags,
     required this.categories,
     required this.replies,

lib/models/post.g.dart

@@ -20,6 +20,7 @@ Post _$PostFromJson(Map<String, dynamic> json) => Post(
       areaAlias: json['area_alias'] as String?,
       type: json['type'] as String,
       body: json['body'],
+      visibility: (json['visibility'] as num).toInt(),
       tags: (json['tags'] as List<dynamic>?)
           ?.map((e) => Tag.fromJson(e as Map<String, dynamic>))
           .toList(),
@@ -67,6 +68,7 @@ Map<String, dynamic> _$PostToJson(Post instance) => <String, dynamic>{
       'alias': instance.alias,
       'area_alias': instance.areaAlias,
       'body': instance.body,
+      'visibility': instance.visibility,
       'tags': instance.tags?.map((e) => e.toJson()).toList(),
       'categories': instance.categories?.map((e) => e.toJson()).toList(),
       'replies': instance.replies?.map((e) => e.toJson()).toList(),

lib/models/theme.dart

@@ -0,0 +1,50 @@
+import 'dart:ui';
+
+import 'package:json_annotation/json_annotation.dart';
+
+part 'theme.g.dart';
+
+@JsonSerializable(converters: [ColorConverter()])
+class SolianThemeData {
+  String id;
+  Color seedColor;
+  String? fontFamily;
+  List<String>? fontFamilyFallback;
+
+  SolianThemeData({
+    required this.id,
+    required this.seedColor,
+    this.fontFamily,
+    this.fontFamilyFallback,
+  });
+
+  factory SolianThemeData.fromJson(Map<String, dynamic> json) =>
+      _$SolianThemeDataFromJson(json);
+
+  Map<String, dynamic> toJson() => _$SolianThemeDataToJson(this);
+
+  @override
+  int get hashCode => id.hashCode;
+
+  @override
+  bool operator ==(Object other) {
+    if (other is SolianThemeData) {
+      return id == other.id;
+    }
+    return false;
+  }
+}
+
+class ColorConverter extends JsonConverter<Color, int> {
+  const ColorConverter();
+
+  @override
+  Color fromJson(int json) {
+    return Color(json);
+  }
+
+  @override
+  int toJson(Color object) {
+    return object.value;
+  }
+}

lib/models/theme.g.dart

@@ -0,0 +1,26 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'theme.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+SolianThemeData _$SolianThemeDataFromJson(Map<String, dynamic> json) =>
+    SolianThemeData(
+      id: json['id'] as String,
+      seedColor:
+          const ColorConverter().fromJson((json['seed_color'] as num).toInt()),
+      fontFamily: json['font_family'] as String?,
+      fontFamilyFallback: (json['font_family_fallback'] as List<dynamic>?)
+          ?.map((e) => e as String)
+          .toList(),
+    );
+
+Map<String, dynamic> _$SolianThemeDataToJson(SolianThemeData instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'seed_color': const ColorConverter().toJson(instance.seedColor),
+      'font_family': instance.fontFamily,
+      'font_family_fallback': instance.fontFamilyFallback,
+    };

lib/platform.dart

@@ -27,6 +27,10 @@ abstract class PlatformInfo {
 
   static bool get canCacheImage => isAndroid || isIOS || isMacOS;
 
+  static bool get canRateTheApp => isIOS || isMacOS;
+
+  static bool get canCropImage => isIOS || isAndroid || isWeb;
+
   static bool get canRecord => (isMobile || isMacOS);
 
   static bool get canPushNotification => isAndroid || isIOS || isMacOS;
@@ -38,4 +42,4 @@ abstract class PlatformInfo {
     } catch (_) {}
     return version;
   }
-}
+}

lib/providers/auth.dart

@@ -11,6 +11,7 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/database/database.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
 
@@ -125,7 +126,7 @@ class AuthProvider extends GetConnect {
       userAgent: await ServiceFinder.getUserAgent(),
       sendUserAgent: true,
     );
-    client.httpClient.addAuthenticator(requestAuthenticator);
+    client.httpClient.addRequestModifier(requestAuthenticator);
     client.httpClient.baseUrl = ServiceFinder.buildUrl(service, null);
 
     return client;
@@ -174,7 +175,7 @@ class AuthProvider extends GetConnect {
     );
 
     Get.find<WebSocketProvider>().connect();
-    Get.find<WebSocketProvider>().notifyPrefetch();
+    Get.find<NotificationProvider>().fetchNotification();
 
     return credentials!;
   }
@@ -184,8 +185,8 @@ class AuthProvider extends GetConnect {
     userProfile.value = null;
 
     Get.find<WebSocketProvider>().disconnect();
-    Get.find<WebSocketProvider>().notifications.clear();
-    Get.find<WebSocketProvider>().notificationUnread.value = 0;
+    Get.find<NotificationProvider>().notifications.clear();
+    Get.find<NotificationProvider>().notificationUnread.value = 0;
 
     AppDatabase.removeDatabase();
     autoStopBackgroundNotificationService();

lib/providers/call.dart

@@ -392,7 +392,7 @@ class ChatCallProvider extends GetxController {
   }
 
   Future gotoScreen(BuildContext context) {
-    return Navigator.of(context, rootNavigator: true).push(
+    return Navigator.of(context).push(
       MaterialPageRoute(builder: (context) => const CallScreen()),
     );
   }

lib/providers/content/attachment.dart

@@ -23,6 +23,21 @@ class AttachmentProvider extends GetConnect {
 
   final Map<String, Attachment> _cachedResponses = {};
 
+  List<Attachment?> listMetadataFromCache(List<String> rid) {
+    if (rid.isEmpty) return List.empty();
+
+    List<Attachment?> result = List.filled(rid.length, null);
+    for (var idx = 0; idx < rid.length; idx++) {
+      if (_cachedResponses.containsKey(rid[idx])) {
+        result[idx] = _cachedResponses[rid[idx]];
+      } else {
+        result[idx] = null;
+      }
+    }
+
+    return result;
+  }
+
   Future<List<Attachment?>> listMetadata(
     List<String> rid, {
     noCache = false,
@@ -41,25 +56,27 @@ class AttachmentProvider extends GetConnect {
       }
     }
 
-    final resp = await get(
-      '/attachments?take=${pendingQuery.length}&id=${pendingQuery.join(',')}',
-    );
-    if (resp.statusCode != 200) return result;
+    if (pendingQuery.isNotEmpty) {
+      final resp = await get(
+        '/attachments?take=${pendingQuery.length}&id=${pendingQuery.join(',')}',
+      );
+      if (resp.statusCode != 200) return result;
 
-    final rawOut = PaginationResult.fromJson(resp.body);
-    if (rawOut.data == null) return result;
+      final rawOut = PaginationResult.fromJson(resp.body);
+      if (rawOut.data == null) return result;
 
-    final List<Attachment> out =
-        rawOut.data!.map((x) => Attachment.fromJson(x)).toList();
-    for (final item in out) {
-      if (item.destination != 0 && item.isAnalyzed) {
-        _cachedResponses[item.rid] = item;
+      final List<Attachment> out =
+          rawOut.data!.map((x) => Attachment.fromJson(x)).toList();
+      for (final item in out) {
+        if (item.destination != 0 && item.isAnalyzed) {
+          _cachedResponses[item.rid] = item;
+        }
       }
-    }
-    for (var i = 0; i < out.length; i++) {
-      for (var j = 0; j < rid.length; j++) {
-        if (out[i].rid == rid[j]) {
-          result[j] = out[i];
+      for (var i = 0; i < out.length; i++) {
+        for (var j = 0; j < rid.length; j++) {
+          if (out[i].rid == rid[j]) {
+            result[j] = out[i];
+          }
         }
       }
     }

lib/providers/content/channel.dart

@@ -9,25 +9,6 @@ import 'package:uuid/uuid.dart';
 
 class ChannelProvider extends GetxController {
   RxBool isLoading = false.obs;
-  RxList<Channel> availableChannels = RxList.empty(growable: true);
-
-  List<Channel> get groupChannels =>
-      availableChannels.where((x) => x.type == 0).toList();
-  List<Channel> get directChannels =>
-      availableChannels.where((x) => x.type == 1).toList();
-
-  Future<void> refreshAvailableChannel() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) throw const UnauthorizedException();
-
-    isLoading.value = true;
-    final resp = await listAvailableChannel();
-    isLoading.value = false;
-
-    availableChannels.value =
-        resp.body.map((x) => Channel.fromJson(x)).toList().cast<Channel>();
-    availableChannels.refresh();
-  }
 
   Future<Response> getChannel(String alias, {String realm = 'global'}) async {
     final AuthProvider auth = Get.find();
@@ -89,18 +70,22 @@ class ChannelProvider extends GetxController {
     return resp;
   }
 
-  Future<Response> listAvailableChannel({String scope = 'global'}) async {
+  Future<List<Channel>> listAvailableChannel({
+    String scope = 'global',
+    bool isDirect = false,
+  }) async {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) throw const UnauthorizedException();
 
     final client = await auth.configureClient('messaging');
 
-    final resp = await client.get('/channels/$scope/me/available');
+    final resp =
+        await client.get('/channels/$scope/me/available?direct=$isDirect');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
 
-    return resp;
+    return List.from(resp.body.map((x) => Channel.fromJson(x)));
   }
 
   Future<Response> createChannel(String scope, dynamic payload) async {

lib/providers/content/posts.dart

@@ -3,22 +3,11 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/services.dart';
-
-class PostProvider extends GetConnect {
-  @override
-  void onInit() {
-    httpClient.baseUrl = ServiceFinder.buildUrl('interactive', null);
-  }
 
+class PostProvider extends GetxController {
   Future<Response> seeWhatsNew(int pivot) async {
-    GetConnect client;
     final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final client = await auth.configureClient('co');
     final resp = await client.get('/whats-new?pivot=$pivot');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
@@ -28,19 +17,14 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> listRecommendations(int page,
-      {String? realm, String? channel}) async {
-    GetConnect client;
-    final AuthProvider auth = Get.find();
+      {String? realm, String? channel, int take = 10}) async {
     final queries = [
-      'take=${10}',
+      'take=$take',
       'offset=$page',
       if (realm != null) 'realm=$realm',
     ];
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('interactive');
     final resp = await client.get(
       channel == null
           ? '/recommendations?${queries.join('&')}'
@@ -60,9 +44,33 @@ class PostProvider extends GetConnect {
     final queries = [
       'take=${10}',
       'offset=$page',
+      'truncate=false',
     ];
     final client = await auth.configureClient('interactive');
-    final resp = await client.get('/posts/drafts?${queries.join('&')}');
+    final resp = await client.get(
+      '/posts/drafts?${queries.join('&')}',
+    );
+    if (resp.statusCode != 200) {
+      throw RequestException(resp);
+    }
+
+    return resp;
+  }
+
+  Future<Response> searchPost(String probe, int page,
+      {String? realm, String? author, tag, category, int take = 10}) async {
+    final queries = [
+      'probe=$probe',
+      'take=$take',
+      'offset=$page',
+      if (tag != null) 'tag=$tag',
+      if (category != null) 'category=$category',
+      if (author != null) 'author=$author',
+      if (realm != null) 'realm=$realm',
+    ];
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/search?${queries.join('&')}');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -71,16 +79,18 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> listPost(int page,
-      {String? realm, String? author, tag, category}) async {
+      {String? realm, String? author, tag, category, int take = 10}) async {
     final queries = [
-      'take=${10}',
+      'take=$take',
       'offset=$page',
       if (tag != null) 'tag=$tag',
       if (category != null) 'category=$category',
       if (author != null) 'author=$author',
       if (realm != null) 'realm=$realm',
     ];
-    final resp = await get('/posts?${queries.join('&')}');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts?${queries.join('&')}');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -89,7 +99,10 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> listPostReplies(String alias, int page) async {
-    final resp = await get('/posts/$alias/replies?take=${10}&offset=$page');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp =
+        await client.get('/posts/$alias/replies?take=${10}&offset=$page');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -98,7 +111,9 @@ class PostProvider extends GetConnect {
   }
 
   Future<List<Post>> listPostFeaturedReply(String alias, {int take = 1}) async {
-    final resp = await get('/posts/$alias/replies/featured?take=$take');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias/replies/featured?take=$take');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -107,16 +122,9 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> getPost(String alias) async {
-    final resp = await get('/posts/$alias');
-    if (resp.statusCode != 200) {
-      throw RequestException(resp);
-    }
-
-    return resp;
-  }
-
-  Future<Response> getArticle(String alias) async {
-    final resp = await get('/articles/$alias');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }

lib/providers/database/database.g.dart

@@ -299,53 +299,71 @@ typedef $$LocalMessageEventTableTableUpdateCompanionBuilder
 });
 
 class $$LocalMessageEventTableTableFilterComposer
-    extends FilterComposer<_$AppDatabase, $LocalMessageEventTableTable> {
-  $$LocalMessageEventTableTableFilterComposer(super.$state);
-  ColumnFilters<int> get id => $state.composableBuilder(
-      column: $state.table.id,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableFilterComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  ColumnFilters<int> get id => $composableBuilder(
+      column: $table.id, builder: (column) => ColumnFilters(column));
 
-  ColumnFilters<int> get channelId => $state.composableBuilder(
-      column: $state.table.channelId,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+  ColumnFilters<int> get channelId => $composableBuilder(
+      column: $table.channelId, builder: (column) => ColumnFilters(column));
 
   ColumnWithTypeConverterFilters<Event?, Event, String> get data =>
-      $state.composableBuilder(
-          column: $state.table.data,
-          builder: (column, joinBuilders) => ColumnWithTypeConverterFilters(
-              column,
-              joinBuilders: joinBuilders));
+      $composableBuilder(
+          column: $table.data,
+          builder: (column) => ColumnWithTypeConverterFilters(column));
 
-  ColumnFilters<DateTime> get createdAt => $state.composableBuilder(
-      column: $state.table.createdAt,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+  ColumnFilters<DateTime> get createdAt => $composableBuilder(
+      column: $table.createdAt, builder: (column) => ColumnFilters(column));
 }
 
 class $$LocalMessageEventTableTableOrderingComposer
-    extends OrderingComposer<_$AppDatabase, $LocalMessageEventTableTable> {
-  $$LocalMessageEventTableTableOrderingComposer(super.$state);
-  ColumnOrderings<int> get id => $state.composableBuilder(
-      column: $state.table.id,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableOrderingComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  ColumnOrderings<int> get id => $composableBuilder(
+      column: $table.id, builder: (column) => ColumnOrderings(column));
 
-  ColumnOrderings<int> get channelId => $state.composableBuilder(
-      column: $state.table.channelId,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<int> get channelId => $composableBuilder(
+      column: $table.channelId, builder: (column) => ColumnOrderings(column));
 
-  ColumnOrderings<String> get data => $state.composableBuilder(
-      column: $state.table.data,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<String> get data => $composableBuilder(
+      column: $table.data, builder: (column) => ColumnOrderings(column));
 
-  ColumnOrderings<DateTime> get createdAt => $state.composableBuilder(
-      column: $state.table.createdAt,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<DateTime> get createdAt => $composableBuilder(
+      column: $table.createdAt, builder: (column) => ColumnOrderings(column));
+}
+
+class $$LocalMessageEventTableTableAnnotationComposer
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableAnnotationComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  GeneratedColumn<int> get id =>
+      $composableBuilder(column: $table.id, builder: (column) => column);
+
+  GeneratedColumn<int> get channelId =>
+      $composableBuilder(column: $table.channelId, builder: (column) => column);
+
+  GeneratedColumnWithTypeConverter<Event?, String> get data =>
+      $composableBuilder(column: $table.data, builder: (column) => column);
+
+  GeneratedColumn<DateTime> get createdAt =>
+      $composableBuilder(column: $table.createdAt, builder: (column) => column);
 }
 
 class $$LocalMessageEventTableTableTableManager extends RootTableManager<
@@ -354,6 +372,7 @@ class $$LocalMessageEventTableTableTableManager extends RootTableManager<
     LocalMessageEventTableData,
     $$LocalMessageEventTableTableFilterComposer,
     $$LocalMessageEventTableTableOrderingComposer,
+    $$LocalMessageEventTableTableAnnotationComposer,
     $$LocalMessageEventTableTableCreateCompanionBuilder,
     $$LocalMessageEventTableTableUpdateCompanionBuilder,
     (
@@ -368,10 +387,15 @@ class $$LocalMessageEventTableTableTableManager extends RootTableManager<
       : super(TableManagerState(
           db: db,
           table: table,
-          filteringComposer: $$LocalMessageEventTableTableFilterComposer(
-              ComposerState(db, table)),
-          orderingComposer: $$LocalMessageEventTableTableOrderingComposer(
-              ComposerState(db, table)),
+          createFilteringComposer: () =>
+              $$LocalMessageEventTableTableFilterComposer(
+                  $db: db, $table: table),
+          createOrderingComposer: () =>
+              $$LocalMessageEventTableTableOrderingComposer(
+                  $db: db, $table: table),
+          createComputedFieldComposer: () =>
+              $$LocalMessageEventTableTableAnnotationComposer(
+                  $db: db, $table: table),
           updateCompanionCallback: ({
             Value<int> id = const Value.absent(),
             Value<int> channelId = const Value.absent(),
@@ -410,6 +434,7 @@ typedef $$LocalMessageEventTableTableProcessedTableManager
         LocalMessageEventTableData,
         $$LocalMessageEventTableTableFilterComposer,
         $$LocalMessageEventTableTableOrderingComposer,
+        $$LocalMessageEventTableTableAnnotationComposer,
         $$LocalMessageEventTableTableCreateCompanionBuilder,
         $$LocalMessageEventTableTableUpdateCompanionBuilder,
         (

lib/providers/database/services/messages.dart

@@ -1,3 +1,6 @@
+import 'dart:convert';
+
+import 'package:collection/collection.dart';
 import 'package:drift/drift.dart';
 import 'package:get/get.dart' hide Value;
 import 'package:solian/exceptions/request.dart';
@@ -182,4 +185,26 @@ class MessagesFetchingProvider extends GetxController {
           ..orderBy([(t) => OrderingTerm.desc(t.id)]))
         .getSingleOrNull();
   }
+
+  Future<Map<int, List<LocalMessageEventTableData>>>
+      getLastInAllChannels() async {
+    final database = Get.find<DatabaseProvider>().database;
+    final rows = await database.customSelect('''
+    SELECT id, channel_id, data, created_at
+    FROM ${database.localMessageEventTable.actualTableName}
+    WHERE (channel_id, created_at) IN (
+      SELECT channel_id, MAX(created_at)
+      FROM ${database.localMessageEventTable.actualTableName}
+      GROUP BY channel_id
+    )
+    ''', readsFrom: {database.localMessageEventTable}).get();
+    return rows.map((row) {
+      return LocalMessageEventTableData(
+        id: row.read<int>('id'),
+        channelId: row.read<int>('channel_id'),
+        data: Event.fromJson(jsonDecode(row.read<String>('data'))),
+        createdAt: row.read<DateTime>('created_at'),
+      );
+    }).groupListsBy((x) => x.channelId);
+  }
 }

lib/providers/experience.dart

@@ -4,19 +4,19 @@ import 'package:intl/intl.dart';
 class ExperienceProvider extends GetxController {
   static List<int> experienceToLevelRequirements = [
     0, // Level 0
-    100, // Level 1
-    400, // Level 2
-    900, // Level 3
-    1600, // Level 4
-    2500, // Level 5
-    3600, // Level 6
-    4900, // Level 7
-    6400, // Level 8
-    8100, // Level 9
-    10000, // Level 10
-    12100, // Level 11
-    14400, // Level 12
-    36800 // Level 13
+    1000, // Level 1
+    4000, // Level 2
+    9000, // Level 3
+    16000, // Level 4
+    25000, // Level 5
+    36000, // Level 6
+    49000, // Level 7
+    64000, // Level 8
+    81000, // Level 9
+    100000, // Level 10
+    121000, // Level 11
+    144000, // Level 12
+    368000 // Level 13
   ];
 
   static List<String> levelLabelMapping =
@@ -35,7 +35,7 @@ class ExperienceProvider extends GetxController {
     final idx = experienceToLevelRequirements.indexOf(exp);
     if (idx + 1 >= experienceToLevelRequirements.length) return 1;
     final nextExp = experienceToLevelRequirements[idx + 1];
-    return exp / nextExp;
+    return (experience - exp).abs() / (exp - nextExp).abs();
   }
 
   static String calcLevelUpProgressLevel(int experience) {
@@ -43,9 +43,9 @@ class ExperienceProvider extends GetxController {
         .firstWhere((x) => x <= experience);
     final idx = experienceToLevelRequirements.indexOf(exp);
     if (idx + 1 >= experienceToLevelRequirements.length) return 'Infinity';
-    final nextExp = experienceToLevelRequirements[idx + 1];
+    final nextExp = exp - experienceToLevelRequirements[idx + 1];
     final formatter =
         NumberFormat.compactCurrency(symbol: '', decimalDigits: 1);
-    return '${formatter.format(exp)}/${formatter.format(nextExp)}';
+    return '${formatter.format((exp - experience).abs())}/${formatter.format(nextExp.abs())}';
   }
 }

lib/providers/notifications.dart

@@ -0,0 +1,175 @@
+import 'dart:developer';
+
+import 'package:firebase_messaging/firebase_messaging.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+import 'package:flutter_udid/flutter_udid.dart';
+import 'package:get/get.dart';
+import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/platform.dart';
+import 'package:solian/providers/auth.dart';
+
+class NotificationProvider extends GetxController {
+  RxBool isBusy = false.obs;
+
+  RxInt notificationUnread = 0.obs;
+  RxList<Notification> notifications =
+      List<Notification>.empty(growable: true).obs;
+
+  Future<void> fetchNotification() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.get('/notifications?skip=0&take=100');
+    if (resp.statusCode == 200) {
+      final result = PaginationResult.fromJson(resp.body);
+      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
+      if (data != null) {
+        notifications.addAll(data);
+        notificationUnread.value = data.where((x) => x.readAt == null).length;
+      }
+    }
+  }
+
+  Future<void> markAllRead() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    isBusy.value = true;
+
+    final NotificationProvider nty = Get.find();
+
+    List<int> markList = List.empty(growable: true);
+    for (final element in nty.notifications) {
+      if (element.id <= 0) continue;
+      if (element.readAt != null) continue;
+      markList.add(element.id);
+    }
+
+    if (markList.isNotEmpty) {
+      final client = await auth.configureClient('auth');
+      await client.put('/notifications/read', {'messages': markList});
+    }
+
+    nty.notifications.value = nty.notifications.map((x) {
+      x.readAt = DateTime.now();
+      return x;
+    }).toList();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  Future<void> markOneRead(Notification element, int index) async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final NotificationProvider nty = Get.find();
+
+    if (element.id <= 0) {
+      nty.notifications.removeAt(index);
+      return;
+    } else if (element.readAt != null) {
+      return;
+    }
+
+    isBusy.value = true;
+
+    final client = await auth.configureClient('auth');
+
+    await client.put('/notifications/read/${element.id}', {});
+
+    nty.notifications[0].readAt = DateTime.now();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  void requestPermissions() {
+    try {
+      FirebaseMessaging.instance.requestPermission(
+          alert: true,
+          announcement: true,
+          carPlay: true,
+          badge: true,
+          sound: true);
+    } catch (_) {
+      // When firebase isn't initialized (background service)
+      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
+          FlutterLocalNotificationsPlugin();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              AndroidFlutterLocalNotificationsPlugin>()
+          ?.requestNotificationsPermission();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              IOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              MacOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+    }
+  }
+
+  Future<void> registerPushNotifications() async {
+    if (PlatformInfo.isWeb) return;
+
+    final prefs = await SharedPreferences.getInstance();
+    if (prefs.getBool('service_background_notification') == true) {
+      log('Background notification service has been enabled, skip register push notifications');
+      return;
+    }
+
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    late final String? token;
+    late final String provider;
+    var deviceUuid = await _getDeviceUuid();
+
+    if (deviceUuid == null || deviceUuid.isEmpty) {
+      log("Unable to active push notifications, couldn't get device uuid");
+      return;
+    } else {
+      log('Device UUID is $deviceUuid');
+    }
+
+    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
+      provider = 'apple';
+      token = await FirebaseMessaging.instance.getAPNSToken();
+    } else {
+      provider = 'firebase';
+      token = await FirebaseMessaging.instance.getToken();
+    }
+    log('Device Push Token is $token');
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.post('/notifications/subscribe', {
+      'provider': provider,
+      'device_token': token,
+      'device_id': deviceUuid,
+    });
+    if (resp.statusCode != 200 && resp.statusCode != 400) {
+      throw RequestException(resp);
+    }
+  }
+
+  Future<String?> _getDeviceUuid() async {
+    if (PlatformInfo.isWeb) return null;
+    return await FlutterUdid.consistentUdid;
+  }
+}

lib/providers/relation.dart

@@ -26,6 +26,19 @@ class RelationshipProvider extends GetxController {
     return _friends.any((x) => x.relatedId == account.id);
   }
 
+  Future<Relationship?> getRelationship(int relatedId) async {
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('auth');
+    final resp = await client.get('/users/me/relations/$relatedId');
+    if (resp.statusCode == 404) {
+      return null;
+    } else if (resp.statusCode != 200) {
+      throw RequestException(resp);
+    }
+
+    return Relationship.fromJson(resp.body);
+  }
+
   Future<Response> listRelation() async {
     final AuthProvider auth = Get.find();
     final client = await auth.configureClient('auth');
@@ -38,7 +51,19 @@ class RelationshipProvider extends GetxController {
     return client.get('/users/me/relations?status=$status');
   }
 
-  Future<Response> makeFriend(String username) async {
+  Future<Relationship?> blockUser(String username) async {
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('auth');
+    final resp =
+        await client.post('/users/me/relations/block?related=$username', {});
+    if (resp.statusCode != 200) {
+      throw RequestException(resp);
+    }
+
+    return Relationship.fromJson(resp.body);
+  }
+
+  Future<Relationship?> makeFriend(String username) async {
     final AuthProvider auth = Get.find();
     final client = await auth.configureClient('auth');
     final resp = await client.post('/users/me/relations?related=$username', {});
@@ -46,7 +71,7 @@ class RelationshipProvider extends GetxController {
       throw RequestException(resp);
     }
 
-    return resp;
+    return Relationship.fromJson(resp.body);
   }
 
   Future<Response> handleRelation(
@@ -64,17 +89,17 @@ class RelationshipProvider extends GetxController {
     return resp;
   }
 
-  Future<Response> editRelation(Relationship relationship, int status) async {
+  Future<Relationship?> editRelation(int relatedId, int status) async {
     final AuthProvider auth = Get.find();
     final client = await auth.configureClient('auth');
-    final resp = await client.patch(
-      '/users/me/relations/${relationship.relatedId}',
+    final resp = await client.put(
+      '/users/me/relations/$relatedId',
       {'status': status},
     );
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
 
-    return resp;
+    return Relationship.fromJson(resp.body);
   }
 }

lib/providers/theme_switcher.dart

@@ -1,5 +1,8 @@
+import 'dart:convert';
+
 import 'package:flutter/material.dart';
 import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/theme.dart';
 
 class ThemeSwitcher extends ChangeNotifier {
@@ -13,11 +16,21 @@ class ThemeSwitcher extends ChangeNotifier {
 
   Future<void> restoreTheme() async {
     final prefs = await SharedPreferences.getInstance();
-    if (prefs.containsKey('global_theme_color')) {
-      final value = prefs.getInt('global_theme_color')!;
-      final color = Color(value);
-      lightThemeData = AppTheme.build(Brightness.light, seedColor: color);
-      darkThemeData = AppTheme.build(Brightness.dark, seedColor: color);
+    if (prefs.containsKey('global_theme')) {
+      final value = SolianThemeData.fromJson(
+        jsonDecode(prefs.getString('global_theme')!),
+      );
+      final agedTheme = prefs.getBool('aged_theme');
+      lightThemeData = AppTheme.buildFromData(
+        Brightness.light,
+        value,
+        useMaterial3: agedTheme == null ? true : !agedTheme,
+      );
+      darkThemeData = AppTheme.buildFromData(
+        Brightness.dark,
+        value,
+        useMaterial3: agedTheme == null ? true : !agedTheme,
+      );
       notifyListeners();
     }
   }
@@ -27,4 +40,25 @@ class ThemeSwitcher extends ChangeNotifier {
     darkThemeData = dark;
     notifyListeners();
   }
+
+  Future<void> setThemeData(SolianThemeData? data) async {
+    final prefs = await SharedPreferences.getInstance();
+    if (data == null) {
+      prefs.remove('global_theme');
+    } else {
+      prefs.setString(
+        'global_theme',
+        jsonEncode(data.toJson()),
+      );
+      lightThemeData = AppTheme.buildFromData(Brightness.light, data);
+      darkThemeData = AppTheme.buildFromData(Brightness.dark, data);
+      notifyListeners();
+    }
+  }
+
+  Future<void> setAgedTheme(bool enabled) async {
+    final prefs = await SharedPreferences.getInstance();
+    prefs.setBool('aged_theme', enabled);
+    await restoreTheme();
+  }
 }

lib/providers/websocket.dart

@@ -3,17 +3,11 @@ import 'dart:convert';
 import 'dart:developer';
 import 'dart:io';
 
-import 'package:device_info_plus/device_info_plus.dart';
-import 'package:firebase_messaging/firebase_messaging.dart';
-import 'package:flutter_local_notifications/flutter_local_notifications.dart';
 import 'package:get/get.dart';
-import 'package:shared_preferences/shared_preferences.dart';
-import 'package:solian/exceptions/request.dart';
 import 'package:solian/models/notification.dart';
 import 'package:solian/models/packet.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/services.dart';
 import 'package:web_socket_channel/web_socket_channel.dart';
 
@@ -21,56 +15,10 @@ class WebSocketProvider extends GetxController {
   RxBool isConnected = false.obs;
   RxBool isConnecting = false.obs;
 
-  RxInt notificationUnread = 0.obs;
-  RxList<Notification> notifications =
-      List<Notification>.empty(growable: true).obs;
-
   WebSocketChannel? websocket;
 
   StreamController<NetworkPackage> stream = StreamController.broadcast();
 
-  @override
-  onInit() {
-    notifyPrefetch();
-
-    super.onInit();
-  }
-
-  void requestPermissions() {
-    try {
-      FirebaseMessaging.instance.requestPermission(
-          alert: true,
-          announcement: true,
-          carPlay: true,
-          badge: true,
-          sound: true);
-    } catch (_) {
-      // When firebase isn't initialized (background service)
-      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
-          FlutterLocalNotificationsPlugin();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              AndroidFlutterLocalNotificationsPlugin>()
-          ?.requestNotificationsPermission();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              IOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              MacOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-    }
-  }
-
   Future<void> connect({noRetry = false}) async {
     if (isConnected.value) {
       return;
@@ -119,8 +67,9 @@ class WebSocketProvider extends GetxController {
         log('Websocket incoming message: ${packet.method} ${packet.message}');
         stream.sink.add(packet);
         if (packet.method == 'notifications.new') {
-          notifications.add(Notification.fromJson(packet.payload!));
-          notificationUnread.value++;
+          final NotificationProvider nty = Get.find();
+          nty.notifications.add(Notification.fromJson(packet.payload!));
+          nty.notificationUnread.value++;
         }
       },
       onDone: () {
@@ -133,95 +82,4 @@ class WebSocketProvider extends GetxController {
       },
     );
   }
-
-  Future<void> notifyPrefetch() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.get('/notifications?skip=0&take=100');
-    if (resp.statusCode == 200) {
-      final result = PaginationResult.fromJson(resp.body);
-      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
-      if (data != null) {
-        notifications.addAll(data);
-        notificationUnread.value = data.length;
-      }
-    }
-  }
-
-  Future<void> registerPushNotifications() async {
-    if (PlatformInfo.isWeb) return;
-
-    final prefs = await SharedPreferences.getInstance();
-    if (prefs.getBool('service_background_notification') == true) {
-      log('Background notification service has been enabled, skip register push notifications');
-      return;
-    }
-
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    late final String? token;
-    late final String provider;
-    final deviceUuid = await _getDeviceUuid();
-
-    if (deviceUuid == null || deviceUuid.isEmpty) {
-      log("Unable to active push notifications, couldn't get device uuid");
-    } else {
-      log('Device UUID is $deviceUuid');
-    }
-
-    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
-      provider = 'apple';
-      token = await FirebaseMessaging.instance.getAPNSToken();
-    } else {
-      provider = 'firebase';
-      token = await FirebaseMessaging.instance.getToken();
-    }
-    log('Device Push Token is $token');
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.post('/notifications/subscribe', {
-      'provider': provider,
-      'device_token': token,
-      'device_id': deviceUuid,
-    });
-    if (resp.statusCode != 200 && resp.statusCode != 400) {
-      throw RequestException(resp);
-    }
-  }
-
-  Future<String?> _getDeviceUuid() async {
-    DeviceInfoPlugin deviceInfo = DeviceInfoPlugin();
-    if (PlatformInfo.isWeb) {
-      final webInfo = await deviceInfo.webBrowserInfo;
-      return webInfo.vendor! +
-          webInfo.userAgent! +
-          webInfo.hardwareConcurrency.toString();
-    }
-    if (PlatformInfo.isAndroid) {
-      final androidInfo = await deviceInfo.androidInfo;
-      return androidInfo.id;
-    }
-    if (PlatformInfo.isIOS) {
-      final iosInfo = await deviceInfo.iosInfo;
-      return iosInfo.identifierForVendor!;
-    }
-    if (PlatformInfo.isLinux) {
-      final linuxInfo = await deviceInfo.linuxInfo;
-      return linuxInfo.machineId!;
-    }
-    if (PlatformInfo.isWindows) {
-      final windowsInfo = await deviceInfo.windowsInfo;
-      return windowsInfo.deviceId;
-    }
-    if (PlatformInfo.isMacOS) {
-      final macosInfo = await deviceInfo.macOsInfo;
-      return macosInfo.systemGUID;
-    }
-    return null;
-  }
 }

lib/router.dart

@@ -2,11 +2,14 @@ import 'package:animations/animations.dart';
 import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/bootstrapper.dart';
+import 'package:solian/models/post.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/screens/about.dart';
 import 'package:solian/screens/account.dart';
+import 'package:solian/screens/account/audit_log.dart';
 import 'package:solian/screens/account/friend.dart';
 import 'package:solian/screens/account/preferences/notifications.dart';
+import 'package:solian/screens/account/preferences/security.dart';
 import 'package:solian/screens/account/profile_edit.dart';
 import 'package:solian/screens/account/profile_page.dart';
 import 'package:solian/screens/auth/signin.dart';
@@ -16,18 +19,20 @@ import 'package:solian/screens/channel/channel_detail.dart';
 import 'package:solian/screens/channel/channel_organize.dart';
 import 'package:solian/screens/chat.dart';
 import 'package:solian/screens/dashboard.dart';
-import 'package:solian/screens/feed/search.dart';
+import 'package:solian/screens/posts/post_search.dart';
 import 'package:solian/screens/posts/post_detail.dart';
-import 'package:solian/screens/feed/draft_box.dart';
+import 'package:solian/screens/posts/draft_box.dart';
 import 'package:solian/screens/realms.dart';
 import 'package:solian/screens/realms/realm_detail.dart';
 import 'package:solian/screens/realms/realm_organize.dart';
 import 'package:solian/screens/realms/realm_view.dart';
-import 'package:solian/screens/feed.dart';
+import 'package:solian/screens/explore.dart';
 import 'package:solian/screens/posts/post_editor.dart';
 import 'package:solian/screens/settings.dart';
 import 'package:solian/shells/root_shell.dart';
 import 'package:solian/shells/title_shell.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/sidebar/empty_placeholder.dart';
 
 abstract class AppRouter {
   static GoRouter instance = GoRouter(
@@ -78,26 +83,26 @@ abstract class AppRouter {
     builder: (context, state, child) => child,
     routes: [
       GoRoute(
-        path: '/feed',
-        name: 'feed',
-        builder: (context, state) => const FeedScreen(),
-      ),
-      GoRoute(
-        path: '/feed/search',
-        name: 'feedSearch',
-        builder: (context, state) => TitleShell(
-          state: state,
-          child: FeedSearchScreen(
-            tag: state.uri.queryParameters['tag'],
-            category: state.uri.queryParameters['category'],
-          ),
-        ),
+        path: '/explore',
+        name: 'explore',
+        builder: (context, state) => const ExploreScreen(),
       ),
       GoRoute(
         path: '/drafts',
         name: 'draftBox',
         builder: (context, state) => const DraftBoxScreen(),
       ),
+      GoRoute(
+        path: '/posts/search',
+        name: 'postSearch',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: PostSearchScreen(
+            tag: state.uri.queryParameters['tag'],
+            category: state.uri.queryParameters['category'],
+          ),
+        ),
+      ),
       GoRoute(
         path: '/posts/view/:id',
         name: 'postDetail',
@@ -105,6 +110,7 @@ abstract class AppRouter {
           state: state,
           child: PostDetailScreen(
             id: state.pathParameters['id']!,
+            post: state.extra as Post?,
           ),
         ),
       ),
@@ -137,12 +143,15 @@ abstract class AppRouter {
   );
 
   static final ShellRoute _chatRoute = ShellRoute(
-    builder: (context, state, child) => child,
+    builder: (context, state, child) =>
+        AppTheme.isLargeScreen(context) ? ChatListShell(child: child) : child,
     routes: [
       GoRoute(
         path: '/chat',
         name: 'chat',
-        builder: (context, state) => const ChatScreen(),
+        builder: (context, state) => AppTheme.isLargeScreen(context)
+            ? const EmptyPagePlaceholder()
+            : const ChatScreen(),
       ),
       GoRoute(
         path: '/chat/organize',
@@ -173,6 +182,7 @@ abstract class AppRouter {
           final arguments = state.extra as ChannelDetailArguments;
           return TitleShell(
             state: state,
+            isResponsive: true,
             child: ChannelDetailScreen(
               channel: arguments.channel,
               profile: arguments.profile,
@@ -258,6 +268,22 @@ abstract class AppRouter {
           child: const NotificationPreferencesScreen(),
         ),
       ),
+      GoRoute(
+        path: '/account/preferences/auth',
+        name: 'authPreferences',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuthPreferencesScreen(),
+        ),
+      ),
+      GoRoute(
+        path: '/account/audit',
+        name: 'auditLog',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuditLogScreen(),
+        ),
+      ),
       GoRoute(
         path: '/account/view/:name',
         name: 'accountProfilePage',

lib/screens/about.dart

@@ -1,7 +1,9 @@
 import 'package:flutter/material.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:intl/intl.dart';
 import 'package:package_info_plus/package_info_plus.dart';
+import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
@@ -13,97 +15,130 @@ class AboutScreen extends StatelessWidget {
     const denseButtonStyle =
         ButtonStyle(visualDensity: VisualDensity(vertical: -4));
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: SizedBox(
-        width: double.infinity,
-        child: Column(
-          mainAxisAlignment: MainAxisAlignment.center,
-          children: [
-            ClipRRect(
-              borderRadius: const BorderRadius.all(Radius.circular(16)),
-              child: Image.asset('assets/logo.png', width: 120, height: 120),
-            ),
-            const Gap(8),
-            Text(
-              'Solian',
-              style: Theme.of(context).textTheme.headlineMedium,
-            ),
-            const Text(
-              'The Solar Network',
-              style: TextStyle(fontWeight: FontWeight.bold, fontSize: 16),
-            ),
-            const Gap(8),
-            FutureBuilder(
-              future: PackageInfo.fromPlatform(),
-              builder: (context, snapshot) {
-                if (!snapshot.hasData) {
-                  return const SizedBox.shrink();
-                }
+    return SizedBox(
+      width: double.infinity,
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        children: [
+          ClipRRect(
+            borderRadius: const BorderRadius.all(Radius.circular(16)),
+            child: Image.asset('assets/logo.png', width: 120, height: 120),
+          ),
+          const Gap(8),
+          Text(
+            'Solian',
+            style: Theme.of(context).textTheme.headlineMedium,
+          ),
+          const Text(
+            'The Solar Network',
+            style: TextStyle(fontWeight: FontWeight.bold, fontSize: 16),
+          ),
+          const Gap(8),
+          FutureBuilder(
+            future: PackageInfo.fromPlatform(),
+            builder: (context, snapshot) {
+              if (!snapshot.hasData) {
+                return const SizedBox.shrink();
+              }
 
-                return Text(
-                  'v${snapshot.data!.version} · ${snapshot.data!.buildNumber}',
-                  style: const TextStyle(fontFamily: 'monospace'),
-                );
-              },
-            ),
-            Text('Copyright © ${DateTime.now().year} Solsynth LLC'),
-            const Gap(16),
-            CenteredContainer(
-              maxWidth: 280,
-              child: Wrap(
-                spacing: 8,
-                runSpacing: 8,
-                children: [
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('appDetails'.tr),
-                    onPressed: () async {
-                      final info = await PackageInfo.fromPlatform();
+              return Text(
+                'v${snapshot.data!.version} · ${snapshot.data!.buildNumber}',
+                style: const TextStyle(fontFamily: 'monospace'),
+              );
+            },
+          ),
+          Text('Copyright © ${DateTime.now().year} Solsynth LLC'),
+          const Gap(16),
+          CenteredContainer(
+            maxWidth: 280,
+            child: Wrap(
+              spacing: 4,
+              runSpacing: 4,
+              alignment: WrapAlignment.center,
+              children: [
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('appDetails'.tr),
+                  onPressed: () async {
+                    final info = await PackageInfo.fromPlatform();
 
-                      showAboutDialog(
-                        context: context,
-                        applicationVersion:
-                            '${info.version} (${info.buildNumber})',
-                        applicationLegalese:
-                            'The Solar Network App is an intuitive and open-source social network and computing platform. Experience the freedom of a user-friendly design that empowers you to create and connect with communities on your own terms. Embrace the future of social networking with a platform that prioritizes your independence and privacy.',
-                        applicationIcon: ClipRRect(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(16)),
-                          child: Image.asset('assets/logo.png',
-                              width: 60, height: 60),
-                        ),
-                      );
-                    },
-                  ),
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('projectWebsite'.tr),
-                    onPressed: () {
-                      launchUrlString(
-                          'https://solsynth.dev/products/solar-network');
-                    },
-                  ),
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('termRelated'.tr),
-                    onPressed: () {
-                      launchUrlString('https://solsynth.dev/terms');
-                    },
-                  ),
-                ],
-              ),
+                    showAboutDialog(
+                      context: context,
+                      applicationVersion:
+                          '${info.version} (${info.buildNumber})',
+                      applicationLegalese:
+                          'The Solar Network App is an intuitive and open-source social network and computing platform. Experience the freedom of a user-friendly design that empowers you to create and connect with communities on your own terms. Embrace the future of social networking with a platform that prioritizes your independence and privacy.',
+                      applicationIcon: ClipRRect(
+                        borderRadius:
+                            const BorderRadius.all(Radius.circular(16)),
+                        child: Image.asset('assets/logo.png',
+                            width: 60, height: 60),
+                      ),
+                    );
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('projectWebsite'.tr),
+                  onPressed: () {
+                    launchUrlString(
+                        'https://solsynth.dev/products/solar-network');
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('termRelated'.tr),
+                  onPressed: () {
+                    launchUrlString('https://solsynth.dev/terms');
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('serviceStatus'.tr),
+                  onPressed: () {
+                    launchUrlString('https://status.solsynth.dev');
+                  },
+                ),
+              ],
             ),
-            const Gap(16),
-            const Text(
-              'Open-sourced under AGPLv3',
-              style: TextStyle(
+          ),
+          const Gap(16),
+          const Text(
+            'Open-sourced under AGPLv3',
+            style: TextStyle(
+              fontWeight: FontWeight.w300,
+              fontSize: 12,
+            ),
+          ),
+          FutureBuilder(
+            future: SharedPreferences.getInstance(),
+            builder: (context, snapshot) {
+              const textStyle = TextStyle(
                 fontWeight: FontWeight.w300,
                 fontSize: 12,
-              ),
-            ),
-          ],
-        ),
+              );
+              if (!snapshot.hasData ||
+                  !snapshot.data!.containsKey('first_boot_time')) {
+                return Text(
+                  'firstBootTime'.trParams({'time': 'unknown'.tr}),
+                  style: textStyle,
+                );
+              } else {
+                return Text(
+                  'firstBootTime'.trParams({
+                    'time': DateFormat('yyyy-MM-dd').format(
+                      DateTime.tryParse(
+                            snapshot.data!.getString('first_boot_time')!,
+                          )?.toLocal() ??
+                          DateTime.now(),
+                    ),
+                  }),
+                  style: textStyle,
+                );
+              }
+            },
+          ),
+        ],
       ),
     );
   }

lib/screens/account.dart

@@ -49,113 +49,128 @@ class _AccountScreenState extends State<AccountScreen> {
 
     final AuthProvider auth = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: SafeArea(
-        child: Obx(() {
-          if (auth.isAuthorized.isFalse) {
-            return Center(
-              child: Column(
-                mainAxisSize: MainAxisSize.min,
-                children: [
-                  _ActionCard(
-                    icon: Icon(
-                      Icons.login,
-                      color: Theme.of(context).colorScheme.onPrimary,
-                    ),
-                    title: 'signin'.tr,
-                    caption: 'signinCaption'.tr,
-                    onTap: () {
-                      AppRouter.instance.pushNamed('signin').then((val) async {
-                        if (val == true) {
-                          await auth.refreshUserProfile();
-                        }
-                      });
-                    },
-                  ),
-                  _ActionCard(
-                    icon: Icon(
-                      Icons.add,
-                      color: Theme.of(context).colorScheme.onPrimary,
-                    ),
-                    title: 'signup'.tr,
-                    caption: 'signupCaption'.tr,
-                    onTap: () {
-                      AppRouter.instance.pushNamed('signup').then((_) {
-                        setState(() {});
-                      });
-                    },
-                  ),
-                  const Gap(4),
-                  TextButton(
-                    style: const ButtonStyle(
-                      visualDensity: VisualDensity(
-                        horizontal: -4,
-                        vertical: -2,
-                      ),
-                    ),
-                    onPressed: () {
-                      AppRouter.instance.pushNamed('settings');
-                    },
-                    child: Text('settings'.tr),
-                  ),
-                ],
-              ),
-            );
-          }
-
-          return CenteredContainer(
-            child: ListView(
+    return SafeArea(
+      child: Obx(() {
+        if (auth.isAuthorized.isFalse) {
+          return Center(
+            child: Column(
+              mainAxisSize: MainAxisSize.min,
               children: [
-                if (auth.userProfile.value != null)
-                  const AccountHeading().paddingOnly(bottom: 8, top: 8),
-                ...(actionItems.map(
-                  (x) => ListTile(
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                    leading: x.$1,
-                    title: Text(x.$2),
-                    onTap: () {
-                      AppRouter.instance
-                          .pushNamed(x.$3)
-                          .then((_) => setState(() {}));
-                    },
+                _ActionCard(
+                  icon: Icon(
+                    Icons.login,
+                    color: Theme.of(context).colorScheme.onPrimary,
                   ),
-                )),
-                const Divider(thickness: 0.3, height: 1)
-                    .paddingSymmetric(vertical: 4),
-                ListTile(
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                  leading: const Icon(Icons.settings),
-                  title: Text('settings'.tr),
+                  title: 'signin'.tr,
+                  caption: 'signinCaption'.tr,
                   onTap: () {
-                    AppRouter.instance.pushNamed('settings');
+                    AppRouter.instance.pushNamed('signin').then((val) async {
+                      if (val == true) {
+                        await auth.refreshUserProfile();
+                      }
+                    });
                   },
                 ),
-                if (auth.isAuthorized.value)
-                  ListTile(
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                    leading: const Icon(Icons.edit_notifications),
-                    title: Text('notificationPreferences'.tr),
-                    onTap: () {
-                      AppRouter.instance.pushNamed('notificationPreferences');
-                    },
+                _ActionCard(
+                  icon: Icon(
+                    Icons.add,
+                    color: Theme.of(context).colorScheme.onPrimary,
                   ),
-                const Divider(thickness: 0.3, height: 1)
-                    .paddingSymmetric(vertical: 4),
-                ListTile(
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                  leading: const Icon(Icons.logout),
-                  title: Text('signout'.tr),
+                  title: 'signup'.tr,
+                  caption: 'signupCaption'.tr,
                   onTap: () {
-                    auth.signout();
-                    setState(() {});
+                    AppRouter.instance.pushNamed('signup').then((_) {
+                      setState(() {});
+                    });
                   },
                 ),
+                const Gap(4),
+                TextButton(
+                  style: const ButtonStyle(
+                    visualDensity: VisualDensity(
+                      horizontal: -4,
+                      vertical: -2,
+                    ),
+                  ),
+                  onPressed: () {
+                    AppRouter.instance.pushNamed('settings');
+                  },
+                  child: Text('settings'.tr),
+                ),
               ],
             ),
           );
-        }),
-      ),
+        }
+
+        return CenteredContainer(
+          child: ListView(
+            children: [
+              if (auth.userProfile.value != null)
+                const AccountHeading().paddingOnly(bottom: 8, top: 16),
+              ...(actionItems.map(
+                (x) => ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  leading: x.$1,
+                  title: Text(x.$2),
+                  onTap: () {
+                    AppRouter.instance
+                        .pushNamed(x.$3)
+                        .then((_) => setState(() {}));
+                  },
+                ),
+              )),
+              const Divider(thickness: 0.3, height: 1)
+                  .paddingSymmetric(vertical: 4),
+              ListTile(
+                contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                leading: const Icon(Icons.settings),
+                title: Text('settings'.tr),
+                onTap: () {
+                  AppRouter.instance.pushNamed('settings');
+                },
+              ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.event_repeat),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('auditLog'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('auditLog');
+                  },
+                ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.lock),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('authPreferences'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('authPreferences');
+                  },
+                ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  leading: const Icon(Icons.edit_notifications),
+                  title: Text('notificationPreferences'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('notificationPreferences');
+                  },
+                ),
+              const Divider(thickness: 0.3, height: 1)
+                  .paddingSymmetric(vertical: 4),
+              ListTile(
+                contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                leading: const Icon(Icons.logout),
+                title: Text('signout'.tr),
+                onTap: () {
+                  auth.signout();
+                  setState(() {});
+                },
+              ),
+            ],
+          ),
+        );
+      }),
     );
   }
 }

lib/screens/account/audit_log.dart

@@ -0,0 +1,154 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
+import 'package:marquee/marquee.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/audit_log.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/relative_date.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+import 'package:timeline_tile/timeline_tile.dart';
+
+class AuditLogScreen extends StatefulWidget {
+  const AuditLogScreen({super.key});
+
+  @override
+  State<AuditLogScreen> createState() => _AuditLogScreenState();
+}
+
+class _AuditLogScreenState extends State<AuditLogScreen> {
+  bool _isBusy = true;
+
+  final List<AuditEvent> _events = List.empty(growable: true);
+
+  Future<void> _getEvents() async {
+    if (!_isBusy) setState(() => _isBusy = true);
+
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('id');
+    final resp =
+        await client.get('/users/me/events?take=15&offset=${_events.length}');
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    final result = PaginationResult.fromJson(resp.body);
+
+    setState(() {
+      _events.addAll(
+        result.data?.map((x) => AuditEvent.fromJson(x)).toList() ??
+            List.empty(),
+      );
+      _isBusy = false;
+    });
+  }
+
+  bool _showIp = false;
+
+  String _censorIpAddress(String ip) {
+    List<String> parts = ip.split('.');
+
+    if (parts.length == 4) {
+      String censoredPart1 = '*' * parts[1].length;
+      String censoredPart2 = '*' * parts[2].length;
+      String censoredPart3 = '*' * parts[3].length;
+
+      return '${parts[0]}.$censoredPart1.$censoredPart2.$censoredPart3';
+    } else {
+      return '***.***.***.***';
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getEvents();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        CheckboxListTile(
+          value: _showIp,
+          title: Text('showIp'.tr),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          secondary: const Icon(Icons.alternate_email),
+          tileColor:
+              Theme.of(context).colorScheme.surfaceContainer.withOpacity(0.5),
+          onChanged: (val) {
+            setState(() => _showIp = val ?? false);
+          },
+        ),
+        Expanded(
+          child: RefreshIndicator(
+            onRefresh: () {
+              _events.clear();
+              return _getEvents();
+            },
+            child: InfiniteList(
+              padding: const EdgeInsets.symmetric(vertical: 12),
+              itemCount: _events.length,
+              isLoading: _isBusy,
+              onFetchData: () {
+                _getEvents();
+              },
+              itemBuilder: (context, idx) {
+                final element = _events[idx];
+                return TimelineTile(
+                  isFirst: idx == 0,
+                  isLast: _events.length - 1 == idx,
+                  alignment: TimelineAlign.start,
+                  indicatorStyle: IndicatorStyle(width: 15),
+                  endChild: Container(
+                    child: Card(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            element.type,
+                            style: GoogleFonts.robotoMono(fontSize: 15),
+                          ),
+                          Text(
+                            _showIp
+                                ? element.ipAddress
+                                : _censorIpAddress(element.ipAddress),
+                            style: GoogleFonts.sourceCodePro(
+                              fontWeight: FontWeight.bold,
+                            ),
+                          ),
+                          SizedBox(
+                            height: 20,
+                            width: double.maxFinite,
+                            child: Marquee(
+                              text: element.userAgent,
+                              velocity: 25,
+                              startAfter: Duration(milliseconds: 500),
+                              pauseAfterRound: Duration(milliseconds: 3000),
+                            ),
+                          ),
+                          Row(
+                            children: [
+                              RelativeDate(element.createdAt),
+                              const Gap(6),
+                              Text('·'),
+                              const Gap(6),
+                              RelativeDate(element.createdAt, isFull: true),
+                            ],
+                          ),
+                        ],
+                      ).paddingSymmetric(horizontal: 12, vertical: 8),
+                    ).paddingOnly(left: 16),
+                  ),
+                ).paddingSymmetric(horizontal: 18);
+              },
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/screens/account/friend.dart

@@ -6,6 +6,7 @@ import 'package:solian/models/relations.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/account/relative_list.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class FriendScreen extends StatefulWidget {
   const FriendScreen({super.key});
@@ -117,8 +118,7 @@ class _FriendScreenState extends State<FriendScreen>
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           centerTitle: false,

lib/screens/account/notification.dart

@@ -1,9 +1,14 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
-import 'package:solian/providers/websocket.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/models/notification.dart' as notify;
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/notifications.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/markdown_text_content.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/relative_date.dart';
 import 'package:uuid/uuid.dart';
 
 class NotificationScreen extends StatefulWidget {
@@ -14,57 +19,9 @@ class NotificationScreen extends StatefulWidget {
 }
 
 class _NotificationScreenState extends State<NotificationScreen> {
-  bool _isBusy = false;
-
-  Future<void> _markAllRead() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    setState(() => _isBusy = true);
-
-    final WebSocketProvider provider = Get.find();
-
-    List<int> markList = List.empty(growable: true);
-    for (final element in provider.notifications) {
-      if (element.id <= 0) continue;
-      markList.add(element.id);
-    }
-
-    if (markList.isNotEmpty) {
-      final client = await auth.configureClient('auth');
-      await client.put('/notifications/read', {'messages': markList});
-    }
-
-    provider.notifications.clear();
-
-    setState(() => _isBusy = false);
-  }
-
-  Future<void> _markOneRead(notify.Notification element, int index) async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final WebSocketProvider provider = Get.find();
-
-    if (element.id <= 0) {
-      provider.notifications.removeAt(index);
-      return;
-    }
-
-    setState(() => _isBusy = true);
-
-    final client = await auth.configureClient('auth');
-
-    await client.put('/notifications/read/${element.id}', {});
-
-    provider.notifications.removeAt(index);
-
-    setState(() => _isBusy = false);
-  }
-
   @override
   Widget build(BuildContext context) {
-    final WebSocketProvider ws = Get.find();
+    final NotificationProvider nty = Get.find();
 
     return SizedBox(
       height: MediaQuery.of(context).size.height * 0.85,
@@ -77,71 +34,174 @@ class _NotificationScreenState extends State<NotificationScreen> {
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
           Expanded(
             child: Obx(() {
-              return CustomScrollView(
-                slivers: [
-                  if (_isBusy)
+              return RefreshIndicator(
+                onRefresh: () => nty.fetchNotification(),
+                child: CustomScrollView(
+                  slivers: [
                     SliverToBoxAdapter(
-                      child: const LinearProgressIndicator().animate().scaleX(),
-                    ),
-                  if (ws.notifications.isEmpty)
-                    SliverToBoxAdapter(
-                      child: Container(
-                        padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color:
-                            Theme.of(context).colorScheme.surfaceContainerHigh,
-                        child: ListTile(
-                          leading: const Icon(Icons.check),
-                          title: Text('notifyEmpty'.tr),
-                          subtitle: Text('notifyEmptyCaption'.tr),
-                        ),
+                      child: LoadingIndicator(
+                        isActive: nty.isBusy.value,
                       ),
                     ),
-                  if (ws.notifications.isNotEmpty)
-                    SliverToBoxAdapter(
-                      child: Container(
-                        padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color: Theme.of(context).colorScheme.secondaryContainer,
-                        child: ListTile(
-                          leading: const Icon(Icons.checklist),
-                          title: Text('notifyAllRead'.tr),
-                          onTap: _isBusy ? null : () => _markAllRead(),
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isEmpty)
+                      SliverToBoxAdapter(
+                        child: Container(
+                          padding: const EdgeInsets.symmetric(horizontal: 10),
+                          color: Theme.of(context)
+                              .colorScheme
+                              .surfaceContainerHigh,
+                          child: ListTile(
+                            leading: const Icon(Icons.check),
+                            title: Text('notifyEmpty'.tr),
+                            subtitle: Text('notifyEmptyCaption'.tr),
+                          ),
                         ),
                       ),
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isNotEmpty)
+                      SliverToBoxAdapter(
+                        child: Container(
+                          padding: const EdgeInsets.symmetric(horizontal: 10),
+                          color:
+                              Theme.of(context).colorScheme.secondaryContainer,
+                          child: ListTile(
+                            leading: const Icon(Icons.checklist),
+                            title: Text('notifyAllRead'.tr),
+                            onTap: nty.isBusy.value
+                                ? null
+                                : () => nty.markAllRead(),
+                          ),
+                        ),
+                      ),
+                    SliverList.separated(
+                      itemCount: nty.notifications.length,
+                      itemBuilder: (BuildContext context, int index) {
+                        var element = nty.notifications[index];
+                        return ClipRect(
+                          child: Dismissible(
+                            direction: element.readAt == null
+                                ? DismissDirection.horizontal
+                                : DismissDirection.none,
+                            key: Key(const Uuid().v4()),
+                            background: Container(
+                              color: Colors.lightBlue,
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
+                              alignment: Alignment.centerLeft,
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
+                            ),
+                            secondaryBackground: Container(
+                              color: Colors.lightBlue,
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
+                              alignment: Alignment.centerRight,
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
+                            ),
+                            child: Container(
+                              padding: const EdgeInsets.symmetric(
+                                horizontal: 28,
+                                vertical: 16,
+                              ),
+                              child: Row(
+                                crossAxisAlignment: CrossAxisAlignment.start,
+                                children: [
+                                  Icon(NotificationTopicIcons[element.topic]),
+                                  const Gap(16),
+                                  Expanded(
+                                    child: Column(
+                                      crossAxisAlignment:
+                                          CrossAxisAlignment.start,
+                                      children: [
+                                        if (element.readAt == null)
+                                          Badge(
+                                            label: Row(
+                                              children: [
+                                                Icon(
+                                                  Icons.new_releases_outlined,
+                                                  color: Theme.of(context)
+                                                      .colorScheme
+                                                      .onSurface,
+                                                  size: 12,
+                                                ),
+                                                const Gap(4),
+                                                Text('unread'.tr),
+                                              ],
+                                            ),
+                                          ).paddingOnly(bottom: 4),
+                                        Text(
+                                          element.title,
+                                          style: Theme.of(context)
+                                              .textTheme
+                                              .titleMedium,
+                                        ),
+                                        if (element.subtitle != null)
+                                          Text(
+                                            element.subtitle!,
+                                            style: Theme.of(context)
+                                                .textTheme
+                                                .titleSmall,
+                                          ),
+                                        if (element.subtitle != null)
+                                          const Gap(4),
+                                        MarkdownTextContent(
+                                          content: element.body,
+                                          isAutoWarp: true,
+                                          isSelectable: true,
+                                          parentId:
+                                              'notification-${element.id}',
+                                        ),
+                                        if ([
+                                              'interactive.feedback',
+                                              'interactive.subscription'
+                                            ].contains(element.topic) &&
+                                            element.metadata?['related_post'] !=
+                                                null)
+                                          _PostRelatedNotificationWidget(
+                                            metadata: element.metadata!,
+                                          ),
+                                        const Gap(8),
+                                        Opacity(
+                                          opacity: 0.75,
+                                          child: Row(
+                                            children: [
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              Text(
+                                                '·',
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                                isFull: true,
+                                              ),
+                                            ],
+                                          ),
+                                        ),
+                                      ],
+                                    ),
+                                  ),
+                                ],
+                              ),
+                            ),
+                            onDismissed: (_) => nty.markOneRead(element, index),
+                          ),
+                        );
+                      },
+                      separatorBuilder: (_, __) =>
+                          const Divider(thickness: 0.3, height: 0.3),
                     ),
-                  SliverList.separated(
-                    itemCount: ws.notifications.length,
-                    itemBuilder: (BuildContext context, int index) {
-                      var element = ws.notifications[index];
-                      return Dismissible(
-                        key: Key(const Uuid().v4()),
-                        background: Container(
-                          color: Colors.lightBlue,
-                          padding: const EdgeInsets.symmetric(horizontal: 20),
-                          alignment: Alignment.centerLeft,
-                          child: const Icon(Icons.check, color: Colors.white),
-                        ),
-                        child: ListTile(
-                          contentPadding: const EdgeInsets.symmetric(
-                            horizontal: 24,
-                            vertical: 8,
-                          ),
-                          title: Text(element.title),
-                          subtitle: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            children: [
-                              if (element.subtitle != null)
-                                Text(element.subtitle!),
-                              Text(element.body),
-                            ],
-                          ),
-                        ),
-                        onDismissed: (_) => _markOneRead(element, index),
-                      );
-                    },
-                    separatorBuilder: (_, __) =>
-                        const Divider(thickness: 0.3, height: 0.3),
-                  ),
-                ],
+                  ],
+                ),
               );
             }),
           ),
@@ -156,7 +216,7 @@ class NotificationButton extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    final WebSocketProvider provider = Get.find();
+    final NotificationProvider nty = Get.find();
 
     final button = IconButton(
       icon: const Icon(Icons.notifications),
@@ -166,16 +226,16 @@ class NotificationButton extends StatelessWidget {
           isScrollControlled: true,
           context: context,
           builder: (context) => const NotificationScreen(),
-        ).then((_) => provider.notificationUnread.value = 0);
+        ).then((_) => nty.notificationUnread.value = 0);
       },
     );
 
     return Obx(() {
-      if (provider.notificationUnread.value > 0) {
+      if (nty.notificationUnread.value > 0) {
         return Badge(
           isLabelVisible: true,
           offset: const Offset(-8, 2),
-          label: Text(provider.notificationUnread.value.toString()),
+          label: Text(nty.notificationUnread.value.toString()),
           child: button,
         );
       } else {
@@ -184,3 +244,31 @@ class NotificationButton extends StatelessWidget {
     });
   }
 }
+
+class _PostRelatedNotificationWidget extends StatelessWidget {
+  final Map<String, dynamic> metadata;
+
+  const _PostRelatedNotificationWidget({super.key, required this.metadata});
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: Card(
+        margin: const EdgeInsets.symmetric(vertical: 4),
+        child: PostItem(
+          item: Post.fromJson(metadata['related_post']),
+          isCompact: true,
+        ).paddingAll(8),
+      ),
+      onTap: () {
+        final data = Post.fromJson(metadata['related_post']);
+        Navigator.pop(context);
+        AppRouter.instance.pushNamed(
+          'postDetail',
+          pathParameters: {'id': data.id.toString()},
+          extra: data,
+        );
+      },
+    );
+  }
+}

lib/screens/account/preferences/notifications.dart

@@ -1,11 +1,11 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
 import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class NotificationPreferencesScreen extends StatefulWidget {
   const NotificationPreferencesScreen({super.key});
@@ -59,10 +59,10 @@ class _NotificationPreferencesScreenState
     });
     if (resp.statusCode != 200) {
       context.showErrorDialog(RequestException(resp));
+    } else {
+      context.showSnackbar('preferencesApplied'.tr);
     }
 
-    context.showSnackbar('preferencesApplied'.tr);
-
     setState(() => _isBusy = false);
   }
 
@@ -74,45 +74,42 @@ class _NotificationPreferencesScreenState
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Column(
-        children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
-          ListTile(
-            tileColor: Theme.of(context).colorScheme.surfaceContainer,
-            contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-            leading: const Icon(Icons.save),
-            title: Text('save'.tr),
-            enabled: !_isBusy,
-            onTap: () {
-              _savePreferences();
+    return Column(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        ListTile(
+          tileColor: Theme.of(context).colorScheme.surfaceContainer,
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          leading: const Icon(Icons.save),
+          title: Text('save'.tr),
+          enabled: !_isBusy,
+          onTap: () {
+            _savePreferences();
+          },
+        ),
+        Expanded(
+          child: ListView.builder(
+            itemCount: _topicMap.length,
+            itemBuilder: (context, index) {
+              final element = _topicMap.entries.elementAt(index);
+              return CheckboxListTile(
+                title: Text(element.value),
+                subtitle: Text(
+                  element.key,
+                  style: GoogleFonts.robotoMono(fontSize: 12),
+                ),
+                value: _config[element.key] ?? true,
+                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                onChanged: (value) {
+                  setState(() {
+                    _config[element.key] = value ?? false;
+                  });
+                },
+              );
             },
           ),
-          Expanded(
-            child: ListView.builder(
-              itemCount: _topicMap.length,
-              itemBuilder: (context, index) {
-                final element = _topicMap.entries.elementAt(index);
-                return CheckboxListTile(
-                  title: Text(element.value),
-                  subtitle: Text(
-                    element.key,
-                    style: GoogleFonts.robotoMono(fontSize: 12),
-                  ),
-                  value: _config[element.key] ?? true,
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                  onChanged: (value) {
-                    setState(() {
-                      _config[element.key] = value ?? false;
-                    });
-                  },
-                );
-              },
-            ),
-          ),
-        ],
-      ),
+        ),
+      ],
     );
   }
 }

lib/screens/account/preferences/security.dart

@@ -0,0 +1,118 @@
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:get/get.dart';
+import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+
+class AuthPreferencesScreen extends StatefulWidget {
+  const AuthPreferencesScreen({super.key});
+
+  @override
+  State<AuthPreferencesScreen> createState() => _AuthPreferencesScreenState();
+}
+
+class _AuthPreferencesScreenState extends State<AuthPreferencesScreen> {
+  bool _isBusy = true;
+
+  Map<String, dynamic> _config = {
+    'maximum_auth_steps': 2,
+  };
+
+  Future<void> _getPreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.get('/preferences/auth');
+    if (resp.statusCode != 200 && resp.statusCode != 404) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    if (resp.statusCode == 200) {
+      _config = resp.body;
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _savePreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.put('/preferences/auth', _config);
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    } else {
+      context.showSnackbar('preferencesApplied'.tr);
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPreferences();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        ListTile(
+          tileColor: Theme.of(context).colorScheme.surfaceContainer,
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          leading: const Icon(Icons.save),
+          title: Text('save'.tr),
+          enabled: !_isBusy,
+          onTap: () {
+            _savePreferences();
+          },
+        ),
+        Expanded(
+          child: ListView(
+            children: [
+              ListTile(
+                title: Text('authMaximumAuthSteps'.tr),
+                subtitle: Text('authMaximumAuthStepsDesc'.tr),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                trailing: SizedBox(
+                  width: 60,
+                  child: _isBusy
+                      ? null
+                      : TextFormField(
+                          decoration: InputDecoration(
+                            border: const OutlineInputBorder(),
+                            isDense: true,
+                          ),
+                          initialValue:
+                              _config['maximum_auth_steps']?.toString() ?? '2',
+                          keyboardType: TextInputType.number,
+                          inputFormatters: [
+                            FilteringTextInputFormatter.digitsOnly
+                          ],
+                          onTapOutside: (_) =>
+                              FocusManager.instance.primaryFocus?.unfocus(),
+                          onChanged: (value) {
+                            _config['maximum_auth_steps'] =
+                                int.tryParse(value) ?? 2;
+                          },
+                        ),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/screens/account/profile_edit.dart

@@ -1,7 +1,4 @@
-import 'dart:io';
-
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
@@ -9,10 +6,12 @@ import 'package:image_picker/image_picker.dart';
 import 'package:intl/intl.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
+import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class PersonalizeScreen extends StatefulWidget {
   const PersonalizeScreen({super.key});
@@ -77,36 +76,42 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) return;
 
+    XFile file;
+
     final image = await _imagePicker.pickImage(source: ImageSource.gallery);
     if (image == null) return;
 
-    CroppedFile? croppedFile = await ImageCropper().cropImage(
-      sourcePath: image.path,
-      uiSettings: [
-        AndroidUiSettings(
-          toolbarTitle: 'cropImage'.tr,
-          toolbarColor: Theme.of(context).colorScheme.primary,
-          toolbarWidgetColor: Theme.of(context).colorScheme.onPrimary,
-          aspectRatioPresets: [
-            if (position == 'avatar') CropAspectRatioPreset.square,
-            if (position == 'banner') _BannerCropAspectRatioPreset(),
-          ],
-        ),
-        IOSUiSettings(
-          title: 'cropImage'.tr,
-          aspectRatioPresets: [
-            if (position == 'avatar') CropAspectRatioPreset.square,
-            if (position == 'banner') _BannerCropAspectRatioPreset(),
-          ],
-        ),
-        WebUiSettings(
-          context: context,
-        ),
-      ],
-    );
+    if (PlatformInfo.canCropImage) {
+      CroppedFile? croppedFile = await ImageCropper().cropImage(
+        sourcePath: image.path,
+        uiSettings: [
+          AndroidUiSettings(
+            toolbarTitle: 'cropImage'.tr,
+            toolbarColor: Theme.of(context).colorScheme.primary,
+            toolbarWidgetColor: Theme.of(context).colorScheme.onPrimary,
+            aspectRatioPresets: [
+              if (position == 'avatar') CropAspectRatioPreset.square,
+              if (position == 'banner') _BannerCropAspectRatioPreset(),
+            ],
+          ),
+          IOSUiSettings(
+            title: 'cropImage'.tr,
+            aspectRatioPresets: [
+              if (position == 'avatar') CropAspectRatioPreset.square,
+              if (position == 'banner') _BannerCropAspectRatioPreset(),
+            ],
+          ),
+          WebUiSettings(
+            context: context,
+          ),
+        ],
+      );
 
-    if (croppedFile == null) return;
-    final file = File(croppedFile.path);
+      if (croppedFile == null) return;
+      file = XFile(croppedFile.path);
+    } else {
+      file = XFile(image.path);
+    }
 
     setState(() => _isBusy = true);
 
@@ -181,164 +186,161 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
   Widget build(BuildContext context) {
     const double padding = 32;
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: ListView(
-        children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
-          const Gap(24),
-          Stack(
-            children: [
-              AccountAvatar(content: _avatar, radius: 40),
-              Positioned(
-                bottom: 0,
-                left: 40,
-                child: FloatingActionButton.small(
-                  heroTag: const Key('avatar-editor'),
-                  onPressed: () => _editImage('avatar'),
-                  child: const Icon(
-                    Icons.camera,
-                  ),
+    return ListView(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        const Gap(24),
+        Stack(
+          children: [
+            AttachedCircleAvatar(content: _avatar, radius: 40),
+            Positioned(
+              bottom: 0,
+              left: 40,
+              child: FloatingActionButton.small(
+                heroTag: const Key('avatar-editor'),
+                onPressed: () => _editImage('avatar'),
+                child: const Icon(
+                  Icons.camera,
                 ),
               ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Stack(
-            children: [
-              ClipRRect(
-                borderRadius: const BorderRadius.all(Radius.circular(8)),
-                child: AspectRatio(
-                  aspectRatio: 16 / 9,
-                  child: Container(
-                    color: Theme.of(context).colorScheme.surfaceContainerHigh,
-                    child: _banner != null
-                        ? Image.network(
-                            ServiceFinder.buildUrl(
-                                'files', '/attachments/$_banner'),
-                            fit: BoxFit.cover,
-                            loadingBuilder: (BuildContext context, Widget child,
-                                ImageChunkEvent? loadingProgress) {
-                              if (loadingProgress == null) return child;
-                              return Center(
-                                child: CircularProgressIndicator(
-                                  value: loadingProgress.expectedTotalBytes !=
-                                          null
-                                      ? loadingProgress.cumulativeBytesLoaded /
-                                          loadingProgress.expectedTotalBytes!
-                                      : null,
-                                ),
-                              );
-                            },
-                          )
-                        : Container(),
-                  ),
-                ),
-              ),
-              Positioned(
-                bottom: 16,
-                right: 16,
-                child: FloatingActionButton(
-                  heroTag: const Key('banner-editor'),
-                  onPressed: () => _editImage('banner'),
-                  child: const Icon(
-                    Icons.camera_alt,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(24),
-          Row(
-            children: [
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  readOnly: true,
-                  controller: _usernameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'username'.tr,
-                    prefixText: '@',
-                  ),
-                ),
-              ),
-              const Gap(16),
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _nicknameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'nickname'.tr,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Row(
-            children: [
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _firstNameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'firstName'.tr,
-                  ),
-                ),
-              ),
-              const Gap(16),
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _lastNameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'lastName'.tr,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          TextField(
-            controller: _descriptionController,
-            keyboardType: TextInputType.multiline,
-            maxLines: null,
-            minLines: 3,
-            decoration: InputDecoration(
-              border: const OutlineInputBorder(),
-              labelText: 'description'.tr,
             ),
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          TextField(
-            controller: _birthdayController,
-            readOnly: true,
-            decoration: InputDecoration(
-              border: const OutlineInputBorder(),
-              labelText: 'birthday'.tr,
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Stack(
+          children: [
+            ClipRRect(
+              borderRadius: const BorderRadius.all(Radius.circular(8)),
+              child: AspectRatio(
+                aspectRatio: 16 / 9,
+                child: Container(
+                  color: Theme.of(context).colorScheme.surfaceContainerHigh,
+                  child: _banner != null
+                      ? Image.network(
+                          ServiceFinder.buildUrl(
+                              'files', '/attachments/$_banner'),
+                          fit: BoxFit.cover,
+                          loadingBuilder: (BuildContext context, Widget child,
+                              ImageChunkEvent? loadingProgress) {
+                            if (loadingProgress == null) return child;
+                            return Center(
+                              child: CircularProgressIndicator(
+                                value: loadingProgress.expectedTotalBytes !=
+                                        null
+                                    ? loadingProgress.cumulativeBytesLoaded /
+                                        loadingProgress.expectedTotalBytes!
+                                    : null,
+                              ),
+                            );
+                          },
+                        )
+                      : Container(),
+                ),
+              ),
             ),
-            onTap: () => _selectBirthday(),
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Row(
-            mainAxisAlignment: MainAxisAlignment.end,
-            children: [
-              TextButton(
-                onPressed: _isBusy ? null : () => _syncWidget(),
-                child: Text('reset'.tr),
+            Positioned(
+              bottom: 16,
+              right: 16,
+              child: FloatingActionButton(
+                heroTag: const Key('banner-editor'),
+                onPressed: () => _editImage('banner'),
+                child: const Icon(
+                  Icons.camera_alt,
+                ),
               ),
-              ElevatedButton(
-                onPressed: _isBusy ? null : () => _editUserInfo(),
-                child: Text('apply'.tr),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(24),
+        Row(
+          children: [
+            Flexible(
+              flex: 1,
+              child: TextField(
+                readOnly: true,
+                controller: _usernameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'username'.tr,
+                  prefixText: '@',
+                ),
               ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-        ],
-      ),
+            ),
+            const Gap(16),
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _nicknameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'nickname'.tr,
+                ),
+              ),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Row(
+          children: [
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _firstNameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'firstName'.tr,
+                ),
+              ),
+            ),
+            const Gap(16),
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _lastNameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'lastName'.tr,
+                ),
+              ),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        TextField(
+          controller: _descriptionController,
+          keyboardType: TextInputType.multiline,
+          maxLines: null,
+          minLines: 3,
+          decoration: InputDecoration(
+            border: const OutlineInputBorder(),
+            labelText: 'description'.tr,
+          ),
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        TextField(
+          controller: _birthdayController,
+          readOnly: true,
+          decoration: InputDecoration(
+            border: const OutlineInputBorder(),
+            labelText: 'birthday'.tr,
+          ),
+          onTap: () => _selectBirthday(),
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Row(
+          mainAxisAlignment: MainAxisAlignment.end,
+          children: [
+            TextButton(
+              onPressed: _isBusy ? null : () => _syncWidget(),
+              child: Text('reset'.tr),
+            ),
+            ElevatedButton(
+              onPressed: _isBusy ? null : () => _editUserInfo(),
+              child: Text('apply'.tr),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+      ],
     );
   }
 

lib/screens/account/profile_page.dart

@@ -13,6 +13,7 @@ import 'package:solian/models/attachment.dart';
 import 'package:solian/models/daily_sign.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/models/relations.dart';
 import 'package:solian/models/subscription.dart';
 import 'package:solian/providers/account_status.dart';
 import 'package:solian/providers/relation.dart';
@@ -25,7 +26,8 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/daily_sign/history_chart.dart';
 import 'package:solian/widgets/posts/post_list.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
+import 'package:solian/widgets/reports/abuse_report.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 
 class AccountProfilePage extends StatefulWidget {
@@ -50,6 +52,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
 
   Account? _userinfo;
   Subscription? _subscription;
+  Relationship? _relationship;
   List<Post> _pinnedPosts = List.empty();
   List<DailySignRecord> _dailySignRecords = List.empty();
   int _totalUpvote = 0, _totalDownvote = 0;
@@ -61,6 +64,15 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
     setState(() => _isSubscribing = false);
   }
 
+  Future<void> _getRelationship() async {
+    setState(() => _isBusy = true);
+
+    final relations = Get.find<RelationshipProvider>();
+    _relationship = await relations.getRelationship(_userinfo!.id);
+
+    setState(() => _isBusy = false);
+  }
+
   Future<void> _getUserinfo() async {
     setState(() => _isBusy = true);
 
@@ -120,6 +132,63 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
     }
   }
 
+  Future<void> _subscribeToUser() async {
+    setState(() => _isSubscribing = true);
+    _subscription =
+        await Get.find<SubscriptionProvider>().subscribeToUser(_userinfo!.id);
+    setState(() => _isSubscribing = false);
+  }
+
+  Future<void> _unsubscribeFromUser() async {
+    setState(() => _isSubscribing = true);
+    await Get.find<SubscriptionProvider>().unsubscribeFromUser(_userinfo!.id);
+    _subscription = null;
+    setState(() => _isSubscribing = false);
+  }
+
+  Future<void> _makeFriend() async {
+    setState(() => _isMakingFriend = true);
+    try {
+      _relationship = await _relationshipProvider.makeFriend(widget.name);
+      context.showSnackbar(
+        'accountFriendRequestSent'.tr,
+      );
+    } catch (e) {
+      context.showErrorDialog(e);
+    } finally {
+      setState(() => _isMakingFriend = false);
+    }
+  }
+
+  Future<void> _blockUser() async {
+    setState(() => _isMakingFriend = true);
+    try {
+      _relationship = await _relationshipProvider.blockUser(widget.name);
+      context.showSnackbar(
+        'accountBlocked'.tr,
+      );
+    } catch (e) {
+      context.showErrorDialog(e);
+    } finally {
+      setState(() => _isMakingFriend = false);
+    }
+  }
+
+  Future<void> _unblockUser() async {
+    setState(() => _isMakingFriend = true);
+    try {
+      _relationship =
+          await _relationshipProvider.editRelation(_userinfo!.id, 1);
+      context.showSnackbar(
+        'accountUnblocked'.tr,
+      );
+    } catch (e) {
+      context.showErrorDialog(e);
+    } finally {
+      setState(() => _isMakingFriend = false);
+    }
+  }
+
   int get _userSocialCreditPoints {
     return _totalUpvote * 2 - _totalDownvote + _postController.postTotal.value;
   }
@@ -151,37 +220,24 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
     });
 
     _getUserinfo().then((_) {
+      _getRelationship();
       _getSubscription();
       _getPinnedPosts();
       _getDailySignRecords();
     });
   }
 
-  Widget _buildStatisticsEntry(String label, String content) {
-    return Expanded(
-      child: Column(
-        children: [
-          Text(
-            label,
-            style: Theme.of(context).textTheme.bodySmall,
-          ),
-          Text(
-            content,
-            style: Theme.of(context).textTheme.bodyLarge,
-          ),
-        ],
-      ),
-    );
-  }
-
   @override
   Widget build(BuildContext context) {
     if (_isBusy || _userinfo == null) {
-      return const Center(child: CircularProgressIndicator());
+      return RootContainer(
+        child: const Center(
+          child: CircularProgressIndicator(),
+        ),
+      );
     }
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: DefaultTabController(
         length: 3,
         child: NestedScrollView(
@@ -193,96 +249,76 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                 toolbarHeight: AppTheme.toolbarHeight(context),
                 leadingWidth: 24,
                 automaticallyImplyLeading: false,
-                flexibleSpace: Row(
-                  children: [
-                    AppBarLeadingButton.adaptive(context) ?? const Gap(8),
-                    const Gap(8),
-                    if (_userinfo != null)
-                      AccountAvatar(content: _userinfo!.avatar, radius: 16),
-                    const Gap(12),
-                    Expanded(
-                      child: Column(
-                        mainAxisAlignment: MainAxisAlignment.center,
-                        crossAxisAlignment: CrossAxisAlignment.start,
-                        children: [
-                          if (_userinfo != null)
-                            Text(
-                              _userinfo!.nick,
-                              style: Theme.of(context).textTheme.bodyLarge,
-                            ),
-                          if (_userinfo != null)
-                            Text(
-                              '@${_userinfo!.name}',
-                              style: Theme.of(context).textTheme.bodySmall,
-                            ),
-                        ],
-                      ),
-                    ),
-                    if (_userinfo != null && _subscription == null)
-                      OutlinedButton(
-                        style: const ButtonStyle(
-                          visualDensity:
-                              VisualDensity(horizontal: -4, vertical: -2),
+                flexibleSpace: SizedBox(
+                  height: 56,
+                  child: Row(
+                    children: [
+                      AppBarLeadingButton.adaptive(
+                            context,
+                            forceBack: true,
+                          ) ??
+                          const Gap(8),
+                      const Gap(8),
+                      if (_userinfo != null)
+                        AttachedCircleAvatar(
+                            content: _userinfo!.avatar, radius: 16),
+                      const Gap(12),
+                      Expanded(
+                        child: Column(
+                          mainAxisAlignment: MainAxisAlignment.center,
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            if (_userinfo != null)
+                              Text(
+                                _userinfo!.nick,
+                                style: Theme.of(context).textTheme.bodyLarge,
+                              ),
+                            if (_userinfo != null)
+                              Text(
+                                '@${_userinfo!.name}',
+                                style: Theme.of(context).textTheme.bodySmall,
+                              ),
+                          ],
                         ),
-                        onPressed: _isSubscribing
-                            ? null
-                            : () async {
-                                setState(() => _isSubscribing = true);
-                                _subscription =
-                                    await Get.find<SubscriptionProvider>()
-                                        .subscribeToUser(_userinfo!.id);
-                                setState(() => _isSubscribing = false);
-                              },
-                        child: Text('subscribe'.tr),
-                      )
-                    else if (_userinfo != null)
-                      OutlinedButton(
-                        style: const ButtonStyle(
-                          visualDensity:
-                              VisualDensity(horizontal: -4, vertical: -2),
+                      ),
+                      if (_userinfo != null && _subscription == null)
+                        IconButton(
+                          style: const ButtonStyle(
+                            visualDensity:
+                                VisualDensity(horizontal: -4, vertical: -2),
+                          ),
+                          onPressed: _isSubscribing ? null : _subscribeToUser,
+                          icon: const Icon(Icons.add_circle_outline),
+                          tooltip: 'subscribe'.tr,
+                        )
+                      else if (_userinfo != null)
+                        IconButton(
+                          style: const ButtonStyle(
+                            visualDensity:
+                                VisualDensity(horizontal: -4, vertical: -2),
+                          ),
+                          onPressed:
+                              _isSubscribing ? null : _unsubscribeFromUser,
+                          icon: const Icon(Icons.remove_circle_outline),
+                          tooltip: 'unsubscribe'.tr,
                         ),
-                        onPressed: _isSubscribing
-                            ? null
-                            : () async {
-                                setState(() => _isSubscribing = true);
-                                await Get.find<SubscriptionProvider>()
-                                    .unsubscribeFromUser(_userinfo!.id);
-                                _subscription = null;
-                                setState(() => _isSubscribing = false);
-                              },
-                        child: Text('unsubscribe'.tr),
+                      if (_userinfo != null && _relationship == null)
+                        IconButton(
+                          icon: const Icon(Icons.person_add),
+                          onPressed: _isMakingFriend ? null : _makeFriend,
+                          tooltip: 'friendAdd'.tr,
+                        )
+                      else
+                        const IconButton(
+                          icon: Icon(Icons.handshake),
+                          onPressed: null,
+                        ),
+                      SizedBox(
+                        width: AppTheme.isLargeScreen(context) ? 8 : 16,
                       ),
-                    if (_userinfo != null &&
-                        !_relationshipProvider.hasFriend(_userinfo!))
-                      IconButton(
-                        icon: const Icon(Icons.person_add),
-                        onPressed: _isMakingFriend
-                            ? null
-                            : () async {
-                                setState(() => _isMakingFriend = true);
-                                try {
-                                  await _relationshipProvider
-                                      .makeFriend(widget.name);
-                                  context.showSnackbar(
-                                    'accountFriendRequestSent'.tr,
-                                  );
-                                } catch (e) {
-                                  context.showErrorDialog(e);
-                                } finally {
-                                  setState(() => _isMakingFriend = false);
-                                }
-                              },
-                      )
-                    else
-                      const IconButton(
-                        icon: Icon(Icons.handshake),
-                        onPressed: null,
-                      ),
-                    SizedBox(
-                      width: AppTheme.isLargeScreen(context) ? 8 : 16,
-                    ),
-                  ],
-                ),
+                    ],
+                  ),
+                ).paddingOnly(top: MediaQuery.of(context).padding.top),
                 bottom: TabBar(
                   tabs: [
                     Tab(text: 'profilePage'.tr),
@@ -296,128 +332,205 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
           body: TabBarView(
             physics: const NeverScrollableScrollPhysics(),
             children: [
-              Column(
+              ListView(
+                padding: const EdgeInsets.only(top: 16, bottom: 16),
                 children: [
-                  const Gap(16),
-                  AccountHeadingWidget(
-                    name: _userinfo!.name,
-                    nick: _userinfo!.nick,
-                    desc: _userinfo!.description,
-                    badges: _userinfo!.badges,
-                    banner: _userinfo!.banner,
-                    avatar: _userinfo!.avatar,
-                    status: Get.find<StatusProvider>()
-                        .getSomeoneStatus(_userinfo!.name),
-                    detail: _userinfo,
-                    profile: _userinfo!.profile,
-                    extraWidgets: [
-                      if (_dailySignRecords.isNotEmpty)
-                        Card(
-                          child: SizedBox(
-                            height: 180,
-                            width: max(640, MediaQuery.of(context).size.width),
-                            child: LineChart(
-                              LineChartData(
-                                lineBarsData: [
-                                  LineChartBarData(
-                                    isCurved: true,
-                                    isStrokeCapRound: true,
-                                    isStrokeJoinRound: true,
-                                    color:
-                                        Theme.of(context).colorScheme.primary,
-                                    belowBarData: BarAreaData(
-                                      show: true,
-                                      gradient: LinearGradient(
-                                        colors: List.filled(
-                                          _dailySignRecords.length,
-                                          Theme.of(context)
-                                              .colorScheme
-                                              .primary
-                                              .withOpacity(0.3),
-                                        ).toList(),
-                                      ),
-                                    ),
-                                    spots: _dailySignRecords
-                                        .map(
-                                          (x) => FlSpot(
-                                            x.createdAt
-                                                .copyWith(
-                                                  hour: 0,
-                                                  minute: 0,
-                                                  second: 0,
-                                                  millisecond: 0,
-                                                  microsecond: 0,
-                                                )
-                                                .millisecondsSinceEpoch
-                                                .toDouble(),
-                                            x.resultTier.toDouble(),
-                                          ),
-                                        )
-                                        .toList(),
-                                  )
-                                ],
-                                lineTouchData: LineTouchData(
-                                  touchTooltipData: LineTouchTooltipData(
-                                    getTooltipItems: (spots) => spots
-                                        .map((spot) => LineTooltipItem(
-                                              '${DailySignHistoryChartDialog.signSymbols[spot.y.toInt()]}\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
-                                              TextStyle(
-                                                color: Theme.of(context)
-                                                    .colorScheme
-                                                    .onSurface,
-                                              ),
-                                            ))
-                                        .toList(),
-                                    getTooltipColor: (_) => Theme.of(context)
-                                        .colorScheme
-                                        .surfaceContainerHigh,
-                                  ),
-                                ),
-                                titlesData: FlTitlesData(
-                                  topTitles: const AxisTitles(
-                                    sideTitles: SideTitles(showTitles: false),
-                                  ),
-                                  rightTitles: const AxisTitles(
-                                    sideTitles: SideTitles(showTitles: false),
-                                  ),
-                                  leftTitles: AxisTitles(
-                                    sideTitles: SideTitles(
-                                      showTitles: true,
-                                      reservedSize: 40,
-                                      interval: 1,
-                                      getTitlesWidget: (value, _) => Align(
-                                        alignment: Alignment.centerRight,
-                                        child: Text(
-                                          DailySignHistoryChartDialog
-                                              .signSymbols[value.toInt()],
-                                          textAlign: TextAlign.right,
-                                        ).paddingOnly(right: 8),
-                                      ),
-                                    ),
-                                  ),
-                                  bottomTitles: AxisTitles(
-                                    sideTitles: SideTitles(
-                                      showTitles: true,
-                                      reservedSize: 28,
-                                      interval: 86400000,
-                                      getTitlesWidget: (value, _) => Text(
-                                        DateFormat('dd').format(
-                                          DateTime.fromMillisecondsSinceEpoch(
-                                            value.toInt(),
-                                          ),
+                  CenteredContainer(
+                    child: AccountHeadingWidget(
+                      name: _userinfo!.name,
+                      nick: _userinfo!.nick,
+                      desc: _userinfo!.description,
+                      badges: _userinfo!.badges,
+                      banner: _userinfo!.banner,
+                      avatar: _userinfo!.avatar,
+                      status: Get.find<StatusProvider>()
+                          .getSomeoneStatus(_userinfo!.name),
+                      detail: _userinfo,
+                      profile: _userinfo!.profile,
+                      extraWidgets: [
+                        if (_dailySignRecords.length > 1)
+                          Card(
+                            child: SizedBox(
+                              height: 180,
+                              width:
+                                  max(640, MediaQuery.of(context).size.width),
+                              child: LineChart(
+                                LineChartData(
+                                  lineBarsData: [
+                                    LineChartBarData(
+                                      isCurved: true,
+                                      isStrokeCapRound: true,
+                                      isStrokeJoinRound: true,
+                                      color:
+                                          Theme.of(context).colorScheme.primary,
+                                      belowBarData: BarAreaData(
+                                        show: true,
+                                        gradient: LinearGradient(
+                                          colors: List.filled(
+                                            _dailySignRecords.length,
+                                            Theme.of(context)
+                                                .colorScheme
+                                                .primary
+                                                .withOpacity(0.3),
+                                          ).toList(),
                                         ),
-                                        textAlign: TextAlign.center,
-                                      ).paddingOnly(top: 8),
+                                      ),
+                                      spots: _dailySignRecords
+                                          .map(
+                                            (x) => FlSpot(
+                                              x.createdAt
+                                                  .copyWith(
+                                                    hour: 0,
+                                                    minute: 0,
+                                                    second: 0,
+                                                    millisecond: 0,
+                                                    microsecond: 0,
+                                                  )
+                                                  .millisecondsSinceEpoch
+                                                  .toDouble(),
+                                              x.resultTier.toDouble(),
+                                            ),
+                                          )
+                                          .toList(),
+                                    )
+                                  ],
+                                  lineTouchData: LineTouchData(
+                                    touchTooltipData: LineTouchTooltipData(
+                                      getTooltipItems: (spots) => spots
+                                          .map((spot) => LineTooltipItem(
+                                                '${DailySignHistoryChartDialog.signSymbols[spot.y.toInt()]}\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
+                                                TextStyle(
+                                                  color: Theme.of(context)
+                                                      .colorScheme
+                                                      .onSurface,
+                                                ),
+                                              ))
+                                          .toList(),
+                                      getTooltipColor: (_) => Theme.of(context)
+                                          .colorScheme
+                                          .surfaceContainerHigh,
                                     ),
                                   ),
+                                  titlesData: FlTitlesData(
+                                    topTitles: const AxisTitles(
+                                      sideTitles: SideTitles(showTitles: false),
+                                    ),
+                                    rightTitles: const AxisTitles(
+                                      sideTitles: SideTitles(showTitles: false),
+                                    ),
+                                    leftTitles: AxisTitles(
+                                      sideTitles: SideTitles(
+                                        showTitles: true,
+                                        reservedSize: 40,
+                                        interval: 1,
+                                        getTitlesWidget: (value, _) => Align(
+                                          alignment: Alignment.centerRight,
+                                          child: Text(
+                                            DailySignHistoryChartDialog
+                                                .signSymbols[value.toInt()],
+                                            textAlign: TextAlign.right,
+                                          ).paddingOnly(right: 8),
+                                        ),
+                                      ),
+                                    ),
+                                    bottomTitles: AxisTitles(
+                                      sideTitles: SideTitles(
+                                        showTitles: true,
+                                        reservedSize: 28,
+                                        interval: 86400000,
+                                        getTitlesWidget: (value, _) => Text(
+                                          DateFormat('dd').format(
+                                            DateTime.fromMillisecondsSinceEpoch(
+                                              value.toInt(),
+                                            ),
+                                          ),
+                                          textAlign: TextAlign.center,
+                                        ).paddingOnly(top: 8),
+                                      ),
+                                    ),
+                                  ),
+                                  gridData: const FlGridData(show: false),
+                                  borderData: FlBorderData(show: false),
                                 ),
-                                gridData: const FlGridData(show: false),
-                                borderData: FlBorderData(show: false),
                               ),
+                            ).marginOnly(
+                              right: 24,
+                              left: 12,
+                              bottom: 8,
+                              top: 24,
                             ),
-                          ).marginOnly(right: 24, left: 12, bottom: 8, top: 24),
-                        )
-                    ],
+                          )
+                      ],
+                      appendWidgets: [
+                        Card(
+                          child: Container(
+                            padding: const EdgeInsets.symmetric(
+                              vertical: 4,
+                              horizontal: 8,
+                            ),
+                            width: double.maxFinite,
+                            child: Wrap(
+                              alignment: WrapAlignment.spaceAround,
+                              children: [
+                                TextButton.icon(
+                                  style: const ButtonStyle(
+                                    visualDensity: VisualDensity(
+                                      horizontal: -4,
+                                      vertical: -2,
+                                    ),
+                                  ),
+                                  onPressed: () {
+                                    showDialog(
+                                      context: context,
+                                      builder: (context) => AbuseReportDialog(
+                                        resourceId: 'user:${_userinfo!.id}',
+                                      ),
+                                    );
+                                  },
+                                  icon: const Icon(
+                                    Icons.flag,
+                                    size: 16,
+                                  ),
+                                  label: Text('reportAbuse'.tr),
+                                ),
+                                if (_relationship?.status != 2)
+                                  TextButton.icon(
+                                    style: const ButtonStyle(
+                                      visualDensity: VisualDensity(
+                                        horizontal: -4,
+                                        vertical: -2,
+                                      ),
+                                    ),
+                                    onPressed:
+                                        _isMakingFriend ? null : _blockUser,
+                                    icon: const Icon(
+                                      Icons.block,
+                                      size: 16,
+                                    ),
+                                    label: Text('blockUser'.tr),
+                                  )
+                                else
+                                  TextButton.icon(
+                                    style: const ButtonStyle(
+                                      visualDensity: VisualDensity(
+                                        horizontal: -4,
+                                        vertical: -2,
+                                      ),
+                                    ),
+                                    onPressed:
+                                        _isMakingFriend ? null : _unblockUser,
+                                    icon: const Icon(
+                                      Icons.add_circle_outline,
+                                      size: 16,
+                                    ),
+                                    label: Text('unblockUser'.tr),
+                                  ),
+                              ],
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
                   ),
                 ],
               ),
@@ -433,7 +546,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                         Row(
                           mainAxisAlignment: MainAxisAlignment.spaceAround,
                           children: [
-                            _buildStatisticsEntry(
+                            _StatsWidget(
                               'totalSocialCreditPoints'.tr,
                               _userinfo != null
                                   ? _userSocialCreditPoints.toString()
@@ -446,16 +559,16 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                           mainAxisAlignment: MainAxisAlignment.spaceAround,
                           children: [
                             Obx(
-                              () => _buildStatisticsEntry(
+                              () => _StatsWidget(
                                 'totalPostCount'.tr,
                                 _postController.postTotal.value.toString(),
                               ),
                             ),
-                            _buildStatisticsEntry(
+                            _StatsWidget(
                               'totalUpvote'.tr,
                               _totalUpvote.toString(),
                             ),
-                            _buildStatisticsEntry(
+                            _StatsWidget(
                               'totalDownvote'.tr,
                               _totalDownvote.toString(),
                             ),
@@ -475,8 +588,6 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                         color:
                             Theme.of(context).colorScheme.surfaceContainerLow,
                         child: PostListEntryWidget(
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surfaceContainerLow,
                           item: element,
                           isClickable: true,
                           isNestedClickable: true,
@@ -496,7 +607,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                       child: Center(child: CircularProgressIndicator()),
                     ),
                   if (_userinfo != null)
-                    PostWarpedListWidget(
+                    ControlledPostListWidget(
                       isPinned: false,
                       controller: _postController.pagingController,
                       onUpdate: () => _postController.reloadAllOver(),
@@ -553,3 +664,28 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
     );
   }
 }
+
+class _StatsWidget extends StatelessWidget {
+  final String label;
+  final String content;
+
+  const _StatsWidget(this.label, this.content);
+
+  @override
+  Widget build(BuildContext context) {
+    return Expanded(
+      child: Column(
+        children: [
+          Text(
+            label,
+            style: Theme.of(context).textTheme.bodySmall,
+          ),
+          Text(
+            content,
+            style: Theme.of(context).textTheme.bodyLarge,
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/screens/auth/signin.dart

@@ -7,10 +7,9 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/channel.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
-import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';
@@ -177,10 +176,9 @@ class _SignInScreenState extends State<SignInScreen> {
           await auth.refreshAuthorizeStatus();
           await auth.refreshUserProfile();
 
-          Get.find<ChannelProvider>().refreshAvailableChannel();
           Get.find<RealmProvider>().refreshAvailableRealms();
           Get.find<RelationshipProvider>().refreshRelativeList();
-          Get.find<WebSocketProvider>().registerPushNotifications();
+          Get.find<NotificationProvider>().registerPushNotifications();
           autoConfigureBackgroundNotificationService();
           autoStartBackgroundNotificationService();
 
@@ -218,10 +216,10 @@ class _SignInScreenState extends State<SignInScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: CenteredContainer(
-        maxWidth: 360,
+    return CenteredContainer(
+      maxWidth: 360,
+      child: Theme(
+        data: Theme.of(context).copyWith(canvasColor: Colors.transparent),
         child: PageTransitionSwitcher(
           transitionBuilder: (
             Widget child,

lib/screens/auth/signup.dart

@@ -65,148 +65,141 @@ class _SignUpScreenState extends State<SignUpScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: CenteredContainer(
-        maxWidth: 360,
-        child: ListView(
-          shrinkWrap: true,
-          children: [
-            Align(
-              alignment: Alignment.centerLeft,
-              child: ClipRRect(
-                borderRadius: const BorderRadius.all(Radius.circular(8)),
-                child: Image.asset('assets/logo.png', width: 64, height: 64),
-              ).paddingOnly(bottom: 8, left: 4),
+    return CenteredContainer(
+      maxWidth: 360,
+      child: ListView(
+        shrinkWrap: true,
+        children: [
+          Align(
+            alignment: Alignment.centerLeft,
+            child: ClipRRect(
+              borderRadius: const BorderRadius.all(Radius.circular(8)),
+              child: Image.asset('assets/logo.png', width: 64, height: 64),
+            ).paddingOnly(bottom: 8, left: 4),
+          ),
+          Text(
+            'signupGreeting'.tr,
+            style: const TextStyle(
+              fontSize: 28,
+              fontWeight: FontWeight.w900,
             ),
-            Text(
-              'signupGreeting'.tr,
-              style: const TextStyle(
-                fontSize: 28,
-                fontWeight: FontWeight.w900,
-              ),
-            ).paddingOnly(left: 4, bottom: 16),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _usernameController,
-              autofillHints: const [AutofillHints.username],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'username'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+          ).paddingOnly(left: 4, bottom: 16),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _usernameController,
+            autofillHints: const [AutofillHints.username],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'username'.tr,
             ),
-            const Gap(12),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _nicknameController,
-              autofillHints: const [AutofillHints.nickname],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'nickname'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _nicknameController,
+            autofillHints: const [AutofillHints.nickname],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'nickname'.tr,
             ),
-            const Gap(12),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _emailController,
-              autofillHints: const [AutofillHints.email],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'email'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _emailController,
+            autofillHints: const [AutofillHints.email],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'email'.tr,
             ),
-            const Gap(12),
-            TextField(
-              obscureText: true,
-              autocorrect: false,
-              enableSuggestions: false,
-              autofillHints: const [AutofillHints.password],
-              controller: _passwordController,
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'password'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
-              onSubmitted: (_) => _performAction(context),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            obscureText: true,
+            autocorrect: false,
+            enableSuggestions: false,
+            autofillHints: const [AutofillHints.password],
+            controller: _passwordController,
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'password'.tr,
             ),
-            const Gap(8),
-            CheckboxListTile(
-              value: _isTermAccepted,
-              title: Text(
-                'termAccept'.tr,
-                style: const TextStyle(height: 1.2),
-              ).paddingOnly(bottom: 4),
-              shape: const RoundedRectangleBorder(
-                borderRadius: BorderRadius.all(
-                  Radius.circular(8),
-                ),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+            onSubmitted: (_) => _performAction(context),
+          ),
+          const Gap(8),
+          CheckboxListTile(
+            value: _isTermAccepted,
+            title: Text(
+              'termAccept'.tr,
+              style: const TextStyle(height: 1.2),
+            ).paddingOnly(bottom: 4),
+            shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(
+                Radius.circular(8),
               ),
-              subtitle: RichText(
-                text: TextSpan(
-                  style: Theme.of(context).textTheme.bodySmall!.copyWith(
-                        color: Theme.of(context)
-                            .colorScheme
-                            .onSurface
-                            .withOpacity(0.75),
-                      ),
-                  children: [
-                    TextSpan(text: 'termAcceptDesc'.tr),
-                    WidgetSpan(
-                      child: Material(
-                        color: Colors.transparent,
-                        child: InkWell(
-                          child: Row(
-                            mainAxisSize: MainAxisSize.min,
-                            children: [
-                              Text('termAcceptLink'.tr),
-                              const Gap(4),
-                              const Icon(Icons.launch, size: 14),
-                            ],
-                          ),
-                          onTap: () {
-                            launchUrlString('https://solsynth.dev/terms');
-                          },
+            ),
+            subtitle: RichText(
+              text: TextSpan(
+                style: Theme.of(context).textTheme.bodySmall!.copyWith(
+                      color: Theme.of(context)
+                          .colorScheme
+                          .onSurface
+                          .withOpacity(0.75),
+                    ),
+                children: [
+                  TextSpan(text: 'termAcceptDesc'.tr),
+                  WidgetSpan(
+                    child: Material(
+                      color: Colors.transparent,
+                      child: InkWell(
+                        child: Row(
+                          mainAxisSize: MainAxisSize.min,
+                          children: [
+                            Text('termAcceptLink'.tr),
+                            const Gap(4),
+                            const Icon(Icons.launch, size: 14),
+                          ],
                         ),
+                        onTap: () {
+                          launchUrlString('https://solsynth.dev/terms');
+                        },
                       ),
                     ),
-                  ],
-                ),
+                  ),
+                ],
               ),
-              onChanged: (value) {
-                setState(() => _isTermAccepted = value ?? false);
-              },
             ),
-            const Gap(16),
-            Align(
-              alignment: Alignment.centerRight,
-              child: TextButton(
-                onPressed:
-                    !_isTermAccepted ? null : () => _performAction(context),
-                child: Row(
-                  mainAxisSize: MainAxisSize.min,
-                  children: [
-                    Text('next'.tr),
-                    const Icon(Icons.chevron_right),
-                  ],
-                ),
+            onChanged: (value) {
+              setState(() => _isTermAccepted = value ?? false);
+            },
+          ),
+          const Gap(16),
+          Align(
+            alignment: Alignment.centerRight,
+            child: TextButton(
+              onPressed:
+                  !_isTermAccepted ? null : () => _performAction(context),
+              child: Row(
+                mainAxisSize: MainAxisSize.min,
+                children: [
+                  Text('next'.tr),
+                  const Icon(Icons.chevron_right),
+                ],
               ),
-            )
-          ],
-        ),
+            ),
+          )
+        ],
       ).paddingAll(24),
     );
   }

lib/screens/channel/call/call.dart

@@ -11,6 +11,7 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/chat/call/call_controls.dart';
 import 'package:solian/widgets/chat/call/call_participant.dart';
 import 'package:livekit_client/livekit_client.dart' as livekit;
+import 'package:solian/widgets/root_container.dart';
 
 class CallScreen extends StatefulWidget {
   final bool hideAppBar;
@@ -197,8 +198,7 @@ class _CallScreenState extends State<CallScreen> with TickerProviderStateMixin {
   Widget build(BuildContext context) {
     final ChatCallProvider ctrl = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return ResponsiveRootContainer(
       child: Scaffold(
         appBar: widget.hideAppBar
             ? null

lib/screens/channel/channel_chat.dart

@@ -3,6 +3,7 @@ import 'dart:ui';
 
 import 'package:flutter/material.dart';
 import 'package:get/get.dart';
+import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/call.dart';
@@ -25,6 +26,7 @@ import 'package:solian/widgets/chat/chat_event_list.dart';
 import 'package:solian/widgets/chat/chat_message_input.dart';
 import 'package:solian/widgets/chat/chat_typing_indicator.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class ChannelChatScreen extends StatefulWidget {
   final String alias;
@@ -179,6 +181,8 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     }
   }
 
+  late SharedPreferences _prefs;
+
   @override
   void initState() {
     super.initState();
@@ -189,10 +193,13 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     _chatController = ChatEventController();
     _chatController.initialize();
 
-    _getOngoingCall();
-    _getChannel().then((_) {
-      _chatController.getInitialEvents(_channel!, widget.realm);
-      _listenMessages();
+    SharedPreferences.getInstance().then((inst) {
+      _prefs = inst;
+      _getOngoingCall();
+      _getChannel().then((_) {
+        _chatController.getInitialEvents(_channel!, widget.realm);
+        _listenMessages();
+      });
     });
   }
 
@@ -201,151 +208,159 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     String title = _channel?.name ?? 'loading'.tr;
     String? placeholder;
 
-    if (_channel?.type == 1) {
-      final otherside =
-          _channel!.members!.where((e) => e.account.id != _accountId).first;
+    final otherside =
+        _channel?.members!.where((e) => e.account.id != _accountId).firstOrNull;
+
+    if (_channel?.type == 1 && otherside != null) {
       title = otherside.account.nick;
       placeholder = 'messageInputPlaceholder'.trParams(
         {'channel': '@${otherside.account.name}'},
       );
     }
 
-    return Scaffold(
-      appBar: AppBar(
-        leading: AppBarLeadingButton.adaptive(context),
-        title: AppBarTitle(title),
-        centerTitle: false,
-        titleSpacing: AppTheme.titleSpacing(context),
-        toolbarHeight: AppTheme.toolbarHeight(context),
-        actions: [
-          const BackgroundStateWidget(),
-          Builder(builder: (context) {
-            if (_isBusy || _channel == null) return const SizedBox.shrink();
+    return ResponsiveRootContainer(
+      child: Scaffold(
+        appBar: AppBar(
+          leading: AppBarLeadingButton.adaptive(context),
+          title: AppBarTitle(title),
+          centerTitle: false,
+          titleSpacing: AppTheme.titleSpacing(context),
+          toolbarHeight: AppTheme.toolbarHeight(context),
+          actions: [
+            const BackgroundStateWidget(),
+            Builder(builder: (context) {
+              if (_isBusy || _channel == null) return const SizedBox.shrink();
 
-            return ChatCallButton(
-              realm: _channel!.realm,
-              channel: _channel!,
-              ongoingCall: _ongoingCall,
-            );
-          }),
-          IconButton(
-            icon: const Icon(Icons.more_vert),
-            onPressed: () {
-              if (_channel == null) return;
+              return ChatCallButton(
+                realm: _channel!.realm,
+                channel: _channel!,
+                ongoingCall: _ongoingCall,
+              );
+            }),
+            IconButton(
+              icon: const Icon(Icons.more_vert),
+              onPressed: () {
+                if (_channel == null) return;
 
-              AppRouter.instance
-                  .pushNamed(
-                'channelDetail',
-                pathParameters: {'alias': widget.alias},
-                queryParameters: {'realm': widget.realm},
-                extra: ChannelDetailArguments(
-                  profile: _channelProfile!,
-                  channel: _channel!,
-                ),
-              )
-                  .then((value) {
-                if (value == false) AppRouter.instance.pop();
-                if (value != null) {
-                  final resp = Channel.fromJson(value as Map<String, dynamic>);
-                  _getChannel(alias: resp.alias);
-                }
-              });
-            },
-          ),
-          SizedBox(
-            width: AppTheme.isLargeScreen(context) ? 8 : 16,
-          ),
-        ],
-      ),
-      body: Builder(builder: (context) {
-        if (_isBusy || _channel == null) {
-          return const Center(
-            child: CircularProgressIndicator(),
-          );
-        }
-
-        return Row(
-          children: [
-            Expanded(
-              child: Column(
-                children: [
-                  if (_ongoingCall != null)
-                    ChannelCallIndicator(
-                      channel: _channel!,
-                      ongoingCall: _ongoingCall!,
-                      onJoin: () {
-                        if (!AppTheme.isLargeScreen(context)) {
-                          final ChatCallProvider call = Get.find();
-                          call.gotoScreen(context);
-                        }
-                      },
-                    ),
-                  Expanded(
-                    child: ChatEventList(
-                      scope: widget.realm,
-                      channel: _channel!,
-                      chatController: _chatController,
-                      onEdit: (item) {
-                        setState(() => _messageToEditing = item);
-                      },
-                      onReply: (item) {
-                        setState(() => _messageToReplying = item);
-                      },
-                    ),
+                AppRouter.instance
+                    .pushNamed(
+                  'channelDetail',
+                  pathParameters: {'alias': widget.alias},
+                  queryParameters: {'realm': widget.realm},
+                  extra: ChannelDetailArguments(
+                    profile: _channelProfile!,
+                    channel: _channel!,
                   ),
-                  ClipRect(
-                    child: BackdropFilter(
-                      filter: ImageFilter.blur(sigmaX: 50, sigmaY: 50),
-                      child: SafeArea(
-                        child: Column(
-                          children: [
-                            ChatTypingIndicator(users: _typingUsers),
-                            ChatMessageInput(
-                              edit: _messageToEditing,
-                              reply: _messageToReplying,
-                              realm: widget.realm,
-                              placeholder: placeholder,
-                              channel: _channel!,
-                              onSent: (Event item) {
-                                setState(() {
-                                  _chatController.addPendingEvent(item);
-                                });
-                              },
-                              onReset: () {
-                                setState(() {
-                                  _messageToReplying = null;
-                                  _messageToEditing = null;
-                                });
-                              },
-                            ),
-                          ],
+                )
+                    .then((value) {
+                  if (value == false) AppRouter.instance.pop();
+                  if (value != null) {
+                    final resp =
+                        Channel.fromJson(value as Map<String, dynamic>);
+                    _getChannel(alias: resp.alias);
+                  }
+                });
+              },
+            ),
+            SizedBox(
+              width: AppTheme.isLargeScreen(context) ? 8 : 16,
+            ),
+          ],
+        ),
+        body: Builder(builder: (context) {
+          if (_isBusy || _channel == null) {
+            return const Center(
+              child: CircularProgressIndicator(),
+            );
+          }
+
+          return Row(
+            children: [
+              Expanded(
+                child: Column(
+                  children: [
+                    if (_ongoingCall != null)
+                      ChannelCallIndicator(
+                        channel: _channel!,
+                        ongoingCall: _ongoingCall!,
+                        onJoin: () {
+                          if (!AppTheme.isUltraLargeScreen(context)) {
+                            final ChatCallProvider call = Get.find();
+                            call.gotoScreen(context);
+                          }
+                        },
+                      ),
+                    Expanded(
+                      child: ChatEventList(
+                        noAnimated:
+                            _prefs.getBool('non_animated_message_list') ??
+                                false,
+                        scope: widget.realm,
+                        channel: _channel!,
+                        chatController: _chatController,
+                        onEdit: (item) {
+                          setState(() => _messageToEditing = item);
+                        },
+                        onReply: (item) {
+                          setState(() => _messageToReplying = item);
+                        },
+                      ),
+                    ),
+                    ClipRect(
+                      child: BackdropFilter(
+                        filter: ImageFilter.blur(sigmaX: 50, sigmaY: 50),
+                        child: SafeArea(
+                          child: Column(
+                            children: [
+                              ChatTypingIndicator(users: _typingUsers),
+                              ChatMessageInput(
+                                edit: _messageToEditing,
+                                reply: _messageToReplying,
+                                realm: widget.realm,
+                                placeholder: placeholder,
+                                channel: _channel!,
+                                onSent: (Event item) {
+                                  setState(() {
+                                    _chatController.addPendingEvent(item);
+                                  });
+                                },
+                                onReset: () {
+                                  setState(() {
+                                    _messageToReplying = null;
+                                    _messageToEditing = null;
+                                  });
+                                },
+                              ),
+                            ],
+                          ),
                         ),
                       ),
                     ),
-                  ),
-                ],
+                  ],
+                ),
               ),
-            ),
-            Obx(() {
-              final ChatCallProvider call = Get.find();
-              if (call.isMounted.value && AppTheme.isLargeScreen(context)) {
-                return const Expanded(
-                  child: Row(children: [
-                    VerticalDivider(width: 0.3, thickness: 0.3),
-                    Expanded(
-                      child: CallScreen(
-                        hideAppBar: true,
-                        isExpandable: true,
+              Obx(() {
+                final ChatCallProvider call = Get.find();
+                if (call.isMounted.value &&
+                    AppTheme.isUltraLargeScreen(context)) {
+                  return const Expanded(
+                    child: Row(children: [
+                      VerticalDivider(width: 0.3, thickness: 0.3),
+                      Expanded(
+                        child: CallScreen(
+                          hideAppBar: true,
+                          isExpandable: true,
+                        ),
                       ),
-                    ),
-                  ]),
-                );
-              }
-              return const SizedBox.shrink();
-            }),
-          ],
-        );
-      }),
+                    ]),
+                  );
+                }
+                return const SizedBox.shrink();
+              }),
+            ],
+          );
+        }),
+      ),
     );
   }
 

lib/screens/channel/channel_organize.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@@ -9,6 +8,8 @@ import 'package:solian/providers/content/channel.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';
 
 class ChannelOrganizeArguments {
@@ -114,8 +115,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
       ),
     ];
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return ResponsiveRootContainer(
       child: Scaffold(
         appBar: AppBar(
           title: AppBarTitle('channelOrganizing'.tr),
@@ -132,7 +132,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
           top: false,
           child: Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               if (widget.edit != null)
                 MaterialBanner(
                   leading: const Icon(Icons.edit),

lib/screens/chat.dart

@@ -1,145 +1,338 @@
 import 'package:flutter/material.dart';
+import 'package:flutter_resizable_container/flutter_resizable_container.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/channel.dart';
+import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/database/database.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/signin_required_overlay.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/channel/channel_list.dart';
 import 'package:solian/widgets/chat/call/chat_call_indicator.dart';
 import 'package:solian/widgets/current_state_action.dart';
-import 'package:solian/widgets/sized_container.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
+import 'package:solian/widgets/sidebar/empty_placeholder.dart';
 
-class ChatScreen extends StatefulWidget {
+class ChatScreen extends StatelessWidget {
   const ChatScreen({super.key});
 
   @override
-  State<ChatScreen> createState() => _ChatScreenState();
+  Widget build(BuildContext context) {
+    return const ResponsiveRootContainer(
+      child: ChatList(),
+    );
+  }
 }
 
-class _ChatScreenState extends State<ChatScreen> {
-  late final ChannelProvider _channels;
+class ChatListShell extends StatelessWidget {
+  final Widget? child;
+
+  const ChatListShell({super.key, required this.child});
+
+  @override
+  Widget build(BuildContext context) {
+    return RootContainer(
+      child: ResizableContainer(
+        direction: Axis.horizontal,
+        divider: ResizableDivider(
+          thickness: 0.3,
+          color: Theme.of(context).dividerColor.withOpacity(0.3),
+        ),
+        children: [
+          const ResizableChild(
+            minSize: 280,
+            maxSize: 520,
+            size: ResizableSize.pixels(360),
+            child: ChatList(),
+          ),
+          ResizableChild(
+            minSize: 280,
+            child: child ?? const EmptyPagePlaceholder(),
+          ),
+        ],
+      ),
+    );
+  }
+}
+
+class ChatList extends StatefulWidget {
+  const ChatList({super.key});
+
+  @override
+  State<ChatList> createState() => _ChatListState();
+}
+
+class _ChatListState extends State<ChatList> {
+  List<Channel> _normalChannels = List.empty();
+  List<Channel> _directChannels = List.empty();
+  final Map<String, List<Channel>> _realmChannels = {};
+
+  late final ChannelProvider _channels = Get.find();
+
+  bool _isBusy = true;
+
+  List<Channel> _sortChannels(List<Channel> channels) {
+    channels.sort(
+      (a, b) =>
+          _lastMessages?[b.id]?.createdAt.compareTo(
+                _lastMessages?[a.id]?.createdAt ??
+                    DateTime.fromMillisecondsSinceEpoch(0),
+              ) ??
+          0,
+    );
+    return channels;
+  }
+
+  Future<void> _loadNormalChannels() async {
+    final resp = await _channels.listAvailableChannel(isDirect: false);
+    setState(() {
+      _normalChannels = _sortChannels(resp);
+    });
+  }
+
+  Future<void> _loadDirectChannels() async {
+    final resp = await _channels.listAvailableChannel(isDirect: true);
+    setState(() {
+      _directChannels = _sortChannels(resp);
+    });
+  }
+
+  Future<void> _loadRealmChannels(String realm) async {
+    final resp = await _channels.listAvailableChannel(scope: realm);
+    setState(() {
+      _realmChannels[realm] = _sortChannels(List.from(resp));
+    });
+  }
+
+  Future<void> _loadAllChannels() async {
+    final RealmProvider realms = Get.find();
+    Future.wait([
+      _loadNormalChannels(),
+      _loadDirectChannels(),
+      ...realms.availableRealms.map((x) => _loadRealmChannels(x.alias)),
+    ]);
+  }
+
+  Map<int, LocalMessageEventTableData>? _lastMessages;
+
+  Future<void> _loadLastMessages() async {
+    final ctrl = ChatEventController();
+    await ctrl.initialize();
+    final messages = await ctrl.src.getLastInAllChannels();
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
+    }
+  }
 
   @override
   void initState() {
     super.initState();
-    try {
-      _channels = Get.find();
-      _channels.refreshAvailableChannel();
-    } catch (e) {
-      context.showErrorDialog(e);
-    }
+    _loadLastMessages().then((_) {
+      if (!mounted) return;
+      _loadAllChannels().then((_) {
+        if (mounted) {
+          setState(() => _isBusy = false);
+        }
+      });
+    });
   }
 
   @override
   Widget build(BuildContext context) {
     final AuthProvider auth = Get.find();
+    final RealmProvider realms = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Scaffold(
-        appBar: AppBar(
-          leading: AppBarLeadingButton.adaptive(context),
-          title: AppBarTitle('chat'.tr),
-          centerTitle: true,
-          toolbarHeight: AppTheme.toolbarHeight(context),
-          actions: [
-            const BackgroundStateWidget(),
-            const NotificationButton(),
-            PopupMenuButton(
-              icon: const Icon(Icons.add_circle),
-              itemBuilder: (BuildContext context) => [
-                PopupMenuItem(
-                  child: ListTile(
-                    title: Text('channelOrganizeCommon'.tr),
-                    leading: const Icon(Icons.tag),
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 8),
-                  ),
-                  onTap: () {
-                    AppRouter.instance.pushNamed('channelOrganizing').then(
-                      (value) {
-                        if (value != null) {
-                          _channels.refreshAvailableChannel();
-                        }
+    return Obx(
+      () => DefaultTabController(
+        length: 2 + realms.availableRealms.length,
+        child: ResponsiveRootContainer(
+          child: Scaffold(
+            appBar: AppBar(
+              leading: AppBarLeadingButton.adaptive(context),
+              title: AppBarTitle('chat'.tr),
+              centerTitle: true,
+              toolbarHeight: AppTheme.toolbarHeight(context),
+              actions: [
+                const BackgroundStateWidget(),
+                const NotificationButton(),
+                PopupMenuButton(
+                  icon: const Icon(Icons.add_circle),
+                  itemBuilder: (BuildContext context) => [
+                    PopupMenuItem(
+                      child: ListTile(
+                        title: Text('channelOrganizeCommon'.tr),
+                        leading: const Icon(Icons.tag),
+                        contentPadding:
+                            const EdgeInsets.symmetric(horizontal: 8),
+                      ),
+                      onTap: () {
+                        AppRouter.instance.pushNamed('channelOrganizing').then(
+                          (value) {
+                            if (value != null) {
+                              _loadAllChannels();
+                            }
+                          },
+                        );
                       },
-                    );
-                  },
-                ),
-                PopupMenuItem(
-                  child: ListTile(
-                    title: Text('channelOrganizeDirect'.tr),
-                    leading: const FaIcon(
-                      FontAwesomeIcons.userGroup,
-                      size: 16,
                     ),
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 8),
-                  ),
-                  onTap: () {
-                    final ChannelProvider channels = Get.find();
-                    channels
-                        .createDirectChannel(context, 'global')
-                        .then((resp) {
-                      if (resp != null) {
-                        _channels.refreshAvailableChannel();
-                      }
-                    }).catchError((e) {
-                      context.showErrorDialog(e);
-                    });
-                  },
+                    PopupMenuItem(
+                      child: ListTile(
+                        title: Text('channelOrganizeDirect'.tr),
+                        leading: const FaIcon(
+                          FontAwesomeIcons.userGroup,
+                          size: 16,
+                        ),
+                        contentPadding:
+                            const EdgeInsets.symmetric(horizontal: 8),
+                      ),
+                      onTap: () {
+                        final ChannelProvider channels = Get.find();
+                        channels
+                            .createDirectChannel(context, 'global')
+                            .then((resp) {
+                          if (resp != null) {
+                            _loadAllChannels();
+                          }
+                        }).catchError((e) {
+                          context.showErrorDialog(e);
+                        });
+                      },
+                    ),
+                  ],
+                ),
+                SizedBox(
+                  width: AppTheme.isLargeScreen(context) ? 8 : 16,
                 ),
               ],
-            ),
-            SizedBox(
-              width: AppTheme.isLargeScreen(context) ? 8 : 16,
-            ),
-          ],
-        ),
-        body: Obx(() {
-          if (auth.isAuthorized.isFalse) {
-            return SigninRequiredOverlay(
-              onDone: () => _channels.refreshAvailableChannel(),
-            );
-          }
-
-          final selfId = auth.userProfile.value!['id'];
-
-          return Column(
-            children: [
-              Obx(() {
-                if (_channels.isLoading.isFalse) {
-                  return const SizedBox.shrink();
-                } else {
-                  return const LinearProgressIndicator();
-                }
-              }),
-              const ChatCallCurrentIndicator(),
-              Expanded(
-                child: CenteredContainer(
-                  child: RefreshIndicator(
-                    onRefresh: _channels.refreshAvailableChannel,
-                    child: Obx(
-                      () => ChannelListWidget(
-                        noCategory: true,
-                        channels: List.from([
-                          ..._channels.groupChannels
-                              .where((x) => x.realmId == null),
-                          ..._channels.directChannels
-                        ]),
-                        selfId: selfId,
-                        useReplace: true,
-                      ),
+              bottom: TabBar(
+                isScrollable: true,
+                dividerHeight: 0.3,
+                tabAlignment: TabAlignment.startOffset,
+                tabs: [
+                  Tab(
+                    child: Row(
+                      mainAxisSize: MainAxisSize.min,
+                      children: [
+                        CircleAvatar(
+                          radius: 14,
+                          backgroundColor:
+                              Theme.of(context).colorScheme.primary,
+                          child: const Icon(
+                            Icons.forum,
+                            size: 16,
+                            color: Colors.white,
+                          ),
+                        ),
+                        const Gap(8),
+                        Text('all'.tr),
+                      ],
                     ),
                   ),
-                ),
+                  Tab(
+                    child: Row(
+                      mainAxisSize: MainAxisSize.min,
+                      children: [
+                        const CircleAvatar(
+                          radius: 14,
+                          child: Icon(
+                            Icons.chat_bubble,
+                            size: 16,
+                          ),
+                        ),
+                        const Gap(8),
+                        Text('channelTypeDirect'.tr),
+                      ],
+                    ),
+                  ),
+                  ...realms.availableRealms.map((x) => Tab(
+                        child: Row(
+                          mainAxisSize: MainAxisSize.min,
+                          children: [
+                            AttachedCircleAvatar(
+                              content: x.avatar,
+                              radius: 14,
+                              fallbackWidget: const Icon(
+                                Icons.workspaces,
+                                size: 16,
+                              ),
+                            ),
+                            const Gap(8),
+                            Text(x.name),
+                          ],
+                        ),
+                      )),
+                ],
               ),
-            ],
-          );
-        }),
+            ),
+            body: Obx(() {
+              if (auth.isAuthorized.isFalse) {
+                return SigninRequiredOverlay(
+                  onDone: () => _loadAllChannels(),
+                );
+              }
+
+              final selfId = auth.userProfile.value!['id'];
+
+              return Column(
+                children: [
+                  const ChatCallCurrentIndicator(),
+                  LoadingIndicator(isActive: _isBusy),
+                  Expanded(
+                    child: TabBarView(
+                      children: [
+                        RefreshIndicator(
+                          onRefresh: _loadNormalChannels,
+                          child: ChannelListWidget(
+                            channels: _sortChannels([
+                              ..._normalChannels,
+                              ..._directChannels,
+                              ..._realmChannels.values.expand((x) => x),
+                            ]),
+                            selfId: selfId,
+                            useReplace: AppTheme.isLargeScreen(context),
+                          ),
+                        ),
+                        RefreshIndicator(
+                          onRefresh: _loadDirectChannels,
+                          child: ChannelListWidget(
+                            channels: _directChannels,
+                            selfId: selfId,
+                            useReplace: AppTheme.isLargeScreen(context),
+                          ),
+                        ),
+                        ...realms.availableRealms.map(
+                          (x) => RefreshIndicator(
+                            onRefresh: () => _loadRealmChannels(x.alias),
+                            child: ChannelListWidget(
+                              channels: _realmChannels[x.alias] ?? [],
+                              selfId: selfId,
+                              useReplace: AppTheme.isLargeScreen(context),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ],
+              );
+            }),
+          ),
+        ),
       ),
     );
   }

lib/screens/dashboard.dart

@@ -20,7 +20,7 @@ import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/daily_sign.dart';
 import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
-import 'package:solian/providers/websocket.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
@@ -38,7 +38,7 @@ class DashboardScreen extends StatefulWidget {
 class _DashboardScreenState extends State<DashboardScreen> {
   late final AuthProvider _auth = Get.find();
   late final LastReadProvider _lastRead = Get.find();
-  late final WebSocketProvider _ws = Get.find();
+  late final NotificationProvider _nty = Get.find();
   late final PostProvider _posts = Get.find();
   late final DailySignProvider _dailySign = Get.find();
 
@@ -46,7 +46,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
       Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
 
   List<Notification> get _pendingNotifications =>
-      List<Notification>.from(_ws.notifications)
+      List<Notification>.from(_nty.notifications.where((x) => x.readAt == null))
         ..sort((a, b) => b.createdAt.compareTo(a.createdAt));
 
   List<Post>? _currentPosts;
@@ -75,10 +75,12 @@ class _DashboardScreenState extends State<DashboardScreen> {
     final src = Get.find<MessagesFetchingProvider>();
     final out = await src.getWhatsNewEvents(_lastRead.messagesLastReadAt!);
     if (out == null) return;
-    setState(() {
-      _currentMessages = out.$1;
-      _currentMessagesCount = out.$2;
-    });
+    if (mounted) {
+      setState(() {
+        _currentMessages = out.$1;
+        _currentMessagesCount = out.$2;
+      });
+    }
   }
 
   bool _signingDaily = true;
@@ -89,13 +91,17 @@ class _DashboardScreenState extends State<DashboardScreen> {
     try {
       _signRecord = await _dailySign.getToday();
       _dailySign.listLastRecord(14).then((value) {
-        setState(() => _signRecordHistory = value);
+        if (mounted) {
+          setState(() => _signRecordHistory = value);
+        }
       });
     } catch (e) {
       context.showErrorDialog(e);
     }
 
-    setState(() => _signingDaily = false);
+    if (mounted) {
+      setState(() => _signingDaily = false);
+    }
   }
 
   Future<void> _signDaily() async {
@@ -147,7 +153,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
               ),
               Text(DateFormat('yyyy/MM/dd').format(DateTime.now().toUtc())),
             ],
-          ).paddingOnly(top: 8, left: 18, right: 18, bottom: 12),
+          ).paddingOnly(top: 16, left: 18, right: 18, bottom: 12),
           Card(
             child: Column(
               children: [
@@ -248,7 +254,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                         ),
                         Text(
                           'notificationUnreadCount'.trParams({
-                            'count': _ws.notifications.length.toString(),
+                            'count': _pendingNotifications.length.toString(),
                           }),
                         ),
                       ],
@@ -261,12 +267,12 @@ class _DashboardScreenState extends State<DashboardScreen> {
                           isScrollControlled: true,
                           context: context,
                           builder: (context) => const NotificationScreen(),
-                        ).then((_) => _ws.notificationUnread.value = 0);
+                        ).then((_) => _nty.notificationUnread.value = 0);
                       },
                     ),
                   ],
                 ).paddingOnly(left: 18, right: 18, bottom: 8),
-                if (_ws.notifications.isNotEmpty)
+                if (_pendingNotifications.isNotEmpty)
                   SizedBox(
                     height: 76,
                     child: ListView.separated(
@@ -354,7 +360,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                     IconButton(
                       icon: const Icon(Icons.arrow_forward),
                       onPressed: () {
-                        AppRouter.instance.goNamed('feed');
+                        AppRouter.instance.goNamed('explore');
                       },
                     ),
                   ],
@@ -383,9 +389,10 @@ class _DashboardScreenState extends State<DashboardScreen> {
                                 onUpdate: (_) {
                                   _pullPosts();
                                 },
-                                backgroundColor: Theme.of(context)
-                                    .colorScheme
-                                    .surfaceContainerLow,
+                                padding: EdgeInsets.symmetric(
+                                  vertical: 8,
+                                  horizontal: 4,
+                                ),
                               ),
                             ),
                           ),
@@ -519,7 +526,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                 style: TextStyle(color: _unFocusColor, fontSize: 12),
               )
             ],
-          ).paddingAll(8),
+          ).paddingOnly(left: 8, right: 8, top: 8, bottom: 50),
         ],
       ),
     );

lib/screens/explore.dart

@@ -0,0 +1,251 @@
+import 'dart:async';
+import 'dart:ui';
+
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:solian/controllers/post_list_controller.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/navigation.dart';
+import 'package:solian/router.dart';
+import 'package:solian/screens/account/notification.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/account/signin_required_overlay.dart';
+import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/app_bar_leading.dart';
+import 'package:solian/widgets/navigation/realm_switcher.dart';
+import 'package:solian/widgets/posts/post_creation.dart';
+import 'package:solian/widgets/posts/post_list.dart';
+import 'package:solian/widgets/posts/post_shuffle_swiper.dart';
+import 'package:solian/widgets/root_container.dart';
+
+class ExploreScreen extends StatefulWidget {
+  const ExploreScreen({super.key});
+
+  @override
+  State<ExploreScreen> createState() => _ExploreScreenState();
+}
+
+class _ExploreScreenState extends State<ExploreScreen>
+    with SingleTickerProviderStateMixin {
+  late final PostListController _postController;
+  late final TabController _tabController;
+
+  List<StreamSubscription>? _subscriptions;
+
+  @override
+  void initState() {
+    super.initState();
+    final navState = Get.find<NavigationStateProvider>();
+    _postController = PostListController();
+    _postController.realm = navState.focusedRealm.value?.alias;
+    _tabController = TabController(length: 3, vsync: this);
+    _tabController.addListener(() {
+      if (_postController.mode.value == _tabController.index) return;
+      _postController.mode.value = _tabController.index;
+      _postController.reloadAllOver();
+    });
+    _subscriptions = [
+      Get.find<NavigationStateProvider>().focusedRealm.listen((value) {
+        if (value?.alias != _postController.realm) {
+          _postController.realm = value?.alias;
+          _postController.reloadAllOver();
+        }
+      }),
+    ];
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+
+    return RootContainer(
+      child: Scaffold(
+        floatingActionButton: FloatingActionButton(
+          child: const Icon(Icons.add),
+          onPressed: () async {
+            final value = await showModalBottomSheet(
+              useRootNavigator: true,
+              isScrollControlled: true,
+              context: context,
+              builder: (context) => const PostCreatePopup(),
+            );
+            if (value is Future) {
+              value.then((_) {
+                _postController.reloadAllOver();
+              });
+            } else if (value != null) {
+              _postController.reloadAllOver();
+            }
+          },
+        ),
+        body: NestedScrollView(
+          headerSliverBuilder: (BuildContext context, bool innerBoxIsScrolled) {
+            return [
+              SliverLayoutBuilder(
+                builder: (context, constraints) {
+                  final scrollOffset = constraints.scrollOffset;
+                  final colorChangeOffset = 120;
+
+                  final scrollProgress =
+                      (scrollOffset / colorChangeOffset).clamp(0.0, 1.0);
+                  final blurSigma = lerpDouble(0, 10, scrollProgress) ?? 0;
+
+                  return SliverAppBar(
+                    flexibleSpace: ClipRRect(
+                      child: BackdropFilter(
+                        filter: ImageFilter.blur(
+                          sigmaX: blurSigma,
+                          sigmaY: blurSigma,
+                        ),
+                        child: ListView(
+                          padding: EdgeInsets.zero,
+                          physics: const NeverScrollableScrollPhysics(),
+                          children: [
+                            SizedBox(
+                              height: 48,
+                              child: const Row(
+                                children: [
+                                  RealmSwitcher(),
+                                ],
+                              ).paddingSymmetric(horizontal: 8),
+                            ).paddingSymmetric(vertical: 4),
+                            TabBar(
+                              controller: _tabController,
+                              dividerHeight: scrollProgress > 0 ? 0 : 0.3,
+                              tabAlignment: TabAlignment.fill,
+                              tabs: [
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.feed, size: 20),
+                                      const Gap(8),
+                                      Text('postListNews'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.people, size: 20),
+                                      const Gap(8),
+                                      Text('postListFriends'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(
+                                        Icons.shuffle_on_outlined,
+                                        size: 20,
+                                      ),
+                                      const Gap(8),
+                                      Text('postListShuffle'.tr),
+                                    ],
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ],
+                        ).paddingOnly(top: MediaQuery.of(context).padding.top),
+                      ),
+                    ),
+                    expandedHeight: 104,
+                    snap: true,
+                    floating: true,
+                    toolbarHeight: AppTheme.toolbarHeight(context),
+                    leading: AppBarLeadingButton.adaptive(context),
+                    actions: [
+                      const BackgroundStateWidget(),
+                      IconButton(
+                        icon: const Icon(Icons.search),
+                        onPressed: () {
+                          AppRouter.instance.pushNamed('postSearch');
+                        },
+                      ),
+                      const NotificationButton(),
+                      SizedBox(
+                        width: AppTheme.isLargeScreen(context) ? 8 : 16,
+                      ),
+                    ],
+                  );
+                },
+              )
+            ];
+          },
+          body: Obx(() {
+            if (_postController.isPreparing.isTrue) {
+              return const Center(
+                child: CircularProgressIndicator(),
+              );
+            }
+
+            return Column(
+              children: [
+                Expanded(
+                  child: TabBarView(
+                    physics: const NeverScrollableScrollPhysics(),
+                    controller: _tabController,
+                    children: [
+                      RefreshIndicator(
+                        onRefresh: () => _postController.reloadAllOver(),
+                        child: CustomScrollView(slivers: [
+                          ControlledPostListWidget(
+                            padding: AppTheme.isLargeScreen(context)
+                                ? EdgeInsets.symmetric(
+                                    horizontal: 4,
+                                    vertical: 8,
+                                  )
+                                : EdgeInsets.zero,
+                            controller: _postController.pagingController,
+                            onUpdate: () => _postController.reloadAllOver(),
+                          ),
+                        ]),
+                      ),
+                      Obx(() {
+                        if (auth.isAuthorized.value) {
+                          return RefreshIndicator(
+                            onRefresh: () => _postController.reloadAllOver(),
+                            child: CustomScrollView(slivers: [
+                              ControlledPostListWidget(
+                                padding: AppTheme.isLargeScreen(context)
+                                    ? EdgeInsets.symmetric(horizontal: 16)
+                                    : EdgeInsets.zero,
+                                controller: _postController.pagingController,
+                                onUpdate: () => _postController.reloadAllOver(),
+                              ),
+                            ]),
+                          );
+                        } else {
+                          return SigninRequiredOverlay(
+                            onDone: () => _postController.reloadAllOver(),
+                          );
+                        }
+                      }),
+                      PostShuffleSwiper(controller: _postController),
+                    ],
+                  ),
+                ),
+              ],
+            );
+          }),
+        ),
+      ),
+    );
+  }
+
+  @override
+  void dispose() {
+    _postController.dispose();
+    if (_subscriptions != null) {
+      for (final subscription in _subscriptions!) {
+        subscription.cancel();
+      }
+    }
+    super.dispose();
+  }
+}

lib/screens/feed.dart

@@ -1,283 +0,0 @@
-import 'dart:async';
-
-import 'package:flutter/material.dart';
-import 'package:gap/gap.dart';
-import 'package:get/get.dart';
-import 'package:solian/controllers/post_list_controller.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/navigation.dart';
-import 'package:solian/router.dart';
-import 'package:solian/screens/account/notification.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/account/signin_required_overlay.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/current_state_action.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/posts/post_shuffle_swiper.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
-
-class FeedScreen extends StatefulWidget {
-  const FeedScreen({super.key});
-
-  @override
-  State<FeedScreen> createState() => _FeedScreenState();
-}
-
-class _FeedScreenState extends State<FeedScreen>
-    with SingleTickerProviderStateMixin {
-  late final PostListController _postController;
-  late final TabController _tabController;
-
-  List<StreamSubscription>? _subscriptions;
-
-  @override
-  void initState() {
-    super.initState();
-    final navState = Get.find<NavigationStateProvider>();
-    _postController = PostListController();
-    _postController.realm = navState.focusedRealm.value?.alias;
-    _tabController = TabController(length: 3, vsync: this);
-    _tabController.addListener(() {
-      if (_postController.mode.value == _tabController.index) return;
-      _postController.mode.value = _tabController.index;
-      _postController.reloadAllOver();
-    });
-    _subscriptions = [
-      Get.find<NavigationStateProvider>().focusedRealm.listen((value) {
-        if (value?.alias != _postController.realm) {
-          _postController.realm = value?.alias;
-          _postController.reloadAllOver();
-        }
-      }),
-    ];
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    final AuthProvider auth = Get.find();
-    final NavigationStateProvider navState = Get.find();
-
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Scaffold(
-        floatingActionButton: FloatingActionButton(
-          child: const Icon(Icons.add),
-          onPressed: () async {
-            final value = await showModalBottomSheet(
-              useRootNavigator: true,
-              isScrollControlled: true,
-              context: context,
-              builder: (context) => const PostCreatePopup(),
-            );
-            if (value is Future) {
-              value.then((_) {
-                _postController.reloadAllOver();
-              });
-            } else if (value != null) {
-              _postController.reloadAllOver();
-            }
-          },
-        ),
-        body: NestedScrollView(
-          headerSliverBuilder: (BuildContext context, bool innerBoxIsScrolled) {
-            return [
-              SliverAppBar(
-                title: AppBarTitle('feed'.tr),
-                centerTitle: false,
-                floating: true,
-                toolbarHeight: AppTheme.toolbarHeight(context),
-                leading: AppBarLeadingButton.adaptive(context),
-                actions: [
-                  const BackgroundStateWidget(),
-                  const NotificationButton(),
-                  SizedBox(
-                    width: AppTheme.isLargeScreen(context) ? 8 : 16,
-                  ),
-                ],
-                bottom: TabBar(
-                  controller: _tabController,
-                  tabs: [
-                    Tab(text: 'postListNews'.tr),
-                    Tab(text: 'postListFriends'.tr),
-                    Tab(text: 'postListShuffle'.tr),
-                  ],
-                ),
-              )
-            ];
-          },
-          body: Obx(() {
-            if (_postController.isPreparing.isTrue) {
-              return const Center(
-                child: CircularProgressIndicator(),
-              );
-            }
-
-            return Column(
-              children: [
-                if (navState.focusedRealm.value != null)
-                  MaterialBanner(
-                    leading: const Icon(Icons.layers),
-                    content: Text(
-                      'postBrowsingIn'.trParams({
-                        'region': '#${navState.focusedRealm.value!.alias}',
-                      }),
-                    ),
-                    actions: const [SizedBox.shrink()],
-                  ),
-                Expanded(
-                  child: TabBarView(
-                    physics: const NeverScrollableScrollPhysics(),
-                    controller: _tabController,
-                    children: [
-                      RefreshIndicator(
-                        onRefresh: () => _postController.reloadAllOver(),
-                        child: CustomScrollView(slivers: [
-                          PostWarpedListWidget(
-                            controller: _postController.pagingController,
-                            onUpdate: () => _postController.reloadAllOver(),
-                          ),
-                        ]),
-                      ),
-                      Obx(() {
-                        if (auth.isAuthorized.value) {
-                          return RefreshIndicator(
-                            onRefresh: () => _postController.reloadAllOver(),
-                            child: CustomScrollView(slivers: [
-                              PostWarpedListWidget(
-                                controller: _postController.pagingController,
-                                onUpdate: () => _postController.reloadAllOver(),
-                              ),
-                            ]),
-                          );
-                        } else {
-                          return SigninRequiredOverlay(
-                            onDone: () => _postController.reloadAllOver(),
-                          );
-                        }
-                      }),
-                      PostShuffleSwiper(controller: _postController),
-                    ],
-                  ),
-                ),
-              ],
-            );
-          }),
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _postController.dispose();
-    if (_subscriptions != null) {
-      for (final subscription in _subscriptions!) {
-        subscription.cancel();
-      }
-    }
-    super.dispose();
-  }
-}
-
-class PostCreatePopup extends StatelessWidget {
-  final bool hideDraftBox;
-
-  const PostCreatePopup({
-    super.key,
-    this.hideDraftBox = false,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    final AuthProvider auth = Get.find();
-
-    if (auth.isAuthorized.isFalse) {
-      return const SizedBox.shrink();
-    }
-
-    final List<dynamic> actionList = [
-      (
-        icon: const Icon(Icons.post_add),
-        label: 'postEditorModeStory'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 0.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.description),
-        label: 'postEditorModeArticle'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 1.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.drafts),
-        label: 'draftBoxOpen'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed('draftBox'),
-          );
-        },
-      ),
-    ];
-
-    return SizedBox(
-      height: MediaQuery.of(context).size.height * 0.38,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
-        children: [
-          Text(
-            'postNew'.tr,
-            style: Theme.of(context).textTheme.headlineSmall,
-          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          Expanded(
-            child: GridView.count(
-              physics: const NeverScrollableScrollPhysics(),
-              crossAxisCount: 3,
-              children: actionList
-                  .map((x) => Card(
-                        color: Theme.of(context).colorScheme.surfaceContainer,
-                        child: InkWell(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(8)),
-                          onTap: x.onTap,
-                          child: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            children: [
-                              x.icon,
-                              const Gap(8),
-                              Expanded(
-                                child: Text(
-                                  x.label,
-                                  overflow: TextOverflow.fade,
-                                ),
-                              ),
-                            ],
-                          ).paddingAll(18),
-                        ),
-                      ))
-                  .toList(),
-            ).paddingSymmetric(horizontal: 20),
-          ),
-        ],
-      ),
-    );
-  }
-}

lib/screens/feed/draft_box.dart

@@ -1,114 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/models/post.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/posts/post_action.dart';
-import 'package:solian/widgets/posts/post_owned_list.dart';
-
-class DraftBoxScreen extends StatefulWidget {
-  const DraftBoxScreen({super.key});
-
-  @override
-  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
-}
-
-class _DraftBoxScreenState extends State<DraftBoxScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  _getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listDraft(pageKey);
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    if (result.count == 0) {
-      _pagingController.appendLastPage([]);
-      return;
-    }
-
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-    _pagingController.addPageRequestListener(_getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Scaffold(
-        appBar: AppBar(
-          leading: AppBarLeadingButton.adaptive(context),
-          title: AppBarTitle('draftBox'.tr),
-          centerTitle: false,
-          toolbarHeight: AppTheme.toolbarHeight(context),
-          actions: [
-            SizedBox(
-              width: AppTheme.isLargeScreen(context) ? 8 : 16,
-            ),
-          ],
-        ),
-        body: RefreshIndicator(
-          onRefresh: () => Future.sync(() => _pagingController.refresh()),
-          child: PagedListView<int, Post>(
-            pagingController: _pagingController,
-            builderDelegate: PagedChildBuilderDelegate(
-              itemBuilder: (context, item, index) {
-                return PostOwnedListEntry(
-                  item: item,
-                  isFullContent: true,
-                  backgroundColor:
-                      Theme.of(context).colorScheme.surfaceContainerLow,
-                  onTap: () async {
-                    showModalBottomSheet(
-                      useRootNavigator: true,
-                      context: context,
-                      builder: (context) => PostAction(
-                        item: item,
-                        noReact: true,
-                      ),
-                    ).then((value) {
-                      if (value is Future) {
-                        value.then((_) {
-                          _pagingController.refresh();
-                        });
-                      } else if (value != null) {
-                        _pagingController.refresh();
-                      }
-                    });
-                  },
-                ).paddingOnly(left: 12, right: 12, bottom: 4);
-              },
-            ),
-          ),
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}

lib/screens/feed/search.dart

@@ -1,99 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
-
-import '../../models/post.dart';
-
-class FeedSearchScreen extends StatefulWidget {
-  final String? tag;
-  final String? category;
-
-  const FeedSearchScreen({super.key, this.tag, this.category});
-
-  @override
-  State<FeedSearchScreen> createState() => _FeedSearchScreenState();
-}
-
-class _FeedSearchScreenState extends State<FeedSearchScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listPost(
-        pageKey,
-        tag: widget.tag,
-        category: widget.category,
-      );
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-
-    _pagingController.addPageRequestListener(getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      body: Material(
-        color: Theme.of(context).colorScheme.surface,
-        child: Column(
-          children: [
-            if (widget.tag != null)
-              ListTile(
-                leading: const Icon(Icons.label),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('feedSearchWithTag'.trParams({'key': widget.tag!})),
-              ),
-            if (widget.category != null)
-              ListTile(
-                leading: const Icon(Icons.category),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('feedSearchWithCategory'
-                    .trParams({'key': widget.category!})),
-              ),
-            Expanded(
-              child: RefreshIndicator(
-                onRefresh: () => Future.sync(() => _pagingController.refresh()),
-                child: CustomScrollView(
-                  slivers: [
-                    PostWarpedListWidget(
-                      controller: _pagingController,
-                      onUpdate: () => _pagingController.refresh(),
-                    ),
-                  ],
-                ),
-              ),
-            ),
-          ],
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}

lib/screens/posts/draft_box.dart

@@ -0,0 +1,128 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/app_bar_leading.dart';
+import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/root_container.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+
+class DraftBoxScreen extends StatefulWidget {
+  const DraftBoxScreen({super.key});
+
+  @override
+  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
+}
+
+class _DraftBoxScreenState extends State<DraftBoxScreen> {
+  bool _isBusy = true;
+  int? _totalPosts;
+  final List<Post> _posts = List.empty(growable: true);
+
+  _getPosts() async {
+    setState(() => _isBusy = true);
+
+    final PostProvider posts = Get.find();
+    final resp = await posts.listDraft(_posts.length);
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    _totalPosts = result.count;
+    _posts.addAll(parsed ?? List.empty());
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _openActions(Post item) async {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => PostAction(
+        item: item,
+        noReact: true,
+      ),
+    ).then((value) {
+      if (value is Future) {
+        value.then((_) {
+          _posts.clear();
+          _getPosts();
+        });
+      } else if (value != null) {
+        _posts.clear();
+        _getPosts();
+      }
+    });
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPosts();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return RootContainer(
+      child: Scaffold(
+        appBar: AppBar(
+          leading: AppBarLeadingButton.adaptive(context),
+          title: AppBarTitle('draftBox'.tr),
+          centerTitle: false,
+          toolbarHeight: AppTheme.toolbarHeight(context),
+          actions: [
+            SizedBox(
+              width: AppTheme.isLargeScreen(context) ? 8 : 16,
+            ),
+          ],
+        ),
+        body: Column(
+          children: [
+            LoadingIndicator(isActive: _isBusy),
+            Expanded(
+              child: RefreshIndicator(
+                onRefresh: () {
+                  _posts.clear();
+                  return _getPosts();
+                },
+                child: InfiniteList(
+                  itemCount: _posts.length,
+                  hasReachedMax: _totalPosts == _posts.length,
+                  isLoading: _isBusy,
+                  onFetchData: () => _getPosts(),
+                  itemBuilder: (context, index) {
+                    final item = _posts[index];
+                    return Card(
+                      child: GestureDetector(
+                        child: Column(
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            PostItem(
+                              key: Key('p${item.id}'),
+                              item: item,
+                              isShowEmbed: false,
+                              isClickable: false,
+                              isShowReply: false,
+                              isReactable: false,
+                              onTapMore: () => _openActions(item),
+                            ).paddingSymmetric(vertical: 8),
+                          ],
+                        ),
+                        onTap: () => _openActions(item),
+                      ),
+                    ).paddingOnly(left: 12, right: 12, bottom: 4);
+                  },
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/screens/posts/post_detail.dart

@@ -4,6 +4,9 @@ import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:solian/widgets/posts/post_replies.dart';
 
@@ -22,76 +25,109 @@ class PostDetailScreen extends StatefulWidget {
 }
 
 class _PostDetailScreenState extends State<PostDetailScreen> {
-  Post? item;
+  bool _isBusy = true;
 
-  Future<Post?> getDetail() async {
-    if (widget.post != null) {
-      item = widget.post;
-      Get.find<LastReadProvider>().feedLastReadAt = item?.id;
-      return widget.post;
-    }
+  Post? _item;
 
-    final PostProvider provider = Get.find();
+  Future<void> _getDetail() async {
+    final PostProvider posts = Get.find();
 
     try {
-      final resp = await provider.getPost(widget.id);
-      item = Post.fromJson(resp.body);
+      final resp = await posts.getPost(widget.id);
+      _item = Post.fromJson(resp.body);
     } catch (e) {
       context.showErrorDialog(e).then((_) => Navigator.pop(context));
     }
 
-    Get.find<LastReadProvider>().feedLastReadAt = item?.id;
+    Get.find<LastReadProvider>().feedLastReadAt = _item?.id;
 
-    return item;
+    if (mounted) setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    if (widget.post != null) {
+      _item = widget.post;
+    }
+    _getDetail();
   }
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: FutureBuilder(
-        future: getDetail(),
-        builder: (context, snapshot) {
-          if (!snapshot.hasData || snapshot.data == null) {
-            return const Center(
-              child: CircularProgressIndicator(),
-            );
-          }
+    if (_isBusy && _item == null) {
+      return const Center(
+        child: CircularProgressIndicator(),
+      );
+    }
 
-          return CustomScrollView(
-            slivers: [
-              SliverToBoxAdapter(
-                child: PostItem(
-                  item: item!,
-                  isClickable: false,
-                  isOverrideEmbedClickable: true,
-                  isFullDate: true,
-                  isFullContent: true,
-                  isShowReply: false,
-                  isContentSelectable: true,
+    return CustomScrollView(
+      slivers: [
+        SliverToBoxAdapter(
+          child: LoadingIndicator(isActive: _isBusy),
+        ),
+        SliverToBoxAdapter(
+          child: PostItem(
+            key: ValueKey(_item),
+            item: _item!,
+            isClickable: false,
+            isOverrideEmbedClickable: true,
+            isFullDate: true,
+            isShowReply: false,
+            isContentSelectable: true,
+            padding: AppTheme.isLargeScreen(context)
+                ? EdgeInsets.symmetric(
+                    horizontal: 4,
+                    vertical: 8,
+                  )
+                : EdgeInsets.zero,
+            onTapMore: () {
+              showModalBottomSheet(
+                useRootNavigator: true,
+                context: context,
+                builder: (context) => PostAction(
+                  item: _item!,
+                  noReact: true,
                 ),
-              ),
-              SliverToBoxAdapter(
-                child: const Divider(thickness: 0.3, height: 1)
-                    .paddingOnly(top: 4),
-              ),
-              SliverToBoxAdapter(
-                child: Align(
-                  alignment: Alignment.centerLeft,
-                  child: Text(
-                    'postReplies'.tr,
-                    style: Theme.of(context).textTheme.headlineSmall,
-                  ).paddingOnly(left: 24, right: 24, top: 16),
-                ),
-              ),
-              PostReplyList(item: item!),
-              SliverToBoxAdapter(
-                child: SizedBox(height: MediaQuery.of(context).padding.bottom),
-              ),
-            ],
-          );
-        },
-      ),
+              ).then((value) {
+                if (value is Future) {
+                  value.then((_) {
+                    _getDetail();
+                  });
+                } else if (value != null) {
+                  _getDetail();
+                }
+              });
+            },
+          ),
+        ),
+        SliverToBoxAdapter(
+          child: const Divider(thickness: 0.3, height: 1).paddingOnly(
+            top: 8,
+          ),
+        ),
+        SliverToBoxAdapter(
+          child: Align(
+            alignment: Alignment.centerLeft,
+            child: Text(
+              'postReplies'.tr,
+              style: Theme.of(context).textTheme.headlineSmall,
+            ).paddingOnly(left: 24, right: 24, top: 16),
+          ),
+        ),
+        PostReplyList(
+          item: _item!,
+          padding: AppTheme.isLargeScreen(context)
+              ? EdgeInsets.symmetric(
+                  horizontal: 4,
+                  vertical: 8,
+                )
+              : EdgeInsets.zero,
+        ),
+        SliverToBoxAdapter(
+          child: SizedBox(height: MediaQuery.of(context).padding.bottom),
+        ),
+      ],
     );
   }
 }

lib/screens/posts/post_editor.dart

@@ -16,9 +16,11 @@ import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/markdown_text_content.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:badges/badges.dart' as badges;
+import 'package:solian/widgets/root_container.dart';
 
 class PostPublishArguments {
   final Post? edit;
@@ -151,8 +153,7 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
       )
     ];
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -182,7 +183,10 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
           crossAxisAlignment: CrossAxisAlignment.start,
           children: [
             ListTile(
-              tileColor: Theme.of(context).colorScheme.surfaceContainerLow,
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainerLow
+                  .withOpacity(0.5),
               title: Column(
                 crossAxisAlignment: CrossAxisAlignment.start,
                 children: [
@@ -271,117 +275,71 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                   ),
                 ],
               ),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
             Expanded(
-              child: Row(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                children: [
-                  Expanded(
-                    child: Column(
-                      children: [
-                        Expanded(
-                          child: ListView(
-                            children: [
-                              Container(
-                                padding: const EdgeInsets.symmetric(
-                                  horizontal: 16,
-                                  vertical: 8,
-                                ),
-                                child: TextField(
-                                  maxLines: null,
-                                  autofocus: true,
-                                  autocorrect: true,
-                                  keyboardType: TextInputType.multiline,
-                                  controller:
-                                      _editorController.contentController,
-                                  focusNode: _contentFocusNode,
-                                  decoration: InputDecoration.collapsed(
-                                    hintText: 'postContentPlaceholder'.tr,
-                                  ),
-                                  onTapOutside: (_) => FocusManager
-                                      .instance.primaryFocus
-                                      ?.unfocus(),
-                                ),
-                              ),
-                              const Gap(120)
+              child: DefaultTabController(
+                length: 2,
+                child: AppTheme.isLargeScreen(context)
+                    ? Row(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Expanded(
+                            child: _PostEditorTextField(
+                              focusNode: _contentFocusNode,
+                              controller: _editorController,
+                              onUpdate: () => setState(() {}),
+                            ),
+                          ),
+                          const VerticalDivider(width: 0.3, thickness: 0.3)
+                              .paddingSymmetric(horizontal: 16),
+                          Expanded(
+                            child: SingleChildScrollView(
+                              padding:
+                                  const EdgeInsets.only(top: 12, bottom: 64),
+                              child: MarkdownTextContent(
+                                isAutoWarp: _editorController.mode.value == 0,
+                                content:
+                                    _editorController.contentController.text,
+                                parentId: 'post-editor-preview',
+                              ).paddingOnly(right: 16),
+                            ),
+                          ),
+                        ],
+                      )
+                    : Column(
+                        children: [
+                          TabBar(
+                            tabs: [
+                              const Tab(icon: Icon(Icons.edit)),
+                              const Tab(icon: Icon(Icons.preview)),
                             ],
                           ),
-                        ),
-                        Obx(() {
-                          final textStyle = TextStyle(
-                            fontSize: 12,
-                            color: Theme.of(context)
-                                .colorScheme
-                                .onSurface
-                                .withOpacity(0.75),
-                          );
-                          final showFactors = [
-                            _editorController.isRestoreFromLocal.value,
-                            _editorController.lastSaveTime.value != null,
-                          ];
-                          final doShow = showFactors.any((x) => x);
-                          return Container(
-                            padding: const EdgeInsets.symmetric(
-                              vertical: 4,
-                              horizontal: 16,
-                            ),
-                            child: Row(
+                          Expanded(
+                            child: TabBarView(
                               children: [
-                                if (showFactors[0])
-                                  Text('postRestoreFromLocal'.tr,
-                                          style: textStyle)
-                                      .paddingOnly(right: 4),
-                                if (showFactors[0])
-                                  InkWell(
-                                    child: Text('clear'.tr, style: textStyle),
-                                    onTap: () {
-                                      _editorController.localClear();
-                                      _editorController.currentClear();
-                                      setState(() {});
-                                    },
-                                  ),
-                                if (showFactors.where((x) => x).length > 1)
-                                  Text(
-                                    '·',
-                                    style: textStyle,
-                                  ).paddingSymmetric(horizontal: 8),
-                                if (showFactors[1])
-                                  Text(
-                                    'postAutoSaveAt'.trParams({
-                                      'date': DateFormat('HH:mm:ss').format(
-                                        _editorController.lastSaveTime.value ??
-                                            DateTime.now(),
-                                      )
-                                    }),
-                                    style: textStyle,
+                                _PostEditorTextField(
+                                  focusNode: _contentFocusNode,
+                                  controller: _editorController,
+                                  onUpdate: () => setState(() {}),
+                                ),
+                                SingleChildScrollView(
+                                  padding: const EdgeInsets.only(
+                                    top: 12,
+                                    bottom: 64,
                                   ),
+                                  child: MarkdownTextContent(
+                                    isAutoWarp:
+                                        _editorController.mode.value == 0,
+                                    content: _editorController
+                                        .contentController.text,
+                                    parentId: 'post-editor-preview',
+                                  ).paddingOnly(left: 16, right: 16),
+                                )
                               ],
                             ),
-                          )
-                              .animate(
-                                key: const Key('post-editor-hint-animation'),
-                                target: doShow ? 1 : 0,
-                              )
-                              .fade(curve: Curves.easeInOut, duration: 300.ms);
-                        }),
-                      ],
-                    ),
-                  ),
-                  if (AppTheme.isLargeScreen(context))
-                    const VerticalDivider(width: 0.3, thickness: 0.3)
-                        .paddingSymmetric(
-                      horizontal: 16,
-                    ),
-                  if (AppTheme.isLargeScreen(context))
-                    Expanded(
-                      child: SingleChildScrollView(
-                        child: MarkdownTextContent(
-                          content: _editorController.contentController.text,
-                          parentId: 'post-editor-preview',
-                        ).paddingOnly(top: 12, right: 16),
+                          ),
+                        ],
                       ),
-                    ),
-                ],
               ),
             ),
             Material(
@@ -390,6 +348,26 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                 crossAxisAlignment: CrossAxisAlignment.start,
                 children: [
                   const Divider(thickness: 0.3, height: 0.3),
+                  SizedBox(
+                    height: 40,
+                    child: SingleChildScrollView(
+                      scrollDirection: Axis.horizontal,
+                      child: MarkdownToolbar(
+                        width: 38,
+                        height: 38,
+                        iconSize: 20,
+                        spacing: 8,
+                        hideImage: true,
+                        useIncludedTextField: false,
+                        backgroundColor: Theme.of(context).colorScheme.surface,
+                        iconColor: Theme.of(context).colorScheme.onSurface,
+                        controller: _editorController.contentController,
+                        focusNode: _contentFocusNode,
+                        borderRadius:
+                            const BorderRadius.all(Radius.circular(20)),
+                      ).paddingSymmetric(horizontal: 12),
+                    ),
+                  ).paddingOnly(top: 12),
                   SizedBox(
                     height: 56,
                     child: ListView(
@@ -519,7 +497,7 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                                 top: -4,
                                 end: -6,
                               ),
-                              child: const Icon(Icons.preview),
+                              child: const Icon(Icons.wallpaper),
                             );
                           }),
                           color: Theme.of(context).colorScheme.primary,
@@ -546,18 +524,6 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                             _editorController.editPublishDate(context);
                           },
                         ),
-                        MarkdownToolbar(
-                          hideImage: true,
-                          useIncludedTextField: false,
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surface,
-                          iconColor: Theme.of(context).colorScheme.onSurface,
-                          controller: _editorController.contentController,
-                          focusNode: _contentFocusNode,
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(20)),
-                          width: 40,
-                        ).paddingSymmetric(horizontal: 2),
                       ],
                     ).paddingSymmetric(horizontal: 6, vertical: 8),
                   ),
@@ -577,3 +543,101 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
     super.dispose();
   }
 }
+
+class _PostEditorTextField extends StatelessWidget {
+  final FocusNode focusNode;
+  final PostEditorController controller;
+  final Function onUpdate;
+
+  const _PostEditorTextField({
+    required this.focusNode,
+    required this.controller,
+    required this.onUpdate,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        Expanded(
+          child: ListView(
+            children: [
+              Container(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 16,
+                  vertical: 8,
+                ),
+                child: TextField(
+                  maxLines: null,
+                  autofocus: true,
+                  autocorrect: true,
+                  keyboardType: TextInputType.multiline,
+                  controller: controller.contentController,
+                  focusNode: focusNode,
+                  decoration: InputDecoration.collapsed(
+                    hintText: 'postContentPlaceholder'.tr,
+                  ),
+                  onTapOutside: (_) =>
+                      FocusManager.instance.primaryFocus?.unfocus(),
+                ),
+              ),
+              const Gap(120)
+            ],
+          ),
+        ),
+        Obx(() {
+          final textStyle = TextStyle(
+            fontSize: 12,
+            color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+          );
+          final showFactors = [
+            controller.isRestoreFromLocal.value,
+            controller.lastSaveTime.value != null,
+          ];
+          final doShow = showFactors.any((x) => x);
+          return Container(
+            padding: const EdgeInsets.symmetric(
+              vertical: 4,
+              horizontal: 16,
+            ),
+            child: Row(
+              children: [
+                if (showFactors[0])
+                  Text('postRestoreFromLocal'.tr, style: textStyle)
+                      .paddingOnly(right: 4),
+                if (showFactors[0])
+                  InkWell(
+                    child: Text('clear'.tr, style: textStyle),
+                    onTap: () {
+                      controller.localClear();
+                      controller.currentClear();
+                      onUpdate();
+                    },
+                  ),
+                if (showFactors.where((x) => x).length > 1)
+                  Text(
+                    '·',
+                    style: textStyle,
+                  ).paddingSymmetric(horizontal: 8),
+                if (showFactors[1])
+                  Text(
+                    'postAutoSaveAt'.trParams({
+                      'date': DateFormat('HH:mm:ss').format(
+                        controller.lastSaveTime.value ?? DateTime.now(),
+                      )
+                    }),
+                    style: textStyle,
+                  ),
+              ],
+            ),
+          )
+              .animate(
+                key: const Key('post-editor-hint-animation'),
+                target: doShow ? 1 : 0,
+              )
+              .fade(curve: Curves.easeInOut, duration: 300.ms);
+        }),
+      ],
+    );
+  }
+}

lib/screens/posts/post_search.dart

@@ -0,0 +1,206 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_list.dart';
+
+import '../../models/post.dart';
+
+class PostSearchScreen extends StatefulWidget {
+  final String? tag;
+  final String? category;
+
+  const PostSearchScreen({super.key, this.tag, this.category});
+
+  @override
+  State<PostSearchScreen> createState() => _PostSearchScreenState();
+}
+
+class _PostSearchScreenState extends State<PostSearchScreen> {
+  int? _totalCount;
+  Duration? _lastTook;
+
+  final TextEditingController _probeController = TextEditingController();
+  final PagingController<int, Post> _pagingController =
+      PagingController(firstPageKey: 0);
+
+  late bool _isBusy = widget.tag != null || widget.category != null;
+
+  _searchPosts(int pageKey) async {
+    if (widget.tag == null &&
+        widget.category == null &&
+        _probeController.text.isEmpty) {
+      _pagingController.appendLastPage([]);
+      return;
+    }
+
+    if (!_isBusy) {
+      setState(() => _isBusy = true);
+    }
+
+    if (pageKey == 0) {
+      _pagingController.itemList?.clear();
+      _pagingController.nextPageKey = 0;
+    }
+
+    final PostProvider posts = Get.find();
+
+    Stopwatch stopwatch = new Stopwatch()..start();
+
+    Response resp;
+    try {
+      if (_probeController.text.isEmpty) {
+        resp = await posts.listPost(
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      } else {
+        resp = await posts.searchPost(
+          _probeController.text,
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      }
+    } catch (e) {
+      _pagingController.error = e;
+      return;
+    }
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    if (parsed != null && parsed.length >= 10) {
+      _pagingController.appendPage(parsed, pageKey + parsed.length);
+    } else if (parsed != null) {
+      _pagingController.appendLastPage(parsed);
+    }
+
+    stopwatch.stop();
+
+    _totalCount = result.count;
+    _lastTook = stopwatch.elapsed;
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _pagingController.addPageRequestListener(_searchPosts);
+  }
+
+  @override
+  void dispose() {
+    _probeController.dispose();
+    _pagingController.dispose();
+    super.dispose();
+  }
+
+  Color get _unFocusColor =>
+      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: Column(
+        children: [
+          if (widget.tag != null)
+            ListTile(
+              leading: const Icon(Icons.label),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithTag'.trParams({'key': widget.tag!})),
+            ),
+          if (widget.category != null)
+            ListTile(
+              leading: const Icon(Icons.category),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithCategory'.trParams({
+                'key': widget.category!,
+              })),
+            ),
+          Container(
+            color: Theme.of(context)
+                .colorScheme
+                .secondaryContainer
+                .withOpacity(0.5),
+            padding: const EdgeInsets.symmetric(horizontal: 24, vertical: 16),
+            child: TextField(
+              controller: _probeController,
+              decoration: InputDecoration(
+                isCollapsed: true,
+                border: InputBorder.none,
+                hintText: 'search'.tr,
+              ),
+              onSubmitted: (_) {
+                _searchPosts(0);
+              },
+            ),
+          ),
+          LoadingIndicator(isActive: _isBusy),
+          if (_totalCount != null || _lastTook != null)
+            Container(
+              padding: const EdgeInsets.symmetric(horizontal: 20, vertical: 4),
+              child: Row(
+                children: [
+                  Icon(
+                    Icons.summarize_outlined,
+                    size: 16,
+                    color: _unFocusColor,
+                  ),
+                  const Gap(4),
+                  if (_totalCount != null)
+                    Text(
+                      'searchResult'.trParams({
+                        'count': _totalCount!.toString(),
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                  const Gap(4),
+                  if (_lastTook != null)
+                    Text(
+                      'searchTook'.trParams({
+                        'time':
+                            '${(_lastTook!.inMilliseconds / 1000).toStringAsFixed(3)}s',
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                ],
+              ),
+            ),
+          Expanded(
+            child: RefreshIndicator(
+              onRefresh: () => Future.sync(() => _pagingController.refresh()),
+              child: CustomScrollView(
+                slivers: [
+                  ControlledPostListWidget(
+                    controller: _pagingController,
+                    onUpdate: () => _pagingController.refresh(),
+                  ),
+                  SliverGap(MediaQuery.of(context).padding.bottom),
+                ],
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/screens/realms.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/realm.dart';
@@ -15,6 +14,8 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 
 class RealmListScreen extends StatefulWidget {
@@ -58,8 +59,7 @@ class _RealmListScreenState extends State<RealmListScreen> {
   Widget build(BuildContext context) {
     final AuthProvider auth = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -93,12 +93,13 @@ class _RealmListScreenState extends State<RealmListScreen> {
 
           return Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               Expanded(
                 child: CenteredContainer(
                   child: RefreshIndicator(
                     onRefresh: () => _getRealms(),
                     child: ListView.builder(
+                      padding: const EdgeInsets.symmetric(vertical: 16),
                       itemCount: _realms.length,
                       itemBuilder: (context, index) {
                         final element = _realms[index];
@@ -155,7 +156,7 @@ class _RealmListScreenState extends State<RealmListScreen> {
                                 size: 18,
                               ),
                             )
-                          : AccountAvatar(
+                          : AttachedCircleAvatar(
                               content: element.avatar!,
                               bgColor: Theme.of(context).colorScheme.primary,
                             ),

lib/screens/realms/realm_detail.dart

@@ -7,6 +7,7 @@ import 'package:solian/router.dart';
 import 'package:solian/screens/realms/realm_organize.dart';
 import 'package:solian/widgets/realms/realm_deletion.dart';
 import 'package:solian/widgets/realms/realm_member.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class RealmDetailScreen extends StatefulWidget {
   final String alias;
@@ -86,61 +87,63 @@ class _RealmDetailScreenState extends State<RealmDetailScreen> {
       ),
     ];
 
-    return Column(
-      children: [
-        Padding(
-          padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
-          child: Row(
-            children: [
-              const CircleAvatar(
-                radius: 28,
-                backgroundColor: Colors.teal,
-                child: Icon(Icons.group, color: Colors.white),
-              ),
-              const Gap(16),
-              Expanded(
-                child: Column(
-                  crossAxisAlignment: CrossAxisAlignment.start,
-                  children: [
-                    Text(widget.realm.name,
-                        style: Theme.of(context).textTheme.bodyLarge),
-                    Text(widget.realm.description,
-                        style: Theme.of(context).textTheme.bodySmall),
-                    Text(
-                      '#${widget.realm.id.toString().padLeft(8, '0')} · ${widget.realm.alias}',
-                      style: const TextStyle(fontSize: 11),
-                    ),
-                  ],
+    return RootContainer(
+      child: Column(
+        children: [
+          Padding(
+            padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
+            child: Row(
+              children: [
+                const CircleAvatar(
+                  radius: 28,
+                  backgroundColor: Colors.teal,
+                  child: Icon(Icons.group, color: Colors.white),
                 ),
-              )
-            ],
+                const Gap(16),
+                Expanded(
+                  child: Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    children: [
+                      Text(widget.realm.name,
+                          style: Theme.of(context).textTheme.bodyLarge),
+                      Text(widget.realm.description,
+                          style: Theme.of(context).textTheme.bodySmall),
+                      Text(
+                        '#${widget.realm.id.toString().padLeft(8, '0')} · ${widget.realm.alias}',
+                        style: const TextStyle(fontSize: 11),
+                      ),
+                    ],
+                  ),
+                )
+              ],
+            ),
           ),
-        ),
-        const Divider(thickness: 0.3),
-        Expanded(
-          child: ListView(
-            children: [
-              ListTile(
-                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                leading: const Icon(Icons.supervisor_account),
-                trailing: const Icon(Icons.chevron_right),
-                title: Text('realmMembers'.tr),
-                onTap: () => showMemberList(),
-              ),
-              ...(_isOwned ? ownerActions : List.empty()),
-              const Divider(thickness: 0.3),
-              ListTile(
-                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                leading: _isOwned
-                    ? const Icon(Icons.delete)
-                    : const Icon(Icons.exit_to_app),
-                title: Text(_isOwned ? 'delete'.tr : 'leave'.tr),
-                onTap: () => promptLeaveChannel(),
-              ),
-            ],
+          const Divider(thickness: 0.3),
+          Expanded(
+            child: ListView(
+              children: [
+                ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                  leading: const Icon(Icons.supervisor_account),
+                  trailing: const Icon(Icons.chevron_right),
+                  title: Text('realmMembers'.tr),
+                  onTap: () => showMemberList(),
+                ),
+                ...(_isOwned ? ownerActions : List.empty()),
+                const Divider(thickness: 0.3),
+                ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                  leading: _isOwned
+                      ? const Icon(Icons.delete)
+                      : const Icon(Icons.exit_to_app),
+                  title: Text(_isOwned ? 'delete'.tr : 'leave'.tr),
+                  onTap: () => promptLeaveChannel(),
+                ),
+              ],
+            ),
           ),
-        ),
-      ],
+        ],
+      ),
     );
   }
 }

lib/screens/realms/realm_organize.dart

@@ -1,19 +1,19 @@
-import 'dart:io';
-
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
 import 'package:image_picker/image_picker.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/models/realm.dart';
+import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';
 
 class RealmOrganizeArguments {
@@ -84,36 +84,42 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) return;
 
+    XFile file;
+
     final image = await _imagePicker.pickImage(source: ImageSource.gallery);
     if (image == null) return;
 
-    CroppedFile? croppedFile = await ImageCropper().cropImage(
-      sourcePath: image.path,
-      uiSettings: [
-        AndroidUiSettings(
-          toolbarTitle: 'cropImage'.tr,
-          toolbarColor: Theme.of(context).colorScheme.primary,
-          toolbarWidgetColor: Theme.of(context).colorScheme.onPrimary,
-          aspectRatioPresets: [
-            if (position == 'avatar') CropAspectRatioPreset.square,
-            if (position == 'banner') _BannerCropAspectRatioPreset(),
-          ],
-        ),
-        IOSUiSettings(
-          title: 'cropImage'.tr,
-          aspectRatioPresets: [
-            if (position == 'avatar') CropAspectRatioPreset.square,
-            if (position == 'banner') _BannerCropAspectRatioPreset(),
-          ],
-        ),
-        WebUiSettings(
-          context: context,
-        ),
-      ],
-    );
+    if (PlatformInfo.canCropImage) {
+      CroppedFile? croppedFile = await ImageCropper().cropImage(
+        sourcePath: image.path,
+        uiSettings: [
+          AndroidUiSettings(
+            toolbarTitle: 'cropImage'.tr,
+            toolbarColor: Theme.of(context).colorScheme.primary,
+            toolbarWidgetColor: Theme.of(context).colorScheme.onPrimary,
+            aspectRatioPresets: [
+              if (position == 'avatar') CropAspectRatioPreset.square,
+              if (position == 'banner') _BannerCropAspectRatioPreset(),
+            ],
+          ),
+          IOSUiSettings(
+            title: 'cropImage'.tr,
+            aspectRatioPresets: [
+              if (position == 'avatar') CropAspectRatioPreset.square,
+              if (position == 'banner') _BannerCropAspectRatioPreset(),
+            ],
+          ),
+          WebUiSettings(
+            context: context,
+          ),
+        ],
+      );
 
-    if (croppedFile == null) return;
-    final file = File(croppedFile.path);
+      if (croppedFile == null) return;
+      file = XFile(croppedFile.path);
+    } else {
+      file = XFile(image.path);
+    }
 
     setState(() => _isBusy = true);
 
@@ -184,8 +190,7 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -203,7 +208,7 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
           top: false,
           child: Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               if (widget.edit != null)
                 MaterialBanner(
                   leading: const Icon(Icons.edit),

lib/screens/realms/realm_view.dart

@@ -16,6 +16,7 @@ import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/channel/channel_list.dart';
 import 'package:solian/widgets/posts/post_list.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class RealmViewScreen extends StatefulWidget {
   final String alias;
@@ -68,12 +69,7 @@ class _RealmViewScreenState extends State<RealmViewScreen> {
       _channels.addAll(
         resp.body.map((e) => Channel.fromJson(e)).toList().cast<Channel>(),
       );
-      _channels.addAll(
-        availableResp.body
-            .map((e) => Channel.fromJson(e))
-            .toList()
-            .cast<Channel>(),
-      );
+      _channels.addAll(availableResp);
       _channels.retainWhere((x) => channelIdx.add(x.id));
     });
 
@@ -91,8 +87,7 @@ class _RealmViewScreenState extends State<RealmViewScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: DefaultTabController(
         length: 2,
         child: NestedScrollView(
@@ -260,7 +255,6 @@ class RealmChannelListWidget extends StatelessWidget {
             child: ChannelListWidget(
               channels: channels,
               selfId: auth.userProfile.value!['id'],
-              noCategory: true,
             ),
           )
         ],

lib/screens/settings.dart

@@ -1,15 +1,23 @@
+import 'dart:convert';
+import 'dart:io';
+
+import 'package:dropdown_button2/dropdown_button2.dart';
 import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:image_picker/image_picker.dart';
+import 'package:in_app_review/in_app_review.dart';
+import 'package:path_provider/path_provider.dart';
 import 'package:provider/provider.dart';
 import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/database/database.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/router.dart';
-import 'package:solian/theme.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
 
 class SettingScreen extends StatefulWidget {
@@ -21,6 +29,7 @@ class SettingScreen extends StatefulWidget {
 
 class _SettingScreenState extends State<SettingScreen> {
   SharedPreferences? _prefs;
+  String _docBasepath = '/';
 
   Widget _buildCaptionHeader(String title) {
     return Container(
@@ -31,39 +40,38 @@ class _SettingScreenState extends State<SettingScreen> {
     );
   }
 
-  Widget _buildThemeColorButton(String label, Color color) {
-    return IconButton(
-      icon: Icon(Icons.circle, color: color),
-      tooltip: label,
-      onPressed: () {
-        context.read<ThemeSwitcher>().setTheme(
-              AppTheme.build(
-                Brightness.light,
-                seedColor: color,
-              ),
-              AppTheme.build(
-                Brightness.dark,
-                seedColor: color,
-              ),
-            );
-        _prefs?.setInt('global_theme_color', color.value);
-        context.clearSnackbar();
-        context.showSnackbar('themeColorApplied'.tr);
-      },
-    );
-  }
-
-  static final List<(String, Color)> _presentTheme = [
-    ('themeColorRed', const Color.fromRGBO(154, 98, 91, 1)),
-    ('themeColorBlue', const Color.fromRGBO(103, 96, 193, 1)),
-    ('themeColorMiku', const Color.fromRGBO(56, 120, 126, 1)),
-    ('themeColorKagamine', const Color.fromRGBO(244, 183, 63, 1)),
-    ('themeColorLuka', const Color.fromRGBO(243, 174, 218, 1)),
+  static final List<SolianThemeData> _presentTheme = [
+    SolianThemeData(
+      id: 'themeColorRed',
+      seedColor: const Color.fromRGBO(154, 98, 91, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorBlue',
+      seedColor: const Color.fromRGBO(103, 96, 193, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorMiku',
+      seedColor: const Color.fromRGBO(56, 120, 126, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorKagamine',
+      seedColor: const Color.fromRGBO(244, 183, 63, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorLuka',
+      seedColor: const Color.fromRGBO(243, 174, 218, 1),
+    ),
   ];
 
   @override
   void initState() {
     super.initState();
+    getApplicationDocumentsDirectory().then((dir) {
+      _docBasepath = dir.path;
+      if (mounted) {
+        setState(() {});
+      }
+    });
     SharedPreferences.getInstance().then((inst) {
       _prefs = inst;
       if (mounted) {
@@ -74,148 +82,258 @@ class _SettingScreenState extends State<SettingScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: ListView(
-        children: [
-          _buildCaptionHeader('themeColor'.tr),
-          SizedBox(
-            height: 56,
-            child: ListView(
-              scrollDirection: Axis.horizontal,
-              children: _presentTheme
-                  .map((x) => _buildThemeColorButton(x.$1, x.$2))
-                  .toList(),
-            ).paddingSymmetric(horizontal: 12, vertical: 8),
-          ),
-          _buildCaptionHeader('notification'.tr),
-          Tooltip(
-            message: 'settingsNotificationBgServiceDesc'.tr,
-            child: CheckboxListTile(
-              contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-              secondary: const Icon(Icons.system_security_update_warning),
-              enabled: PlatformInfo.isAndroid,
-              title: Text('settingsNotificationBgService'.tr),
-              subtitle: Column(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                children: [
-                  Text('holdToSeeDetail'.tr),
-                  Text(
-                    'needRestartToApply'.tr,
-                    style: const TextStyle(fontWeight: FontWeight.bold),
-                  )
-                ],
+    return ListView(
+      children: [
+        _buildCaptionHeader('theme'.tr),
+        ListTile(
+          leading: const Icon(Icons.palette),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('globalTheme'.tr),
+          trailing: DropdownButtonHideUnderline(
+            child: DropdownButton2<SolianThemeData>(
+              isExpanded: true,
+              hint: Text(
+                'theme'.tr,
+                style: TextStyle(
+                  fontSize: 14,
+                  color: Theme.of(context).hintColor,
+                ),
               ),
-              value:
-                  _prefs?.getBool('service_background_notification') ?? false,
-              onChanged: (value) {
-                _prefs
-                    ?.setBool('service_background_notification', value ?? false)
-                    .then((_) {
-                  setState(() {});
-                });
+              items: _presentTheme
+                  .map((SolianThemeData item) =>
+                      DropdownMenuItem<SolianThemeData>(
+                        value: item,
+                        child: Row(
+                          crossAxisAlignment: CrossAxisAlignment.center,
+                          children: [
+                            Icon(Icons.circle, color: item.seedColor),
+                            const Gap(8),
+                            Expanded(
+                              child: Text(
+                                item.id.tr,
+                                maxLines: 1,
+                                overflow: TextOverflow.ellipsis,
+                                style: const TextStyle(
+                                  fontSize: 14,
+                                ),
+                              ),
+                            ),
+                          ],
+                        ),
+                      ))
+                  .toList(),
+              value: (_prefs?.containsKey('global_theme') ?? false)
+                  ? SolianThemeData.fromJson(
+                      jsonDecode(_prefs!.getString('global_theme')!),
+                    )
+                  : null,
+              onChanged: (SolianThemeData? value) {
+                context.read<ThemeSwitcher>().setThemeData(value);
+                setState(() {});
               },
+              buttonStyleData: const ButtonStyleData(
+                padding: EdgeInsets.symmetric(horizontal: 8),
+                height: 40,
+                width: 140,
+              ),
+              menuItemStyleData: const MenuItemStyleData(
+                height: 40,
+              ),
             ),
           ),
-          _buildCaptionHeader('update'.tr),
-          CheckboxListTile(
+        ),
+        CheckboxListTile(
+          secondary: const Icon(Icons.military_tech),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('agedTheme'.tr),
+          subtitle: Text('agedThemeDesc'.tr),
+          value: _prefs?.getBool('aged_theme') ?? false,
+          onChanged: (value) {
+            if (value != null) {
+              context.read<ThemeSwitcher>().setAgedTheme(value);
+            }
+            setState(() {});
+          },
+        ),
+        if (!PlatformInfo.isWeb)
+          ListTile(
+            leading: const Icon(Icons.wallpaper),
+            contentPadding: const EdgeInsets.only(left: 22, right: 31),
+            title: Text('appBackgroundImage'.tr),
+            subtitle: Text('appBackgroundImageDesc'.tr),
+            trailing: File('$_docBasepath/app_background_image').existsSync()
+                ? const Icon(Icons.check_box)
+                : const Icon(Icons.check_box_outline_blank),
+            onTap: () async {
+              if (File('$_docBasepath/app_background_image').existsSync()) {
+                File('$_docBasepath/app_background_image').deleteSync();
+              } else {
+                final image = await ImagePicker().pickImage(
+                  source: ImageSource.gallery,
+                );
+                if (image == null) return;
+
+                await File(image.path)
+                    .copy('$_docBasepath/app_background_image');
+              }
+
+              setState(() {});
+            },
+          ),
+        _buildCaptionHeader('notification'.tr),
+        Tooltip(
+          message: 'settingsNotificationBgServiceDesc'.tr,
+          child: CheckboxListTile(
             contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            secondary: const Icon(Icons.sync_alt),
-            title: Text('updateCheckStrictly'.tr),
-            subtitle: Text('updateCheckStrictlyDesc'.tr),
-            value: _prefs?.getBool('check_update_strictly') ?? false,
+            secondary: const Icon(Icons.system_security_update_warning),
+            enabled: PlatformInfo.isAndroid,
+            title: Text('settingsNotificationBgService'.tr),
+            subtitle: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Text('holdToSeeDetail'.tr),
+                Text(
+                  'needRestartToApply'.tr,
+                  style: const TextStyle(fontWeight: FontWeight.bold),
+                )
+              ],
+            ),
+            value: _prefs?.getBool('service_background_notification') ?? false,
             onChanged: (value) {
               _prefs
-                  ?.setBool('check_update_strictly', value ?? false)
+                  ?.setBool('service_background_notification', value ?? false)
                   .then((_) {
                 setState(() {});
               });
             },
           ),
-          Obx(() {
-            final AuthProvider auth = Get.find<AuthProvider>();
-            if (!auth.isAuthorized.value) return const SizedBox.shrink();
-            return Column(
-              children: [
-                _buildCaptionHeader('account'.tr),
-                ListTile(
-                  leading: const Icon(Icons.flag),
-                  trailing: const Icon(Icons.chevron_right),
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-                  title: Text('reportAbuse'.tr),
-                  subtitle: Text('reportAbuseDesc'.tr),
-                  onTap: () {
-                    showDialog(
-                      context: context,
-                      builder: (context) => const AbuseReportDialog(),
-                    );
-                  },
-                ),
-                ListTile(
-                  leading: const Icon(Icons.person_remove),
-                  trailing: const Icon(Icons.chevron_right),
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-                  title: Text('accountDeletion'.tr),
-                  subtitle: Text('accountDeletionDesc'.tr),
-                  onTap: () {
-                    context
-                        .showSlideToConfirmDialog(
-                      'accountDeletionConfirm'.tr,
-                      'accountDeletionConfirmDesc'.trParams({
-                        'account': '@${auth.userProfile.value!['name']}',
-                      }),
-                    )
-                        .then((value) async {
-                      if (value != true) return;
-                      final client = await auth.configureClient('id');
-                      final resp = await client.post('/users/me/deletion', {});
-                      if (resp.statusCode != 200) {
-                        context.showErrorDialog(RequestException(resp));
-                      } else {
-                        context.showSnackbar('accountDeletionRequested'.tr);
-                      }
-                    });
-                  },
-                ),
-              ],
-            );
-          }),
-          _buildCaptionHeader('more'.tr),
-          ListTile(
-            leading: const Icon(Icons.delete_sweep),
-            trailing: const Icon(Icons.chevron_right),
-            subtitle: FutureBuilder(
-              future: AppDatabase.getDatabaseSize(),
-              builder: (context, snapshot) {
-                if (!snapshot.hasData) {
-                  return Text('localDatabaseSize'.trParams(
-                    {'size': 'unknown'.tr},
-                  ));
-                }
+        ),
+        _buildCaptionHeader('update'.tr),
+        CheckboxListTile(
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          secondary: const Icon(Icons.sync_alt),
+          title: Text('updateCheckStrictly'.tr),
+          subtitle: Text('updateCheckStrictlyDesc'.tr),
+          value: _prefs?.getBool('check_update_strictly') ?? false,
+          onChanged: (value) {
+            _prefs?.setBool('check_update_strictly', value ?? false).then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        Obx(() {
+          final AuthProvider auth = Get.find<AuthProvider>();
+          if (!auth.isAuthorized.value) return const SizedBox.shrink();
+          return Column(
+            children: [
+              _buildCaptionHeader('account'.tr),
+              ListTile(
+                leading: const Icon(Icons.flag),
+                trailing: const Icon(Icons.chevron_right),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+                title: Text('reportAbuse'.tr),
+                subtitle: Text('reportAbuseDesc'.tr),
+                onTap: () {
+                  showDialog(
+                    context: context,
+                    builder: (context) => const AbuseReportDialog(),
+                  );
+                },
+              ),
+              ListTile(
+                leading: const Icon(Icons.person_remove),
+                trailing: const Icon(Icons.chevron_right),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+                title: Text('accountDeletion'.tr),
+                subtitle: Text('accountDeletionDesc'.tr),
+                onTap: () {
+                  context
+                      .showSlideToConfirmDialog(
+                    'accountDeletionConfirm'.tr,
+                    'accountDeletionConfirmDesc'.trParams({
+                      'account': '@${auth.userProfile.value!['name']}',
+                    }),
+                  )
+                      .then((value) async {
+                    if (value != true) return;
+                    final client = await auth.configureClient('id');
+                    final resp = await client.post('/users/me/deletion', {});
+                    if (resp.statusCode != 200) {
+                      context.showErrorDialog(RequestException(resp));
+                    } else {
+                      context.showSnackbar('accountDeletionRequested'.tr);
+                    }
+                  });
+                },
+              ),
+            ],
+          );
+        }),
+        _buildCaptionHeader('performance'.tr),
+        CheckboxListTile(
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          secondary: const Icon(Icons.message),
+          title: Text('animatedMessageList'.tr),
+          subtitle: Text('animatedMessageListDesc'.tr),
+          value: _prefs?.getBool('non_animated_message_list') ?? false,
+          onChanged: (value) {
+            _prefs
+                ?.setBool('non_animated_message_list', value ?? false)
+                .then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        _buildCaptionHeader('more'.tr),
+        ListTile(
+          leading: const Icon(Icons.delete_sweep),
+          trailing: const Icon(Icons.chevron_right),
+          subtitle: FutureBuilder(
+            future: AppDatabase.getDatabaseSize(),
+            builder: (context, snapshot) {
+              if (!snapshot.hasData) {
                 return Text('localDatabaseSize'.trParams(
-                  {'size': snapshot.data!.formatBytes()},
+                  {'size': 'unknown'.tr},
                 ));
-              },
-            ),
-            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('localDatabaseWipe'.tr),
-            onTap: () {
-              AppDatabase.removeDatabase().then((_) {
-                setState(() {});
-              });
+              }
+              return Text('localDatabaseSize'.trParams(
+                {'size': snapshot.data!.formatBytes()},
+              ));
             },
           ),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('localDatabaseWipe'.tr),
+          onTap: () {
+            AppDatabase.removeDatabase().then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        if (PlatformInfo.canRateTheApp)
           ListTile(
-            leading: const Icon(Icons.info_outline),
+            leading: const Icon(Icons.star),
             trailing: const Icon(Icons.chevron_right),
             contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('about'.tr),
+            title: Text('rateTheApp'.tr),
+            subtitle: Text('rateTheAppDesc'.tr),
             onTap: () {
-              AppRouter.instance.pushNamed('about');
+              final inAppReview = InAppReview.instance;
+
+              inAppReview.openStoreListing(
+                appStoreId: '6499032345',
+              );
             },
           ),
-        ],
-      ),
+        ListTile(
+          leading: const Icon(Icons.info_outline),
+          trailing: const Icon(Icons.chevron_right),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('about'.tr),
+          onTap: () {
+            AppRouter.instance.pushNamed('about');
+          },
+        ),
+      ],
     );
   }
 }

lib/shells/root_shell.dart

@@ -2,7 +2,9 @@ import 'package:firebase_analytics/firebase_analytics.dart';
 import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/theme.dart';
-import 'package:solian/widgets/navigation/app_navigation_drawer.dart';
+import 'package:solian/widgets/navigation/app_navigation.dart';
+import 'package:solian/widgets/navigation/app_navigation_bottom.dart';
+import 'package:solian/widgets/navigation/app_navigation_rail.dart';
 
 final GlobalKey<ScaffoldState> rootScaffoldKey = GlobalKey<ScaffoldState>();
 
@@ -39,17 +41,41 @@ class RootShell extends StatelessWidget {
       );
     }
 
+    final showRailNavigation = AppTheme.isLargeScreen(context);
+
+    final destNames = [
+      'postDetail',
+      ...AppNavigation.destinations.map((x) => x.page),
+    ];
+    final showBottomNavigation =
+        destNames.contains(routeName) && !showRailNavigation;
+
     return Scaffold(
       key: rootScaffoldKey,
-      drawer: AppTheme.isLargeScreen(context)
-          ? null
-          : AppNavigationDrawer(routeName: routeName),
+      backgroundColor: Theme.of(context).colorScheme.surface,
+      bottomNavigationBar: showBottomNavigation
+          ? AppNavigationBottom(
+              initialIndex: AppNavigation.destinations
+                  .map((x) => x.page)
+                  .toList()
+                  .indexOf(routeName ?? 'page'),
+            )
+          : null,
       body: AppTheme.isLargeScreen(context)
           ? Row(
               children: [
-                if (showNavigation) AppNavigationDrawer(routeName: routeName),
-                if (showNavigation)
-                  const VerticalDivider(thickness: 0.3, width: 1),
+                if (showRailNavigation)
+                  AppNavigationRail(
+                    initialIndex: AppNavigation.destinations
+                        .map((x) => x.page)
+                        .toList()
+                        .indexOf(routeName ?? 'page'),
+                  ),
+                if (showRailNavigation)
+                  const VerticalDivider(
+                    width: 0.3,
+                    thickness: 0.3,
+                  ),
                 Expanded(child: child),
               ],
             )

lib/shells/sidebar_shell.dart

@@ -1,62 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:go_router/go_router.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/sidebar/sidebar_placeholder.dart';
-
-class SidebarShell extends StatelessWidget {
-  final bool showAppBar;
-  final GoRouterState state;
-  final Widget child;
-
-  final bool sidebarFirst;
-  final Widget? sidebar;
-
-  const SidebarShell({
-    super.key,
-    required this.child,
-    required this.state,
-    this.showAppBar = true,
-    this.sidebarFirst = false,
-    this.sidebar,
-  });
-
-  List<Widget> buildContent(BuildContext context) {
-    return [
-      Flexible(
-        flex: 2,
-        child: child,
-      ),
-      if (AppTheme.isExtraLargeScreen(context))
-        const VerticalDivider(thickness: 0.3, width: 1),
-      if (AppTheme.isExtraLargeScreen(context))
-        Flexible(
-          flex: 1,
-          child: sidebar ?? const SidebarPlaceholder(),
-        ),
-    ];
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      appBar: showAppBar
-          ? AppBar(
-              leading: AppBarLeadingButton.adaptive(context),
-              title: AppBarTitle(state.topRoute?.name?.tr ?? 'page'.tr),
-              centerTitle: false,
-              toolbarHeight: AppTheme.toolbarHeight(context),
-            )
-          : null,
-      body: AppTheme.isLargeScreen(context)
-          ? Row(
-              children: sidebarFirst
-                  ? buildContent(context).reversed.toList()
-                  : buildContent(context),
-            )
-          : child,
-    );
-  }
-}

lib/shells/title_shell.dart

@@ -5,10 +5,12 @@ import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class TitleShell extends StatelessWidget {
   final bool showAppBar;
   final bool isCenteredTitle;
+  final bool isResponsive;
   final String? title;
   final GoRouterState? state;
   final Widget child;
@@ -20,13 +22,14 @@ class TitleShell extends StatelessWidget {
     this.state,
     this.showAppBar = true,
     this.isCenteredTitle = false,
+    this.isResponsive = false,
   });
 
   @override
   Widget build(BuildContext context) {
     assert(state != null || title != null);
 
-    return Scaffold(
+    final widget = Scaffold(
       appBar: showAppBar
           ? AppBar(
               leading: AppBarLeadingButton.adaptive(context),
@@ -45,5 +48,11 @@ class TitleShell extends StatelessWidget {
           : null,
       body: child,
     );
+
+    if (isResponsive) {
+      return ResponsiveRootContainer(child: widget);
+    } else {
+      return RootContainer(child: widget);
+    }
   }
 }

lib/theme.dart

@@ -1,4 +1,5 @@
 import 'package:flutter/material.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/platform.dart';
 
 abstract class AppTheme {
@@ -6,7 +7,10 @@ abstract class AppTheme {
       MediaQuery.of(context).size.width > 640;
 
   static bool isExtraLargeScreen(BuildContext context) =>
-      MediaQuery.of(context).size.width > 720;
+      MediaQuery.of(context).size.width > 920;
+
+  static bool isUltraLargeScreen(BuildContext context) =>
+      MediaQuery.of(context).size.width > 1200;
 
   static bool isSpecializedMacOS(BuildContext context) =>
       PlatformInfo.isMacOS && !AppTheme.isLargeScreen(context);
@@ -38,6 +42,10 @@ abstract class AppTheme {
       snackBarTheme: const SnackBarThemeData(
         behavior: SnackBarBehavior.floating,
       ),
+      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(
+        backgroundColor: Colors.transparent,
+      ),
       fontFamily: 'Comfortaa',
       fontFamilyFallback: [
         'NotoSansSC',
@@ -52,4 +60,37 @@ abstract class AppTheme {
       ),
     );
   }
+
+  static ThemeData buildFromData(
+    Brightness brightness,
+    SolianThemeData data, {
+    bool useMaterial3 = true,
+  }) {
+    return ThemeData(
+      brightness: brightness,
+      useMaterial3: useMaterial3,
+      colorScheme: ColorScheme.fromSeed(
+        brightness: brightness,
+        seedColor: data.seedColor,
+      ),
+      snackBarTheme: const SnackBarThemeData(
+        behavior: SnackBarBehavior.floating,
+      ),
+      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(backgroundColor: Colors.transparent),
+      fontFamily: data.fontFamily ?? 'Comfortaa',
+      fontFamilyFallback: data.fontFamilyFallback ??
+          [
+            'NotoSansSC',
+            'NotoSansHK',
+            'NotoSansJP',
+            if (PlatformInfo.isWeb) 'NotoSansEmoji',
+          ],
+      typography: Typography.material2021(
+        colorScheme: brightness == Brightness.light
+            ? const ColorScheme.light()
+            : const ColorScheme.dark(),
+      ),
+    );
+  }
 }

lib/widgets/account/account_avatar.dart

@@ -1,19 +1,22 @@
 import 'package:flutter/material.dart';
 import 'package:solian/services.dart';
+import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 
-class AccountAvatar extends StatelessWidget {
+class AttachedCircleAvatar extends StatelessWidget {
   final dynamic content;
   final Color? bgColor;
   final Color? feColor;
   final double? radius;
+  final Widget? fallbackWidget;
 
-  const AccountAvatar({
+  const AttachedCircleAvatar({
     super.key,
     required this.content,
     this.bgColor,
     this.feColor,
     this.radius,
+    this.fallbackWidget,
   });
 
   @override
@@ -35,12 +38,61 @@ class AccountAvatar extends StatelessWidget {
       backgroundColor: bgColor,
       backgroundImage: !isEmpty ? AutoCacheImage.provider(url) : null,
       child: isEmpty
-          ? Icon(
+          ? (fallbackWidget ??
+              Icon(
+                Icons.image,
+                size: radius != null ? radius! * 1.2 : 24,
+                color: feColor,
+              ))
+          : null,
+    );
+  }
+}
+
+class AccountAvatar extends StatelessWidget {
+  final dynamic content;
+  final String username;
+  final Color? bgColor;
+  final Color? feColor;
+  final double? radius;
+  final Widget? fallbackWidget;
+
+  const AccountAvatar({
+    super.key,
+    required this.content,
+    required this.username,
+    this.bgColor,
+    this.feColor,
+    this.radius,
+    this.fallbackWidget,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: AttachedCircleAvatar(
+        content: content,
+        bgColor: bgColor,
+        feColor: feColor,
+        radius: radius,
+        fallbackWidget: (fallbackWidget ??
+            Icon(
               Icons.account_circle,
               size: radius != null ? radius! * 1.2 : 24,
               color: feColor,
-            )
-          : null,
+            )),
+      ),
+      onTap: () {
+        showModalBottomSheet(
+          useRootNavigator: true,
+          isScrollControlled: true,
+          backgroundColor: Theme.of(context).colorScheme.surface,
+          context: context,
+          builder: (context) => AccountProfilePopup(
+            name: username,
+          ),
+        );
+      },
     );
   }
 }

lib/widgets/account/account_heading.dart

@@ -23,6 +23,7 @@ class AccountHeadingWidget extends StatelessWidget {
   final AccountProfile? profile;
   final List<AccountBadge>? badges;
   final List<Widget>? extraWidgets;
+  final List<Widget>? appendWidgets;
 
   final Future<Response>? status;
   final Function? onEditStatus;
@@ -39,6 +40,7 @@ class AccountHeadingWidget extends StatelessWidget {
     this.profile,
     this.status,
     this.extraWidgets,
+    this.appendWidgets,
     this.onEditStatus,
   });
 
@@ -82,7 +84,7 @@ class AccountHeadingWidget extends StatelessWidget {
               Positioned(
                 bottom: -30,
                 left: 32,
-                child: AccountAvatar(content: avatar, radius: 40),
+                child: AttachedCircleAvatar(content: avatar, radius: 40),
               ),
             ],
           ),
@@ -257,6 +259,7 @@ class AccountHeadingWidget extends StatelessWidget {
               ),
             ),
           ).paddingSymmetric(horizontal: 16),
+          ...?appendWidgets?.map((x) => x.paddingSymmetric(horizontal: 16)),
         ],
       ),
     );

lib/widgets/account/account_profile_popup.dart

@@ -89,8 +89,7 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {
 
     return SizedBox(
       height: MediaQuery.of(context).size.height * 0.75,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
+      child: ListView(
         children: [
           AccountHeadingWidget(
             avatar: _userinfo!.avatar,
@@ -106,15 +105,19 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {
             extraWidgets: [
               Card(
                 child: ListTile(
+                  leading: const Icon(
+                    Icons.contact_page_outlined,
+                  ),
                   shape: const RoundedRectangleBorder(
                     borderRadius: BorderRadius.all(Radius.circular(8)),
                   ),
                   title: Text('visitProfilePage'.tr),
+                  subtitle: Text('learnMoreAboutPerson'.tr),
                   visualDensity:
                       const VisualDensity(horizontal: -4, vertical: -2),
                   trailing: const Icon(Icons.chevron_right),
                   onTap: () {
-                    AppRouter.instance.goNamed(
+                    AppRouter.instance.pushNamed(
                       'accountProfilePage',
                       pathParameters: {'name': _userinfo!.name},
                     );

lib/widgets/account/account_select.dart

@@ -138,7 +138,7 @@ class _AccountSelectorState extends State<AccountSelector> {
                 return ListTile(
                   title: Text(element.nick),
                   subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                   trailing: widget.trailingBuilder != null
                       ? widget.trailingBuilder!(element)
                       : _checkSelected(element)

lib/widgets/account/relative_list.dart

@@ -23,47 +23,51 @@ class SilverRelativeList extends StatelessWidget {
       title: Text(element.related.nick),
       subtitle: Text(element.related.name),
       leading: GestureDetector(
-        child: AccountAvatar(content: element.related.avatar),
+        child: AttachedCircleAvatar(content: element.related.avatar),
         onTap: () {
           showModalBottomSheet(
             useRootNavigator: true,
             isScrollControlled: true,
-            backgroundColor: Theme
-                .of(context)
-                .colorScheme
-                .surface,
+            backgroundColor: Theme.of(context).colorScheme.surface,
             context: context,
-            builder: (context) =>
-                AccountProfilePopup(
-                  name: element.related.name,
-                ),
+            builder: (context) => AccountProfilePopup(
+              name: element.related.name,
+            ),
           );
         },
       ),
       trailing: Row(
         mainAxisSize: MainAxisSize.min,
         children: [
-          if(element.status != 1 && element.status != 3)
+          if (element.status != 1 && element.status != 3)
             IconButton(
               icon: const Icon(Icons.check),
               onPressed: () {
                 final RelationshipProvider provider = Get.find();
                 if (element.status == 0) {
-                  provider.handleRelation(element, true).then((_) => onUpdate());
+                  provider
+                      .handleRelation(element, true)
+                      .then((_) => onUpdate());
                 } else {
-                  provider.editRelation(element, 1).then((_) => onUpdate());
+                  provider
+                      .editRelation(element.relatedId, 1)
+                      .then((_) => onUpdate());
                 }
               },
             ),
-          if(element.status != 2 && element.status != 3)
+          if (element.status != 2 && element.status != 3)
             IconButton(
               icon: const Icon(Icons.close),
               onPressed: () {
                 final RelationshipProvider provider = Get.find();
                 if (element.status == 0) {
-                  provider.handleRelation(element, false).then((_) => onUpdate());
+                  provider
+                      .handleRelation(element, false)
+                      .then((_) => onUpdate());
                 } else {
-                  provider.editRelation(element, 2).then((_) => onUpdate());
+                  provider
+                      .editRelation(element.relatedId, 2)
+                      .then((_) => onUpdate());
                 }
               },
             ),

lib/widgets/account/relative_select.dart

@@ -56,7 +56,7 @@ class _RelativeSelectorState extends State<RelativeSelector> {
                 return ListTile(
                   title: Text(element.nick),
                   subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                   trailing: widget.trailingBuilder != null
                       ? widget.trailingBuilder!(element)
                       : null,

lib/widgets/app_bar_leading.dart

@@ -1,28 +1,22 @@
 import 'package:flutter/material.dart';
-import 'package:solian/shells/root_shell.dart';
 
 class AppBarLeadingButton extends StatelessWidget {
-  const AppBarLeadingButton({super.key});
+  final bool forceBack;
 
-  static Widget? adaptive(BuildContext context) {
-    final hasContent =
-        Navigator.canPop(context) || rootScaffoldKey.currentState!.hasDrawer;
-    return hasContent ? const AppBarLeadingButton() : null;
+  const AppBarLeadingButton({super.key, this.forceBack = false});
+
+  static Widget? adaptive(BuildContext context, {bool forceBack = false}) {
+    final hasContent = Navigator.canPop(context) || forceBack;
+    return hasContent ? AppBarLeadingButton(forceBack: forceBack) : null;
   }
 
   @override
   Widget build(BuildContext context) {
-    if (Navigator.canPop(context)) {
+    if (Navigator.canPop(context) || forceBack) {
       return BackButton(
         onPressed: () => Navigator.pop(context),
       );
     }
-    if (rootScaffoldKey.currentState!.hasDrawer) {
-      return DrawerButton(
-        onPressed: () => rootScaffoldKey.currentState!.openDrawer(),
-      );
-    } else {
-      return const SizedBox.shrink();
-    }
+    return const SizedBox.shrink();
   }
 }

lib/widgets/attachments/attachment_editor.dart

@@ -21,6 +21,7 @@ import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/widgets/attachments/attachment_attr_editor.dart';
 import 'package:solian/widgets/attachments/attachment_editor_thumbnail.dart';
 import 'package:solian/widgets/attachments/attachment_fullscreen.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class AttachmentEditorPopup extends StatefulWidget {
   final String pool;
@@ -32,12 +33,14 @@ class AttachmentEditorPopup extends StatefulWidget {
   final List<String>? initialAttachments;
   final void Function(String) onAdd;
   final void Function(String) onRemove;
+  final void Function(String)? onInsert;
 
   const AttachmentEditorPopup({
     super.key,
     required this.pool,
     required this.onAdd,
     required this.onRemove,
+    this.onInsert,
     this.singleMode = false,
     this.imageOnly = false,
     this.autoUpload = false,
@@ -228,7 +231,10 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
         .listMetadata(widget.initialAttachments ?? List.empty())
         .then((result) {
       setState(() {
-        _attachments = List.from(result, growable: true);
+        _attachments = List.from(
+          result.where((x) => x != null),
+          growable: true,
+        );
         _isBusy = false;
         _isFirstTimeBusy = false;
       });
@@ -396,7 +402,8 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                     ),
                   if (!element.isCompleted &&
                       element.error == null &&
-                      canBeCrop)
+                      canBeCrop &&
+                      PlatformInfo.canCropImage)
                     Obx(
                       () => IconButton(
                         color: Colors.teal,
@@ -552,6 +559,22 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                           setState(() => _attachments.removeAt(idx));
                         },
                       ),
+                      if (widget.onInsert != null)
+                        PopupMenuItem(
+                          child: ListTile(
+                            title: Text('insert'.tr),
+                            leading: const Icon(Icons.insert_link),
+                            contentPadding: const EdgeInsets.symmetric(
+                              horizontal: 8,
+                            ),
+                          ),
+                          onTap: () {
+                            widget.onInsert!(
+                              '![](solink://attachments/${element.rid})',
+                            );
+                            Navigator.pop(context);
+                          },
+                        ),
                     ],
                   ),
                 ],
@@ -659,7 +682,7 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                 ),
               ],
             ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
             Expanded(
               child: CustomScrollView(
                 slivers: [
@@ -744,8 +767,8 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
               return IgnorePointer(
                 ignoring: _uploadController.isUploading.value,
                 child: Container(
-                  height: 64,
                   width: MediaQuery.of(context).size.width,
+                  padding: const EdgeInsets.all(8),
                   decoration: BoxDecoration(
                     border: Border(
                       top: BorderSide(
@@ -754,67 +777,72 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                       ),
                     ),
                   ),
-                  child: SingleChildScrollView(
-                    scrollDirection: Axis.horizontal,
-                    child: Wrap(
-                      spacing: 8,
-                      runSpacing: 0,
-                      alignment: WrapAlignment.center,
-                      runAlignment: WrapAlignment.center,
-                      children: [
-                        if ((PlatformInfo.isDesktop ||
-                                PlatformInfo.isIOS ||
-                                PlatformInfo.isWeb) &&
-                            !widget.imageOnly)
-                          ElevatedButton.icon(
-                            icon: const Icon(Icons.paste),
-                            label: Text('attachmentAddClipboard'.tr),
-                            style: const ButtonStyle(visualDensity: density),
-                            onPressed: () => _pasteFileToUpload(),
-                          ),
-                        ElevatedButton.icon(
-                          icon: const Icon(Icons.add_photo_alternate),
-                          label: Text('attachmentAddGalleryPhoto'.tr),
+                  child: Wrap(
+                    spacing: 8,
+                    runSpacing: 8,
+                    alignment: WrapAlignment.center,
+                    runAlignment: WrapAlignment.center,
+                    children: [
+                      if ((PlatformInfo.isDesktop ||
+                              PlatformInfo.isIOS ||
+                              PlatformInfo.isWeb) &&
+                          !widget.imageOnly)
+                        IconButton(
+                          icon: const Icon(Icons.paste),
+                          tooltip: 'attachmentAddClipboard'.tr,
                           style: const ButtonStyle(visualDensity: density),
-                          onPressed: () => _pickPhotoToUpload(),
+                          color: Theme.of(context).colorScheme.primary,
+                          onPressed: () => _pasteFileToUpload(),
                         ),
-                        if (!widget.imageOnly)
-                          ElevatedButton.icon(
-                            icon: const Icon(Icons.add_road),
-                            label: Text('attachmentAddGalleryVideo'.tr),
-                            style: const ButtonStyle(visualDensity: density),
-                            onPressed: () => _pickVideoToUpload(),
-                          ),
-                        ElevatedButton.icon(
-                          icon: const Icon(Icons.photo_camera_back),
-                          label: Text('attachmentAddCameraPhoto'.tr),
+                      IconButton(
+                        icon: const Icon(Icons.add_photo_alternate),
+                        tooltip: 'attachmentAddGalleryPhoto'.tr,
+                        style: const ButtonStyle(visualDensity: density),
+                        color: Theme.of(context).colorScheme.primary,
+                        onPressed: () => _pickPhotoToUpload(),
+                      ),
+                      if (!widget.imageOnly)
+                        IconButton(
+                          icon: const Icon(Icons.add_road),
+                          tooltip: 'attachmentAddGalleryVideo'.tr,
                           style: const ButtonStyle(visualDensity: density),
+                          color: Theme.of(context).colorScheme.primary,
+                          onPressed: () => _pickVideoToUpload(),
+                        ),
+                      if (PlatformInfo.isMobile)
+                        IconButton(
+                          icon: const Icon(Icons.photo_camera_back),
+                          tooltip: 'attachmentAddCameraPhoto'.tr,
+                          style: const ButtonStyle(visualDensity: density),
+                          color: Theme.of(context).colorScheme.primary,
                           onPressed: () => _takeMediaToUpload(false),
                         ),
-                        if (!widget.imageOnly)
-                          ElevatedButton.icon(
-                            icon: const Icon(Icons.video_camera_back_outlined),
-                            label: Text('attachmentAddCameraVideo'.tr),
-                            style: const ButtonStyle(visualDensity: density),
-                            onPressed: () => _takeMediaToUpload(true),
-                          ),
-                        if (!widget.imageOnly)
-                          ElevatedButton.icon(
-                            icon: const Icon(Icons.file_present_rounded),
-                            label: Text('attachmentAddFile'.tr),
-                            style: const ButtonStyle(visualDensity: density),
-                            onPressed: () => _pickFileToUpload(),
-                          ),
-                        if (!widget.imageOnly)
-                          ElevatedButton.icon(
-                            icon: const Icon(Icons.link),
-                            label: Text('attachmentAddFile'.tr),
-                            style: const ButtonStyle(visualDensity: density),
-                            onPressed: () => _linkAttachments(),
-                          ),
-                      ],
-                    ).paddingSymmetric(horizontal: 12),
-                  ),
+                      if (!widget.imageOnly && PlatformInfo.isMobile)
+                        IconButton(
+                          icon: const Icon(Icons.video_camera_back_outlined),
+                          tooltip: 'attachmentAddCameraVideo'.tr,
+                          style: const ButtonStyle(visualDensity: density),
+                          color: Theme.of(context).colorScheme.primary,
+                          onPressed: () => _takeMediaToUpload(true),
+                        ),
+                      if (!widget.imageOnly)
+                        IconButton(
+                          icon: const Icon(Icons.file_present_rounded),
+                          tooltip: 'attachmentAddFile'.tr,
+                          style: const ButtonStyle(visualDensity: density),
+                          color: Theme.of(context).colorScheme.primary,
+                          onPressed: () => _pickFileToUpload(),
+                        ),
+                      if (!widget.imageOnly)
+                        IconButton(
+                          icon: const Icon(Icons.link),
+                          tooltip: 'attachmentAddLink'.tr,
+                          style: const ButtonStyle(visualDensity: density),
+                          color: Theme.of(context).colorScheme.primary,
+                          onPressed: () => _linkAttachments(),
+                        ),
+                    ],
+                  ).paddingSymmetric(horizontal: 12),
                 )
                     .animate(
                       target: _uploadController.isUploading.value ? 0 : 1,

lib/widgets/attachments/attachment_fullscreen.dart

@@ -8,6 +8,7 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gal/gal.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/platform.dart';
@@ -103,9 +104,10 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
 
   @override
   Widget build(BuildContext context) {
-    final metaTextStyle = TextStyle(
+    final metaTextStyle = GoogleFonts.roboto(
       fontSize: 12,
       color: _unFocusColor,
+      height: 1,
     );
 
     return DismissiblePage(
@@ -175,7 +177,7 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                       Row(
                         children: [
                           IgnorePointer(
-                            child: AccountAvatar(
+                            child: AttachedCircleAvatar(
                               content: widget.item.account!.avatar,
                               radius: 19,
                             ),
@@ -239,25 +241,58 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                       child: Wrap(
                         spacing: 6,
                         children: [
-                          Text(
-                            '#${widget.item.rid}',
-                            style: metaTextStyle,
-                          ),
-                          if (widget.item.metadata?['width'] != null &&
-                              widget.item.metadata?['height'] != null)
+                          if (widget.item.metadata?['exif'] == null)
                             Text(
-                              '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
+                              '#${widget.item.rid}',
                               style: metaTextStyle,
                             ),
+                          if (widget.item.metadata?['exif']?['Model'] != null)
+                            Text(
+                              'shotOn'.trParams({
+                                'device': widget.item.metadata?['exif']
+                                    ?['Model']
+                              }),
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ShutterSpeed'] !=
+                              null)
+                            Text(
+                              widget.item.metadata?['exif']?['ShutterSpeed'],
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ISO'] != null)
+                            Text(
+                              'ISO${widget.item.metadata?['exif']?['ISO']}',
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['Aperture'] !=
+                              null)
+                            Text(
+                              'f/${widget.item.metadata?['exif']?['Aperture']}',
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['Megapixels'] !=
+                                  null &&
+                              widget.item.metadata?['exif']?['Model'] != null)
+                            Text(
+                              '${widget.item.metadata?['exif']?['Megapixels']}MP',
+                              style: metaTextStyle,
+                            )
+                          else
+                            Text(
+                              widget.item.size.formatBytes(),
+                              style: metaTextStyle,
+                            ),
+                          Text(
+                            '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
+                            style: metaTextStyle,
+                          ),
                           if (widget.item.metadata?['ratio'] != null)
                             Text(
-                              '${_getRatio().toPrecision(2)}',
+                              (widget.item.metadata?['ratio'] as num)
+                                  .toStringAsFixed(2),
                               style: metaTextStyle,
                             ),
-                          Text(
-                            widget.item.size.formatBytes(),
-                            style: metaTextStyle,
-                          ),
                           Text(
                             widget.item.mimetype,
                             style: metaTextStyle,

lib/widgets/attachments/attachment_item.dart

@@ -21,6 +21,7 @@ class AttachmentItem extends StatefulWidget {
   final bool showBadge;
   final bool showHideButton;
   final bool autoload;
+  final bool isDense;
   final BoxFit fit;
   final String? badge;
   final Function? onHide;
@@ -34,6 +35,7 @@ class AttachmentItem extends StatefulWidget {
     this.showBadge = true,
     this.showHideButton = true,
     this.autoload = false,
+    this.isDense = false,
     this.onHide,
   });
 
@@ -53,6 +55,7 @@ class _AttachmentItemState extends State<AttachmentItem> {
           fit: widget.fit,
           showBadge: widget.showBadge,
           showHideButton: widget.showHideButton,
+          isDense: widget.isDense,
           onHide: widget.onHide,
         );
       case 'video':
@@ -120,6 +123,7 @@ class _AttachmentItemImage extends StatelessWidget {
   final bool showBadge;
   final bool showHideButton;
   final BoxFit fit;
+  final bool isDense;
   final String? badge;
   final Function? onHide;
 
@@ -128,6 +132,7 @@ class _AttachmentItemImage extends StatelessWidget {
     required this.item,
     required this.showBadge,
     required this.showHideButton,
+    required this.isDense,
     required this.fit,
     this.badge,
     this.onHide,
@@ -146,14 +151,22 @@ class _AttachmentItemImage extends StatelessWidget {
               '/attachments/${item.rid}',
             ),
             fit: fit,
+            isDense: isDense,
           ),
           if (showBadge && badge != null)
             Positioned(
-              right: 12,
-              bottom: 8,
+              right: 8,
+              bottom: 4,
               child: Material(
                 color: Colors.transparent,
-                child: Chip(label: Text(badge!)),
+                child: Chip(
+                  label: Text(badge!),
+                  labelStyle: GoogleFonts.robotoMono(),
+                  visualDensity: const VisualDensity(
+                    horizontal: -4,
+                    vertical: -2,
+                  ),
+                ),
               ),
             ),
           if (showHideButton && item.isMature)

lib/widgets/attachments/attachment_list.dart

@@ -1,7 +1,6 @@
 import 'dart:math' as math;
 import 'dart:ui';
 
-import 'package:carousel_slider/carousel_slider.dart';
 import 'package:dismissible_page/dismissible_page.dart';
 import 'package:flutter/material.dart' hide CarouselController;
 import 'package:flutter_animate/flutter_animate.dart';
@@ -15,27 +14,29 @@ import 'package:solian/widgets/sized_container.dart';
 
 class AttachmentList extends StatefulWidget {
   final String parentId;
-  final List<String> attachmentsId;
+  final List<String>? attachmentIds;
+  final List<Attachment>? attachments;
   final bool isGrid;
   final bool isColumn;
-  final bool isForceGrid;
+  final bool isFullWidth;
   final bool autoload;
-  final double flatMaxHeight;
   final double columnMaxWidth;
 
+  final EdgeInsets? padding;
   final double? width;
   final double? viewport;
 
   const AttachmentList({
     super.key,
     required this.parentId,
-    required this.attachmentsId,
+    this.attachmentIds,
+    this.attachments,
     this.isGrid = false,
     this.isColumn = false,
-    this.isForceGrid = false,
+    this.isFullWidth = false,
     this.autoload = false,
-    this.flatMaxHeight = 720,
     this.columnMaxWidth = 480,
+    this.padding,
     this.width,
     this.viewport,
   });
@@ -48,23 +49,24 @@ class _AttachmentListState extends State<AttachmentList> {
   bool _isLoading = true;
   bool _showMature = false;
 
+  // ignore: unused_field
   double _aspectRatio = 1;
 
-  List<Attachment?> _attachmentsMeta = List.empty();
+  List<Attachment?> _attachments = List.empty();
 
   void _getMetadataList() {
     final AttachmentProvider attach = Get.find();
 
-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? false) {
       return;
     } else {
-      _attachmentsMeta = List.filled(widget.attachmentsId.length, null);
+      _attachments = List.filled(widget.attachmentIds!.length, null);
     }
 
-    attach.listMetadata(widget.attachmentsId).then((result) {
+    attach.listMetadata(widget.attachmentIds!).then((result) {
       if (mounted) {
         setState(() {
-          _attachmentsMeta = result;
+          _attachments = result;
           _isLoading = false;
         });
       }
@@ -76,7 +78,7 @@ class _AttachmentListState extends State<AttachmentList> {
     bool isConsistent = true;
     double? consistentValue;
     int portrait = 0, square = 0, landscape = 0;
-    for (var entry in _attachmentsMeta) {
+    for (var entry in _attachments) {
       if (entry == null) continue;
       if (entry.metadata?['ratio'] != null) {
         if (entry.metadata?['ratio'] is int) {
@@ -117,10 +119,9 @@ class _AttachmentListState extends State<AttachmentList> {
       item: element,
       parentId: widget.parentId,
       width: width ?? widget.width,
-      badgeContent: '${idx + 1}/${_attachmentsMeta.length}',
-      showBadge:
-          _attachmentsMeta.length > 1 && !widget.isGrid && !widget.isColumn,
-      showBorder: widget.attachmentsId.length > 1,
+      badgeContent: '${idx + 1}/${_attachments.length}',
+      showBadge: _attachments.length > 1 && !widget.isGrid && !widget.isColumn,
+      showBorder: _attachments.length > 1,
       showMature: _showMature,
       autoload: widget.autoload,
       onReveal: (value) {
@@ -132,7 +133,26 @@ class _AttachmentListState extends State<AttachmentList> {
   @override
   void initState() {
     super.initState();
-    _getMetadataList();
+    assert(widget.attachmentIds != null || widget.attachments != null);
+    if (widget.attachments == null) {
+      final AttachmentProvider attach = Get.find();
+      final cachedResult = attach.listMetadataFromCache(widget.attachmentIds!);
+      if (cachedResult.every((x) => x != null)) {
+        setState(() {
+          _attachments = cachedResult;
+          _isLoading = false;
+        });
+        _calculateAspectRatio();
+      } else {
+        _getMetadataList();
+      }
+    } else {
+      setState(() {
+        _attachments = widget.attachments!;
+        _isLoading = false;
+      });
+      _calculateAspectRatio();
+    }
   }
 
   Color get _unFocusColor =>
@@ -140,7 +160,7 @@ class _AttachmentListState extends State<AttachmentList> {
 
   @override
   Widget build(BuildContext context) {
-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? widget.attachments!.isEmpty) {
       return const SizedBox.shrink();
     }
 
@@ -153,9 +173,7 @@ class _AttachmentListState extends State<AttachmentList> {
             color: _unFocusColor,
           ).paddingOnly(right: 5),
           Text(
-            'attachmentHint'.trParams(
-              {'count': widget.attachmentsId.length.toString()},
-            ),
+            'attachmentHint'.trParams({'count': _attachments.toString()}),
             style: TextStyle(color: _unFocusColor, fontSize: 12),
           )
         ],
@@ -165,21 +183,90 @@ class _AttachmentListState extends State<AttachmentList> {
           .fadeIn(duration: 1250.ms);
     }
 
+    const radius = BorderRadius.all(Radius.circular(8));
+
+    if (widget.isFullWidth && _attachments.length == 1) {
+      final element = _attachments.first;
+      final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+      double ratio =
+          element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
+      return Container(
+        width: MediaQuery.of(context).size.width,
+        constraints: BoxConstraints(
+          maxHeight: 640,
+        ),
+        child: AspectRatio(
+          aspectRatio: ratio,
+          child: Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.symmetric(
+                horizontal: BorderSide(
+                  color: Theme.of(context).dividerColor,
+                  width: 1,
+                ),
+              ),
+            ),
+            child: _buildEntry(element, 0),
+          ),
+        ),
+      );
+    }
+
+    final isNotPureImage = _attachments.any(
+      (x) => x?.mimetype.split('/').firstOrNull != 'image',
+    );
+    if (widget.isGrid && !isNotPureImage) {
+      return GridView.builder(
+        padding: EdgeInsets.zero,
+        primary: false,
+        physics: const NeverScrollableScrollPhysics(),
+        shrinkWrap: true,
+        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
+          crossAxisCount: math.min(3, _attachments.length),
+          mainAxisSpacing: 8.0,
+          crossAxisSpacing: 8.0,
+        ),
+        itemCount: _attachments.length,
+        itemBuilder: (context, idx) {
+          final element = _attachments[idx];
+          return Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.all(
+                color: Theme.of(context).dividerColor,
+                width: 1,
+              ),
+              borderRadius: radius,
+            ),
+            child: ClipRRect(
+              borderRadius: radius,
+              child: _buildEntry(element, idx),
+            ),
+          );
+        },
+      );
+    }
+
     if (widget.isColumn) {
       var idx = 0;
-      const radius = BorderRadius.all(Radius.circular(8));
       return Wrap(
         spacing: 8,
         runSpacing: 8,
-        children: widget.attachmentsId.map((x) {
-          final element = _attachmentsMeta[idx];
+        children: _attachments.map((x) {
+          final element = _attachments[idx];
           idx++;
           if (element == null) return const SizedBox.shrink();
-          double ratio = element.metadata?['ratio']?.toDouble() ?? 16 / 9;
+          final isImage = element.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
           return Container(
-            decoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
-            ),
             constraints: BoxConstraints(
               maxWidth: widget.columnMaxWidth,
               maxHeight: 640,
@@ -188,6 +275,10 @@ class _AttachmentListState extends State<AttachmentList> {
               aspectRatio: ratio,
               child: Container(
                 decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
                   border: Border.all(
                     color: Theme.of(context).dividerColor,
                     width: 1,
@@ -205,68 +296,52 @@ class _AttachmentListState extends State<AttachmentList> {
       );
     }
 
-    final isNotPureImage = _attachmentsMeta.any(
-      (x) => x?.mimetype.split('/').firstOrNull != 'image',
-    );
-    if (widget.isGrid && (widget.isForceGrid || !isNotPureImage)) {
-      const radius = BorderRadius.all(Radius.circular(8));
-      return GridView.builder(
-        padding: EdgeInsets.zero,
-        primary: false,
-        physics: const NeverScrollableScrollPhysics(),
+    return Container(
+      constraints: BoxConstraints(
+        maxHeight: 320,
+      ),
+      child: ListView.separated(
+        padding: widget.padding,
+        scrollDirection: Axis.horizontal,
         shrinkWrap: true,
-        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
-          crossAxisCount: math.min(3, widget.attachmentsId.length),
-          mainAxisSpacing: 8.0,
-          crossAxisSpacing: 8.0,
-        ),
-        itemCount: widget.attachmentsId.length,
+        itemCount: _attachments.length,
         itemBuilder: (context, idx) {
-          final element = _attachmentsMeta[idx];
+          final element = _attachments[idx];
+          if (element == null) const SizedBox.shrink();
+          final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
           return Container(
-            decoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
-              border: Border.all(
-                color: Theme.of(context).dividerColor,
-                width: 1,
+            constraints: BoxConstraints(
+              maxWidth: math.min(
+                widget.columnMaxWidth,
+                MediaQuery.of(context).size.width -
+                    (widget.padding?.horizontal ?? 0),
               ),
-              borderRadius: radius,
             ),
-            child: ClipRRect(
-              borderRadius: radius,
-              child: _buildEntry(element, idx),
+            child: AspectRatio(
+              aspectRatio: ratio,
+              child: Container(
+                decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
+                  border: Border.all(
+                    color: Theme.of(context).dividerColor,
+                    width: 1,
+                  ),
+                  borderRadius: radius,
+                ),
+                child: ClipRRect(
+                  borderRadius: radius,
+                  child: _buildEntry(element, idx),
+                ),
+              ),
             ),
           );
         },
-      ).paddingSymmetric(horizontal: 24);
-    }
-
-    return Container(
-      width: MediaQuery.of(context).size.width,
-      constraints: BoxConstraints(
-        maxHeight: widget.flatMaxHeight,
-      ),
-      decoration: BoxDecoration(
-        color: Theme.of(context).colorScheme.surfaceContainerHigh,
-        border: Border.symmetric(
-          horizontal: BorderSide(
-            width: 0.3,
-            color: Theme.of(context).dividerColor,
-          ),
-        ),
-      ),
-      child: CarouselSlider.builder(
-        options: CarouselOptions(
-          aspectRatio: _aspectRatio,
-          viewportFraction:
-              widget.viewport ?? (widget.attachmentsId.length > 1 ? 0.95 : 1),
-          enableInfiniteScroll: false,
-        ),
-        itemCount: _attachmentsMeta.length,
-        itemBuilder: (context, idx, _) {
-          final element = _attachmentsMeta[idx];
-          return _buildEntry(element, idx);
-        },
+        separatorBuilder: (context, _) => const Gap(8),
       ),
     );
   }
@@ -319,6 +394,7 @@ class AttachmentListEntry extends StatelessWidget {
         width: width ?? MediaQuery.of(context).size.width,
         height: height,
         decoration: BoxDecoration(
+          color: Colors.transparent,
           border: showBorder
               ? Border.symmetric(
                   vertical: BorderSide(
@@ -338,16 +414,19 @@ class AttachmentListEntry extends StatelessWidget {
               badge: showBadge ? badgeContent : null,
               showHideButton: !item!.isMature || showMature,
               autoload: autoload,
+              isDense: isDense,
               onHide: () {
                 onReveal(false);
               },
             ),
             if (item!.isMature && !showMature)
-              BackdropFilter(
-                filter: ImageFilter.blur(sigmaX: 100, sigmaY: 100),
-                child: Container(
-                  decoration: BoxDecoration(
-                    color: Colors.black.withOpacity(0.5),
+              ClipRect(
+                child: BackdropFilter(
+                  filter: ImageFilter.blur(sigmaX: 100, sigmaY: 100),
+                  child: Container(
+                    decoration: BoxDecoration(
+                      color: Colors.black.withOpacity(0.5),
+                    ),
                   ),
                 ),
               ),

lib/widgets/auto_cache_image.dart

@@ -34,8 +34,17 @@ class AutoCacheImage extends StatelessWidget {
         progressIndicatorBuilder: noProgressIndicator
             ? null
             : (context, url, downloadProgress) => Center(
-                  child: CircularProgressIndicator(
-                    value: downloadProgress.progress,
+                  child: TweenAnimationBuilder(
+                    tween: Tween(
+                      begin: 0,
+                      end: downloadProgress.progress ?? 0,
+                    ),
+                    duration: const Duration(milliseconds: 300),
+                    builder: (context, value, _) => CircularProgressIndicator(
+                      value: downloadProgress.progress != null
+                          ? value.toDouble()
+                          : null,
+                    ),
                   ),
                 ),
         errorWidget: noErrorWidget
@@ -74,11 +83,20 @@ class AutoCacheImage extends StatelessWidget {
               ImageChunkEvent? loadingProgress) {
               if (loadingProgress == null) return child;
               return Center(
-                child: CircularProgressIndicator(
-                  value: loadingProgress.expectedTotalBytes != null
-                      ? loadingProgress.cumulativeBytesLoaded /
-                          loadingProgress.expectedTotalBytes!
-                      : null,
+                child: TweenAnimationBuilder(
+                  tween: Tween(
+                    begin: 0,
+                    end: loadingProgress.expectedTotalBytes != null
+                        ? loadingProgress.cumulativeBytesLoaded /
+                            loadingProgress.expectedTotalBytes!
+                        : 0,
+                  ),
+                  duration: const Duration(milliseconds: 300),
+                  builder: (context, value, _) => CircularProgressIndicator(
+                    value: loadingProgress.expectedTotalBytes != null
+                        ? value.toDouble()
+                        : null,
+                  ),
                 ),
               );
             },

lib/widgets/channel/channel_call_indicator.dart

@@ -98,12 +98,12 @@ class ChannelCallIndicator extends StatelessWidget {
               child: Text('callJoin'.tr),
             );
           } else if (call.channel.value?.id == channel.id &&
-              !AppTheme.isLargeScreen(context)) {
+              !AppTheme.isUltraLargeScreen(context)) {
             return TextButton(
               onPressed: () => onJoin(),
               child: Text('callResume'.tr),
             );
-          } else if (!AppTheme.isLargeScreen(context)) {
+          } else if (!AppTheme.isUltraLargeScreen(context)) {
             return TextButton(
               onPressed: null,
               child: Text('callJoin'.tr),

lib/widgets/channel/channel_list.dart

@@ -4,18 +4,18 @@ import 'package:flutter/material.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:intl/intl.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/platform.dart';
+import 'package:solian/providers/database/database.dart';
 import 'package:solian/router.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:badges/badges.dart' as badges;
 
 class ChannelListWidget extends StatefulWidget {
   final List<Channel> channels;
   final int selfId;
-  final bool isDense;
-  final bool isCollapsed;
-  final bool noCategory;
   final bool useReplace;
   final Function(Channel)? onSelected;
 
@@ -23,9 +23,6 @@ class ChannelListWidget extends StatefulWidget {
     super.key,
     required this.channels,
     required this.selfId,
-    this.isDense = false,
-    this.isCollapsed = false,
-    this.noCategory = false,
     this.useReplace = false,
     this.onSelected,
   });
@@ -35,43 +32,27 @@ class ChannelListWidget extends StatefulWidget {
 }
 
 class _ChannelListWidgetState extends State<ChannelListWidget> {
-  final List<Channel> _globalChannels = List.empty(growable: true);
-  final Map<String, List<Channel>> _inRealms = {};
+  Map<int, LocalMessageEventTableData>? _lastMessages;
 
   final ChatEventController _eventController = ChatEventController();
 
-  void _mapChannels() {
-    _inRealms.clear();
-    _globalChannels.clear();
-
-    if (widget.noCategory) {
-      _globalChannels.addAll(widget.channels);
-      return;
+  Future<void> _loadLastMessages() async {
+    final messages = await _eventController.src.getLastInAllChannels();
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
     }
-
-    for (final channel in widget.channels) {
-      if (channel.realmId != null) {
-        if (_inRealms[channel.realm!.alias] == null) {
-          _inRealms[channel.realm!.alias] = List.empty(growable: true);
-        }
-        _inRealms[channel.realm!.alias]!.add(channel);
-      } else {
-        _globalChannels.add(channel);
-      }
-    }
-  }
-
-  @override
-  void didUpdateWidget(covariant ChannelListWidget oldWidget) {
-    super.didUpdateWidget(oldWidget);
-    setState(() => _mapChannels());
   }
 
   @override
   void initState() {
     super.initState();
-    _mapChannels();
-    _eventController.initialize();
+    _eventController.initialize().then((_) {
+      _loadLastMessages();
+    });
   }
 
   void _gotoChannel(Channel item) {
@@ -98,107 +79,183 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
     }
   }
 
-  Widget _buildDirectMessageDescription(Channel item, ChannelMember otherside) {
+  Widget _buildTitle(Channel item, ChannelMember? otherside) {
+    if (otherside != null) {
+      return Row(
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Expanded(child: Text(otherside.account.nick)),
+          if (_lastMessages != null && _lastMessages![item.id] != null)
+            Text(
+              DateFormat('MM/dd').format(
+                _lastMessages![item.id]!.createdAt.toLocal(),
+              ),
+              style: TextStyle(
+                fontSize: 12,
+                color:
+                    Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+              ),
+            ),
+        ],
+      );
+    }
+    return Row(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      children: [
+        Expanded(child: Text(item.name)),
+        if (_lastMessages != null && _lastMessages![item.id] != null)
+          Text(
+            DateFormat('MM/dd').format(
+              _lastMessages![item.id]!.createdAt.toLocal(),
+            ),
+            style: TextStyle(
+              fontSize: 12,
+              color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+            ),
+          ),
+      ],
+    );
+  }
+
+  Widget _buildSubtitle(Channel item, ChannelMember? otherside) {
     if (PlatformInfo.isWeb) {
-      return Text('channelDirectDescription'.trParams(
-        {'username': '@${otherside.account.name}'},
-      ));
+      return otherside != null
+          ? Text(
+              'channelDirectDescription'.trParams(
+                {'username': '@${otherside.account.name}'},
+              ),
+              maxLines: 1,
+              overflow: TextOverflow.ellipsis,
+            )
+          : Text(
+              item.description,
+              maxLines: 1,
+              overflow: TextOverflow.ellipsis,
+            );
     }
 
-    return FutureBuilder(
-      future: Future.delayed(
-        const Duration(milliseconds: 500),
-        () => _eventController.src.getLastInChannel(item),
-      ),
-      builder: (context, snapshot) {
-        if (!snapshot.hasData && snapshot.data == null) {
-          return Text('channelDirectDescription'.trParams(
-            {'username': '@${otherside.account.name}'},
-          ));
-        }
-
-        final data = snapshot.data!.data!;
-        return Text(
-          '${data.sender.account.nick}: ${data.body['text'] ?? 'Unsupported message to preview'}',
-          maxLines: 1,
-          overflow: TextOverflow.ellipsis,
+    return AnimatedSwitcher(
+      switchInCurve: Curves.easeIn,
+      switchOutCurve: Curves.easeOut,
+      transitionBuilder: (child, animation) {
+        return FadeTransition(opacity: animation, child: child);
+      },
+      duration: const Duration(milliseconds: 300),
+      child: (_lastMessages == null || _lastMessages![item.id] == null)
+          ? Builder(
+              builder: (context) {
+                return otherside != null
+                    ? Text(
+                        'channelDirectDescription'.trParams(
+                          {'username': '@${otherside.account.name}'},
+                        ),
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      )
+                    : Text(
+                        item.description,
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      );
+              },
+            )
+          : Builder(
+              builder: (context) {
+                final data = _lastMessages![item.id]!.data!;
+                return Row(
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    if (item.type == 0)
+                      Badge(
+                        label: Text(data.sender.account.nick),
+                        backgroundColor:
+                            Theme.of(context).colorScheme.secondaryContainer,
+                        textColor:
+                            Theme.of(context).colorScheme.onSecondaryContainer,
+                      ),
+                    if (item.type == 0) const Gap(6),
+                    if (data.body['text'] != null)
+                      Expanded(
+                        child: Text(
+                          data.body['text'],
+                          maxLines: 1,
+                          overflow: TextOverflow.ellipsis,
+                        ),
+                      )
+                    else
+                      Badge(label: Text('unablePreview'.tr)),
+                  ],
+                );
+              },
+            ),
+      layoutBuilder: (currentChild, previousChildren) {
+        return Stack(
+          alignment: Alignment.centerLeft,
+          children: <Widget>[
+            ...previousChildren,
+            if (currentChild != null) currentChild,
+          ],
         );
       },
     );
   }
 
   Widget _buildEntry(Channel item) {
-    final padding = widget.isDense
-        ? const EdgeInsets.symmetric(horizontal: 20)
-        : const EdgeInsets.symmetric(horizontal: 16);
+    const padding = EdgeInsets.symmetric(horizontal: 20);
 
-    if (item.type == 1) {
-      final otherside =
-          item.members!.where((e) => e.account.id != widget.selfId).first;
+    final otherside =
+        item.members!.where((e) => e.account.id != widget.selfId).firstOrNull;
 
-      final avatar = AccountAvatar(
+    if (item.type == 1 && otherside != null) {
+      final avatar = AttachedCircleAvatar(
         content: otherside.account.avatar,
-        radius: widget.isDense ? 12 : 20,
+        radius: 20,
         bgColor: Theme.of(context).colorScheme.primary,
         feColor: Theme.of(context).colorScheme.onPrimary,
       );
 
-      if (widget.isCollapsed) {
-        return Tooltip(
-          message: otherside.account.nick,
-          child: InkWell(
-            child: avatar.paddingSymmetric(vertical: 12),
-            onTap: () => _gotoChannel(item),
-          ),
-        );
-      }
-
       return ListTile(
         leading: avatar,
         contentPadding: padding,
-        title: Text(otherside.account.nick),
-        subtitle: !widget.isDense
-            ? _buildDirectMessageDescription(item, otherside)
-            : null,
+        title: _buildTitle(item, otherside),
+        subtitle: _buildSubtitle(item, otherside),
         onTap: () => _gotoChannel(item),
       );
     } else {
       final avatar = CircleAvatar(
-        backgroundColor: item.realmId == null
-            ? Theme.of(context).colorScheme.primary
-            : Colors.transparent,
-        radius: widget.isDense ? 12 : 20,
+        backgroundColor: Theme.of(context).colorScheme.primary,
+        radius: 20,
         child: FaIcon(
           FontAwesomeIcons.hashtag,
-          color: item.realmId == null
-              ? Theme.of(context).colorScheme.onPrimary
-              : Theme.of(context).colorScheme.primary,
-          size: widget.isDense ? 12 : 16,
+          color: Theme.of(context).colorScheme.onPrimary,
+          size: 16,
         ),
       );
 
-      if (widget.isCollapsed) {
-        return Tooltip(
-          message: item.name,
-          child: InkWell(
-            child: avatar.paddingSymmetric(vertical: 12),
-            onTap: () => _gotoChannel(item),
-          ),
-        );
-      }
-
       return ListTile(
-        minTileHeight: widget.isDense ? 48 : null,
-        leading: avatar,
+        minTileHeight: null,
+        leading: item.realmId == null
+            ? avatar
+            : badges.Badge(
+                position: badges.BadgePosition.bottomEnd(bottom: -4, end: -6),
+                badgeStyle: badges.BadgeStyle(
+                  badgeColor: Theme.of(context).colorScheme.secondaryContainer,
+                  padding: const EdgeInsets.all(2),
+                  elevation: 8,
+                ),
+                badgeContent: AttachedCircleAvatar(
+                  content: item.realm?.avatar,
+                  radius: 10,
+                  fallbackWidget: const Icon(
+                    Icons.workspaces,
+                    size: 16,
+                  ),
+                ),
+                child: avatar,
+              ),
         contentPadding: padding,
-        title: Text(item.name),
-        subtitle: !widget.isDense
-            ? Text(
-                item.description,
-                maxLines: 1,
-                overflow: TextOverflow.ellipsis,
-              )
-            : null,
+        title: _buildTitle(item, null),
+        subtitle: _buildSubtitle(item, null),
         onTap: () => _gotoChannel(item),
       );
     }
@@ -206,49 +263,16 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
 
   @override
   Widget build(BuildContext context) {
-    if (widget.noCategory) {
-      return CustomScrollView(
-        slivers: [
-          SliverList.builder(
-            itemCount: _globalChannels.length,
-            itemBuilder: (context, index) {
-              final element = _globalChannels[index];
-              return _buildEntry(element);
-            },
-          ),
-          SliverGap(max(16, MediaQuery.of(context).padding.bottom)),
-        ],
-      );
-    }
-
     return CustomScrollView(
       slivers: [
         SliverList.builder(
-          itemCount: _globalChannels.length,
+          itemCount: widget.channels.length,
           itemBuilder: (context, index) {
-            final element = _globalChannels[index];
+            final element = widget.channels[index];
             return _buildEntry(element);
           },
         ),
-        SliverList.list(
-          children: _inRealms.entries.map((element) {
-            return ExpansionTile(
-              tilePadding: const EdgeInsets.only(left: 20, right: 24),
-              minTileHeight: 48,
-              title: Text(element.value.first.realm!.name),
-              leading: CircleAvatar(
-                backgroundColor: Colors.teal,
-                radius: widget.isDense ? 12 : 24,
-                child: Icon(
-                  Icons.workspaces,
-                  color: Colors.white,
-                  size: widget.isDense ? 12 : 16,
-                ),
-              ),
-              children: element.value.map((x) => _buildEntry(x)).toList(),
-            );
-          }).toList(),
-        ),
+        SliverGap(max(16, MediaQuery.of(context).padding.bottom)),
       ],
     );
   }

lib/widgets/channel/channel_member.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@@ -8,6 +7,7 @@ import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/account/relative_select.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class ChannelMemberListPopup extends StatefulWidget {
   final Channel channel;
@@ -131,7 +131,7 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
             'channelMembers'.tr,
             style: Theme.of(context).textTheme.headlineSmall,
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
           ListTile(
             tileColor: Theme.of(context).colorScheme.surfaceContainerHigh,
             contentPadding: const EdgeInsets.symmetric(horizontal: 20),
@@ -152,7 +152,8 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
                   title: Text(element.account.nick),
                   subtitle: Text(element.account.name),
                   leading: GestureDetector(
-                    child: AccountAvatar(content: element.account.avatar),
+                    child:
+                        AttachedCircleAvatar(content: element.account.avatar),
                     onTap: () {
                       showModalBottomSheet(
                         useRootNavigator: true,

lib/widgets/chat/call/call_no_content.dart

@@ -74,7 +74,7 @@ class _NoContentWidgetState extends State<NoContentWidget>
               ),
             )
           ],
-          child: AccountAvatar(
+          child: AttachedCircleAvatar(
             content: widget.userinfo!.avatar,
             bgColor: Colors.transparent,
             radius: radius,

lib/widgets/chat/chat_event.dart

@@ -78,7 +78,7 @@ class ChatEvent extends StatelessWidget {
       child: AttachmentList(
         key: Key('m${item.uuid}attachments'),
         parentId: item.uuid,
-        attachmentsId: attachments,
+        attachmentIds: attachments,
         isColumn: true,
       ),
     );
@@ -220,7 +220,7 @@ class ChatEvent extends StatelessWidget {
                 children: [
                   Row(
                     children: [
-                      AccountAvatar(
+                      AttachedCircleAvatar(
                         content: item.sender.account.avatar,
                         radius: 9,
                       ),
@@ -250,7 +250,8 @@ class ChatEvent extends StatelessWidget {
             crossAxisAlignment: CrossAxisAlignment.start,
             children: [
               GestureDetector(
-                child: AccountAvatar(content: item.sender.account.avatar),
+                child:
+                    AttachedCircleAvatar(content: item.sender.account.avatar),
                 onTap: () {
                   showModalBottomSheet(
                     useRootNavigator: true,

lib/widgets/chat/chat_event_action.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/channel.dart';
@@ -7,6 +6,7 @@ import 'package:solian/models/event.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/widgets/chat/chat_event_deletion.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class ChatEventAction extends StatefulWidget {
   final Channel channel;
@@ -73,7 +73,7 @@ class _ChatEventActionState extends State<ChatEventAction> {
               ),
             ],
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
           Expanded(
             child: ListView(
               children: [

lib/widgets/chat/chat_event_list.dart

@@ -1,4 +1,6 @@
+import 'package:flutter/gestures.dart';
 import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/models/channel.dart';
@@ -9,6 +11,7 @@ import 'package:solian/widgets/chat/chat_event_action.dart';
 import 'package:very_good_infinite_list/very_good_infinite_list.dart';
 
 class ChatEventList extends StatelessWidget {
+  final bool noAnimated;
   final String scope;
   final Channel channel;
   final ChatEventController chatController;
@@ -23,6 +26,7 @@ class ChatEventList extends StatelessWidget {
     required this.chatController,
     required this.onEdit,
     required this.onReply,
+    this.noAnimated = false,
   });
 
   bool _checkMessageMergeable(Event? a, Event? b) {
@@ -31,9 +35,28 @@ class ChatEventList extends StatelessWidget {
     return a.createdAt.difference(b.createdAt).inMinutes <= 3;
   }
 
+  void _openActions(BuildContext context, Event item) {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => ChatEventAction(
+        channel: channel,
+        realm: channel.realm,
+        item: item,
+        onEdit: () {
+          onEdit(item);
+        },
+        onReply: () {
+          onReply(item);
+        },
+      ),
+    );
+  }
+
   @override
   Widget build(BuildContext context) {
     return CustomScrollView(
+      cacheExtent: 100,
       reverse: true,
       slivers: [
         Obx(() {
@@ -61,33 +84,45 @@ class ChatEventList extends StatelessWidget {
 
               final item = chatController.currentEvents[index].data;
 
-              return GestureDetector(
-                behavior: HitTestBehavior.opaque,
-                child: ChatEvent(
-                  key: Key('m${item!.uuid}'),
-                  item: item,
-                  isMerged: isMerged,
-                  chatController: chatController,
-                ).paddingOnly(
-                  top: !isMerged ? 8 : 0,
-                  bottom: !hasMerged ? 8 : 0,
-                ),
-                onLongPress: () {
-                  showModalBottomSheet(
-                    useRootNavigator: true,
-                    context: context,
-                    builder: (context) => ChatEventAction(
-                      channel: channel,
-                      realm: channel.realm,
+              return TapRegion(
+                child: GestureDetector(
+                  behavior: HitTestBehavior.opaque,
+                  child: Builder(builder: (context) {
+                    final widget = ChatEvent(
+                      key: Key('m${item!.uuid}'),
                       item: item,
-                      onEdit: () {
-                        onEdit(item);
-                      },
-                      onReply: () {
-                        onReply(item);
-                      },
-                    ),
-                  );
+                      isMerged: isMerged,
+                      chatController: chatController,
+                    ).paddingOnly(
+                      top: !isMerged ? 8 : 0,
+                      bottom: !hasMerged ? 8 : 0,
+                    );
+
+                    if (noAnimated) {
+                      return widget;
+                    } else {
+                      return widget
+                          .animate(
+                            key: Key('animated-m${item.uuid}'),
+                          )
+                          .slideY(
+                            curve: Curves.fastLinearToSlowEaseIn,
+                            duration: 250.ms,
+                            begin: 0.5,
+                            end: 0,
+                          );
+                    }
+                  }),
+                  onLongPress: () {
+                    _openActions(context, item!);
+                  },
+                ),
+                onTapInside: (event) {
+                  if (event.buttons == kSecondaryMouseButton) {
+                    _openActions(context, item!);
+                  } else if (event.buttons == kMiddleMouseButton) {
+                    onReply(item!);
+                  }
                 },
               );
             },

lib/widgets/chat/chat_event_message.dart

@@ -49,6 +49,7 @@ class ChatEventMessage extends StatelessWidget {
     return MarkdownTextContent(
       parentId: 'm${item.id}',
       isSelectable: true,
+      isAutoWarp: true,
       content: body.text,
     );
   }

lib/widgets/chat/chat_message_input.dart

@@ -443,7 +443,7 @@ class _ChatMessageInputState extends State<ChatMessageInput> {
                           .map(
                             (x) => ChatMessageSuggestion(
                               type: 'users',
-                              leading: AccountAvatar(content: x.avatar),
+                              leading: AttachedCircleAvatar(content: x.avatar),
                               display: x.nick,
                               content: '@${x.name}',
                             ),

lib/widgets/daily_sign/history_chart.dart

@@ -42,61 +42,168 @@ class DailySignHistoryChartDialog extends StatelessWidget {
                 child: CircularProgressIndicator(),
               ),
             )
-          : Column(
-              mainAxisSize: MainAxisSize.min,
-              crossAxisAlignment: CrossAxisAlignment.start,
-              children: [
-                Text(
-                  'dailySignHistoryRecent'.tr,
-                  style: Theme.of(context).textTheme.titleMedium,
-                ).paddingOnly(bottom: 18),
-                SizedBox(
-                  height: 180,
-                  width: max(640, MediaQuery.of(context).size.width),
-                  child: LineChart(
-                    LineChartData(
-                      lineBarsData: [
-                        LineChartBarData(
-                          isCurved: true,
-                          isStrokeCapRound: true,
-                          isStrokeJoinRound: true,
-                          color: Theme.of(context).colorScheme.primary,
-                          belowBarData: BarAreaData(
-                            show: true,
-                            gradient: LinearGradient(
-                              colors: List.filled(
-                                data!.length,
-                                Theme.of(context)
-                                    .colorScheme
-                                    .primary
-                                    .withOpacity(0.3),
-                              ).toList(),
+          : SizedBox(
+              width: double.maxFinite,
+              child: ListView(
+                shrinkWrap: true,
+                children: [
+                  Text(
+                    'dailySignHistoryRecent'.tr,
+                    style: Theme.of(context).textTheme.titleMedium,
+                  ).paddingOnly(bottom: 18),
+                  SizedBox(
+                    height: 180,
+                    width: max(640, MediaQuery.of(context).size.width),
+                    child: LineChart(
+                      LineChartData(
+                        lineBarsData: [
+                          LineChartBarData(
+                            isCurved: true,
+                            isStrokeCapRound: true,
+                            isStrokeJoinRound: true,
+                            color: Theme.of(context).colorScheme.primary,
+                            belowBarData: BarAreaData(
+                              show: true,
+                              gradient: LinearGradient(
+                                colors: List.filled(
+                                  data!.length,
+                                  Theme.of(context)
+                                      .colorScheme
+                                      .primary
+                                      .withOpacity(0.3),
+                                ).toList(),
+                              ),
+                            ),
+                            spots: data!
+                                .map(
+                                  (x) => FlSpot(
+                                    x.createdAt
+                                        .copyWith(
+                                          hour: 0,
+                                          minute: 0,
+                                          second: 0,
+                                          millisecond: 0,
+                                          microsecond: 0,
+                                        )
+                                        .millisecondsSinceEpoch
+                                        .toDouble(),
+                                    x.resultTier.toDouble(),
+                                  ),
+                                )
+                                .toList(),
+                          )
+                        ],
+                        lineTouchData: LineTouchData(
+                          touchTooltipData: LineTouchTooltipData(
+                            getTooltipItems: (spots) => spots
+                                .map((spot) => LineTooltipItem(
+                                      '${signSymbols[spot.y.toInt()]}\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
+                                      TextStyle(
+                                        color: Theme.of(context)
+                                            .colorScheme
+                                            .onSurface,
+                                      ),
+                                    ))
+                                .toList(),
+                            getTooltipColor: (_) => Theme.of(context)
+                                .colorScheme
+                                .surfaceContainerHigh,
+                          ),
+                        ),
+                        titlesData: FlTitlesData(
+                          topTitles: const AxisTitles(
+                            sideTitles: SideTitles(showTitles: false),
+                          ),
+                          rightTitles: const AxisTitles(
+                            sideTitles: SideTitles(showTitles: false),
+                          ),
+                          leftTitles: AxisTitles(
+                            sideTitles: SideTitles(
+                              showTitles: true,
+                              reservedSize: 40,
+                              interval: 1,
+                              getTitlesWidget: (value, _) => Align(
+                                alignment: Alignment.centerRight,
+                                child: Text(
+                                  signSymbols[value.toInt()],
+                                  textAlign: TextAlign.right,
+                                ).paddingOnly(right: 8),
+                              ),
                             ),
                           ),
-                          spots: data!
-                              .map(
-                                (x) => FlSpot(
-                                  x.createdAt
-                                      .copyWith(
-                                        hour: 0,
-                                        minute: 0,
-                                        second: 0,
-                                        millisecond: 0,
-                                        microsecond: 0,
-                                      )
-                                      .millisecondsSinceEpoch
-                                      .toDouble(),
-                                  x.resultTier.toDouble(),
+                          bottomTitles: AxisTitles(
+                            sideTitles: SideTitles(
+                              showTitles: true,
+                              reservedSize: 28,
+                              interval: 86400000,
+                              getTitlesWidget: (value, _) => Text(
+                                DateFormat('dd').format(
+                                  DateTime.fromMillisecondsSinceEpoch(
+                                    value.toInt(),
+                                  ),
                                 ),
-                              )
-                              .toList(),
-                        )
-                      ],
-                      lineTouchData: LineTouchData(
-                        touchTooltipData: LineTouchTooltipData(
+                                textAlign: TextAlign.center,
+                              ).paddingOnly(top: 8),
+                            ),
+                          ),
+                        ),
+                        gridData: const FlGridData(show: false),
+                        borderData: FlBorderData(show: false),
+                      ),
+                    ),
+                  ).marginOnly(right: 24, bottom: 8, top: 8),
+                  const Gap(16),
+                  Text(
+                    'dailySignHistoryReward'.tr,
+                    style: Theme.of(context).textTheme.titleMedium,
+                  ).paddingOnly(bottom: 18),
+                  SizedBox(
+                    height: 180,
+                    width: max(640, MediaQuery.of(context).size.width),
+                    child: LineChart(
+                      LineChartData(
+                        lineBarsData: [
+                          LineChartBarData(
+                            isCurved: true,
+                            isStrokeCapRound: true,
+                            isStrokeJoinRound: true,
+                            color: Theme.of(context).colorScheme.primary,
+                            belowBarData: BarAreaData(
+                              show: true,
+                              gradient: LinearGradient(
+                                colors: List.filled(
+                                  data!.length,
+                                  Theme.of(context)
+                                      .colorScheme
+                                      .primary
+                                      .withOpacity(0.3),
+                                ).toList(),
+                              ),
+                            ),
+                            spots: data!
+                                .map(
+                                  (x) => FlSpot(
+                                    x.createdAt
+                                        .copyWith(
+                                          hour: 0,
+                                          minute: 0,
+                                          second: 0,
+                                          millisecond: 0,
+                                          microsecond: 0,
+                                        )
+                                        .millisecondsSinceEpoch
+                                        .toDouble(),
+                                    x.resultExperience.toDouble(),
+                                  ),
+                                )
+                                .toList(),
+                          )
+                        ],
+                        lineTouchData: LineTouchData(
+                            touchTooltipData: LineTouchTooltipData(
                           getTooltipItems: (spots) => spots
                               .map((spot) => LineTooltipItem(
-                                    '${signSymbols[spot.y.toInt()]}\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
+                                    '+${spot.y.toStringAsFixed(0)} EXP\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
                                     TextStyle(
                                       color: Theme.of(context)
                                           .colorScheme
@@ -107,153 +214,50 @@ class DailySignHistoryChartDialog extends StatelessWidget {
                           getTooltipColor: (_) => Theme.of(context)
                               .colorScheme
                               .surfaceContainerHigh,
-                        ),
-                      ),
-                      titlesData: FlTitlesData(
-                        topTitles: const AxisTitles(
-                          sideTitles: SideTitles(showTitles: false),
-                        ),
-                        rightTitles: const AxisTitles(
-                          sideTitles: SideTitles(showTitles: false),
-                        ),
-                        leftTitles: AxisTitles(
-                          sideTitles: SideTitles(
-                            showTitles: true,
-                            reservedSize: 40,
-                            interval: 1,
-                            getTitlesWidget: (value, _) => Align(
-                              alignment: Alignment.centerRight,
-                              child: Text(
-                                signSymbols[value.toInt()],
-                                textAlign: TextAlign.right,
-                              ).paddingOnly(right: 8),
-                            ),
+                        )),
+                        titlesData: FlTitlesData(
+                          topTitles: const AxisTitles(
+                            sideTitles: SideTitles(showTitles: false),
                           ),
-                        ),
-                        bottomTitles: AxisTitles(
-                          sideTitles: SideTitles(
-                            showTitles: true,
-                            reservedSize: 28,
-                            interval: 86400000,
-                            getTitlesWidget: (value, _) => Text(
-                              DateFormat('dd').format(
-                                DateTime.fromMillisecondsSinceEpoch(
-                                  value.toInt(),
-                                ),
+                          rightTitles: const AxisTitles(
+                            sideTitles: SideTitles(showTitles: false),
+                          ),
+                          leftTitles: AxisTitles(
+                            sideTitles: SideTitles(
+                              showTitles: true,
+                              reservedSize: 40,
+                              getTitlesWidget: (value, _) => Align(
+                                alignment: Alignment.centerRight,
+                                child: Text(
+                                  value.toStringAsFixed(0),
+                                  textAlign: TextAlign.right,
+                                ).paddingOnly(right: 8),
                               ),
-                              textAlign: TextAlign.center,
-                            ).paddingOnly(top: 8),
-                          ),
-                        ),
-                      ),
-                      gridData: const FlGridData(show: false),
-                      borderData: FlBorderData(show: false),
-                    ),
-                  ),
-                ).marginOnly(right: 24, bottom: 8, top: 8),
-                const Gap(16),
-                Text(
-                  'dailySignHistoryReward'.tr,
-                  style: Theme.of(context).textTheme.titleMedium,
-                ).paddingOnly(bottom: 18),
-                SizedBox(
-                  height: 180,
-                  width: max(640, MediaQuery.of(context).size.width),
-                  child: LineChart(
-                    LineChartData(
-                      lineBarsData: [
-                        LineChartBarData(
-                          isCurved: true,
-                          isStrokeCapRound: true,
-                          isStrokeJoinRound: true,
-                          color: Theme.of(context).colorScheme.primary,
-                          belowBarData: BarAreaData(
-                            show: true,
-                            gradient: LinearGradient(
-                              colors: List.filled(
-                                data!.length,
-                                Theme.of(context)
-                                    .colorScheme
-                                    .primary
-                                    .withOpacity(0.3),
-                              ).toList(),
                             ),
                           ),
-                          spots: data!
-                              .map(
-                                (x) => FlSpot(
-                                  x.createdAt
-                                      .copyWith(
-                                        hour: 0,
-                                        minute: 0,
-                                        second: 0,
-                                        millisecond: 0,
-                                        microsecond: 0,
-                                      )
-                                      .millisecondsSinceEpoch
-                                      .toDouble(),
-                                  x.resultExperience.toDouble(),
-                                ),
-                              )
-                              .toList(),
-                        )
-                      ],
-                      lineTouchData: LineTouchData(
-                          touchTooltipData: LineTouchTooltipData(
-                        getTooltipItems: (spots) => spots
-                            .map((spot) => LineTooltipItem(
-                                  '+${spot.y.toStringAsFixed(0)} EXP\n${DateFormat('MM/dd').format(DateTime.fromMillisecondsSinceEpoch(spot.x.toInt()))}',
-                                  TextStyle(
-                                    color:
-                                        Theme.of(context).colorScheme.onSurface,
+                          bottomTitles: AxisTitles(
+                            sideTitles: SideTitles(
+                              showTitles: true,
+                              reservedSize: 28,
+                              interval: 86400000,
+                              getTitlesWidget: (value, _) => Text(
+                                DateFormat('dd').format(
+                                  DateTime.fromMillisecondsSinceEpoch(
+                                    value.toInt(),
                                   ),
-                                ))
-                            .toList(),
-                        getTooltipColor: (_) =>
-                            Theme.of(context).colorScheme.surfaceContainerHigh,
-                      )),
-                      titlesData: FlTitlesData(
-                        topTitles: const AxisTitles(
-                          sideTitles: SideTitles(showTitles: false),
-                        ),
-                        rightTitles: const AxisTitles(
-                          sideTitles: SideTitles(showTitles: false),
-                        ),
-                        leftTitles: AxisTitles(
-                          sideTitles: SideTitles(
-                            showTitles: true,
-                            reservedSize: 40,
-                            getTitlesWidget: (value, _) => Align(
-                              alignment: Alignment.centerRight,
-                              child: Text(
-                                value.toStringAsFixed(0),
-                                textAlign: TextAlign.right,
-                              ).paddingOnly(right: 8),
+                                ),
+                                textAlign: TextAlign.center,
+                              ).paddingOnly(top: 8),
                             ),
                           ),
                         ),
-                        bottomTitles: AxisTitles(
-                          sideTitles: SideTitles(
-                            showTitles: true,
-                            reservedSize: 28,
-                            interval: 86400000,
-                            getTitlesWidget: (value, _) => Text(
-                              DateFormat('dd').format(
-                                DateTime.fromMillisecondsSinceEpoch(
-                                  value.toInt(),
-                                ),
-                              ),
-                              textAlign: TextAlign.center,
-                            ).paddingOnly(top: 8),
-                          ),
-                        ),
+                        gridData: const FlGridData(show: false),
+                        borderData: FlBorderData(show: false),
                       ),
-                      gridData: const FlGridData(show: false),
-                      borderData: FlBorderData(show: false),
                     ),
-                  ),
-                ).marginOnly(right: 24, bottom: 8, top: 8),
-              ],
+                  ).marginOnly(right: 24, bottom: 8, top: 8),
+                ],
+              ),
             ),
     );
   }

lib/widgets/link_expansion.dart

@@ -2,15 +2,21 @@ import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:flutter_svg/svg.dart';
 import 'package:get/get.dart';
+import 'package:solian/models/link.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
-class LinkExpansion extends StatelessWidget {
+class LinkExpansion extends StatefulWidget {
   final String content;
 
   const LinkExpansion({super.key, required this.content});
 
+  @override
+  State<LinkExpansion> createState() => _LinkExpansionState();
+}
+
+class _LinkExpansionState extends State<LinkExpansion> {
   Widget _buildImage(String url, {double? width, double? height}) {
     if (url.endsWith('svg')) {
       return SvgPicture.network(url, width: width, height: height);
@@ -22,61 +28,74 @@ class LinkExpansion extends StatelessWidget {
     );
   }
 
-  @override
-  Widget build(BuildContext context) {
+  List<LinkMeta>? _meta;
+
+  Future<void> _doExpand() async {
     final linkRegex = RegExp(
       r'(?<!\()(?:(?:https?):\/\/|www\.)(?:[-_a-z0-9]+\.)*(?:[-a-z0-9]+\.[-a-z0-9]+)[^\s<]*[^\s<?!.,:*_~]',
     );
-    final matches = linkRegex.allMatches(content);
-    if (matches.isEmpty) {
-      return const SizedBox.shrink();
-    }
+    final matches = linkRegex.allMatches(widget.content);
+    if (matches.isEmpty) return;
 
     final LinkExpandProvider expandController = Get.find();
 
+    if (matches.isEmpty) return;
+
+    List<LinkMeta> out = List.empty(growable: true);
+    for (final x in matches) {
+      final result = await expandController.expandLink(x.group(0)!);
+      if (result != null) out.add(result);
+    }
+
+    setState(() => _meta = out);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _doExpand();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    if (_meta?.isEmpty ?? true) return const SizedBox.shrink();
+
     return Wrap(
-      children: matches.map((x) {
+      children: _meta!.map((x) {
         return Container(
           constraints: BoxConstraints(
-            maxWidth: matches.length == 1 ? 480 : 340,
+            maxWidth: _meta!.length == 1 ? 480 : 340,
           ),
-          child: FutureBuilder(
-            future: expandController.expandLink(x.group(0)!),
-            builder: (context, snapshot) {
-              if (!snapshot.hasData) {
-                return const SizedBox.shrink();
-              }
-
+          child: Builder(
+            builder: (context) {
               final isRichDescription = [
                 'solsynth.dev',
-              ].contains(Uri.parse(snapshot.data!.url).host);
+              ].contains(Uri.parse(x.url).host);
 
               return GestureDetector(
                 child: Card(
                   child: Column(
                     crossAxisAlignment: CrossAxisAlignment.start,
                     children: [
-                      if ([
-                        (snapshot.data!.icon?.isNotEmpty ?? false),
-                        snapshot.data!.siteName != null
-                      ].any((x) => x))
+                      if ([(x.icon?.isNotEmpty ?? false), x.siteName != null]
+                          .any((x) => x))
                         Row(
                           children: [
-                            if (snapshot.data!.icon?.isNotEmpty ?? false)
+                            if (x.icon?.isNotEmpty ?? false)
                               ClipRRect(
                                 borderRadius: const BorderRadius.all(
                                   Radius.circular(8),
                                 ),
                                 child: _buildImage(
-                                  snapshot.data!.icon!,
+                                  x.icon!,
                                   width: 32,
                                   height: 32,
                                 ),
                               ).paddingOnly(right: 8),
-                            if (snapshot.data!.siteName != null)
+                            if (x.siteName != null)
                               Expanded(
                                 child: Text(
-                                  snapshot.data!.siteName!,
+                                  x.siteName!,
                                   style: Theme.of(context).textTheme.labelLarge,
                                   maxLines: 1,
                                   overflow: TextOverflow.ellipsis,
@@ -84,32 +103,27 @@ class LinkExpansion extends StatelessWidget {
                               ),
                           ],
                         ).paddingOnly(
-                          bottom: (snapshot.data!.icon?.isNotEmpty ?? false)
-                              ? 8
-                              : 4,
+                          bottom: (x.icon?.isNotEmpty ?? false) ? 8 : 4,
                         ),
-                      if (snapshot.data!.image != null &&
-                          (snapshot.data!.image?.startsWith('http') ?? false))
+                      if (x.image != null &&
+                          (x.image?.startsWith('http') ?? false))
                         ClipRRect(
                           borderRadius: const BorderRadius.all(
                             Radius.circular(8),
                           ),
-                          child: _buildImage(
-                            snapshot.data!.image!,
-                          ),
+                          child: _buildImage(x.image!),
                         ).paddingOnly(bottom: 8),
                       Text(
-                        snapshot.data!.title ?? 'No Title',
+                        x.title ?? 'No Title',
                         maxLines: 1,
                         overflow: TextOverflow.fade,
                         style: Theme.of(context).textTheme.bodyLarge,
                       ),
-                      if (snapshot.data!.description != null &&
-                          isRichDescription)
-                        MarkdownBody(data: snapshot.data!.description!)
-                      else if (snapshot.data!.description != null)
+                      if (x.description != null && isRichDescription)
+                        MarkdownBody(data: x.description!)
+                      else if (x.description != null)
                         Text(
-                          snapshot.data!.description!,
+                          x.description!,
                           maxLines: 3,
                           overflow: TextOverflow.ellipsis,
                         ),
@@ -117,7 +131,7 @@ class LinkExpansion extends StatelessWidget {
                   ).paddingAll(12),
                 ),
                 onTap: () {
-                  launchUrlString(x.group(0)!);
+                  launchUrlString(x.url);
                 },
               );
             },

lib/widgets/loading_indicator.dart

@@ -0,0 +1,89 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:gap/gap.dart';
+
+class LoadingIndicator extends StatefulWidget {
+  final bool isActive;
+  final Color? backgroundColor;
+
+  const LoadingIndicator({
+    super.key,
+    this.isActive = true,
+    this.backgroundColor,
+  });
+
+  @override
+  State<LoadingIndicator> createState() => _LoadingIndicatorState();
+}
+
+class _LoadingIndicatorState extends State<LoadingIndicator>
+    with SingleTickerProviderStateMixin {
+  late AnimationController _controller;
+  late Animation<double> _animation;
+
+  @override
+  void initState() {
+    super.initState();
+
+    _controller = AnimationController(
+      vsync: this,
+      duration: const Duration(milliseconds: 300),
+    );
+
+    _animation = CurvedAnimation(
+      parent: _controller,
+      curve: Curves.easeInOut,
+    );
+
+    if (widget.isActive) {
+      _controller.forward();
+    } else {
+      _controller.reverse();
+    }
+  }
+
+  @override
+  void didUpdateWidget(covariant LoadingIndicator oldWidget) {
+    super.didUpdateWidget(oldWidget);
+
+    if (widget.isActive != oldWidget.isActive) {
+      if (widget.isActive) {
+        _controller.forward();
+      } else {
+        _controller.reverse();
+      }
+    }
+  }
+
+  @override
+  void dispose() {
+    _controller.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return SizeTransition(
+      sizeFactor: _animation,
+      axisAlignment: -1, // Align animation from the top
+      child: Container(
+        padding: const EdgeInsets.symmetric(vertical: 16, horizontal: 24),
+        color: widget.backgroundColor ??
+            Theme.of(context).colorScheme.surfaceContainerLow.withOpacity(0.5),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.center,
+          crossAxisAlignment: CrossAxisAlignment.center,
+          children: [
+            const SizedBox(
+              height: 16,
+              width: 16,
+              child: CircularProgressIndicator(strokeWidth: 2.5),
+            ),
+            const Gap(8),
+            Text('loading'.tr),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/widgets/markdown_text_content.dart

@@ -1,67 +1,125 @@
+import 'dart:ui';
+
 import 'package:flutter/material.dart';
-import 'package:flutter_markdown_selectionarea/flutter_markdown.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:markdown/markdown.dart' as markdown;
-import 'package:markdown/markdown.dart';
+import 'package:path/path.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/providers/stickers.dart';
+import 'package:solian/widgets/attachments/attachment_item.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
+import 'package:syntax_highlight/syntax_highlight.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
 import 'account/account_profile_popup.dart';
 
-class MarkdownTextContent extends StatelessWidget {
+class MarkdownTextContent extends StatefulWidget {
   final String content;
   final String parentId;
+  final List<Attachment>? attachments;
   final bool isSelectable;
   final bool isLargeText;
+  final bool isAutoWarp;
 
   const MarkdownTextContent({
     super.key,
     required this.content,
     required this.parentId,
+    this.attachments,
     this.isSelectable = false,
     this.isLargeText = false,
+    this.isAutoWarp = false,
   });
 
+  @override
+  State<MarkdownTextContent> createState() => _MarkdownTextContentState();
+}
+
+class _MarkdownTextContentState extends State<MarkdownTextContent> {
+  final List<int> _stickerSizes = [];
+
+  @override
+  initState() {
+    super.initState();
+    final stickerRegex = RegExp(r':([-\w]+):');
+
+    // Split the content into paragraphs
+    final paragraphs = widget.content.split(RegExp(r'\n\s*\n'));
+
+    // Iterate over each paragraph to process stickers individually
+
+    for (var idx = 0; idx < paragraphs.length; idx++) {
+      // Getting paragraph
+      var paragraph = paragraphs[idx];
+
+      // Matching stickers
+      final stickerMatch = stickerRegex.allMatches(paragraph);
+      if (stickerMatch.length > 3) {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 16));
+      } else if (stickerMatch.length > 1) {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 32));
+      } else {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 128));
+      }
+    }
+  }
+
   Widget _buildContent(BuildContext context) {
-    final emojiRegex = RegExp(r':([-\w]+):');
-    final emojiMatch = emojiRegex.allMatches(content);
-    final isOnlyEmoji = content.replaceAll(emojiRegex, '').trim().isEmpty;
+    var stickerIdx = 0;
 
     return Markdown(
       shrinkWrap: true,
       physics: const NeverScrollableScrollPhysics(),
-      data: content,
+      data: widget.content,
       padding: EdgeInsets.zero,
       styleSheet: MarkdownStyleSheet.fromTheme(
         Theme.of(context),
       ).copyWith(
-        textScaleFactor: isLargeText ? 1.1 : 1,
-        blockquote: TextStyle(
-          color: Theme.of(context).colorScheme.onSurfaceVariant,
-        ),
-        blockquoteDecoration: BoxDecoration(
-          color: Theme.of(context).colorScheme.surfaceContainerHigh,
-          borderRadius: const BorderRadius.all(Radius.circular(4)),
-        ),
-        horizontalRuleDecoration: BoxDecoration(
-          border: Border(
-            top: BorderSide(
-              width: 1.0,
-              color: Theme.of(context).dividerColor,
+          textScaler: TextScaler.linear(widget.isLargeText ? 1.1 : 1),
+          blockquote: TextStyle(
+            color: Theme.of(context).colorScheme.onSurfaceVariant,
+          ),
+          blockquoteDecoration: BoxDecoration(
+            color: Theme.of(context).colorScheme.surfaceContainerHigh,
+            borderRadius: const BorderRadius.all(Radius.circular(4)),
+          ),
+          horizontalRuleDecoration: BoxDecoration(
+            border: Border(
+              top: BorderSide(
+                width: 1.0,
+                color: Theme.of(context).dividerColor,
+              ),
             ),
           ),
-        ),
-      ),
+          codeblockDecoration: BoxDecoration(
+            border: Border.all(
+              color: Theme.of(context).dividerColor,
+              width: 0.3,
+            ),
+            borderRadius: const BorderRadius.all(Radius.circular(4)),
+            color: Theme.of(context).colorScheme.surface.withOpacity(0.5),
+          )),
+      builders: {
+        'code': _MarkdownTextCodeElement(),
+      },
+      softLineBreak: true,
       extensionSet: markdown.ExtensionSet(
-        markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
+        <markdown.BlockSyntax>[
+          markdown.CodeBlockSyntax(),
+          ...markdown.ExtensionSet.commonMark.blockSyntaxes,
+          ...markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
+        ],
         <markdown.InlineSyntax>[
+          if (widget.isAutoWarp) markdown.LineBreakSyntax(),
           _UserNameCardInlineSyntax(),
           _CustomEmoteInlineSyntax(),
-          markdown.EmojiSyntax(),
           markdown.AutolinkSyntax(),
           markdown.AutolinkExtensionSyntax(),
+          markdown.CodeSyntax(),
+          ...markdown.ExtensionSet.commonMark.inlineSyntaxes,
           ...markdown.ExtensionSet.gitHubFlavored.inlineSyntaxes
         ],
       ),
@@ -97,23 +155,24 @@ class MarkdownTextContent extends StatelessWidget {
           final segments = url.replaceFirst('solink://', '').split('/');
           switch (segments[0]) {
             case 'stickers':
-              double radius = 8;
+              double radius = 4;
               final StickerProvider sticker = Get.find();
-              if (emojiMatch.length <= 1 && isOnlyEmoji) {
-                width = 128;
-                height = 128;
-              } else if (emojiMatch.length <= 3 && isOnlyEmoji) {
-                width = 32;
-                height = 32;
-              } else {
-                radius = 4;
-                width = 16;
-                height = 16;
+
+              // Adjust sticker size based on the sticker count in this paragraph
+              width =
+                  _stickerSizes.elementAtOrNull(stickerIdx)?.toDouble() ?? 16;
+              height =
+                  _stickerSizes.elementAtOrNull(stickerIdx)?.toDouble() ?? 16;
+              if (width > 16) {
+                radius = 8;
               }
+              stickerIdx++;
               fit = BoxFit.contain;
               return ClipRRect(
                 borderRadius: BorderRadius.all(Radius.circular(radius)),
                 child: Container(
+                  width: width,
+                  height: height,
                   color: Theme.of(context).colorScheme.surfaceContainer,
                   child: FutureBuilder(
                     future: sticker.getStickerByAlias(segments[1]),
@@ -133,21 +192,44 @@ class MarkdownTextContent extends StatelessWidget {
                 ),
               ).paddingSymmetric(vertical: 4);
             case 'attachments':
+              final match = widget.attachments
+                  ?.where((x) => x.rid == segments[1])
+                  .firstOrNull;
               const radius = BorderRadius.all(Radius.circular(8));
-              return LimitedBox(
-                maxHeight: MediaQuery.of(context).size.width,
-                child: ClipRRect(
-                  borderRadius: radius,
-                  child: AttachmentSelfContainedEntry(
-                    isDense: true,
-                    parentId: parentId,
-                    rid: segments[1],
+              if (match != null) {
+                final isImage =
+                    match.mimetype.split('/').firstOrNull == 'image';
+                double ratio = match.metadata?['ratio']?.toDouble() ??
+                    (isImage ? 1 : 16 / 9);
+                return LimitedBox(
+                  maxWidth: 480,
+                  maxHeight: 640,
+                  child: AspectRatio(
+                    aspectRatio: ratio,
+                    child: ClipRRect(
+                      borderRadius: radius,
+                      child: AttachmentItem(
+                        parentId: widget.parentId,
+                        item: match,
+                      ),
+                    ),
                   ),
-                ),
-              ).paddingSymmetric(vertical: 4);
+                ).paddingSymmetric(vertical: 4);
+              } else {
+                return LimitedBox(
+                  maxHeight: MediaQuery.of(context).size.width,
+                  child: ClipRRect(
+                    borderRadius: radius,
+                    child: AttachmentSelfContainedEntry(
+                      isDense: true,
+                      parentId: widget.parentId,
+                      rid: segments[1],
+                    ),
+                  ),
+                ).paddingSymmetric(vertical: 4);
+              }
           }
         }
-
         return AutoCacheImage(
           url,
           width: width,
@@ -160,14 +242,14 @@ class MarkdownTextContent extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    if (isSelectable) {
+    if (widget.isSelectable) {
       return SelectionArea(child: _buildContent(context));
     }
     return _buildContent(context);
   }
 }
 
-class _UserNameCardInlineSyntax extends InlineSyntax {
+class _UserNameCardInlineSyntax extends markdown.InlineSyntax {
   _UserNameCardInlineSyntax() : super(r'@[a-zA-Z0-9_]+');
 
   @override
@@ -183,7 +265,7 @@ class _UserNameCardInlineSyntax extends InlineSyntax {
   }
 }
 
-class _CustomEmoteInlineSyntax extends InlineSyntax {
+class _CustomEmoteInlineSyntax extends markdown.InlineSyntax {
   _CustomEmoteInlineSyntax() : super(r':([-\w]+):');
 
   @override
@@ -203,3 +285,48 @@ class _CustomEmoteInlineSyntax extends InlineSyntax {
     return true;
   }
 }
+
+class _MarkdownTextCodeElement extends MarkdownElementBuilder {
+  @override
+  Widget? visitElementAfter(
+    markdown.Element element,
+    TextStyle? preferredStyle,
+  ) {
+    var language = '';
+
+    if (element.attributes['class'] != null) {
+      String lg = element.attributes['class'] as String;
+      language = lg.substring(9).trim();
+    }
+    return SizedBox(
+      child: FutureBuilder(
+        future: (() async {
+          final docPath = '../../../';
+          final highlightingPath =
+              join(docPath, 'assets/highlighting', language);
+          await Highlighter.initialize([highlightingPath]);
+          return Highlighter(
+            language: highlightingPath,
+            theme: PlatformDispatcher.instance.platformBrightness ==
+                    Brightness.light
+                ? await HighlighterTheme.loadLightTheme()
+                : await HighlighterTheme.loadDarkTheme(),
+          );
+        })(),
+        builder: (context, snapshot) {
+          if (snapshot.hasData) {
+            final highlighter = snapshot.data!;
+            return Text.rich(
+              highlighter.highlight(element.textContent.trim()),
+              style: GoogleFonts.robotoMono(),
+            );
+          }
+          return Text(
+            element.textContent.trim(),
+            style: GoogleFonts.robotoMono(),
+          );
+        },
+      ),
+    ).paddingAll(8);
+  }
+}

lib/widgets/navigation/app_account_widget.dart

@@ -0,0 +1,80 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/account_status.dart';
+import 'package:solian/providers/account_status.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/relation.dart';
+import 'package:badges/badges.dart' as badges;
+import 'package:solian/widgets/account/account_avatar.dart';
+
+class AppAccountWidget extends StatefulWidget {
+  const AppAccountWidget({super.key});
+
+  @override
+  State<AppAccountWidget> createState() => _AppAccountWidgetState();
+}
+
+class _AppAccountWidgetState extends State<AppAccountWidget> {
+  AccountStatus? _accountStatus;
+
+  Future<void> _getStatus() async {
+    final StatusProvider provider = Get.find();
+
+    final resp = await provider.getCurrentStatus();
+    final status = AccountStatus.fromJson(resp.body);
+
+    if (mounted) {
+      setState(() {
+        _accountStatus = status;
+      });
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getStatus();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+
+    return Obx(() {
+      if (auth.isAuthorized.isFalse || auth.userProfile.value == null) {
+        return const Icon(Icons.account_circle);
+      }
+
+      final statusBadgeColor = _accountStatus != null
+          ? StatusProvider.determineStatus(_accountStatus!).$2
+          : Colors.grey;
+
+      final RelationshipProvider relations = Get.find();
+      final accountNotifications = relations.friendRequestCount.value;
+
+      return badges.Badge(
+        badgeContent: Text(
+          accountNotifications.toString(),
+          style: const TextStyle(color: Colors.white),
+        ),
+        showBadge: accountNotifications > 0,
+        position: badges.BadgePosition.topEnd(
+          top: -10,
+          end: -6,
+        ),
+        child: badges.Badge(
+          showBadge: _accountStatus != null,
+          badgeStyle: badges.BadgeStyle(badgeColor: statusBadgeColor),
+          position: badges.BadgePosition.bottomEnd(
+            bottom: 0,
+            end: -2,
+          ),
+          child: AttachedCircleAvatar(
+            radius: 14,
+            content: auth.userProfile.value!['avatar'],
+          ),
+        ),
+      );
+    });
+  }
+}

lib/widgets/navigation/app_navigation.dart

@@ -1,27 +1,33 @@
 import 'package:flutter/material.dart';
 import 'package:get/utils.dart';
+import 'package:solian/widgets/navigation/app_account_widget.dart';
 
 abstract class AppNavigation {
   static List<AppNavigationDestination> destinations = [
     AppNavigationDestination(
-      icon: Icons.dashboard,
-      label: 'dashboard'.tr,
+      icon: const Icon(Icons.dashboard),
+      label: 'dashboardNav'.tr,
       page: 'dashboard',
     ),
     AppNavigationDestination(
-      icon: Icons.newspaper,
-      label: 'feed'.tr,
-      page: 'feed',
+      icon: const Icon(Icons.explore),
+      label: 'explore'.tr,
+      page: 'explore',
     ),
     AppNavigationDestination(
-      icon: Icons.workspaces,
+      icon: const Icon(Icons.forum),
+      label: 'chat'.tr,
+      page: 'chat',
+    ),
+    AppNavigationDestination(
+      icon: const Icon(Icons.workspaces),
       label: 'realms'.tr,
       page: 'realms',
     ),
     AppNavigationDestination(
-      icon: Icons.forum,
-      label: 'chat'.tr,
-      page: 'chat',
+      icon: const AppAccountWidget(),
+      label: 'accountNav'.tr,
+      page: 'account',
     ),
   ];
 
@@ -30,7 +36,7 @@ abstract class AppNavigation {
 }
 
 class AppNavigationDestination {
-  final IconData icon;
+  final Widget icon;
   final String label;
   final String page;