🚀 Launch 1.4.0+15

💄 Optimize content rendering

.roadsignrc

@@ -0,0 +1,13 @@
+{
+  "sync": {
+    "region": "solian",
+    "configPath": "roadsign.toml"
+  },
+  "deployments": [
+    {
+      "region": "solian",
+      "site": "solian-web",
+      "path": "build/web"
+    }
+  ]
+}

android/gradle.properties

@@ -4,3 +4,4 @@ android.enableJetifier=true
 android.defaults.buildfeatures.buildconfig=true
 android.nonTransitiveRClass=false
 android.nonFinalResIds=false
+kotlin.jvm.target.validation.mode = IGNORE

assets/highlighting/cpp.json

@@ -0,0 +1,358 @@
+{
+  "name": "C++",
+  "version": "1.0.0",
+  "fileTypes": ["cpp", "hpp", "cc", "h"],
+  "scopeName": "source.cpp",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.cpp",
+      "match": "^\\s*#\\s*(include|define|if|ifdef|ifndef|else|endif|pragma)\\b"
+    },
+    {
+      "name": "meta.declaration.cpp",
+      "begin": "^\\w*\\b(namespace|class|struct|enum|typedef|template)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.declaration.cpp"
+        }
+      },
+      "end": "(\\{|;)",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.cpp",
+          "match": "\\b(public|private|protected|virtual|override|final)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.cpp",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.cpp"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#comments-inline"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "(//.*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.cpp",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.cpp",
+          "match": "__attribute__\\(\\w+\\)"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.cpp",
+          "match": "\\b(true|false|nullptr)\\b"
+        },
+        {
+          "name": "variable.language.cpp",
+          "match": "\\b(this|super)\\b"
+        },
+        {
+          "name": "constant.numeric.cpp",
+          "match": "\\b((0(x|X)[0-9a-fA-F]+)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "\\b(bool|int|char|double|float|long|short|signed|unsigned|void)\\b",
+          "name": "storage.type.primitive.cpp"
+        },
+        {
+          "begin": "(\\b[A-Z]\\w*\\b)",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.cpp"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "\\b([a-z_][a-zA-Z0-9_]*)\\s*\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.cpp",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(if|else|for|while|do|switch|case|break|continue|goto|return)\\b"
+        },
+        {
+          "name": "keyword.operator.cpp",
+          "match": "\\b(sizeof|typeid|decltype|new|delete)\\b"
+        },
+        {
+          "name": "keyword.control.try.cpp",
+          "match": "\\b(try|catch|throw)\\b"
+        },
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(static|inline|virtual|override|const|volatile|explicit|friend|constexpr)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.comparison.cpp",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.cpp",
+          "match": "(\\+|\\-|\\*|\\/|%)"
+        },
+        {
+          "name": "keyword.operator.assignment.cpp",
+          "match": "(=|\\+=|-=|\\*=|/=|%=)"
+        },
+        {
+          "name": "keyword.operator.logical.cpp",
+          "match": "(\\&\\&|\\|\\||!)"
+        },
+        {
+          "name": "keyword.operator.bitwise.cpp",
+          "match": "(<<|>>|\\&|\\||\\^|~)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.cpp"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.cpp",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.cpp"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.cpp",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.cpp",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.double.cpp",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.cpp",
+          "begin": "'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.cpp",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.cpp",
+          "match": ";"
+        }
+      ]
+    }
+  }
+}

assets/highlighting/dart.json

@@ -0,0 +1,531 @@
+{
+  "name": "Dart",
+  "version": "1.2.3",
+  "fileTypes": ["dart"],
+  "scopeName": "source.dart",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.dart",
+      "match": "^(#!.*)$"
+    },
+    {
+      "name": "meta.declaration.dart",
+      "begin": "^\\w*\\b(library|import|part of|part|export)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.import.dart"
+        }
+      },
+      "end": ";",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.import.dart",
+          "match": "\\b(as|show|hide)\\b"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "\\b(if)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "dartdoc": {
+      "patterns": [
+        {
+          "match": "(\\[.*?\\])",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "match": "^ {4,}(?![ \\*]).*",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "contentName": "variable.other.source.dart",
+          "begin": "```.*?$",
+          "end": "```"
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(\\* ((    ).*))$",
+          "captures": {
+            "2": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.dart",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.dart"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            },
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "((//).*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.dart",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.dart",
+          "match": "@[a-zA-Z]+"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.dart",
+          "match": "(?<!\\$)\\b(true|false|null)\\b(?!\\$)"
+        },
+        {
+          "name": "variable.language.dart",
+          "match": "(?<!\\$)\\b(this|super)\\b(?!\\$)"
+        },
+        {
+          "name": "constant.numeric.dart",
+          "match": "(?<!\\$)\\b((0(x|X)[0-9a-fA-F]*)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b(?!\\$)"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "(?<!\\$)\\b(bool|num|int|double|dynamic)\\b(?!\\$)",
+          "name": "support.class.dart"
+        },
+        {
+          "match": "(?<!\\$)\\bvoid\\b(?!\\$)",
+          "name": "storage.type.primitive.dart"
+        },
+        {
+          "begin": "(?<![a-zA-Z0-9_$])([_$]*[A-Z][a-zA-Z0-9_$]*)\\b",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.dart"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "([_$]*[a-z][a-zA-Z0-9_$]*)(<(?:[a-zA-Z0-9_$<>?]|,\\s*|\\s+extends\\s+)+>)?[!?]?\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.dart"
+            },
+            "2": {
+              "patterns": [
+                {
+                  "include": "#type-args"
+                }
+              ]
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.cast.dart",
+          "match": "(?<!\\$)\\bas\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.catch-exception.dart",
+          "match": "(?<!\\$)\\b(try|on|catch|finally|throw|rethrow)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(break|case|continue|default|do|else|for|if|in|return|switch|while|when)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(sync(\\*)?|async(\\*)?|await|yield(\\*)?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\bassert\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.new.dart",
+          "match": "(?<!\\$)\\b(new)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "(?<!\\$)\\b(abstract|sealed|base|interface|class|enum|extends|extension type|extension|external|factory|implements|get(?!\\()|mixin|native|operator|set(?!\\()|typedef|with|covariant)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.modifier.dart",
+          "match": "(?<!\\$)\\b(static|final|const|required|late)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.type.primitive.dart",
+          "match": "(?<!\\$)\\b(?:void|var)\\b(?!\\$)"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.dart",
+          "match": "(?<!\\$)\\b(is\\!?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.operator.ternary.dart",
+          "match": "\\?|:"
+        },
+        {
+          "name": "keyword.operator.bitwise.dart",
+          "match": "(<<|>>>?|~|\\^|\\||&)"
+        },
+        {
+          "name": "keyword.operator.assignment.bitwise.dart",
+          "match": "((&|\\^|\\||<<|>>>?)=)"
+        },
+        {
+          "name": "keyword.operator.closure.dart",
+          "match": "(=>)"
+        },
+        {
+          "name": "keyword.operator.comparison.dart",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.assignment.arithmetic.dart",
+          "match": "(([+*/%-]|\\~)=)"
+        },
+        {
+          "name": "keyword.operator.assignment.dart",
+          "match": "(=)"
+        },
+        {
+          "name": "keyword.operator.increment-decrement.dart",
+          "match": "(\\-\\-|\\+\\+)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.dart",
+          "match": "(\\-|\\+|\\*|\\/|\\~\\/|%)"
+        },
+        {
+          "name": "keyword.operator.logical.dart",
+          "match": "(!|&&|\\|\\|)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.dart"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.dart",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.dart"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.dart",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.dart",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.interpolated.triple.double.dart",
+          "begin": "(?<!r)\"\"\"",
+          "end": "\"\"\"(?!\")",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.triple.single.dart",
+          "begin": "(?<!r)'''",
+          "end": "'''(?!')",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.triple.double.dart",
+          "begin": "r\"\"\"",
+          "end": "\"\"\"(?!\")"
+        },
+        {
+          "name": "string.quoted.triple.single.dart",
+          "begin": "r'''",
+          "end": "'''(?!')"
+        },
+        {
+          "name": "string.interpolated.double.dart",
+          "begin": "(?<!\\|r)\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.double.dart",
+          "begin": "r\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.single.dart",
+          "begin": "(?<!\\|r)'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.dart",
+          "begin": "r'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.dart",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.dart",
+          "match": ";"
+        },
+        {
+          "name": "punctuation.dot.dart",
+          "match": "\\."
+        }
+      ]
+    }
+  }
+}

assets/highlighting/json.json

@@ -0,0 +1,212 @@
+{
+  "fileTypes": ["json"],
+  "foldingStartMarker": "^\\s*[{\\[](?!.*[}\\]],?\\s*$)|[{\\[]\\s*$",
+  "foldingStopMarker": "^\\s*[}\\]]",
+  "keyEquivalent": "^~J",
+  "name": "JSON (Javascript Next)",
+  "patterns": [
+    {
+      "include": "#value"
+    }
+  ],
+  "repository": {
+    "array": {
+      "begin": "\\[",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.begin.json"
+        }
+      },
+      "end": "\\]",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.end.json"
+        }
+      },
+      "name": "meta.structure.array.json",
+      "patterns": [
+        {
+          "include": "#value"
+        },
+        {
+          "match": ",",
+          "name": "punctuation.separator.array.json"
+        },
+        {
+          "match": "[^\\s\\]]",
+          "name": "invalid.illegal.expected-array-separator.json"
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "begin": "/\\*\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.documentation.json"
+        },
+        {
+          "begin": "/\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.json"
+        },
+        {
+          "captures": {
+            "1": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "match": "(//).*$\\n?",
+          "name": "comment.line.double-slash.js"
+        }
+      ]
+    },
+    "constant": {
+      "match": "\\b(?:true|false|null)\\b",
+      "name": "constant.language.json"
+    },
+    "number": {
+      "match": "-?(?:0|[1-9]\\d*)\n(?:\n(?:\n\\.\\d+)?\n(?:\n[eE][+-]?\\d+)?)?",
+      "name": "constant.numeric.json"
+    },
+    "object": {
+      "begin": "\\{",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.begin.json"
+        }
+      },
+      "end": "\\}",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.end.json"
+        }
+      },
+      "name": "meta.structure.dictionary.json",
+      "patterns": [
+        {
+          "comment": "the JSON object key",
+          "include": "#objectkey"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "begin": ":",
+          "beginCaptures": {
+            "0": {
+              "name": "punctuation.separator.dictionary.key-value.json"
+            }
+          },
+          "end": "(,)|(?=\\})",
+          "endCaptures": {
+            "1": {
+              "name": "punctuation.separator.dictionary.pair.json"
+            }
+          },
+          "name": "meta.structure.dictionary.value.json",
+          "patterns": [
+            {
+              "comment": "the JSON object value",
+              "include": "#value"
+            },
+            {
+              "match": "[^\\s,]",
+              "name": "invalid.illegal.expected-dictionary-separator.json"
+            }
+          ]
+        },
+        {
+          "match": "[^\\s\\}]",
+          "name": "invalid.illegal.expected-dictionary-separator.json"
+        }
+      ]
+    },
+    "string": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.end.json"
+        }
+      },
+      "name": "string.quoted.double.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "objectkey": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.end.json"
+        }
+      },
+      "name": "support.type.property-name.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "stringcontent": {
+      "patterns": [
+        {
+          "match": "\\\\(?:[\"\\\\/bfnrt]|u[0-9a-fA-F]{4})",
+          "name": "constant.character.escape.json"
+        },
+        {
+          "match": "\\\\.",
+          "name": "invalid.illegal.unrecognized-string-escape.json"
+        }
+      ]
+    },
+    "value": {
+      "patterns": [
+        {
+          "include": "#constant"
+        },
+        {
+          "include": "#number"
+        },
+        {
+          "include": "#string"
+        },
+        {
+          "include": "#array"
+        },
+        {
+          "include": "#object"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    }
+  },
+  "scopeName": "source.json",
+  "uuid": "8f97457b-516e-48ce-83c7-08ae12fb327a"
+}

assets/highlighting/python.json

@@ -0,0 +1,98 @@
+{
+  "name": "Python",
+  "version": "1.0.0",
+  "fileTypes": ["py"],
+  "scopeName": "source.python",
+  "foldingStartMarker": "\\b(?:def|class)\\s*[^:]*:\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+  "patterns": [
+    { "include": "#comments" },
+    { "include": "#keywords" },
+    { "include": "#constants-and-special-vars" },
+    { "include": "#operators" },
+    { "include": "#strings" }
+  ],
+  "repository": {
+    "comments": {
+      "patterns": [
+        { "name": "comment.line.hash.python", "match": "#.*$" },
+        { "name": "comment.block.python", "begin": "'''", "end": "'''" },
+        { "name": "comment.block.python", "begin": "\"\"\"", "end": "\"\"\"" }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.python",
+          "match": "\\b(?:if|else|while|for|in|break|continue|return)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        },
+        { "name": "keyword.operator.assignment.python", "match": "=" },
+        { "name": "storage.modifier.python", "match": "\\b(?:def|class)\\b" }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.python",
+          "match": "\\b(?:True|False|None)\\b"
+        },
+        { "name": "variable.language.python", "match": "\\b(?:self)\\b" },
+        {
+          "name": "constant.numeric.python",
+          "match": "\\b(?:\\d+\\.?\\d*|\\.\\d+)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.arithmetic.python",
+          "match": "\\b(?:\\+|-|\\*|/|%|//)\\b"
+        },
+        {
+          "name": "keyword.operator.comparison.python",
+          "match": "\\b(?:==|!=|<|<=|>|>=)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.triple.double.python",
+          "begin": "\"\"\"",
+          "end": "\"\"\""
+        },
+        {
+          "name": "string.quoted.triple.single.python",
+          "begin": "'''",
+          "end": "'''"
+        },
+        {
+          "name": "string.quoted.double.python",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [{ "include": "#string-escape" }]
+        },
+        {
+          "name": "string.quoted.single.python",
+          "begin": "'",
+          "end": "'",
+          "patterns": [{ "include": "#string-escape" }]
+        }
+      ]
+    },
+    "string-escape": {
+      "patterns": [
+        { "name": "constant.character.escape.python", "match": "\\\\[\"']" }
+      ]
+    }
+  }
+}

assets/highlighting/sql.json

@@ -0,0 +1,145 @@
+{
+  "fileTypes": ["sql", "ddl", "dml"],
+  "foldingStartMarker": "(?i)^\\s*(begin|if|loop)\\b",
+  "foldingStopMarker": "(?i)^\\s*(end)\\b",
+  "keyEquivalent": "^~S",
+  "name": "PL/pgSQL (Postgres)",
+  "patterns": [
+    {
+      "begin": "/\\*",
+      "end": "\\*/",
+      "name": "comment.block.postgres"
+    },
+    {
+      "match": "--.*$",
+      "name": "comment.line.double-dash.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        }
+      },
+      "match": "(?i)^\\s*(create)(\\s+or\\s+replace)?\\s+",
+      "name": "meta.create.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        },
+        "3": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(package)(\\s+body)?\\s+(\\S+)",
+      "name": "meta.package.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(type)\\s+\"([^\"]+)\"",
+      "name": "meta.type.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.function.postgres"
+        }
+      },
+      "match": "(?i)\\s*(function|procedure)\\s+([-a-z0-9_.]+)",
+      "name": "meta.procedure.postgres"
+    },
+    {
+      "match": "[!<>:]?=|<>|<|>|\\+|(?<!\\.)\\*|-|(?<!^)/|@@|\\|\\|",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(true|false|null|found)\\b",
+      "name": "constant.language.postgres"
+    },
+    {
+      "match": "\\b\\d+(\\.\\d+)?\\b",
+      "name": "constant.numeric.postgres"
+    },
+    {
+      "match": "(?i)\\b(if|elsif|else|end\\s+if|loop|end\\s+loop|for|foreach|array|case|end\\s+case|continue|return|goto|alias)\\b",
+      "name": "keyword.control.postgres"
+    },
+    {
+      "match": "(?i)\\b(or|and|not|like)\\b",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(sysdate|%(isopen|found|notfound|rowcount)|commit|rollback|sqlerrm|substr|cast|decode|length|lower|upper|coalesce)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "match": "(?i)\\b(avg|count|sum|max|min|nvl|trim|to_date|to_char|lpad|ltrim|rpad|rtrim|trunc|to_number|regexp_split_to_array|regexp_replace)\\b",
+      "name": "support.function.builtin.postgres"
+    },
+    {
+      "match": "(?i)\\b(sql|sqlcode)\\b",
+      "name": "variable.language.postgres"
+    },
+    {
+      "match": "(?i)\\b(p(i|o|io)_[-a-z0-9_]+)\\b",
+      "name": "variable.parameter.postgres"
+    },
+    {
+      "match": "(?i)\\b(l_[-a-z0-9_]+)\\b",
+      "name": "variable.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(immutable|volatile|stable|serial|primary|key|references|comment|column|schema|authorization|get|diagnostics|returning|drop|all|raise|notice|warning|exception|external|security|definer|language|grant|execute|on|to|function|procedure|returns|end|then|deterministic|exception|when|others|subtype|constant|range|binary_integer|declare|begin|in|out|is|as|exit|open|fetch|into|close|type|rowtype|default|\\.(extend|count|first|last|next|nextval|currval)|cost|alter|owner)\\b",
+      "name": "keyword.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(select|perform|from|where|order\\s+by|group\\s+by|asc|desc|update|set|insert|into|values|delete|from|distinct|union|having|limit|table|of|prepare|(inner|left|outer) join)\\b",
+      "name": "keyword.other.sql.postgres"
+    },
+    {
+      "match": "[$][0-9]+",
+      "name": "storage.type.postgres"
+    },
+    {
+      "match": "(?i)\\b(dbms_lock|dbms_output)\\b",
+      "name": "support.class.postgres"
+    },
+    {
+      "match": "(?i)\\b(put_line)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "begin": "'",
+      "end": "'",
+      "name": "string.quoted.single.postgres"
+    },
+    {
+      "begin": "\"",
+      "end": "\"",
+      "name": "string.quoted.double.postgres"
+    },
+    {
+      "match": "(?i)\\b(number|integer|bigint|varchar2|varchar|boolean|date|setof|record|query|numeric|void|character varying|text|([-a-z0-9_.]+%(row)?type))\\b",
+      "name": "storage.type.postgres"
+    }
+  ],
+  "scopeName": "source.plpgsql.postgres",
+  "uuid": "28DCE4DD-F5E1-4ED3-8847-64DA6B1F9163"
+}

assets/highlighting/yaml.json

@@ -0,0 +1,66 @@
+{
+  "name": "YAML",
+  "fileTypes": ["yaml", "yml"],
+  "scopeName": "source.yaml",
+  "patterns": [
+    {
+      "name": "comment.line.number-sign.yaml",
+      "match": "#.*",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.comment.yaml"
+        }
+      }
+    },
+    {
+      "name": "entity.name.tag.yaml",
+      "match": "^\\s*\\w+",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.tag.yaml"
+        }
+      }
+    },
+    {
+      "name": "punctuation.separator.key-value.yaml",
+      "match": ":",
+      "captures": {
+        "0": {
+          "name": "punctuation.separator.key-value.yaml"
+        }
+      }
+    },
+    {
+      "name": "string.quoted.double.yaml",
+      "begin": "\"",
+      "end": "\"",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "\\\\(x[0-9A-Fa-f]{2}|u[0-9A-Fa-f]{4}|U[0-9A-Fa-f]{6}|.)"
+        }
+      ]
+    },
+    {
+      "name": "string.quoted.single.yaml",
+      "begin": "'",
+      "end": "'",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "''"
+        }
+      ]
+    }
+  ],
+  "repository": {
+    "scalar-plain": {
+      "patterns": [
+        {
+          "match": "\\b(\\w+)\\b",
+          "name": "scalar.plain.yaml"
+        }
+      ]
+    }
+  }
+}

assets/locales/en_us.json

@@ -140,7 +140,7 @@
   "clear": "Clear",
   "pinPost": "Pin this post",
   "unpinPost": "Unpin this post",
-  "postRestoreFromLocal": "Restore from local",
+  "postRestoreFromLocal": "Restored",
   "postAutoSaveAt": "Auto saved at @date",
   "postCategoriesAndTags": "Categories n' Tags",
   "postPublishDate": "Publish Date",
@@ -367,7 +367,7 @@
   "bsRegisteringPushNotify": "Enabling Push Notifications",
   "bsDismissibleErrorHint": "Click anywhere to ignore this error",
   "postShareContent": "@content\n\n@username on the Solar Network\nCheck it out: @link",
-  "postShareSubject": "@username posted a post on the Solar Network",
+  "postShareSubject": "@title by @username on Solar Network",
   "themeColor": "Global Theme Color",
   "themeColorRed": "Modern Red",
   "themeColorBlue": "Classic Blue",
@@ -463,5 +463,32 @@
   "friendAdd": "Add as friend",
   "blockUser": "Block user",
   "unblockUser": "Unblock user",
-  "learnMoreAboutPerson": "Learn more about that person"
+  "learnMoreAboutPerson": "Learn more about that person",
+  "global": "Global",
+  "all": "All",
+  "unablePreview": "Unable to preview",
+  "dashboardNav": "Dash",
+  "accountNav": "You",
+  "performance": "Performance",
+  "animatedMessageList": "Non-animated message list",
+  "animatedMessageListDesc": "Remove animation effects in message list, to reduce cause lag",
+  "theme": "Theme",
+  "globalTheme": "Global theme",
+  "agedTheme": "Old school style theme",
+  "agedThemeDesc": "Downgrade the global theme to Material Design 2. Unexpected issues may occur. For experimental use only.",
+  "appBackgroundImage": "Global background image",
+  "appBackgroundImageDesc": "The global background image will be displayed on all pages",
+  "authPreferences": "Auth preferences",
+  "authPreferencesDesc": "Set the security behavior of your account",
+  "authMaximumAuthSteps": "Maximum authentication steps",
+  "authMaximumAuthStepsDesc": "The maximum number of authentication steps when logging in, higher value is more secure, lower value is more convenient; default is 2",
+  "auditLog": "Audit log",
+  "shareImage": "Share as image",
+  "shareImageFooter": "Only on the Solar Network",
+  "fileSavedAt": "File saved at @path",
+  "showIp": "Show IP Address",
+  "shotOn": "Shot on @device",
+  "unread": "Unread",
+  "searchTook": "Took @time",
+  "searchResult": "@count Matches"
 }

assets/locales/zh_cn.json

@@ -266,7 +266,7 @@
   "channelMembersAddHint": "到 @channel",
   "channelType": "频道类型",
   "channelTypeCommon": "普通频道",
-  "channelTypeDirect": "私信聊天",
+  "channelTypeDirect": "私信",
   "channelAdjust": "调整频道",
   "channelDetail": "频道详情",
   "channelSettings": "频道设置",
@@ -363,7 +363,7 @@
   "bsRegisteringPushNotify": "正在启用推送通知",
   "bsDismissibleErrorHint": "点击任意地方忽略此错误",
   "postShareContent": "@content\n\n@username 在 Solar Network\n原帖地址：@link",
-  "postShareSubject": "@username 在 Solar Network 上发布了一篇帖子",
+  "postShareSubject": "@username 在 Solar Network 发表的 @title",
   "themeColor": "全局主题色",
   "themeColorRed": "现代红",
   "themeColorBlue": "经典蓝",
@@ -459,5 +459,32 @@
   "friendAdd": "添加好友",
   "blockUser": "屏蔽用户",
   "unblockUser": "解除屏蔽用户",
-  "learnMoreAboutPerson": "了解关于 TA 的更多"
+  "learnMoreAboutPerson": "了解关于 TA 的更多",
+  "global": "全局",
+  "all": "全部",
+  "unablePreview": "无法预览",
+  "dashboardNav": "仪表盘",
+  "accountNav": "您",
+  "performance": "性能",
+  "animatedMessageList": "无动画消息列表",
+  "animatedMessageListDesc": "在消息列表中禁用动画效果",
+  "theme": "主题",
+  "globalTheme": "全局应用主题",
+  "agedTheme": "过时主题",
+  "agedThemeDesc": "将全局主题降级为 Material Design 2，可能发生意料之外的问题，仅供实验使用",
+  "appBackgroundImage": "全局背景图片",
+  "appBackgroundImageDesc": "全局背景图片将会在所有页面中展示",
+  "authPreferences": "安全偏好设置",
+  "authPreferencesDesc": "调整账号的安全行为模式",
+  "authMaximumAuthSteps": "最大认证步数",
+  "authMaximumAuthStepsDesc": "登陆时最多的验证步数，值越高则越安全，反之则会相对方便；默认设置为 2",
+  "auditLog": "活动日志",
+  "shareImage": "分享图片",
+  "shareImageFooter": "上 Solar Network 看更多有趣帖子",
+  "fileSavedAt": "文件保存于 @path",
+  "showIp": "显示 IP 地址",
+  "shotOn": "由 @device 拍摄",
+  "unread": "未读",
+  "searchTook": "耗时 @time",
+  "searchResult": "匹配到 @count 条结果"
 }

ios/Podfile.lock

@@ -38,45 +38,47 @@ PODS:
   - file_picker (0.0.1):
     - DKImagePickerController/PhotoGallery
     - Flutter
-  - Firebase/Analytics (11.0.0):
+  - file_saver (0.0.1):
+    - Flutter
+  - Firebase/Analytics (11.2.0):
     - Firebase/Core
-  - Firebase/Core (11.0.0):
+  - Firebase/Core (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseAnalytics (~> 11.0.0)
-  - Firebase/CoreOnly (11.0.0):
-    - FirebaseCore (= 11.0.0)
-  - Firebase/Crashlytics (11.0.0):
+    - FirebaseAnalytics (~> 11.2.0)
+  - Firebase/CoreOnly (11.2.0):
+    - FirebaseCore (= 11.2.0)
+  - Firebase/Crashlytics (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseCrashlytics (~> 11.0.0)
-  - Firebase/Messaging (11.0.0):
+    - FirebaseCrashlytics (~> 11.2.0)
+  - Firebase/Messaging (11.2.0):
     - Firebase/CoreOnly
-    - FirebaseMessaging (~> 11.0.0)
-  - Firebase/Performance (11.0.0):
+    - FirebaseMessaging (~> 11.2.0)
+  - Firebase/Performance (11.2.0):
     - Firebase/CoreOnly
-    - FirebasePerformance (~> 11.0.0)
-  - firebase_analytics (11.3.2):
-    - Firebase/Analytics (= 11.0.0)
+    - FirebasePerformance (~> 11.2.0)
+  - firebase_analytics (11.3.3):
+    - Firebase/Analytics (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_core (3.5.0):
-    - Firebase/CoreOnly (= 11.0.0)
+  - firebase_core (3.6.0):
+    - Firebase/CoreOnly (= 11.2.0)
     - Flutter
-  - firebase_crashlytics (4.1.2):
-    - Firebase/Crashlytics (= 11.0.0)
+  - firebase_crashlytics (4.1.3):
+    - Firebase/Crashlytics (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_messaging (15.1.2):
-    - Firebase/Messaging (= 11.0.0)
+  - firebase_messaging (15.1.3):
+    - Firebase/Messaging (= 11.2.0)
     - firebase_core
     - Flutter
-  - firebase_performance (0.10.0-7):
-    - Firebase/Performance (= 11.0.0)
+  - firebase_performance (0.10.0-8):
+    - Firebase/Performance (= 11.2.0)
     - firebase_core
     - Flutter
-  - FirebaseABTesting (11.2.0):
+  - FirebaseABTesting (11.3.0):
     - FirebaseCore (~> 11.0)
-  - FirebaseAnalytics (11.0.0):
-    - FirebaseAnalytics/AdIdSupport (= 11.0.0)
+  - FirebaseAnalytics (11.2.0):
+    - FirebaseAnalytics/AdIdSupport (= 11.2.0)
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
@@ -84,24 +86,24 @@ PODS:
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - FirebaseAnalytics/AdIdSupport (11.0.0):
+  - FirebaseAnalytics/AdIdSupport (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
-    - GoogleAppMeasurement (= 11.0.0)
+    - GoogleAppMeasurement (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - FirebaseCore (11.0.0):
+  - FirebaseCore (11.2.0):
     - FirebaseCoreInternal (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - GoogleUtilities/Logger (~> 8.0)
-  - FirebaseCoreExtension (11.2.0):
+  - FirebaseCoreExtension (11.3.0):
     - FirebaseCore (~> 11.0)
-  - FirebaseCoreInternal (11.2.0):
+  - FirebaseCoreInternal (11.3.0):
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseCrashlytics (11.0.0):
+  - FirebaseCrashlytics (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - FirebaseRemoteConfigInterop (~> 11.0)
@@ -110,12 +112,12 @@ PODS:
     - GoogleUtilities/Environment (~> 8.0)
     - nanopb (~> 3.30910.0)
     - PromisesObjC (~> 2.4)
-  - FirebaseInstallations (11.2.0):
+  - FirebaseInstallations (11.3.0):
     - FirebaseCore (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - PromisesObjC (~> 2.4)
-  - FirebaseMessaging (11.0.0):
+  - FirebaseMessaging (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - GoogleDataTransport (~> 10.0)
@@ -124,7 +126,7 @@ PODS:
     - GoogleUtilities/Reachability (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
-  - FirebasePerformance (11.0.0):
+  - FirebasePerformance (11.2.0):
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
     - FirebaseRemoteConfig (~> 11.0)
@@ -134,7 +136,7 @@ PODS:
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
-  - FirebaseRemoteConfig (11.2.0):
+  - FirebaseRemoteConfig (11.3.0):
     - FirebaseABTesting (~> 11.0)
     - FirebaseCore (~> 11.0)
     - FirebaseInstallations (~> 11.0)
@@ -142,8 +144,8 @@ PODS:
     - FirebaseSharedSwift (~> 11.0)
     - GoogleUtilities/Environment (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseRemoteConfigInterop (11.2.0)
-  - FirebaseSessions (11.2.0):
+  - FirebaseRemoteConfigInterop (11.3.0)
+  - FirebaseSessions (11.3.0):
     - FirebaseCore (~> 11.0)
     - FirebaseCoreExtension (~> 11.0)
     - FirebaseInstallations (~> 11.0)
@@ -152,7 +154,7 @@ PODS:
     - GoogleUtilities/UserDefaults (~> 8.0)
     - nanopb (~> 3.30910.0)
     - PromisesSwift (~> 2.1)
-  - FirebaseSharedSwift (11.2.0)
+  - FirebaseSharedSwift (11.3.0)
   - Flutter (1.0.0)
   - flutter_app_update (0.0.1):
     - Flutter
@@ -166,27 +168,30 @@ PODS:
     - Flutter
   - flutter_secure_storage (6.0.0):
     - Flutter
+  - flutter_udid (0.0.1):
+    - Flutter
+    - SAMKeychain
   - flutter_webrtc (0.11.3):
     - Flutter
     - WebRTC-SDK (= 125.6422.04)
   - gal (1.0.0):
     - Flutter
     - FlutterMacOS
-  - GoogleAppMeasurement (11.0.0):
-    - GoogleAppMeasurement/AdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement (11.2.0):
+    - GoogleAppMeasurement/AdIdSupport (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/AdIdSupport (11.0.0):
-    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement/AdIdSupport (11.2.0):
+    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.2.0)
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
     - "GoogleUtilities/NSData+zlib (~> 8.0)"
     - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/WithoutAdIdSupport (11.0.0):
+  - GoogleAppMeasurement/WithoutAdIdSupport (11.2.0):
     - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
     - GoogleUtilities/MethodSwizzler (~> 8.0)
     - GoogleUtilities/Network (~> 8.0)
@@ -259,6 +264,7 @@ PODS:
     - PromisesObjC (= 2.4.0)
   - protocol_handler_ios (0.0.1):
     - Flutter
+  - SAMKeychain (1.5.3)
   - screen_brightness_ios (0.1.0):
     - Flutter
   - SDWebImage (5.19.7):
@@ -269,7 +275,7 @@ PODS:
   - shared_preferences_foundation (0.0.1):
     - Flutter
     - FlutterMacOS
-  - sqflite (0.0.3):
+  - sqflite_darwin (0.0.4):
     - Flutter
     - FlutterMacOS
   - "sqlite3 (3.46.1+1)":
@@ -304,6 +310,7 @@ DEPENDENCIES:
   - connectivity_plus (from `.symlinks/plugins/connectivity_plus/darwin`)
   - device_info_plus (from `.symlinks/plugins/device_info_plus/ios`)
   - file_picker (from `.symlinks/plugins/file_picker/ios`)
+  - file_saver (from `.symlinks/plugins/file_saver/ios`)
   - firebase_analytics (from `.symlinks/plugins/firebase_analytics/ios`)
   - firebase_core (from `.symlinks/plugins/firebase_core/ios`)
   - firebase_crashlytics (from `.symlinks/plugins/firebase_crashlytics/ios`)
@@ -316,6 +323,7 @@ DEPENDENCIES:
   - flutter_local_notifications (from `.symlinks/plugins/flutter_local_notifications/ios`)
   - flutter_native_splash (from `.symlinks/plugins/flutter_native_splash/ios`)
   - flutter_secure_storage (from `.symlinks/plugins/flutter_secure_storage/ios`)
+  - flutter_udid (from `.symlinks/plugins/flutter_udid/ios`)
   - flutter_webrtc (from `.symlinks/plugins/flutter_webrtc/ios`)
   - gal (from `.symlinks/plugins/gal/darwin`)
   - image_cropper (from `.symlinks/plugins/image_cropper/ios`)
@@ -334,7 +342,7 @@ DEPENDENCIES:
   - screen_brightness_ios (from `.symlinks/plugins/screen_brightness_ios/ios`)
   - share_plus (from `.symlinks/plugins/share_plus/ios`)
   - shared_preferences_foundation (from `.symlinks/plugins/shared_preferences_foundation/darwin`)
-  - sqflite (from `.symlinks/plugins/sqflite/darwin`)
+  - sqflite_darwin (from `.symlinks/plugins/sqflite_darwin/darwin`)
   - sqlite3_flutter_libs (from `.symlinks/plugins/sqlite3_flutter_libs/ios`)
   - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
   - volume_controller (from `.symlinks/plugins/volume_controller/ios`)
@@ -364,6 +372,7 @@ SPEC REPOS:
     - nanopb
     - PromisesObjC
     - PromisesSwift
+    - SAMKeychain
     - SDWebImage
     - sqlite3
     - SwiftyGif
@@ -377,6 +386,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/device_info_plus/ios"
   file_picker:
     :path: ".symlinks/plugins/file_picker/ios"
+  file_saver:
+    :path: ".symlinks/plugins/file_saver/ios"
   firebase_analytics:
     :path: ".symlinks/plugins/firebase_analytics/ios"
   firebase_core:
@@ -401,6 +412,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/flutter_native_splash/ios"
   flutter_secure_storage:
     :path: ".symlinks/plugins/flutter_secure_storage/ios"
+  flutter_udid:
+    :path: ".symlinks/plugins/flutter_udid/ios"
   flutter_webrtc:
     :path: ".symlinks/plugins/flutter_webrtc/ios"
   gal:
@@ -437,8 +450,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/share_plus/ios"
   shared_preferences_foundation:
     :path: ".symlinks/plugins/shared_preferences_foundation/darwin"
-  sqflite:
-    :path: ".symlinks/plugins/sqflite/darwin"
+  sqflite_darwin:
+    :path: ".symlinks/plugins/sqflite_darwin/darwin"
   sqlite3_flutter_libs:
     :path: ".symlinks/plugins/sqlite3_flutter_libs/ios"
   url_launcher_ios:
@@ -454,25 +467,26 @@ SPEC CHECKSUMS:
   DKImagePickerController: 946cec48c7873164274ecc4624d19e3da4c1ef3c
   DKPhotoGallery: b3834fecb755ee09a593d7c9e389d8b5d6deed60
   file_picker: 09aa5ec1ab24135ccd7a1621c46c84134bfd6655
-  Firebase: 9f574c08c2396885b5e7e100ed4293d956218af9
-  firebase_analytics: 4fd10182fd08bb8358f26ac8aca8dad7b6d0f592
-  firebase_core: 2ec6b789859c7c24766344ec71fdf78639402d56
-  firebase_crashlytics: 60630a0f91ee432275fa1660fd8593079761448a
-  firebase_messaging: a18e1e02b2e8e69097c8173e0c851be223b21c50
-  firebase_performance: 12d45fdf120992fa879d990929bf73d4a5ced053
-  FirebaseABTesting: 2104d957ce33888a3d6f3bde298cdee376dde8f1
-  FirebaseAnalytics: 27eb78b97880ea4a004839b9bac0b58880f5a92a
-  FirebaseCore: 3cf438f431f18c12cdf2aaf64434648b63f7e383
-  FirebaseCoreExtension: cda74ddfb001224bd8fd1d6e74698b4ed07803de
-  FirebaseCoreInternal: 0c569513412da9f3b31bd0b340013bbee8f295c5
-  FirebaseCrashlytics: 745d8f0221fe49c62865391d1bf56f5a12eeec0b
-  FirebaseInstallations: 771177d89d6c451dc6e50085ec82e2fc77ed0a4a
-  FirebaseMessaging: d2d1d9c62c46dd2db49a952f7deb5b16ad2c9742
-  FirebasePerformance: efdc02bacb1b4710588c9f867011605c081cdf79
-  FirebaseRemoteConfig: fca0b2d017fc1de52b28a4e5bcf2007c1a840457
-  FirebaseRemoteConfigInterop: 477b26fdeb8fb5fbaf22fa9db5343b42289dc7db
-  FirebaseSessions: adcec8b72d0066a385e3affcd1bcb1ebb3908ce6
-  FirebaseSharedSwift: 7a0d78d155ede78407f0fdc89fbc914014c7c540
+  file_saver: 503e386464dbe118f630e17b4c2e1190fa0cf808
+  Firebase: 98e6bf5278170668a7983e12971a66b2cd57fc8c
+  firebase_analytics: fbc57838bdb94eef1e0ff504f127d974ff2981ad
+  firebase_core: 2bedc3136ec7c7b8561c6123ed0239387b53f2af
+  firebase_crashlytics: 37d104d457b51760b48504a93a12b3bf70995d77
+  firebase_messaging: 15d114e1a41fc31e4fbabcd48d765a19eec94a38
+  firebase_performance: 26ad47755d3e8d7b04b9bb36bdfbf1cec8d8dfcc
+  FirebaseABTesting: c4559fcd2eba9f6bdaf0599e2c37ded01c343e4c
+  FirebaseAnalytics: c36efd5710c60c17558650fa58c2066eca7e9265
+  FirebaseCore: a282032ae9295c795714ded2ec9c522fc237f8da
+  FirebaseCoreExtension: 30bb063476ef66cd46925243d64ad8b2c8ac3264
+  FirebaseCoreInternal: ac26d09a70c730e497936430af4e60fb0c68ec4e
+  FirebaseCrashlytics: cfc69af5b53565dc6a5e563788809b5778ac4eac
+  FirebaseInstallations: 58cf94dabf1e2bb2fa87725a9be5c2249171cda0
+  FirebaseMessaging: c9ec7b90c399c7a6100297e9d16f8a27fc7f7152
+  FirebasePerformance: c39138c0700b8ef6040f0b80b5707320808e2862
+  FirebaseRemoteConfig: 5be2ca4f9870d475b39214210955fdaeecf7e5ca
+  FirebaseRemoteConfigInterop: c3a5c31b3c22079f41ba1dc645df889d9ce38cb9
+  FirebaseSessions: 655ff17f3cc1a635cbdc2d69b953878001f9e25b
+  FirebaseSharedSwift: d39c2ad64a11a8d936ce25a42b00df47078bb59c
   Flutter: e0871f40cf51350855a761d2e70bf5af5b9b5de7
   flutter_app_update: 65f61da626cb111d1b24674abc4b01728d7723bc
   flutter_background_service_ios: e30e0d3ee69e4cee66272d0c78eacd48c2e94aac
@@ -480,9 +494,10 @@ SPEC CHECKSUMS:
   flutter_local_notifications: 4cde75091f6327eb8517fa068a0a5950212d2086
   flutter_native_splash: edf599c81f74d093a4daf8e17bd7a018854bc778
   flutter_secure_storage: d33dac7ae2ea08509be337e775f6b59f1ff45f12
+  flutter_udid: a2482c67a61b9c806ef59dd82ed8d007f1b7ac04
   flutter_webrtc: 75b868e4f9e817c7a9a42ca4b6169063de4eec9f
   gal: 61e868295d28fe67ffa297fae6dacebf56fd53e1
-  GoogleAppMeasurement: 6e49ffac7d3f2c3ded9cc663f912a13b67bbd0de
+  GoogleAppMeasurement: 76d4f8b36b03bd8381fa9a7fe2cc7f99c0a2e93a
   GoogleDataTransport: aae35b7ea0c09004c3797d53c8c41f66f219d6a7
   GoogleUtilities: 26a3abef001b6533cf678d3eb38fd3f614b7872d
   image_cropper: 37d40f62177c101ff4c164906d259ea2c3aa70cf
@@ -501,11 +516,12 @@ SPEC CHECKSUMS:
   PromisesObjC: f5707f49cb48b9636751c5b2e7d227e43fba9f47
   PromisesSwift: 9d77319bbe72ebf6d872900551f7eeba9bce2851
   protocol_handler_ios: a5db8abc38526ee326988b808be621e5fd568990
+  SAMKeychain: 483e1c9f32984d50ca961e26818a534283b4cd5c
   screen_brightness_ios: 715ca807df953bf676d339f11464e438143ee625
   SDWebImage: 8a6b7b160b4d710e2a22b6900e25301075c34cb3
   share_plus: 8875f4f2500512ea181eef553c3e27dba5135aad
   shared_preferences_foundation: fcdcbc04712aee1108ac7fda236f363274528f78
-  sqflite: 673a0e54cc04b7d6dba8d24fb8095b31c3a99eec
+  sqflite_darwin: a553b1fd6fe66f53bbb0fe5b4f5bab93f08d7a13
   sqlite3: 0bb0e6389d824e40296f531b858a2a0b71c0d2fb
   sqlite3_flutter_libs: c00457ebd31e59fa6bb830380ddba24d44fbcd3b
   SwiftyGif: 706c60cf65fa2bc5ee0313beece843c8eb8194d4

ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme

@@ -59,6 +59,7 @@
       ignoresPersistentStateOnLaunch = "NO"
       debugDocumentVersioning = "YES"
       debugServiceExtension = "internal"
+      showGraphicsOverview = "Yes"
       allowLocationSimulation = "YES">
       <BuildableProductRunnable
          runnableDebuggingMode = "0">

ios/Runner/Info.plist

@@ -83,7 +83,6 @@
 	</array>
 	<key>CFBundleLocalizations</key>
 	<array>
-		<string>zh_CN</string>
 		<string>en</string>
 	</array>
 	<key>UIStatusBarHidden</key>

lib/bootstrapper.dart

@@ -12,12 +12,13 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/channel.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:flutter_app_update/flutter_app_update.dart';
 import 'package:version/version.dart';
@@ -199,7 +200,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
         try {
           await Future.wait([
             if (auth.isAuthorized.isTrue)
-              Get.find<ChannelProvider>().refreshAvailableChannel(),
+              Get.find<NotificationProvider>().fetchNotification(),
             if (auth.isAuthorized.isTrue)
               Get.find<RelationshipProvider>().refreshRelativeList(),
             if (auth.isAuthorized.isTrue)
@@ -216,7 +217,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
         final AuthProvider auth = Get.find();
         if (auth.isAuthorized.isTrue) {
           try {
-            Get.find<WebSocketProvider>().registerPushNotifications();
+            Get.find<NotificationProvider>().registerPushNotifications();
           } catch (err) {
             context.showSnackbar(
               'pushNotifyRegisterFailed'.trParams({'reason': err.toString()}),
@@ -258,8 +259,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
   Widget build(BuildContext context) {
     if (_isBusy || _isErrored) {
       return GestureDetector(
-        child: Material(
-          color: Theme.of(context).colorScheme.surface,
+        child: RootContainer(
           child: Column(
             mainAxisSize: MainAxisSize.max,
             mainAxisAlignment: MainAxisAlignment.spaceAround,

lib/controllers/post_editor_controller.dart

@@ -43,14 +43,17 @@ class PostEditorController extends GetxController {
 
   RxBool isRestoreFromLocal = false.obs;
   Rx<DateTime?> lastSaveTime = Rx(null);
-  Timer? _saveTimer;
+  Future? _saveFuture;
 
   PostEditorController() {
     SharedPreferences.getInstance().then((inst) {
       _prefs = inst;
-      _saveTimer = Timer.periodic(
-        const Duration(seconds: 3),
-        (Timer t) {
+    });
+    contentController.addListener(() {
+      contentLength.value = contentController.text.length;
+      _saveFuture ??= Future.delayed(
+        const Duration(seconds: 1),
+        () {
           if (isNotEmpty) {
             localSave();
             lastSaveTime.value = DateTime.now();
@@ -59,12 +62,10 @@ class PostEditorController extends GetxController {
             localClear();
             lastSaveTime.value = null;
           }
+          _saveFuture = null;
         },
       );
     });
-    contentController.addListener(() {
-      contentLength.value = contentController.text.length;
-    });
   }
 
   Future<void> editOverview(BuildContext context) {
@@ -355,8 +356,6 @@ class PostEditorController extends GetxController {
 
   @override
   void dispose() {
-    _saveTimer?.cancel();
-
     titleController.dispose();
     descriptionController.dispose();
     contentController.dispose();

lib/controllers/post_list_controller.dart

@@ -1,9 +1,12 @@
+import 'dart:async';
 import 'dart:math';
 
 import 'package:get/get.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';
 
@@ -31,9 +34,18 @@ class PostListController extends GetxController {
     pagingController.addPageRequestListener(_onPagingControllerRequest);
   }
 
+  Completer<void>? _pagingLoadCompleter;
+
   Future<void> _onPagingControllerRequest(int pageKey) async {
     try {
+      if (_pagingLoadCompleter != null) {
+        await _pagingLoadCompleter!.future;
+        return;
+      }
+      _pagingLoadCompleter = Completer();
       final result = await loadMore();
+      _pagingLoadCompleter!.complete();
+      _pagingLoadCompleter = null;
 
       if (result != null && hasMore.value) {
         pagingController.appendPage(result, nextPageKey.value);
@@ -97,9 +109,6 @@ class PostListController extends GetxController {
       hasMore.value = false;
     }
 
-    final idx = <dynamic>{};
-    postList.retainWhere((x) => idx.add(x.id));
-
     if (postList.isNotEmpty) {
       var lastId = postList.map((x) => x.id).reduce(max);
       Get.find<LastReadProvider>().feedLastReadAt = lastId;
@@ -111,35 +120,39 @@ class PostListController extends GetxController {
   Future<List<Post>?> _loadPosts(int pageKey) async {
     isBusy.value = true;
 
-    final PostProvider provider = Get.find();
+    final PostProvider posts = Get.find();
 
     Response resp;
     try {
       if (author != null) {
-        resp = await provider.listPost(
+        resp = await posts.listPost(
           pageKey,
           author: author,
+          take: 10,
         );
       } else {
         switch (mode.value) {
           case 2:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               channel: 'shuffle',
               realm: realm,
+              take: 10,
             );
             break;
           case 1:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               channel: 'friends',
               realm: realm,
+              take: 10,
             );
             break;
           default:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
               pageKey,
               realm: realm,
+              take: 10,
             );
             break;
         }
@@ -153,6 +166,27 @@ class PostListController extends GetxController {
     final result = PaginationResult.fromJson(resp.body);
     final out = result.data?.map((e) => Post.fromJson(e)).toList();
 
+    final AttachmentProvider attach = Get.find();
+
+    if (out != null) {
+      final attachmentIds = out
+          .mapMany((x) => x.body['attachments'] ?? [])
+          .cast<String>()
+          .toSet()
+          .toList();
+      final attachmentOut = await attach.listMetadata(attachmentIds);
+
+      for (var idx = 0; idx < out.length; idx++) {
+        final rids = List<String>.from(out[idx].body['attachments'] ?? []);
+        out[idx].preload = PostPreload(
+          attachments: attachmentOut
+              .where((x) => x != null && rids.contains(x.rid))
+              .cast<Attachment>()
+              .toList(),
+        );
+      }
+    }
+
     postTotal.value = result.count;
 
     return out;

lib/main.dart

@@ -18,6 +18,7 @@ import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/providers/navigation.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/stickers.dart';
 import 'package:solian/providers/subscription.dart';
 import 'package:solian/providers/theme_switcher.dart';
@@ -57,6 +58,8 @@ void main() async {
 
 Future<void> _initializeFirebase() async {
   await Firebase.initializeApp(options: DefaultFirebaseOptions.currentPlatform);
+  if (PlatformInfo.isIOS || PlatformInfo.isAndroid || PlatformInfo.isMacOS) {
+    // Initialize firebase crashlytics for the platform that supported
     FlutterError.onError = (errorDetails) {
       FirebaseCrashlytics.instance.recordFlutterFatalError(errorDetails);
     };
@@ -64,6 +67,7 @@ Future<void> _initializeFirebase() async {
       FirebaseCrashlytics.instance.recordError(error, stack, fatal: true);
       return true;
     };
+  }
 }
 
 Future<void> _initializeBackgroundNotificationService() async {
@@ -135,11 +139,12 @@ class SolianApp extends StatelessWidget {
     Get.put(NavigationStateProvider());
 
     Get.lazyPut(() => AuthProvider());
+    Get.lazyPut(() => WebSocketProvider());
     Get.lazyPut(() => RelationshipProvider());
     Get.lazyPut(() => PostProvider());
     Get.lazyPut(() => StickerProvider());
     Get.lazyPut(() => AttachmentProvider());
-    Get.lazyPut(() => WebSocketProvider());
+    Get.lazyPut(() => NotificationProvider());
     Get.lazyPut(() => StatusProvider());
     Get.lazyPut(() => ChannelProvider());
     Get.lazyPut(() => RealmProvider());
@@ -151,6 +156,6 @@ class SolianApp extends StatelessWidget {
     Get.lazyPut(() => LastReadProvider());
     Get.lazyPut(() => SubscriptionProvider());
 
-    Get.find<WebSocketProvider>().requestPermissions();
+    Get.find<NotificationProvider>().requestPermissions();
   }
 }

lib/models/audit_log.dart

@@ -0,0 +1,38 @@
+import 'package:json_annotation/json_annotation.dart';
+import 'package:solian/models/account.dart';
+
+part 'audit_log.g.dart';
+
+@JsonSerializable()
+class AuditEvent {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String type;
+  String target;
+  String location;
+  String ipAddress;
+  String userAgent;
+  Account account;
+  int accountId;
+
+  AuditEvent({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    required this.deletedAt,
+    required this.type,
+    required this.target,
+    required this.location,
+    required this.ipAddress,
+    required this.userAgent,
+    required this.account,
+    required this.accountId,
+  });
+
+  static AuditEvent fromJson(Map<String, dynamic> json) =>
+      _$AuditEventFromJson(json);
+
+  Map<String, dynamic> toJson() => _$AuditEventToJson(this);
+}

lib/models/audit_log.g.dart

@@ -0,0 +1,38 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'audit_log.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+AuditEvent _$AuditEventFromJson(Map<String, dynamic> json) => AuditEvent(
+      id: (json['id'] as num).toInt(),
+      createdAt: DateTime.parse(json['created_at'] as String),
+      updatedAt: DateTime.parse(json['updated_at'] as String),
+      deletedAt: json['deleted_at'] == null
+          ? null
+          : DateTime.parse(json['deleted_at'] as String),
+      type: json['type'] as String,
+      target: json['target'] as String,
+      location: json['location'] as String,
+      ipAddress: json['ip_address'] as String,
+      userAgent: json['user_agent'] as String,
+      account: Account.fromJson(json['account'] as Map<String, dynamic>),
+      accountId: (json['account_id'] as num).toInt(),
+    );
+
+Map<String, dynamic> _$AuditEventToJson(AuditEvent instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'created_at': instance.createdAt.toIso8601String(),
+      'updated_at': instance.updatedAt.toIso8601String(),
+      'deleted_at': instance.deletedAt?.toIso8601String(),
+      'type': instance.type,
+      'target': instance.target,
+      'location': instance.location,
+      'ip_address': instance.ipAddress,
+      'user_agent': instance.userAgent,
+      'account': instance.account.toJson(),
+      'account_id': instance.accountId,
+    };

lib/models/notification.dart

@@ -1,18 +1,29 @@
+import 'package:flutter/material.dart';
 import 'package:json_annotation/json_annotation.dart';
 
 part 'notification.g.dart';
 
+const Map<String, IconData> NotificationTopicIcons = {
+  'passport.security.alert': Icons.gpp_maybe,
+  'interactive.subscription': Icons.subscriptions,
+  'interactive.feedback': Icons.add_reaction,
+  'messaging.callStart': Icons.call_received,
+};
+
 @JsonSerializable()
 class Notification {
   int id;
   DateTime createdAt;
   DateTime updatedAt;
   DateTime? deletedAt;
+  DateTime? readAt;
+  String topic;
   String title;
   String? subtitle;
   String body;
   String? avatar;
   String? picture;
+  Map<String, dynamic>? metadata;
   int? senderId;
   int accountId;
 
@@ -21,11 +32,14 @@ class Notification {
     required this.createdAt,
     required this.updatedAt,
     required this.deletedAt,
+    required this.readAt,
+    required this.topic,
     required this.title,
     required this.subtitle,
     required this.body,
     required this.avatar,
     required this.picture,
+    required this.metadata,
     required this.senderId,
     required this.accountId,
   });

lib/models/notification.g.dart

@@ -13,11 +13,16 @@ Notification _$NotificationFromJson(Map<String, dynamic> json) => Notification(
       deletedAt: json['deleted_at'] == null
           ? null
           : DateTime.parse(json['deleted_at'] as String),
+      readAt: json['read_at'] == null
+          ? null
+          : DateTime.parse(json['read_at'] as String),
+      topic: json['topic'] as String,
       title: json['title'] as String,
       subtitle: json['subtitle'] as String?,
       body: json['body'] as String,
       avatar: json['avatar'] as String?,
       picture: json['picture'] as String?,
+      metadata: json['metadata'] as Map<String, dynamic>?,
       senderId: (json['sender_id'] as num?)?.toInt(),
       accountId: (json['account_id'] as num).toInt(),
     );
@@ -28,11 +33,14 @@ Map<String, dynamic> _$NotificationToJson(Notification instance) =>
       'created_at': instance.createdAt.toIso8601String(),
       'updated_at': instance.updatedAt.toIso8601String(),
       'deleted_at': instance.deletedAt?.toIso8601String(),
+      'read_at': instance.readAt?.toIso8601String(),
+      'topic': instance.topic,
       'title': instance.title,
       'subtitle': instance.subtitle,
       'body': instance.body,
       'avatar': instance.avatar,
       'picture': instance.picture,
+      'metadata': instance.metadata,
       'sender_id': instance.senderId,
       'account_id': instance.accountId,
     };

lib/models/post.dart

@@ -1,10 +1,19 @@
 import 'package:json_annotation/json_annotation.dart';
 import 'package:solian/models/account.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/post_categories.dart';
 import 'package:solian/models/realm.dart';
 
 part 'post.g.dart';
 
+class PostPreload {
+  List<Attachment> attachments;
+
+  PostPreload({
+    required this.attachments,
+  });
+}
+
 @JsonSerializable()
 class Post {
   int id;
@@ -15,6 +24,7 @@ class Post {
   String? alias;
   String? areaAlias;
   dynamic body;
+  int visibility;
   List<Tag>? tags;
   List<Category>? categories;
   List<Post>? replies;
@@ -33,6 +43,9 @@ class Post {
   Account author;
   PostMetric? metric;
 
+  @JsonKey(includeFromJson: false, includeToJson: false)
+  PostPreload? preload;
+
   Post({
     required this.id,
     required this.createdAt,
@@ -43,6 +56,7 @@ class Post {
     required this.areaAlias,
     required this.type,
     required this.body,
+    required this.visibility,
     required this.tags,
     required this.categories,
     required this.replies,

lib/models/post.g.dart

@@ -20,6 +20,7 @@ Post _$PostFromJson(Map<String, dynamic> json) => Post(
       areaAlias: json['area_alias'] as String?,
       type: json['type'] as String,
       body: json['body'],
+      visibility: (json['visibility'] as num).toInt(),
       tags: (json['tags'] as List<dynamic>?)
           ?.map((e) => Tag.fromJson(e as Map<String, dynamic>))
           .toList(),
@@ -67,6 +68,7 @@ Map<String, dynamic> _$PostToJson(Post instance) => <String, dynamic>{
       'alias': instance.alias,
       'area_alias': instance.areaAlias,
       'body': instance.body,
+      'visibility': instance.visibility,
       'tags': instance.tags?.map((e) => e.toJson()).toList(),
       'categories': instance.categories?.map((e) => e.toJson()).toList(),
       'replies': instance.replies?.map((e) => e.toJson()).toList(),

lib/models/theme.dart

@@ -0,0 +1,50 @@
+import 'dart:ui';
+
+import 'package:json_annotation/json_annotation.dart';
+
+part 'theme.g.dart';
+
+@JsonSerializable(converters: [ColorConverter()])
+class SolianThemeData {
+  String id;
+  Color seedColor;
+  String? fontFamily;
+  List<String>? fontFamilyFallback;
+
+  SolianThemeData({
+    required this.id,
+    required this.seedColor,
+    this.fontFamily,
+    this.fontFamilyFallback,
+  });
+
+  factory SolianThemeData.fromJson(Map<String, dynamic> json) =>
+      _$SolianThemeDataFromJson(json);
+
+  Map<String, dynamic> toJson() => _$SolianThemeDataToJson(this);
+
+  @override
+  int get hashCode => id.hashCode;
+
+  @override
+  bool operator ==(Object other) {
+    if (other is SolianThemeData) {
+      return id == other.id;
+    }
+    return false;
+  }
+}
+
+class ColorConverter extends JsonConverter<Color, int> {
+  const ColorConverter();
+
+  @override
+  Color fromJson(int json) {
+    return Color(json);
+  }
+
+  @override
+  int toJson(Color object) {
+    return object.value;
+  }
+}

lib/models/theme.g.dart

@@ -0,0 +1,26 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'theme.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+SolianThemeData _$SolianThemeDataFromJson(Map<String, dynamic> json) =>
+    SolianThemeData(
+      id: json['id'] as String,
+      seedColor:
+          const ColorConverter().fromJson((json['seed_color'] as num).toInt()),
+      fontFamily: json['font_family'] as String?,
+      fontFamilyFallback: (json['font_family_fallback'] as List<dynamic>?)
+          ?.map((e) => e as String)
+          .toList(),
+    );
+
+Map<String, dynamic> _$SolianThemeDataToJson(SolianThemeData instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'seed_color': const ColorConverter().toJson(instance.seedColor),
+      'font_family': instance.fontFamily,
+      'font_family_fallback': instance.fontFamilyFallback,
+    };

lib/platform.dart

@@ -29,6 +29,8 @@ abstract class PlatformInfo {
 
   static bool get canRateTheApp => isIOS || isMacOS;
 
+  static bool get canCropImage => isIOS || isAndroid || isWeb;
+
   static bool get canRecord => (isMobile || isMacOS);
 
   static bool get canPushNotification => isAndroid || isIOS || isMacOS;

lib/providers/auth.dart

@@ -11,6 +11,7 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/database/database.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
 
@@ -125,7 +126,7 @@ class AuthProvider extends GetConnect {
       userAgent: await ServiceFinder.getUserAgent(),
       sendUserAgent: true,
     );
-    client.httpClient.addAuthenticator(requestAuthenticator);
+    client.httpClient.addRequestModifier(requestAuthenticator);
     client.httpClient.baseUrl = ServiceFinder.buildUrl(service, null);
 
     return client;
@@ -174,7 +175,7 @@ class AuthProvider extends GetConnect {
     );
 
     Get.find<WebSocketProvider>().connect();
-    Get.find<WebSocketProvider>().notifyPrefetch();
+    Get.find<NotificationProvider>().fetchNotification();
 
     return credentials!;
   }
@@ -184,8 +185,8 @@ class AuthProvider extends GetConnect {
     userProfile.value = null;
 
     Get.find<WebSocketProvider>().disconnect();
-    Get.find<WebSocketProvider>().notifications.clear();
-    Get.find<WebSocketProvider>().notificationUnread.value = 0;
+    Get.find<NotificationProvider>().notifications.clear();
+    Get.find<NotificationProvider>().notificationUnread.value = 0;
 
     AppDatabase.removeDatabase();
     autoStopBackgroundNotificationService();

lib/providers/call.dart

@@ -392,7 +392,7 @@ class ChatCallProvider extends GetxController {
   }
 
   Future gotoScreen(BuildContext context) {
-    return Navigator.of(context, rootNavigator: true).push(
+    return Navigator.of(context).push(
       MaterialPageRoute(builder: (context) => const CallScreen()),
     );
   }

lib/providers/content/attachment.dart

@@ -23,6 +23,21 @@ class AttachmentProvider extends GetConnect {
 
   final Map<String, Attachment> _cachedResponses = {};
 
+  List<Attachment?> listMetadataFromCache(List<String> rid) {
+    if (rid.isEmpty) return List.empty();
+
+    List<Attachment?> result = List.filled(rid.length, null);
+    for (var idx = 0; idx < rid.length; idx++) {
+      if (_cachedResponses.containsKey(rid[idx])) {
+        result[idx] = _cachedResponses[rid[idx]];
+      } else {
+        result[idx] = null;
+      }
+    }
+
+    return result;
+  }
+
   Future<List<Attachment?>> listMetadata(
     List<String> rid, {
     noCache = false,
@@ -41,6 +56,7 @@ class AttachmentProvider extends GetConnect {
       }
     }
 
+    if (pendingQuery.isNotEmpty) {
       final resp = await get(
         '/attachments?take=${pendingQuery.length}&id=${pendingQuery.join(',')}',
       );
@@ -63,6 +79,7 @@ class AttachmentProvider extends GetConnect {
           }
         }
       }
+    }
 
     return result;
   }

lib/providers/content/channel.dart

@@ -9,25 +9,6 @@ import 'package:uuid/uuid.dart';
 
 class ChannelProvider extends GetxController {
   RxBool isLoading = false.obs;
-  RxList<Channel> availableChannels = RxList.empty(growable: true);
-
-  List<Channel> get groupChannels =>
-      availableChannels.where((x) => x.type == 0).toList();
-  List<Channel> get directChannels =>
-      availableChannels.where((x) => x.type == 1).toList();
-
-  Future<void> refreshAvailableChannel() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) throw const UnauthorizedException();
-
-    isLoading.value = true;
-    final resp = await listAvailableChannel();
-    isLoading.value = false;
-
-    availableChannels.value =
-        resp.body.map((x) => Channel.fromJson(x)).toList().cast<Channel>();
-    availableChannels.refresh();
-  }
 
   Future<Response> getChannel(String alias, {String realm = 'global'}) async {
     final AuthProvider auth = Get.find();
@@ -89,18 +70,22 @@ class ChannelProvider extends GetxController {
     return resp;
   }
 
-  Future<Response> listAvailableChannel({String scope = 'global'}) async {
+  Future<List<Channel>> listAvailableChannel({
+    String scope = 'global',
+    bool isDirect = false,
+  }) async {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) throw const UnauthorizedException();
 
     final client = await auth.configureClient('messaging');
 
-    final resp = await client.get('/channels/$scope/me/available');
+    final resp =
+        await client.get('/channels/$scope/me/available?direct=$isDirect');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
 
-    return resp;
+    return List.from(resp.body.map((x) => Channel.fromJson(x)));
   }
 
   Future<Response> createChannel(String scope, dynamic payload) async {

lib/providers/content/posts.dart

@@ -3,22 +3,11 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/services.dart';
-
-class PostProvider extends GetConnect {
-  @override
-  void onInit() {
-    httpClient.baseUrl = ServiceFinder.buildUrl('interactive', null);
-  }
 
+class PostProvider extends GetxController {
   Future<Response> seeWhatsNew(int pivot) async {
-    GetConnect client;
     final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final client = await auth.configureClient('co');
     final resp = await client.get('/whats-new?pivot=$pivot');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
@@ -28,19 +17,14 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> listRecommendations(int page,
-      {String? realm, String? channel}) async {
-    GetConnect client;
-    final AuthProvider auth = Get.find();
+      {String? realm, String? channel, int take = 10}) async {
     final queries = [
-      'take=${10}',
+      'take=$take',
       'offset=$page',
       if (realm != null) 'realm=$realm',
     ];
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('interactive');
     final resp = await client.get(
       channel == null
           ? '/recommendations?${queries.join('&')}'
@@ -70,17 +54,40 @@ class PostProvider extends GetConnect {
     return resp;
   }
 
-  Future<Response> listPost(int page,
-      {String? realm, String? author, tag, category}) async {
+  Future<Response> searchPost(String probe, int page,
+      {String? realm, String? author, tag, category, int take = 10}) async {
     final queries = [
-      'take=${10}',
+      'probe=$probe',
+      'take=$take',
       'offset=$page',
       if (tag != null) 'tag=$tag',
       if (category != null) 'category=$category',
       if (author != null) 'author=$author',
       if (realm != null) 'realm=$realm',
     ];
-    final resp = await get('/posts?${queries.join('&')}');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/search?${queries.join('&')}');
+    if (resp.statusCode != 200) {
+      throw RequestException(resp);
+    }
+
+    return resp;
+  }
+
+  Future<Response> listPost(int page,
+      {String? realm, String? author, tag, category, int take = 10}) async {
+    final queries = [
+      'take=$take',
+      'offset=$page',
+      if (tag != null) 'tag=$tag',
+      if (category != null) 'category=$category',
+      if (author != null) 'author=$author',
+      if (realm != null) 'realm=$realm',
+    ];
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts?${queries.join('&')}');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -89,7 +96,10 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> listPostReplies(String alias, int page) async {
-    final resp = await get('/posts/$alias/replies?take=${10}&offset=$page');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp =
+        await client.get('/posts/$alias/replies?take=${10}&offset=$page');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -98,7 +108,9 @@ class PostProvider extends GetConnect {
   }
 
   Future<List<Post>> listPostFeaturedReply(String alias, {int take = 1}) async {
-    final resp = await get('/posts/$alias/replies/featured?take=$take');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias/replies/featured?take=$take');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }
@@ -107,16 +119,9 @@ class PostProvider extends GetConnect {
   }
 
   Future<Response> getPost(String alias) async {
-    final resp = await get('/posts/$alias');
-    if (resp.statusCode != 200) {
-      throw RequestException(resp);
-    }
-
-    return resp;
-  }
-
-  Future<Response> getArticle(String alias) async {
-    final resp = await get('/articles/$alias');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias');
     if (resp.statusCode != 200) {
       throw RequestException(resp);
     }

lib/providers/database/services/messages.dart

@@ -1,3 +1,6 @@
+import 'dart:convert';
+
+import 'package:collection/collection.dart';
 import 'package:drift/drift.dart';
 import 'package:get/get.dart' hide Value;
 import 'package:solian/exceptions/request.dart';
@@ -182,4 +185,26 @@ class MessagesFetchingProvider extends GetxController {
           ..orderBy([(t) => OrderingTerm.desc(t.id)]))
         .getSingleOrNull();
   }
+
+  Future<Map<int, List<LocalMessageEventTableData>>>
+      getLastInAllChannels() async {
+    final database = Get.find<DatabaseProvider>().database;
+    final rows = await database.customSelect('''
+    SELECT id, channel_id, data, created_at
+    FROM ${database.localMessageEventTable.actualTableName}
+    WHERE (channel_id, created_at) IN (
+      SELECT channel_id, MAX(created_at)
+      FROM ${database.localMessageEventTable.actualTableName}
+      GROUP BY channel_id
+    )
+    ''', readsFrom: {database.localMessageEventTable}).get();
+    return rows.map((row) {
+      return LocalMessageEventTableData(
+        id: row.read<int>('id'),
+        channelId: row.read<int>('channel_id'),
+        data: Event.fromJson(jsonDecode(row.read<String>('data'))),
+        createdAt: row.read<DateTime>('created_at'),
+      );
+    }).groupListsBy((x) => x.channelId);
+  }
 }

lib/providers/experience.dart

@@ -4,19 +4,19 @@ import 'package:intl/intl.dart';
 class ExperienceProvider extends GetxController {
   static List<int> experienceToLevelRequirements = [
     0, // Level 0
-    100, // Level 1
-    400, // Level 2
-    900, // Level 3
-    1600, // Level 4
-    2500, // Level 5
-    3600, // Level 6
-    4900, // Level 7
-    6400, // Level 8
-    8100, // Level 9
-    10000, // Level 10
-    12100, // Level 11
-    14400, // Level 12
-    36800 // Level 13
+    1000, // Level 1
+    4000, // Level 2
+    9000, // Level 3
+    16000, // Level 4
+    25000, // Level 5
+    36000, // Level 6
+    49000, // Level 7
+    64000, // Level 8
+    81000, // Level 9
+    100000, // Level 10
+    121000, // Level 11
+    144000, // Level 12
+    368000 // Level 13
   ];
 
   static List<String> levelLabelMapping =
@@ -35,7 +35,7 @@ class ExperienceProvider extends GetxController {
     final idx = experienceToLevelRequirements.indexOf(exp);
     if (idx + 1 >= experienceToLevelRequirements.length) return 1;
     final nextExp = experienceToLevelRequirements[idx + 1];
-    return exp / nextExp;
+    return (experience - exp).abs() / (exp - nextExp).abs();
   }
 
   static String calcLevelUpProgressLevel(int experience) {
@@ -43,9 +43,9 @@ class ExperienceProvider extends GetxController {
         .firstWhere((x) => x <= experience);
     final idx = experienceToLevelRequirements.indexOf(exp);
     if (idx + 1 >= experienceToLevelRequirements.length) return 'Infinity';
-    final nextExp = experienceToLevelRequirements[idx + 1];
+    final nextExp = exp - experienceToLevelRequirements[idx + 1];
     final formatter =
         NumberFormat.compactCurrency(symbol: '', decimalDigits: 1);
-    return '${formatter.format(exp)}/${formatter.format(nextExp)}';
+    return '${formatter.format((exp - experience).abs())}/${formatter.format(nextExp.abs())}';
   }
 }

lib/providers/notifications.dart

@@ -0,0 +1,175 @@
+import 'dart:developer';
+
+import 'package:firebase_messaging/firebase_messaging.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+import 'package:flutter_udid/flutter_udid.dart';
+import 'package:get/get.dart';
+import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/platform.dart';
+import 'package:solian/providers/auth.dart';
+
+class NotificationProvider extends GetxController {
+  RxBool isBusy = false.obs;
+
+  RxInt notificationUnread = 0.obs;
+  RxList<Notification> notifications =
+      List<Notification>.empty(growable: true).obs;
+
+  Future<void> fetchNotification() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.get('/notifications?skip=0&take=100');
+    if (resp.statusCode == 200) {
+      final result = PaginationResult.fromJson(resp.body);
+      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
+      if (data != null) {
+        notifications.addAll(data);
+        notificationUnread.value = data.where((x) => x.readAt == null).length;
+      }
+    }
+  }
+
+  Future<void> markAllRead() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    isBusy.value = true;
+
+    final NotificationProvider nty = Get.find();
+
+    List<int> markList = List.empty(growable: true);
+    for (final element in nty.notifications) {
+      if (element.id <= 0) continue;
+      if (element.readAt != null) continue;
+      markList.add(element.id);
+    }
+
+    if (markList.isNotEmpty) {
+      final client = await auth.configureClient('auth');
+      await client.put('/notifications/read', {'messages': markList});
+    }
+
+    nty.notifications.value = nty.notifications.map((x) {
+      x.readAt = DateTime.now();
+      return x;
+    }).toList();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  Future<void> markOneRead(Notification element, int index) async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final NotificationProvider nty = Get.find();
+
+    if (element.id <= 0) {
+      nty.notifications.removeAt(index);
+      return;
+    } else if (element.readAt != null) {
+      return;
+    }
+
+    isBusy.value = true;
+
+    final client = await auth.configureClient('auth');
+
+    await client.put('/notifications/read/${element.id}', {});
+
+    nty.notifications[0].readAt = DateTime.now();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  void requestPermissions() {
+    try {
+      FirebaseMessaging.instance.requestPermission(
+          alert: true,
+          announcement: true,
+          carPlay: true,
+          badge: true,
+          sound: true);
+    } catch (_) {
+      // When firebase isn't initialized (background service)
+      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
+          FlutterLocalNotificationsPlugin();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              AndroidFlutterLocalNotificationsPlugin>()
+          ?.requestNotificationsPermission();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              IOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              MacOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+    }
+  }
+
+  Future<void> registerPushNotifications() async {
+    if (PlatformInfo.isWeb) return;
+
+    final prefs = await SharedPreferences.getInstance();
+    if (prefs.getBool('service_background_notification') == true) {
+      log('Background notification service has been enabled, skip register push notifications');
+      return;
+    }
+
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    late final String? token;
+    late final String provider;
+    var deviceUuid = await _getDeviceUuid();
+
+    if (deviceUuid == null || deviceUuid.isEmpty) {
+      log("Unable to active push notifications, couldn't get device uuid");
+      return;
+    } else {
+      log('Device UUID is $deviceUuid');
+    }
+
+    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
+      provider = 'apple';
+      token = await FirebaseMessaging.instance.getAPNSToken();
+    } else {
+      provider = 'firebase';
+      token = await FirebaseMessaging.instance.getToken();
+    }
+    log('Device Push Token is $token');
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.post('/notifications/subscribe', {
+      'provider': provider,
+      'device_token': token,
+      'device_id': deviceUuid,
+    });
+    if (resp.statusCode != 200 && resp.statusCode != 400) {
+      throw RequestException(resp);
+    }
+  }
+
+  Future<String?> _getDeviceUuid() async {
+    if (PlatformInfo.isWeb) return null;
+    return await FlutterUdid.consistentUdid;
+  }
+}

lib/providers/theme_switcher.dart

@@ -1,5 +1,8 @@
+import 'dart:convert';
+
 import 'package:flutter/material.dart';
 import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/theme.dart';
 
 class ThemeSwitcher extends ChangeNotifier {
@@ -13,11 +16,21 @@ class ThemeSwitcher extends ChangeNotifier {
 
   Future<void> restoreTheme() async {
     final prefs = await SharedPreferences.getInstance();
-    if (prefs.containsKey('global_theme_color')) {
-      final value = prefs.getInt('global_theme_color')!;
-      final color = Color(value);
-      lightThemeData = AppTheme.build(Brightness.light, seedColor: color);
-      darkThemeData = AppTheme.build(Brightness.dark, seedColor: color);
+    if (prefs.containsKey('global_theme')) {
+      final value = SolianThemeData.fromJson(
+        jsonDecode(prefs.getString('global_theme')!),
+      );
+      final agedTheme = prefs.getBool('aged_theme');
+      lightThemeData = AppTheme.buildFromData(
+        Brightness.light,
+        value,
+        useMaterial3: agedTheme == null ? true : !agedTheme,
+      );
+      darkThemeData = AppTheme.buildFromData(
+        Brightness.dark,
+        value,
+        useMaterial3: agedTheme == null ? true : !agedTheme,
+      );
       notifyListeners();
     }
   }
@@ -27,4 +40,25 @@ class ThemeSwitcher extends ChangeNotifier {
     darkThemeData = dark;
     notifyListeners();
   }
+
+  Future<void> setThemeData(SolianThemeData? data) async {
+    final prefs = await SharedPreferences.getInstance();
+    if (data == null) {
+      prefs.remove('global_theme');
+    } else {
+      prefs.setString(
+        'global_theme',
+        jsonEncode(data.toJson()),
+      );
+      lightThemeData = AppTheme.buildFromData(Brightness.light, data);
+      darkThemeData = AppTheme.buildFromData(Brightness.dark, data);
+      notifyListeners();
+    }
+  }
+
+  Future<void> setAgedTheme(bool enabled) async {
+    final prefs = await SharedPreferences.getInstance();
+    prefs.setBool('aged_theme', enabled);
+    await restoreTheme();
+  }
 }

lib/providers/websocket.dart

@@ -3,17 +3,11 @@ import 'dart:convert';
 import 'dart:developer';
 import 'dart:io';
 
-import 'package:device_info_plus/device_info_plus.dart';
-import 'package:firebase_messaging/firebase_messaging.dart';
-import 'package:flutter_local_notifications/flutter_local_notifications.dart';
 import 'package:get/get.dart';
-import 'package:shared_preferences/shared_preferences.dart';
-import 'package:solian/exceptions/request.dart';
 import 'package:solian/models/notification.dart';
 import 'package:solian/models/packet.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/services.dart';
 import 'package:web_socket_channel/web_socket_channel.dart';
 
@@ -21,56 +15,10 @@ class WebSocketProvider extends GetxController {
   RxBool isConnected = false.obs;
   RxBool isConnecting = false.obs;
 
-  RxInt notificationUnread = 0.obs;
-  RxList<Notification> notifications =
-      List<Notification>.empty(growable: true).obs;
-
   WebSocketChannel? websocket;
 
   StreamController<NetworkPackage> stream = StreamController.broadcast();
 
-  @override
-  onInit() {
-    notifyPrefetch();
-
-    super.onInit();
-  }
-
-  void requestPermissions() {
-    try {
-      FirebaseMessaging.instance.requestPermission(
-          alert: true,
-          announcement: true,
-          carPlay: true,
-          badge: true,
-          sound: true);
-    } catch (_) {
-      // When firebase isn't initialized (background service)
-      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
-          FlutterLocalNotificationsPlugin();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              AndroidFlutterLocalNotificationsPlugin>()
-          ?.requestNotificationsPermission();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              IOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              MacOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-    }
-  }
-
   Future<void> connect({noRetry = false}) async {
     if (isConnected.value) {
       return;
@@ -119,8 +67,9 @@ class WebSocketProvider extends GetxController {
         log('Websocket incoming message: ${packet.method} ${packet.message}');
         stream.sink.add(packet);
         if (packet.method == 'notifications.new') {
-          notifications.add(Notification.fromJson(packet.payload!));
-          notificationUnread.value++;
+          final NotificationProvider nty = Get.find();
+          nty.notifications.add(Notification.fromJson(packet.payload!));
+          nty.notificationUnread.value++;
         }
       },
       onDone: () {
@@ -133,95 +82,4 @@ class WebSocketProvider extends GetxController {
       },
     );
   }
-
-  Future<void> notifyPrefetch() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.get('/notifications?skip=0&take=100');
-    if (resp.statusCode == 200) {
-      final result = PaginationResult.fromJson(resp.body);
-      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
-      if (data != null) {
-        notifications.addAll(data);
-        notificationUnread.value = data.length;
-      }
-    }
-  }
-
-  Future<void> registerPushNotifications() async {
-    if (PlatformInfo.isWeb) return;
-
-    final prefs = await SharedPreferences.getInstance();
-    if (prefs.getBool('service_background_notification') == true) {
-      log('Background notification service has been enabled, skip register push notifications');
-      return;
-    }
-
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    late final String? token;
-    late final String provider;
-    final deviceUuid = await _getDeviceUuid();
-
-    if (deviceUuid == null || deviceUuid.isEmpty) {
-      log("Unable to active push notifications, couldn't get device uuid");
-    } else {
-      log('Device UUID is $deviceUuid');
-    }
-
-    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
-      provider = 'apple';
-      token = await FirebaseMessaging.instance.getAPNSToken();
-    } else {
-      provider = 'firebase';
-      token = await FirebaseMessaging.instance.getToken();
-    }
-    log('Device Push Token is $token');
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.post('/notifications/subscribe', {
-      'provider': provider,
-      'device_token': token,
-      'device_id': deviceUuid,
-    });
-    if (resp.statusCode != 200 && resp.statusCode != 400) {
-      throw RequestException(resp);
-    }
-  }
-
-  Future<String?> _getDeviceUuid() async {
-    DeviceInfoPlugin deviceInfo = DeviceInfoPlugin();
-    if (PlatformInfo.isWeb) {
-      final webInfo = await deviceInfo.webBrowserInfo;
-      return webInfo.vendor! +
-          webInfo.userAgent! +
-          webInfo.hardwareConcurrency.toString();
-    }
-    if (PlatformInfo.isAndroid) {
-      final androidInfo = await deviceInfo.androidInfo;
-      return androidInfo.id;
-    }
-    if (PlatformInfo.isIOS) {
-      final iosInfo = await deviceInfo.iosInfo;
-      return iosInfo.identifierForVendor!;
-    }
-    if (PlatformInfo.isLinux) {
-      final linuxInfo = await deviceInfo.linuxInfo;
-      return linuxInfo.machineId!;
-    }
-    if (PlatformInfo.isWindows) {
-      final windowsInfo = await deviceInfo.windowsInfo;
-      return windowsInfo.deviceId;
-    }
-    if (PlatformInfo.isMacOS) {
-      final macosInfo = await deviceInfo.macOsInfo;
-      return macosInfo.systemGUID;
-    }
-    return null;
-  }
 }

lib/router.dart

@@ -2,11 +2,14 @@ import 'package:animations/animations.dart';
 import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/bootstrapper.dart';
+import 'package:solian/models/post.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/screens/about.dart';
 import 'package:solian/screens/account.dart';
+import 'package:solian/screens/account/audit_log.dart';
 import 'package:solian/screens/account/friend.dart';
 import 'package:solian/screens/account/preferences/notifications.dart';
+import 'package:solian/screens/account/preferences/security.dart';
 import 'package:solian/screens/account/profile_edit.dart';
 import 'package:solian/screens/account/profile_page.dart';
 import 'package:solian/screens/auth/signin.dart';
@@ -16,9 +19,9 @@ import 'package:solian/screens/channel/channel_detail.dart';
 import 'package:solian/screens/channel/channel_organize.dart';
 import 'package:solian/screens/chat.dart';
 import 'package:solian/screens/dashboard.dart';
-import 'package:solian/screens/feed/search.dart';
+import 'package:solian/screens/posts/post_search.dart';
 import 'package:solian/screens/posts/post_detail.dart';
-import 'package:solian/screens/feed/draft_box.dart';
+import 'package:solian/screens/posts/draft_box.dart';
 import 'package:solian/screens/realms.dart';
 import 'package:solian/screens/realms/realm_detail.dart';
 import 'package:solian/screens/realms/realm_organize.dart';
@@ -28,6 +31,8 @@ import 'package:solian/screens/posts/post_editor.dart';
 import 'package:solian/screens/settings.dart';
 import 'package:solian/shells/root_shell.dart';
 import 'package:solian/shells/title_shell.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/sidebar/empty_placeholder.dart';
 
 abstract class AppRouter {
   static GoRouter instance = GoRouter(
@@ -92,7 +97,7 @@ abstract class AppRouter {
         name: 'postSearch',
         builder: (context, state) => TitleShell(
           state: state,
-          child: FeedSearchScreen(
+          child: PostSearchScreen(
             tag: state.uri.queryParameters['tag'],
             category: state.uri.queryParameters['category'],
           ),
@@ -105,6 +110,7 @@ abstract class AppRouter {
           state: state,
           child: PostDetailScreen(
             id: state.pathParameters['id']!,
+            post: state.extra as Post?,
           ),
         ),
       ),
@@ -137,12 +143,15 @@ abstract class AppRouter {
   );
 
   static final ShellRoute _chatRoute = ShellRoute(
-    builder: (context, state, child) => child,
+    builder: (context, state, child) =>
+        AppTheme.isLargeScreen(context) ? ChatListShell(child: child) : child,
     routes: [
       GoRoute(
         path: '/chat',
         name: 'chat',
-        builder: (context, state) => const ChatScreen(),
+        builder: (context, state) => AppTheme.isLargeScreen(context)
+            ? const EmptyPagePlaceholder()
+            : const ChatScreen(),
       ),
       GoRoute(
         path: '/chat/organize',
@@ -173,6 +182,7 @@ abstract class AppRouter {
           final arguments = state.extra as ChannelDetailArguments;
           return TitleShell(
             state: state,
+            isResponsive: true,
             child: ChannelDetailScreen(
               channel: arguments.channel,
               profile: arguments.profile,
@@ -258,6 +268,22 @@ abstract class AppRouter {
           child: const NotificationPreferencesScreen(),
         ),
       ),
+      GoRoute(
+        path: '/account/preferences/auth',
+        name: 'authPreferences',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuthPreferencesScreen(),
+        ),
+      ),
+      GoRoute(
+        path: '/account/audit',
+        name: 'auditLog',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuditLogScreen(),
+        ),
+      ),
       GoRoute(
         path: '/account/view/:name',
         name: 'accountProfilePage',

lib/screens/about.dart

@@ -15,9 +15,7 @@ class AboutScreen extends StatelessWidget {
     const denseButtonStyle =
         ButtonStyle(visualDensity: VisualDensity(vertical: -4));
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: SizedBox(
+    return SizedBox(
       width: double.infinity,
       child: Column(
         mainAxisAlignment: MainAxisAlignment.center,
@@ -142,7 +140,6 @@ class AboutScreen extends StatelessWidget {
           ),
         ],
       ),
-      ),
     );
   }
 }

lib/screens/account.dart

@@ -49,9 +49,7 @@ class _AccountScreenState extends State<AccountScreen> {
 
     final AuthProvider auth = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: SafeArea(
+    return SafeArea(
       child: Obx(() {
         if (auth.isAuthorized.isFalse) {
           return Center(
@@ -108,7 +106,7 @@ class _AccountScreenState extends State<AccountScreen> {
           child: ListView(
             children: [
               if (auth.userProfile.value != null)
-                  const AccountHeading().paddingOnly(bottom: 8, top: 8),
+                const AccountHeading().paddingOnly(bottom: 8, top: 16),
               ...(actionItems.map(
                 (x) => ListTile(
                   contentPadding: const EdgeInsets.symmetric(horizontal: 34),
@@ -131,6 +129,24 @@ class _AccountScreenState extends State<AccountScreen> {
                   AppRouter.instance.pushNamed('settings');
                 },
               ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.event_repeat),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('auditLog'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('auditLog');
+                  },
+                ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.lock),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('authPreferences'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('authPreferences');
+                  },
+                ),
               if (auth.isAuthorized.value)
                 ListTile(
                   contentPadding: const EdgeInsets.symmetric(horizontal: 34),
@@ -155,7 +171,6 @@ class _AccountScreenState extends State<AccountScreen> {
           ),
         );
       }),
-      ),
     );
   }
 }

lib/screens/account/audit_log.dart

@@ -0,0 +1,154 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
+import 'package:marquee/marquee.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/audit_log.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/relative_date.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+import 'package:timeline_tile/timeline_tile.dart';
+
+class AuditLogScreen extends StatefulWidget {
+  const AuditLogScreen({super.key});
+
+  @override
+  State<AuditLogScreen> createState() => _AuditLogScreenState();
+}
+
+class _AuditLogScreenState extends State<AuditLogScreen> {
+  bool _isBusy = true;
+
+  final List<AuditEvent> _events = List.empty(growable: true);
+
+  Future<void> _getEvents() async {
+    if (!_isBusy) setState(() => _isBusy = true);
+
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('id');
+    final resp =
+        await client.get('/users/me/events?take=15&offset=${_events.length}');
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    final result = PaginationResult.fromJson(resp.body);
+
+    setState(() {
+      _events.addAll(
+        result.data?.map((x) => AuditEvent.fromJson(x)).toList() ??
+            List.empty(),
+      );
+      _isBusy = false;
+    });
+  }
+
+  bool _showIp = false;
+
+  String _censorIpAddress(String ip) {
+    List<String> parts = ip.split('.');
+
+    if (parts.length == 4) {
+      String censoredPart1 = '*' * parts[1].length;
+      String censoredPart2 = '*' * parts[2].length;
+      String censoredPart3 = '*' * parts[3].length;
+
+      return '${parts[0]}.$censoredPart1.$censoredPart2.$censoredPart3';
+    } else {
+      return '***.***.***.***';
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getEvents();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        CheckboxListTile(
+          value: _showIp,
+          title: Text('showIp'.tr),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          secondary: const Icon(Icons.alternate_email),
+          tileColor:
+              Theme.of(context).colorScheme.surfaceContainer.withOpacity(0.5),
+          onChanged: (val) {
+            setState(() => _showIp = val ?? false);
+          },
+        ),
+        Expanded(
+          child: RefreshIndicator(
+            onRefresh: () {
+              _events.clear();
+              return _getEvents();
+            },
+            child: InfiniteList(
+              padding: const EdgeInsets.symmetric(vertical: 12),
+              itemCount: _events.length,
+              isLoading: _isBusy,
+              onFetchData: () {
+                _getEvents();
+              },
+              itemBuilder: (context, idx) {
+                final element = _events[idx];
+                return TimelineTile(
+                  isFirst: idx == 0,
+                  isLast: _events.length - 1 == idx,
+                  alignment: TimelineAlign.start,
+                  indicatorStyle: IndicatorStyle(width: 15),
+                  endChild: Container(
+                    child: Card(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            element.type,
+                            style: GoogleFonts.robotoMono(fontSize: 15),
+                          ),
+                          Text(
+                            _showIp
+                                ? element.ipAddress
+                                : _censorIpAddress(element.ipAddress),
+                            style: GoogleFonts.sourceCodePro(
+                              fontWeight: FontWeight.bold,
+                            ),
+                          ),
+                          SizedBox(
+                            height: 20,
+                            width: double.maxFinite,
+                            child: Marquee(
+                              text: element.userAgent,
+                              velocity: 25,
+                              startAfter: Duration(milliseconds: 500),
+                              pauseAfterRound: Duration(milliseconds: 3000),
+                            ),
+                          ),
+                          Row(
+                            children: [
+                              RelativeDate(element.createdAt),
+                              const Gap(6),
+                              Text('·'),
+                              const Gap(6),
+                              RelativeDate(element.createdAt, isFull: true),
+                            ],
+                          ),
+                        ],
+                      ).paddingSymmetric(horizontal: 12, vertical: 8),
+                    ).paddingOnly(left: 16),
+                  ),
+                ).paddingSymmetric(horizontal: 18);
+              },
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/screens/account/friend.dart

@@ -6,6 +6,7 @@ import 'package:solian/models/relations.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/account/relative_list.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class FriendScreen extends StatefulWidget {
   const FriendScreen({super.key});
@@ -117,8 +118,7 @@ class _FriendScreenState extends State<FriendScreen>
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           centerTitle: false,

lib/screens/account/notification.dart

@@ -1,9 +1,14 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
-import 'package:solian/providers/websocket.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/models/notification.dart' as notify;
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/notifications.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/markdown_text_content.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/relative_date.dart';
 import 'package:uuid/uuid.dart';
 
 class NotificationScreen extends StatefulWidget {
@@ -14,57 +19,9 @@ class NotificationScreen extends StatefulWidget {
 }
 
 class _NotificationScreenState extends State<NotificationScreen> {
-  bool _isBusy = false;
-
-  Future<void> _markAllRead() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    setState(() => _isBusy = true);
-
-    final WebSocketProvider provider = Get.find();
-
-    List<int> markList = List.empty(growable: true);
-    for (final element in provider.notifications) {
-      if (element.id <= 0) continue;
-      markList.add(element.id);
-    }
-
-    if (markList.isNotEmpty) {
-      final client = await auth.configureClient('auth');
-      await client.put('/notifications/read', {'messages': markList});
-    }
-
-    provider.notifications.clear();
-
-    setState(() => _isBusy = false);
-  }
-
-  Future<void> _markOneRead(notify.Notification element, int index) async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final WebSocketProvider provider = Get.find();
-
-    if (element.id <= 0) {
-      provider.notifications.removeAt(index);
-      return;
-    }
-
-    setState(() => _isBusy = true);
-
-    final client = await auth.configureClient('auth');
-
-    await client.put('/notifications/read/${element.id}', {});
-
-    provider.notifications.removeAt(index);
-
-    setState(() => _isBusy = false);
-  }
-
   @override
   Widget build(BuildContext context) {
-    final WebSocketProvider ws = Get.find();
+    final NotificationProvider nty = Get.find();
 
     return SizedBox(
       height: MediaQuery.of(context).size.height * 0.85,
@@ -77,18 +34,24 @@ class _NotificationScreenState extends State<NotificationScreen> {
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
           Expanded(
             child: Obx(() {
-              return CustomScrollView(
+              return RefreshIndicator(
+                onRefresh: () => nty.fetchNotification(),
+                child: CustomScrollView(
                   slivers: [
-                  if (_isBusy)
                     SliverToBoxAdapter(
-                      child: const LinearProgressIndicator().animate().scaleX(),
+                      child: LoadingIndicator(
+                        isActive: nty.isBusy.value,
                       ),
-                  if (ws.notifications.isEmpty)
+                    ),
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isEmpty)
                       SliverToBoxAdapter(
                         child: Container(
                           padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color:
-                            Theme.of(context).colorScheme.surfaceContainerHigh,
+                          color: Theme.of(context)
+                              .colorScheme
+                              .surfaceContainerHigh,
                           child: ListTile(
                             leading: const Icon(Icons.check),
                             title: Text('notifyEmpty'.tr),
@@ -96,52 +59,147 @@ class _NotificationScreenState extends State<NotificationScreen> {
                           ),
                         ),
                       ),
-                  if (ws.notifications.isNotEmpty)
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isNotEmpty)
                       SliverToBoxAdapter(
                         child: Container(
                           padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color: Theme.of(context).colorScheme.secondaryContainer,
+                          color:
+                              Theme.of(context).colorScheme.secondaryContainer,
                           child: ListTile(
                             leading: const Icon(Icons.checklist),
                             title: Text('notifyAllRead'.tr),
-                          onTap: _isBusy ? null : () => _markAllRead(),
+                            onTap: nty.isBusy.value
+                                ? null
+                                : () => nty.markAllRead(),
                           ),
                         ),
                       ),
                     SliverList.separated(
-                    itemCount: ws.notifications.length,
+                      itemCount: nty.notifications.length,
                       itemBuilder: (BuildContext context, int index) {
-                      var element = ws.notifications[index];
-                      return Dismissible(
+                        var element = nty.notifications[index];
+                        return ClipRect(
+                          child: Dismissible(
+                            direction: element.readAt == null
+                                ? DismissDirection.horizontal
+                                : DismissDirection.none,
                             key: Key(const Uuid().v4()),
                             background: Container(
                               color: Colors.lightBlue,
-                          padding: const EdgeInsets.symmetric(horizontal: 20),
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
                               alignment: Alignment.centerLeft,
-                          child: const Icon(Icons.check, color: Colors.white),
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
                             ),
-                        child: ListTile(
-                          contentPadding: const EdgeInsets.symmetric(
-                            horizontal: 24,
-                            vertical: 8,
+                            secondaryBackground: Container(
+                              color: Colors.lightBlue,
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
+                              alignment: Alignment.centerRight,
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
                             ),
-                          title: Text(element.title),
-                          subtitle: Column(
+                            child: Container(
+                              padding: const EdgeInsets.symmetric(
+                                horizontal: 28,
+                                vertical: 16,
+                              ),
+                              child: Row(
                                 crossAxisAlignment: CrossAxisAlignment.start,
                                 children: [
+                                  Icon(NotificationTopicIcons[element.topic]),
+                                  const Gap(16),
+                                  Expanded(
+                                    child: Column(
+                                      crossAxisAlignment:
+                                          CrossAxisAlignment.start,
+                                      children: [
+                                        if (element.readAt == null)
+                                          Badge(
+                                            label: Row(
+                                              children: [
+                                                const Icon(
+                                                  Icons.new_releases_outlined,
+                                                  color: Colors.white,
+                                                  size: 12,
+                                                ),
+                                                const Gap(4),
+                                                Text('unread'.tr),
+                                              ],
+                                            ),
+                                          ).paddingOnly(bottom: 4),
+                                        Text(
+                                          element.title,
+                                          style: Theme.of(context)
+                                              .textTheme
+                                              .titleMedium,
+                                        ),
                                         if (element.subtitle != null)
-                                Text(element.subtitle!),
-                              Text(element.body),
+                                          Text(
+                                            element.subtitle!,
+                                            style: Theme.of(context)
+                                                .textTheme
+                                                .titleSmall,
+                                          ),
+                                        if (element.subtitle != null)
+                                          const Gap(4),
+                                        MarkdownTextContent(
+                                          content: element.body,
+                                          isAutoWarp: true,
+                                          isSelectable: true,
+                                          parentId:
+                                              'notification-${element.id}',
+                                        ),
+                                        if ([
+                                              'interactive.feedback',
+                                              'interactive.subscription'
+                                            ].contains(element.topic) &&
+                                            element.metadata?['related_post'] !=
+                                                null)
+                                          _PostRelatedNotificationWidget(
+                                            metadata: element.metadata!,
+                                          ),
+                                        const Gap(8),
+                                        Opacity(
+                                          opacity: 0.75,
+                                          child: Row(
+                                            children: [
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              Text(
+                                                '·',
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                                isFull: true,
+                                              ),
                                             ],
                                           ),
                                         ),
-                        onDismissed: (_) => _markOneRead(element, index),
+                                      ],
+                                    ),
+                                  ),
+                                ],
+                              ),
+                            ),
+                            onDismissed: (_) => nty.markOneRead(element, index),
+                          ),
                         );
                       },
                       separatorBuilder: (_, __) =>
                           const Divider(thickness: 0.3, height: 0.3),
                     ),
                   ],
+                ),
               );
             }),
           ),
@@ -156,7 +214,7 @@ class NotificationButton extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    final WebSocketProvider provider = Get.find();
+    final NotificationProvider nty = Get.find();
 
     final button = IconButton(
       icon: const Icon(Icons.notifications),
@@ -166,16 +224,16 @@ class NotificationButton extends StatelessWidget {
           isScrollControlled: true,
           context: context,
           builder: (context) => const NotificationScreen(),
-        ).then((_) => provider.notificationUnread.value = 0);
+        ).then((_) => nty.notificationUnread.value = 0);
       },
     );
 
     return Obx(() {
-      if (provider.notificationUnread.value > 0) {
+      if (nty.notificationUnread.value > 0) {
         return Badge(
           isLabelVisible: true,
           offset: const Offset(-8, 2),
-          label: Text(provider.notificationUnread.value.toString()),
+          label: Text(nty.notificationUnread.value.toString()),
           child: button,
         );
       } else {
@@ -184,3 +242,31 @@ class NotificationButton extends StatelessWidget {
     });
   }
 }
+
+class _PostRelatedNotificationWidget extends StatelessWidget {
+  final Map<String, dynamic> metadata;
+
+  const _PostRelatedNotificationWidget({super.key, required this.metadata});
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: Card(
+        margin: const EdgeInsets.symmetric(vertical: 4),
+        child: PostItem(
+          item: Post.fromJson(metadata['related_post']),
+          isCompact: true,
+        ).paddingAll(8),
+      ),
+      onTap: () {
+        final data = Post.fromJson(metadata['related_post']);
+        Navigator.pop(context);
+        AppRouter.instance.pushNamed(
+          'postDetail',
+          pathParameters: {'id': data.id.toString()},
+          extra: data,
+        );
+      },
+    );
+  }
+}

lib/screens/account/preferences/notifications.dart

@@ -1,11 +1,11 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
 import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class NotificationPreferencesScreen extends StatefulWidget {
   const NotificationPreferencesScreen({super.key});
@@ -59,9 +59,9 @@ class _NotificationPreferencesScreenState
     });
     if (resp.statusCode != 200) {
       context.showErrorDialog(RequestException(resp));
-    }
-
+    } else {
       context.showSnackbar('preferencesApplied'.tr);
+    }
 
     setState(() => _isBusy = false);
   }
@@ -74,11 +74,9 @@ class _NotificationPreferencesScreenState
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Column(
+    return Column(
       children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+        LoadingIndicator(isActive: _isBusy),
         ListTile(
           tileColor: Theme.of(context).colorScheme.surfaceContainer,
           contentPadding: const EdgeInsets.symmetric(horizontal: 24),
@@ -112,7 +110,6 @@ class _NotificationPreferencesScreenState
           ),
         ),
       ],
-      ),
     );
   }
 }

lib/screens/account/preferences/security.dart

@@ -0,0 +1,118 @@
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:get/get.dart';
+import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+
+class AuthPreferencesScreen extends StatefulWidget {
+  const AuthPreferencesScreen({super.key});
+
+  @override
+  State<AuthPreferencesScreen> createState() => _AuthPreferencesScreenState();
+}
+
+class _AuthPreferencesScreenState extends State<AuthPreferencesScreen> {
+  bool _isBusy = true;
+
+  Map<String, dynamic> _config = {
+    'maximum_auth_steps': 2,
+  };
+
+  Future<void> _getPreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.get('/preferences/auth');
+    if (resp.statusCode != 200 && resp.statusCode != 404) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    if (resp.statusCode == 200) {
+      _config = resp.body;
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _savePreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.put('/preferences/auth', _config);
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    } else {
+      context.showSnackbar('preferencesApplied'.tr);
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPreferences();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        ListTile(
+          tileColor: Theme.of(context).colorScheme.surfaceContainer,
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          leading: const Icon(Icons.save),
+          title: Text('save'.tr),
+          enabled: !_isBusy,
+          onTap: () {
+            _savePreferences();
+          },
+        ),
+        Expanded(
+          child: ListView(
+            children: [
+              ListTile(
+                title: Text('authMaximumAuthSteps'.tr),
+                subtitle: Text('authMaximumAuthStepsDesc'.tr),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                trailing: SizedBox(
+                  width: 60,
+                  child: _isBusy
+                      ? null
+                      : TextFormField(
+                          decoration: InputDecoration(
+                            border: const OutlineInputBorder(),
+                            isDense: true,
+                          ),
+                          initialValue:
+                              _config['maximum_auth_steps']?.toString() ?? '2',
+                          keyboardType: TextInputType.number,
+                          inputFormatters: [
+                            FilteringTextInputFormatter.digitsOnly
+                          ],
+                          onTapOutside: (_) =>
+                              FocusManager.instance.primaryFocus?.unfocus(),
+                          onChanged: (value) {
+                            _config['maximum_auth_steps'] =
+                                int.tryParse(value) ?? 2;
+                          },
+                        ),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+}

lib/screens/account/profile_edit.dart

@@ -1,7 +1,4 @@
-import 'dart:io';
-
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
@@ -9,10 +6,12 @@ import 'package:image_picker/image_picker.dart';
 import 'package:intl/intl.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
+import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class PersonalizeScreen extends StatefulWidget {
   const PersonalizeScreen({super.key});
@@ -77,9 +76,12 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) return;
 
+    XFile file;
+
     final image = await _imagePicker.pickImage(source: ImageSource.gallery);
     if (image == null) return;
 
+    if (PlatformInfo.canCropImage) {
       CroppedFile? croppedFile = await ImageCropper().cropImage(
         sourcePath: image.path,
         uiSettings: [
@@ -106,7 +108,10 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
       );
 
       if (croppedFile == null) return;
-    final file = File(croppedFile.path);
+      file = XFile(croppedFile.path);
+    } else {
+      file = XFile(image.path);
+    }
 
     setState(() => _isBusy = true);
 
@@ -181,15 +186,13 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
   Widget build(BuildContext context) {
     const double padding = 32;
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: ListView(
+    return ListView(
       children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+        LoadingIndicator(isActive: _isBusy),
         const Gap(24),
         Stack(
           children: [
-              AccountAvatar(content: _avatar, radius: 40),
+            AttachedCircleAvatar(content: _avatar, radius: 40),
             Positioned(
               bottom: 0,
               left: 40,
@@ -338,7 +341,6 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
           ],
         ).paddingSymmetric(horizontal: padding),
       ],
-      ),
     );
   }
 

lib/screens/account/profile_page.dart

@@ -26,8 +26,8 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/daily_sign/history_chart.dart';
 import 'package:solian/widgets/posts/post_list.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 
 class AccountProfilePage extends StatefulWidget {
@@ -230,11 +230,14 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
   @override
   Widget build(BuildContext context) {
     if (_isBusy || _userinfo == null) {
-      return const Center(child: CircularProgressIndicator());
+      return RootContainer(
+        child: const Center(
+          child: CircularProgressIndicator(),
+        ),
+      );
     }
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: DefaultTabController(
         length: 3,
         child: NestedScrollView(
@@ -250,10 +253,15 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                   height: 56,
                   child: Row(
                     children: [
-                      AppBarLeadingButton.adaptive(context) ?? const Gap(8),
+                      AppBarLeadingButton.adaptive(
+                            context,
+                            forceBack: true,
+                          ) ??
+                          const Gap(8),
                       const Gap(8),
                       if (_userinfo != null)
-                        AccountAvatar(content: _userinfo!.avatar, radius: 16),
+                        AttachedCircleAvatar(
+                            content: _userinfo!.avatar, radius: 16),
                       const Gap(12),
                       Expanded(
                         child: Column(
@@ -580,8 +588,6 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                         color:
                             Theme.of(context).colorScheme.surfaceContainerLow,
                         child: PostListEntryWidget(
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surfaceContainerLow,
                           item: element,
                           isClickable: true,
                           isNestedClickable: true,
@@ -601,7 +607,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                       child: Center(child: CircularProgressIndicator()),
                     ),
                   if (_userinfo != null)
-                    PostWarpedListWidget(
+                    ControlledPostListWidget(
                       isPinned: false,
                       controller: _postController.pagingController,
                       onUpdate: () => _postController.reloadAllOver(),

lib/screens/auth/signin.dart

@@ -7,10 +7,9 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/channel.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
-import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';
@@ -177,10 +176,9 @@ class _SignInScreenState extends State<SignInScreen> {
           await auth.refreshAuthorizeStatus();
           await auth.refreshUserProfile();
 
-          Get.find<ChannelProvider>().refreshAvailableChannel();
           Get.find<RealmProvider>().refreshAvailableRealms();
           Get.find<RelationshipProvider>().refreshRelativeList();
-          Get.find<WebSocketProvider>().registerPushNotifications();
+          Get.find<NotificationProvider>().registerPushNotifications();
           autoConfigureBackgroundNotificationService();
           autoStartBackgroundNotificationService();
 
@@ -218,10 +216,10 @@ class _SignInScreenState extends State<SignInScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: CenteredContainer(
+    return CenteredContainer(
       maxWidth: 360,
+      child: Theme(
+        data: Theme.of(context).copyWith(canvasColor: Colors.transparent),
         child: PageTransitionSwitcher(
           transitionBuilder: (
             Widget child,

lib/screens/auth/signup.dart

@@ -65,9 +65,7 @@ class _SignUpScreenState extends State<SignUpScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: CenteredContainer(
+    return CenteredContainer(
       maxWidth: 360,
       child: ListView(
         shrinkWrap: true,
@@ -96,8 +94,7 @@ class _SignUpScreenState extends State<SignUpScreen> {
               border: const OutlineInputBorder(),
               labelText: 'username'.tr,
             ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
           ),
           const Gap(12),
           TextField(
@@ -110,8 +107,7 @@ class _SignUpScreenState extends State<SignUpScreen> {
               border: const OutlineInputBorder(),
               labelText: 'nickname'.tr,
             ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
           ),
           const Gap(12),
           TextField(
@@ -124,8 +120,7 @@ class _SignUpScreenState extends State<SignUpScreen> {
               border: const OutlineInputBorder(),
               labelText: 'email'.tr,
             ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
           ),
           const Gap(12),
           TextField(
@@ -139,8 +134,7 @@ class _SignUpScreenState extends State<SignUpScreen> {
               border: const OutlineInputBorder(),
               labelText: 'password'.tr,
             ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
             onSubmitted: (_) => _performAction(context),
           ),
           const Gap(8),
@@ -206,7 +200,6 @@ class _SignUpScreenState extends State<SignUpScreen> {
             ),
           )
         ],
-        ),
       ).paddingAll(24),
     );
   }

lib/screens/channel/call/call.dart

@@ -11,6 +11,7 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/chat/call/call_controls.dart';
 import 'package:solian/widgets/chat/call/call_participant.dart';
 import 'package:livekit_client/livekit_client.dart' as livekit;
+import 'package:solian/widgets/root_container.dart';
 
 class CallScreen extends StatefulWidget {
   final bool hideAppBar;
@@ -197,8 +198,7 @@ class _CallScreenState extends State<CallScreen> with TickerProviderStateMixin {
   Widget build(BuildContext context) {
     final ChatCallProvider ctrl = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: widget.hideAppBar
             ? null

lib/screens/channel/channel_chat.dart

@@ -3,6 +3,7 @@ import 'dart:ui';
 
 import 'package:flutter/material.dart';
 import 'package:get/get.dart';
+import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/call.dart';
@@ -25,6 +26,7 @@ import 'package:solian/widgets/chat/chat_event_list.dart';
 import 'package:solian/widgets/chat/chat_message_input.dart';
 import 'package:solian/widgets/chat/chat_typing_indicator.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class ChannelChatScreen extends StatefulWidget {
   final String alias;
@@ -179,6 +181,8 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     }
   }
 
+  late SharedPreferences _prefs;
+
   @override
   void initState() {
     super.initState();
@@ -189,11 +193,14 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     _chatController = ChatEventController();
     _chatController.initialize();
 
+    SharedPreferences.getInstance().then((inst) {
+      _prefs = inst;
       _getOngoingCall();
       _getChannel().then((_) {
         _chatController.getInitialEvents(_channel!, widget.realm);
         _listenMessages();
       });
+    });
   }
 
   @override
@@ -201,16 +208,18 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
     String title = _channel?.name ?? 'loading'.tr;
     String? placeholder;
 
-    if (_channel?.type == 1) {
     final otherside =
-          _channel!.members!.where((e) => e.account.id != _accountId).first;
+        _channel?.members!.where((e) => e.account.id != _accountId).firstOrNull;
+
+    if (_channel?.type == 1 && otherside != null) {
       title = otherside.account.nick;
       placeholder = 'messageInputPlaceholder'.trParams(
         {'channel': '@${otherside.account.name}'},
       );
     }
 
-    return Scaffold(
+    return ResponsiveRootContainer(
+      child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
           title: AppBarTitle(title),
@@ -246,7 +255,8 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
                     .then((value) {
                   if (value == false) AppRouter.instance.pop();
                   if (value != null) {
-                  final resp = Channel.fromJson(value as Map<String, dynamic>);
+                    final resp =
+                        Channel.fromJson(value as Map<String, dynamic>);
                     _getChannel(alias: resp.alias);
                   }
                 });
@@ -274,7 +284,7 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
                         channel: _channel!,
                         ongoingCall: _ongoingCall!,
                         onJoin: () {
-                        if (!AppTheme.isLargeScreen(context)) {
+                          if (!AppTheme.isUltraLargeScreen(context)) {
                             final ChatCallProvider call = Get.find();
                             call.gotoScreen(context);
                           }
@@ -282,6 +292,9 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
                       ),
                     Expanded(
                       child: ChatEventList(
+                        noAnimated:
+                            _prefs.getBool('non_animated_message_list') ??
+                                false,
                         scope: widget.realm,
                         channel: _channel!,
                         chatController: _chatController,
@@ -328,7 +341,8 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
               ),
               Obx(() {
                 final ChatCallProvider call = Get.find();
-              if (call.isMounted.value && AppTheme.isLargeScreen(context)) {
+                if (call.isMounted.value &&
+                    AppTheme.isUltraLargeScreen(context)) {
                   return const Expanded(
                     child: Row(children: [
                       VerticalDivider(width: 0.3, thickness: 0.3),
@@ -346,6 +360,7 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
             ],
           );
         }),
+      ),
     );
   }
 

lib/screens/channel/channel_organize.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@@ -9,6 +8,8 @@ import 'package:solian/providers/content/channel.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';
 
 class ChannelOrganizeArguments {
@@ -114,8 +115,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
       ),
     ];
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return ResponsiveRootContainer(
       child: Scaffold(
         appBar: AppBar(
           title: AppBarTitle('channelOrganizing'.tr),
@@ -132,7 +132,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
           top: false,
           child: Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               if (widget.edit != null)
                 MaterialBanner(
                   leading: const Icon(Icons.edit),

lib/screens/chat.dart

@@ -1,47 +1,166 @@
 import 'package:flutter/material.dart';
+import 'package:flutter_resizable_container/flutter_resizable_container.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/channel.dart';
+import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/database/database.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/signin_required_overlay.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/channel/channel_list.dart';
 import 'package:solian/widgets/chat/call/chat_call_indicator.dart';
 import 'package:solian/widgets/current_state_action.dart';
-import 'package:solian/widgets/sized_container.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
+import 'package:solian/widgets/sidebar/empty_placeholder.dart';
 
-class ChatScreen extends StatefulWidget {
+class ChatScreen extends StatelessWidget {
   const ChatScreen({super.key});
 
   @override
-  State<ChatScreen> createState() => _ChatScreenState();
+  Widget build(BuildContext context) {
+    return const ResponsiveRootContainer(
+      child: ChatList(),
+    );
+  }
 }
 
-class _ChatScreenState extends State<ChatScreen> {
-  late final ChannelProvider _channels;
+class ChatListShell extends StatelessWidget {
+  final Widget? child;
+
+  const ChatListShell({super.key, required this.child});
+
+  @override
+  Widget build(BuildContext context) {
+    return RootContainer(
+      child: ResizableContainer(
+        direction: Axis.horizontal,
+        divider: ResizableDivider(
+          thickness: 0.3,
+          color: Theme.of(context).dividerColor.withOpacity(0.3),
+        ),
+        children: [
+          const ResizableChild(
+            minSize: 280,
+            maxSize: 520,
+            size: ResizableSize.pixels(360),
+            child: ChatList(),
+          ),
+          ResizableChild(
+            minSize: 280,
+            child: child ?? const EmptyPagePlaceholder(),
+          ),
+        ],
+      ),
+    );
+  }
+}
+
+class ChatList extends StatefulWidget {
+  const ChatList({super.key});
+
+  @override
+  State<ChatList> createState() => _ChatListState();
+}
+
+class _ChatListState extends State<ChatList> {
+  List<Channel> _normalChannels = List.empty();
+  List<Channel> _directChannels = List.empty();
+  final Map<String, List<Channel>> _realmChannels = {};
+
+  late final ChannelProvider _channels = Get.find();
+
+  bool _isBusy = true;
+
+  List<Channel> _sortChannels(List<Channel> channels) {
+    channels.sort(
+      (a, b) =>
+          _lastMessages?[b.id]?.createdAt.compareTo(
+                _lastMessages?[a.id]?.createdAt ??
+                    DateTime.fromMillisecondsSinceEpoch(0),
+              ) ??
+          0,
+    );
+    return channels;
+  }
+
+  Future<void> _loadNormalChannels() async {
+    final resp = await _channels.listAvailableChannel(isDirect: false);
+    setState(() {
+      _normalChannels = _sortChannels(resp);
+    });
+  }
+
+  Future<void> _loadDirectChannels() async {
+    final resp = await _channels.listAvailableChannel(isDirect: true);
+    setState(() {
+      _directChannels = _sortChannels(resp);
+    });
+  }
+
+  Future<void> _loadRealmChannels(String realm) async {
+    final resp = await _channels.listAvailableChannel(scope: realm);
+    setState(() {
+      _realmChannels[realm] = _sortChannels(List.from(resp));
+    });
+  }
+
+  Future<void> _loadAllChannels() async {
+    final RealmProvider realms = Get.find();
+    Future.wait([
+      _loadNormalChannels(),
+      _loadDirectChannels(),
+      ...realms.availableRealms.map((x) => _loadRealmChannels(x.alias)),
+    ]);
+  }
+
+  Map<int, LocalMessageEventTableData>? _lastMessages;
+
+  Future<void> _loadLastMessages() async {
+    final ctrl = ChatEventController();
+    await ctrl.initialize();
+    final messages = await ctrl.src.getLastInAllChannels();
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
+    }
+  }
 
   @override
   void initState() {
     super.initState();
-    try {
-      _channels = Get.find();
-      _channels.refreshAvailableChannel();
-    } catch (e) {
-      context.showErrorDialog(e);
+    _loadLastMessages().then((_) {
+      if (!mounted) return;
+      _loadAllChannels().then((_) {
+        if (mounted) {
+          setState(() => _isBusy = false);
         }
+      });
+    });
   }
 
   @override
   Widget build(BuildContext context) {
     final AuthProvider auth = Get.find();
+    final RealmProvider realms = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return Obx(
+      () => DefaultTabController(
+        length: 2 + realms.availableRealms.length,
+        child: ResponsiveRootContainer(
           child: Scaffold(
             appBar: AppBar(
               leading: AppBarLeadingButton.adaptive(context),
@@ -58,13 +177,14 @@ class _ChatScreenState extends State<ChatScreen> {
                       child: ListTile(
                         title: Text('channelOrganizeCommon'.tr),
                         leading: const Icon(Icons.tag),
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 8),
+                        contentPadding:
+                            const EdgeInsets.symmetric(horizontal: 8),
                       ),
                       onTap: () {
                         AppRouter.instance.pushNamed('channelOrganizing').then(
                           (value) {
                             if (value != null) {
-                          _channels.refreshAvailableChannel();
+                              _loadAllChannels();
                             }
                           },
                         );
@@ -77,7 +197,8 @@ class _ChatScreenState extends State<ChatScreen> {
                           FontAwesomeIcons.userGroup,
                           size: 16,
                         ),
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 8),
+                        contentPadding:
+                            const EdgeInsets.symmetric(horizontal: 8),
                       ),
                       onTap: () {
                         final ChannelProvider channels = Get.find();
@@ -85,7 +206,7 @@ class _ChatScreenState extends State<ChatScreen> {
                             .createDirectChannel(context, 'global')
                             .then((resp) {
                           if (resp != null) {
-                        _channels.refreshAvailableChannel();
+                            _loadAllChannels();
                           }
                         }).catchError((e) {
                           context.showErrorDialog(e);
@@ -98,11 +219,70 @@ class _ChatScreenState extends State<ChatScreen> {
                   width: AppTheme.isLargeScreen(context) ? 8 : 16,
                 ),
               ],
+              bottom: TabBar(
+                isScrollable: true,
+                dividerHeight: 0.3,
+                tabAlignment: TabAlignment.startOffset,
+                tabs: [
+                  Tab(
+                    child: Row(
+                      mainAxisSize: MainAxisSize.min,
+                      children: [
+                        CircleAvatar(
+                          radius: 14,
+                          backgroundColor:
+                              Theme.of(context).colorScheme.primary,
+                          child: const Icon(
+                            Icons.forum,
+                            size: 16,
+                            color: Colors.white,
+                          ),
+                        ),
+                        const Gap(8),
+                        Text('all'.tr),
+                      ],
+                    ),
+                  ),
+                  Tab(
+                    child: Row(
+                      mainAxisSize: MainAxisSize.min,
+                      children: [
+                        const CircleAvatar(
+                          radius: 14,
+                          child: Icon(
+                            Icons.chat_bubble,
+                            size: 16,
+                          ),
+                        ),
+                        const Gap(8),
+                        Text('channelTypeDirect'.tr),
+                      ],
+                    ),
+                  ),
+                  ...realms.availableRealms.map((x) => Tab(
+                        child: Row(
+                          mainAxisSize: MainAxisSize.min,
+                          children: [
+                            AttachedCircleAvatar(
+                              content: x.avatar,
+                              radius: 14,
+                              fallbackWidget: const Icon(
+                                Icons.workspaces,
+                                size: 16,
+                              ),
+                            ),
+                            const Gap(8),
+                            Text(x.name),
+                          ],
+                        ),
+                      )),
+                ],
+              ),
             ),
             body: Obx(() {
               if (auth.isAuthorized.isFalse) {
                 return SigninRequiredOverlay(
-              onDone: () => _channels.refreshAvailableChannel(),
+                  onDone: () => _loadAllChannels(),
                 );
               }
 
@@ -110,37 +290,50 @@ class _ChatScreenState extends State<ChatScreen> {
 
               return Column(
                 children: [
-              Obx(() {
-                if (_channels.isLoading.isFalse) {
-                  return const SizedBox.shrink();
-                } else {
-                  return const LinearProgressIndicator();
-                }
-              }),
                   const ChatCallCurrentIndicator(),
+                  LoadingIndicator(isActive: _isBusy),
                   Expanded(
-                child: CenteredContainer(
-                  child: RefreshIndicator(
-                    onRefresh: _channels.refreshAvailableChannel,
-                    child: Obx(
-                      () => ChannelListWidget(
-                        noCategory: true,
-                        channels: List.from([
-                          ..._channels.groupChannels
-                              .where((x) => x.realmId == null),
-                          ..._channels.directChannels
+                    child: TabBarView(
+                      children: [
+                        RefreshIndicator(
+                          onRefresh: _loadNormalChannels,
+                          child: ChannelListWidget(
+                            channels: _sortChannels([
+                              ..._normalChannels,
+                              ..._directChannels,
+                              ..._realmChannels.values.expand((x) => x),
                             ]),
                             selfId: selfId,
-                        useReplace: true,
+                            useReplace: AppTheme.isLargeScreen(context),
+                          ),
+                        ),
+                        RefreshIndicator(
+                          onRefresh: _loadDirectChannels,
+                          child: ChannelListWidget(
+                            channels: _directChannels,
+                            selfId: selfId,
+                            useReplace: AppTheme.isLargeScreen(context),
+                          ),
+                        ),
+                        ...realms.availableRealms.map(
+                          (x) => RefreshIndicator(
+                            onRefresh: () => _loadRealmChannels(x.alias),
+                            child: ChannelListWidget(
+                              channels: _realmChannels[x.alias] ?? [],
+                              selfId: selfId,
+                              useReplace: AppTheme.isLargeScreen(context),
                             ),
                           ),
                         ),
+                      ],
                     ),
                   ),
                 ],
               );
             }),
           ),
+        ),
+      ),
     );
   }
 }

lib/screens/dashboard.dart

@@ -20,7 +20,7 @@ import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/daily_sign.dart';
 import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
-import 'package:solian/providers/websocket.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
@@ -38,7 +38,7 @@ class DashboardScreen extends StatefulWidget {
 class _DashboardScreenState extends State<DashboardScreen> {
   late final AuthProvider _auth = Get.find();
   late final LastReadProvider _lastRead = Get.find();
-  late final WebSocketProvider _ws = Get.find();
+  late final NotificationProvider _nty = Get.find();
   late final PostProvider _posts = Get.find();
   late final DailySignProvider _dailySign = Get.find();
 
@@ -46,7 +46,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
       Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
 
   List<Notification> get _pendingNotifications =>
-      List<Notification>.from(_ws.notifications)
+      List<Notification>.from(_nty.notifications.where((x) => x.readAt == null))
         ..sort((a, b) => b.createdAt.compareTo(a.createdAt));
 
   List<Post>? _currentPosts;
@@ -75,11 +75,13 @@ class _DashboardScreenState extends State<DashboardScreen> {
     final src = Get.find<MessagesFetchingProvider>();
     final out = await src.getWhatsNewEvents(_lastRead.messagesLastReadAt!);
     if (out == null) return;
+    if (mounted) {
       setState(() {
         _currentMessages = out.$1;
         _currentMessagesCount = out.$2;
       });
     }
+  }
 
   bool _signingDaily = true;
   DailySignRecord? _signRecord;
@@ -89,14 +91,18 @@ class _DashboardScreenState extends State<DashboardScreen> {
     try {
       _signRecord = await _dailySign.getToday();
       _dailySign.listLastRecord(14).then((value) {
+        if (mounted) {
           setState(() => _signRecordHistory = value);
+        }
       });
     } catch (e) {
       context.showErrorDialog(e);
     }
 
+    if (mounted) {
       setState(() => _signingDaily = false);
     }
+  }
 
   Future<void> _signDaily() async {
     setState(() => _signingDaily = true);
@@ -147,7 +153,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
               ),
               Text(DateFormat('yyyy/MM/dd').format(DateTime.now().toUtc())),
             ],
-          ).paddingOnly(top: 8, left: 18, right: 18, bottom: 12),
+          ).paddingOnly(top: 16, left: 18, right: 18, bottom: 12),
           Card(
             child: Column(
               children: [
@@ -248,7 +254,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                         ),
                         Text(
                           'notificationUnreadCount'.trParams({
-                            'count': _ws.notifications.length.toString(),
+                            'count': _pendingNotifications.length.toString(),
                           }),
                         ),
                       ],
@@ -261,12 +267,12 @@ class _DashboardScreenState extends State<DashboardScreen> {
                           isScrollControlled: true,
                           context: context,
                           builder: (context) => const NotificationScreen(),
-                        ).then((_) => _ws.notificationUnread.value = 0);
+                        ).then((_) => _nty.notificationUnread.value = 0);
                       },
                     ),
                   ],
                 ).paddingOnly(left: 18, right: 18, bottom: 8),
-                if (_ws.notifications.isNotEmpty)
+                if (_pendingNotifications.isNotEmpty)
                   SizedBox(
                     height: 76,
                     child: ListView.separated(
@@ -354,7 +360,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                     IconButton(
                       icon: const Icon(Icons.arrow_forward),
                       onPressed: () {
-                        AppRouter.instance.goNamed('feed');
+                        AppRouter.instance.goNamed('explore');
                       },
                     ),
                   ],
@@ -383,9 +389,10 @@ class _DashboardScreenState extends State<DashboardScreen> {
                                 onUpdate: (_) {
                                   _pullPosts();
                                 },
-                                backgroundColor: Theme.of(context)
-                                    .colorScheme
-                                    .surfaceContainerLow,
+                                padding: EdgeInsets.symmetric(
+                                  vertical: 8,
+                                  horizontal: 4,
+                                ),
                               ),
                             ),
                           ),
@@ -519,7 +526,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                 style: TextStyle(color: _unFocusColor, fontSize: 12),
               )
             ],
-          ).paddingAll(8),
+          ).paddingOnly(left: 8, right: 8, top: 8, bottom: 50),
         ],
       ),
     );

lib/screens/explore.dart

@@ -1,4 +1,5 @@
 import 'dart:async';
+import 'dart:ui';
 
 import 'package:flutter/material.dart';
 import 'package:gap/gap.dart';
@@ -10,11 +11,13 @@ import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/account/signin_required_overlay.dart';
-import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/current_state_action.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
+import 'package:solian/widgets/navigation/realm_switcher.dart';
+import 'package:solian/widgets/posts/post_creation.dart';
+import 'package:solian/widgets/posts/post_list.dart';
 import 'package:solian/widgets/posts/post_shuffle_swiper.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class ExploreScreen extends StatefulWidget {
   const ExploreScreen({super.key});
@@ -55,10 +58,8 @@ class _ExploreScreenState extends State<ExploreScreen>
   @override
   Widget build(BuildContext context) {
     final AuthProvider auth = Get.find();
-    final NavigationStateProvider navState = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         floatingActionButton: FloatingActionButton(
           child: const Icon(Icons.add),
@@ -81,27 +82,98 @@ class _ExploreScreenState extends State<ExploreScreen>
         body: NestedScrollView(
           headerSliverBuilder: (BuildContext context, bool innerBoxIsScrolled) {
             return [
-              SliverAppBar(
-                title: AppBarTitle('explore'.tr),
-                centerTitle: false,
+              SliverLayoutBuilder(
+                builder: (context, constraints) {
+                  final scrollOffset = constraints.scrollOffset;
+                  final colorChangeOffset = 120;
+
+                  final scrollProgress =
+                      (scrollOffset / colorChangeOffset).clamp(0.0, 1.0);
+                  final blurSigma = lerpDouble(0, 10, scrollProgress) ?? 0;
+
+                  return SliverAppBar(
+                    flexibleSpace: ClipRRect(
+                      child: BackdropFilter(
+                        filter: ImageFilter.blur(
+                          sigmaX: blurSigma,
+                          sigmaY: blurSigma,
+                        ),
+                        child: ListView(
+                          padding: EdgeInsets.zero,
+                          physics: const NeverScrollableScrollPhysics(),
+                          children: [
+                            SizedBox(
+                              height: 48,
+                              child: const Row(
+                                children: [
+                                  RealmSwitcher(),
+                                ],
+                              ).paddingSymmetric(horizontal: 8),
+                            ).paddingSymmetric(vertical: 4),
+                            TabBar(
+                              controller: _tabController,
+                              dividerHeight: scrollProgress > 0 ? 0 : 0.3,
+                              tabAlignment: TabAlignment.fill,
+                              tabs: [
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.feed, size: 20),
+                                      const Gap(8),
+                                      Text('postListNews'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.people, size: 20),
+                                      const Gap(8),
+                                      Text('postListFriends'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(
+                                        Icons.shuffle_on_outlined,
+                                        size: 20,
+                                      ),
+                                      const Gap(8),
+                                      Text('postListShuffle'.tr),
+                                    ],
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ],
+                        ).paddingOnly(top: MediaQuery.of(context).padding.top),
+                      ),
+                    ),
+                    expandedHeight: 104,
+                    snap: true,
                     floating: true,
                     toolbarHeight: AppTheme.toolbarHeight(context),
                     leading: AppBarLeadingButton.adaptive(context),
                     actions: [
                       const BackgroundStateWidget(),
+                      IconButton(
+                        icon: const Icon(Icons.search),
+                        onPressed: () {
+                          AppRouter.instance.pushNamed('postSearch');
+                        },
+                      ),
                       const NotificationButton(),
                       SizedBox(
                         width: AppTheme.isLargeScreen(context) ? 8 : 16,
                       ),
                     ],
-                bottom: TabBar(
-                  controller: _tabController,
-                  tabs: [
-                    Tab(text: 'postListNews'.tr),
-                    Tab(text: 'postListFriends'.tr),
-                    Tab(text: 'postListShuffle'.tr),
-                  ],
-                ),
+                  );
+                },
               )
             ];
           },
@@ -114,16 +186,6 @@ class _ExploreScreenState extends State<ExploreScreen>
 
             return Column(
               children: [
-                if (navState.focusedRealm.value != null)
-                  MaterialBanner(
-                    leading: const Icon(Icons.layers),
-                    content: Text(
-                      'postBrowsingIn'.trParams({
-                        'region': '#${navState.focusedRealm.value!.alias}',
-                      }),
-                    ),
-                    actions: const [SizedBox.shrink()],
-                  ),
                 Expanded(
                   child: TabBarView(
                     physics: const NeverScrollableScrollPhysics(),
@@ -132,7 +194,13 @@ class _ExploreScreenState extends State<ExploreScreen>
                       RefreshIndicator(
                         onRefresh: () => _postController.reloadAllOver(),
                         child: CustomScrollView(slivers: [
-                          PostWarpedListWidget(
+                          ControlledPostListWidget(
+                            padding: AppTheme.isLargeScreen(context)
+                                ? EdgeInsets.symmetric(
+                                    horizontal: 4,
+                                    vertical: 8,
+                                  )
+                                : EdgeInsets.zero,
                             controller: _postController.pagingController,
                             onUpdate: () => _postController.reloadAllOver(),
                           ),
@@ -143,7 +211,10 @@ class _ExploreScreenState extends State<ExploreScreen>
                           return RefreshIndicator(
                             onRefresh: () => _postController.reloadAllOver(),
                             child: CustomScrollView(slivers: [
-                              PostWarpedListWidget(
+                              ControlledPostListWidget(
+                                padding: AppTheme.isLargeScreen(context)
+                                    ? EdgeInsets.symmetric(horizontal: 16)
+                                    : EdgeInsets.zero,
                                 controller: _postController.pagingController,
                                 onUpdate: () => _postController.reloadAllOver(),
                               ),
@@ -178,106 +249,3 @@ class _ExploreScreenState extends State<ExploreScreen>
     super.dispose();
   }
 }
-
-class PostCreatePopup extends StatelessWidget {
-  final bool hideDraftBox;
-
-  const PostCreatePopup({
-    super.key,
-    this.hideDraftBox = false,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    final AuthProvider auth = Get.find();
-
-    if (auth.isAuthorized.isFalse) {
-      return const SizedBox.shrink();
-    }
-
-    final List<dynamic> actionList = [
-      (
-        icon: const Icon(Icons.post_add),
-        label: 'postEditorModeStory'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 0.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.description),
-        label: 'postEditorModeArticle'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 1.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.drafts),
-        label: 'draftBoxOpen'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed('draftBox'),
-          );
-        },
-      ),
-    ];
-
-    return SizedBox(
-      height: MediaQuery.of(context).size.height * 0.38,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
-        children: [
-          Text(
-            'postNew'.tr,
-            style: Theme.of(context).textTheme.headlineSmall,
-          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          Expanded(
-            child: GridView.count(
-              physics: const NeverScrollableScrollPhysics(),
-              crossAxisCount: 3,
-              children: actionList
-                  .map((x) => Card(
-                        color: Theme.of(context).colorScheme.surfaceContainer,
-                        child: InkWell(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(8)),
-                          onTap: x.onTap,
-                          child: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            children: [
-                              x.icon,
-                              const Gap(8),
-                              Expanded(
-                                child: Text(
-                                  x.label,
-                                  overflow: TextOverflow.fade,
-                                ),
-                              ),
-                            ],
-                          ).paddingAll(18),
-                        ),
-                      ))
-                  .toList(),
-            ).paddingSymmetric(horizontal: 20),
-          ),
-        ],
-      ),
-    );
-  }
-}

lib/screens/feed/draft_box.dart

@@ -1,114 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/models/post.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/posts/post_action.dart';
-import 'package:solian/widgets/posts/post_owned_list.dart';
-
-class DraftBoxScreen extends StatefulWidget {
-  const DraftBoxScreen({super.key});
-
-  @override
-  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
-}
-
-class _DraftBoxScreenState extends State<DraftBoxScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  _getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listDraft(pageKey);
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    if (result.count == 0) {
-      _pagingController.appendLastPage([]);
-      return;
-    }
-
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-    _pagingController.addPageRequestListener(_getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: Scaffold(
-        appBar: AppBar(
-          leading: AppBarLeadingButton.adaptive(context),
-          title: AppBarTitle('draftBox'.tr),
-          centerTitle: false,
-          toolbarHeight: AppTheme.toolbarHeight(context),
-          actions: [
-            SizedBox(
-              width: AppTheme.isLargeScreen(context) ? 8 : 16,
-            ),
-          ],
-        ),
-        body: RefreshIndicator(
-          onRefresh: () => Future.sync(() => _pagingController.refresh()),
-          child: PagedListView<int, Post>(
-            pagingController: _pagingController,
-            builderDelegate: PagedChildBuilderDelegate(
-              itemBuilder: (context, item, index) {
-                return PostOwnedListEntry(
-                  item: item,
-                  isFullContent: true,
-                  backgroundColor:
-                      Theme.of(context).colorScheme.surfaceContainerLow,
-                  onTap: () async {
-                    showModalBottomSheet(
-                      useRootNavigator: true,
-                      context: context,
-                      builder: (context) => PostAction(
-                        item: item,
-                        noReact: true,
-                      ),
-                    ).then((value) {
-                      if (value is Future) {
-                        value.then((_) {
-                          _pagingController.refresh();
-                        });
-                      } else if (value != null) {
-                        _pagingController.refresh();
-                      }
-                    });
-                  },
-                ).paddingOnly(left: 12, right: 12, bottom: 4);
-              },
-            ),
-          ),
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}

lib/screens/feed/search.dart

@@ -1,99 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
-
-import '../../models/post.dart';
-
-class FeedSearchScreen extends StatefulWidget {
-  final String? tag;
-  final String? category;
-
-  const FeedSearchScreen({super.key, this.tag, this.category});
-
-  @override
-  State<FeedSearchScreen> createState() => _FeedSearchScreenState();
-}
-
-class _FeedSearchScreenState extends State<FeedSearchScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listPost(
-        pageKey,
-        tag: widget.tag,
-        category: widget.category,
-      );
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-
-    _pagingController.addPageRequestListener(getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      body: Material(
-        color: Theme.of(context).colorScheme.surface,
-        child: Column(
-          children: [
-            if (widget.tag != null)
-              ListTile(
-                leading: const Icon(Icons.label),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('postSearchWithTag'.trParams({'key': widget.tag!})),
-              ),
-            if (widget.category != null)
-              ListTile(
-                leading: const Icon(Icons.category),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('postSearchWithCategory'
-                    .trParams({'key': widget.category!})),
-              ),
-            Expanded(
-              child: RefreshIndicator(
-                onRefresh: () => Future.sync(() => _pagingController.refresh()),
-                child: CustomScrollView(
-                  slivers: [
-                    PostWarpedListWidget(
-                      controller: _pagingController,
-                      onUpdate: () => _pagingController.refresh(),
-                    ),
-                  ],
-                ),
-              ),
-            ),
-          ],
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}

lib/screens/posts/draft_box.dart

@@ -0,0 +1,128 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/app_bar_leading.dart';
+import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/root_container.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+
+class DraftBoxScreen extends StatefulWidget {
+  const DraftBoxScreen({super.key});
+
+  @override
+  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
+}
+
+class _DraftBoxScreenState extends State<DraftBoxScreen> {
+  bool _isBusy = true;
+  int? _totalPosts;
+  final List<Post> _posts = List.empty(growable: true);
+
+  _getPosts() async {
+    setState(() => _isBusy = true);
+
+    final PostProvider posts = Get.find();
+    final resp = await posts.listDraft(_posts.length);
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    _totalPosts = result.count;
+    _posts.addAll(parsed ?? List.empty());
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _openActions(Post item) async {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => PostAction(
+        item: item,
+        noReact: true,
+      ),
+    ).then((value) {
+      if (value is Future) {
+        value.then((_) {
+          _posts.clear();
+          _getPosts();
+        });
+      } else if (value != null) {
+        _posts.clear();
+        _getPosts();
+      }
+    });
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPosts();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return RootContainer(
+      child: Scaffold(
+        appBar: AppBar(
+          leading: AppBarLeadingButton.adaptive(context),
+          title: AppBarTitle('draftBox'.tr),
+          centerTitle: false,
+          toolbarHeight: AppTheme.toolbarHeight(context),
+          actions: [
+            SizedBox(
+              width: AppTheme.isLargeScreen(context) ? 8 : 16,
+            ),
+          ],
+        ),
+        body: Column(
+          children: [
+            LoadingIndicator(isActive: _isBusy),
+            Expanded(
+              child: RefreshIndicator(
+                onRefresh: () {
+                  _posts.clear();
+                  return _getPosts();
+                },
+                child: InfiniteList(
+                  itemCount: _posts.length,
+                  hasReachedMax: _totalPosts == _posts.length,
+                  isLoading: _isBusy,
+                  onFetchData: () => _getPosts(),
+                  itemBuilder: (context, index) {
+                    final item = _posts[index];
+                    return Card(
+                      child: GestureDetector(
+                        child: Column(
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            PostItem(
+                              key: Key('p${item.id}'),
+                              item: item,
+                              isShowEmbed: false,
+                              isClickable: false,
+                              isShowReply: false,
+                              isReactable: false,
+                              onTapMore: () => _openActions(item),
+                            ).paddingSymmetric(vertical: 8),
+                          ],
+                        ),
+                        onTap: () => _openActions(item),
+                      ),
+                    ).paddingOnly(left: 12, right: 12, bottom: 4);
+                  },
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/screens/posts/post_detail.dart

@@ -4,6 +4,9 @@ import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:solian/widgets/posts/post_replies.dart';
 
@@ -22,37 +25,37 @@ class PostDetailScreen extends StatefulWidget {
 }
 
 class _PostDetailScreenState extends State<PostDetailScreen> {
-  Post? item;
+  bool _isBusy = true;
 
-  Future<Post?> getDetail() async {
-    if (widget.post != null) {
-      item = widget.post;
-      Get.find<LastReadProvider>().feedLastReadAt = item?.id;
-      return widget.post;
-    }
+  Post? _item;
 
-    final PostProvider provider = Get.find();
+  Future<void> _getDetail() async {
+    final PostProvider posts = Get.find();
 
     try {
-      final resp = await provider.getPost(widget.id);
-      item = Post.fromJson(resp.body);
+      final resp = await posts.getPost(widget.id);
+      _item = Post.fromJson(resp.body);
     } catch (e) {
       context.showErrorDialog(e).then((_) => Navigator.pop(context));
     }
 
-    Get.find<LastReadProvider>().feedLastReadAt = item?.id;
+    Get.find<LastReadProvider>().feedLastReadAt = _item?.id;
 
-    return item;
+    if (mounted) setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    if (widget.post != null) {
+      _item = widget.post;
+    }
+    _getDetail();
   }
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: FutureBuilder(
-        future: getDetail(),
-        builder: (context, snapshot) {
-          if (!snapshot.hasData || snapshot.data == null) {
+    if (_isBusy && _item == null) {
       return const Center(
         child: CircularProgressIndicator(),
       );
@@ -60,20 +63,48 @@ class _PostDetailScreenState extends State<PostDetailScreen> {
 
     return CustomScrollView(
       slivers: [
+        SliverToBoxAdapter(
+          child: LoadingIndicator(isActive: _isBusy),
+        ),
         SliverToBoxAdapter(
           child: PostItem(
-                  item: item!,
+            key: ValueKey(_item),
+            item: _item!,
             isClickable: false,
             isOverrideEmbedClickable: true,
             isFullDate: true,
-                  isFullContent: true,
             isShowReply: false,
             isContentSelectable: true,
+            padding: AppTheme.isLargeScreen(context)
+                ? EdgeInsets.symmetric(
+                    horizontal: 4,
+                    vertical: 8,
+                  )
+                : EdgeInsets.zero,
+            onTapMore: () {
+              showModalBottomSheet(
+                useRootNavigator: true,
+                context: context,
+                builder: (context) => PostAction(
+                  item: _item!,
+                  noReact: true,
+                ),
+              ).then((value) {
+                if (value is Future) {
+                  value.then((_) {
+                    _getDetail();
+                  });
+                } else if (value != null) {
+                  _getDetail();
+                }
+              });
+            },
           ),
         ),
         SliverToBoxAdapter(
-                child: const Divider(thickness: 0.3, height: 1)
-                    .paddingOnly(top: 4),
+          child: const Divider(thickness: 0.3, height: 1).paddingOnly(
+            top: 8,
+          ),
         ),
         SliverToBoxAdapter(
           child: Align(
@@ -84,14 +115,19 @@ class _PostDetailScreenState extends State<PostDetailScreen> {
             ).paddingOnly(left: 24, right: 24, top: 16),
           ),
         ),
-              PostReplyList(item: item!),
+        PostReplyList(
+          item: _item!,
+          padding: AppTheme.isLargeScreen(context)
+              ? EdgeInsets.symmetric(
+                  horizontal: 4,
+                  vertical: 8,
+                )
+              : EdgeInsets.zero,
+        ),
         SliverToBoxAdapter(
           child: SizedBox(height: MediaQuery.of(context).padding.bottom),
         ),
       ],
     );
-        },
-      ),
-    );
   }
 }

lib/screens/posts/post_editor.dart

@@ -16,9 +16,11 @@ import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/markdown_text_content.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:badges/badges.dart' as badges;
+import 'package:solian/widgets/root_container.dart';
 
 class PostPublishArguments {
   final Post? edit;
@@ -151,8 +153,7 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
       )
     ];
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -182,7 +183,10 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
           crossAxisAlignment: CrossAxisAlignment.start,
           children: [
             ListTile(
-              tileColor: Theme.of(context).colorScheme.surfaceContainerLow,
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainerLow
+                  .withOpacity(0.5),
               title: Column(
                 crossAxisAlignment: CrossAxisAlignment.start,
                 children: [
@@ -271,117 +275,71 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                   ),
                 ],
               ),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
             Expanded(
-              child: Row(
+              child: DefaultTabController(
+                length: 2,
+                child: AppTheme.isLargeScreen(context)
+                    ? Row(
                         crossAxisAlignment: CrossAxisAlignment.start,
                         children: [
                           Expanded(
-                    child: Column(
-                      children: [
-                        Expanded(
-                          child: ListView(
-                            children: [
-                              Container(
-                                padding: const EdgeInsets.symmetric(
-                                  horizontal: 16,
-                                  vertical: 8,
-                                ),
-                                child: TextField(
-                                  maxLines: null,
-                                  autofocus: true,
-                                  autocorrect: true,
-                                  keyboardType: TextInputType.multiline,
-                                  controller:
-                                      _editorController.contentController,
+                            child: _PostEditorTextField(
                               focusNode: _contentFocusNode,
-                                  decoration: InputDecoration.collapsed(
-                                    hintText: 'postContentPlaceholder'.tr,
-                                  ),
-                                  onTapOutside: (_) => FocusManager
-                                      .instance.primaryFocus
-                                      ?.unfocus(),
+                              controller: _editorController,
+                              onUpdate: () => setState(() {}),
                             ),
                           ),
-                              const Gap(120)
-                            ],
-                          ),
-                        ),
-                        Obx(() {
-                          final textStyle = TextStyle(
-                            fontSize: 12,
-                            color: Theme.of(context)
-                                .colorScheme
-                                .onSurface
-                                .withOpacity(0.75),
-                          );
-                          final showFactors = [
-                            _editorController.isRestoreFromLocal.value,
-                            _editorController.lastSaveTime.value != null,
-                          ];
-                          final doShow = showFactors.any((x) => x);
-                          return Container(
-                            padding: const EdgeInsets.symmetric(
-                              vertical: 4,
-                              horizontal: 16,
-                            ),
-                            child: Row(
-                              children: [
-                                if (showFactors[0])
-                                  Text('postRestoreFromLocal'.tr,
-                                          style: textStyle)
-                                      .paddingOnly(right: 4),
-                                if (showFactors[0])
-                                  InkWell(
-                                    child: Text('clear'.tr, style: textStyle),
-                                    onTap: () {
-                                      _editorController.localClear();
-                                      _editorController.currentClear();
-                                      setState(() {});
-                                    },
-                                  ),
-                                if (showFactors.where((x) => x).length > 1)
-                                  Text(
-                                    '·',
-                                    style: textStyle,
-                                  ).paddingSymmetric(horizontal: 8),
-                                if (showFactors[1])
-                                  Text(
-                                    'postAutoSaveAt'.trParams({
-                                      'date': DateFormat('HH:mm:ss').format(
-                                        _editorController.lastSaveTime.value ??
-                                            DateTime.now(),
-                                      )
-                                    }),
-                                    style: textStyle,
-                                  ),
-                              ],
-                            ),
-                          )
-                              .animate(
-                                key: const Key('post-editor-hint-animation'),
-                                target: doShow ? 1 : 0,
-                              )
-                              .fade(curve: Curves.easeInOut, duration: 300.ms);
-                        }),
-                      ],
-                    ),
-                  ),
-                  if (AppTheme.isLargeScreen(context))
                           const VerticalDivider(width: 0.3, thickness: 0.3)
-                        .paddingSymmetric(
-                      horizontal: 16,
-                    ),
-                  if (AppTheme.isLargeScreen(context))
+                              .paddingSymmetric(horizontal: 16),
                           Expanded(
                             child: SingleChildScrollView(
+                              padding:
+                                  const EdgeInsets.only(top: 12, bottom: 64),
                               child: MarkdownTextContent(
-                          content: _editorController.contentController.text,
+                                isAutoWarp: _editorController.mode.value == 0,
+                                content:
+                                    _editorController.contentController.text,
                                 parentId: 'post-editor-preview',
-                        ).paddingOnly(top: 12, right: 16),
+                              ).paddingOnly(right: 16),
                             ),
                           ),
                         ],
+                      )
+                    : Column(
+                        children: [
+                          TabBar(
+                            tabs: [
+                              const Tab(icon: Icon(Icons.edit)),
+                              const Tab(icon: Icon(Icons.preview)),
+                            ],
+                          ),
+                          Expanded(
+                            child: TabBarView(
+                              children: [
+                                _PostEditorTextField(
+                                  focusNode: _contentFocusNode,
+                                  controller: _editorController,
+                                  onUpdate: () => setState(() {}),
+                                ),
+                                SingleChildScrollView(
+                                  padding: const EdgeInsets.only(
+                                    top: 12,
+                                    bottom: 64,
+                                  ),
+                                  child: MarkdownTextContent(
+                                    isAutoWarp:
+                                        _editorController.mode.value == 0,
+                                    content: _editorController
+                                        .contentController.text,
+                                    parentId: 'post-editor-preview',
+                                  ).paddingOnly(left: 16, right: 16),
+                                )
+                              ],
+                            ),
+                          ),
+                        ],
+                      ),
               ),
             ),
             Material(
@@ -390,6 +348,26 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                 crossAxisAlignment: CrossAxisAlignment.start,
                 children: [
                   const Divider(thickness: 0.3, height: 0.3),
+                  SizedBox(
+                    height: 40,
+                    child: SingleChildScrollView(
+                      scrollDirection: Axis.horizontal,
+                      child: MarkdownToolbar(
+                        width: 38,
+                        height: 38,
+                        iconSize: 20,
+                        spacing: 8,
+                        hideImage: true,
+                        useIncludedTextField: false,
+                        backgroundColor: Theme.of(context).colorScheme.surface,
+                        iconColor: Theme.of(context).colorScheme.onSurface,
+                        controller: _editorController.contentController,
+                        focusNode: _contentFocusNode,
+                        borderRadius:
+                            const BorderRadius.all(Radius.circular(20)),
+                      ).paddingSymmetric(horizontal: 12),
+                    ),
+                  ).paddingOnly(top: 12),
                   SizedBox(
                     height: 56,
                     child: ListView(
@@ -519,7 +497,7 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                                 top: -4,
                                 end: -6,
                               ),
-                              child: const Icon(Icons.preview),
+                              child: const Icon(Icons.wallpaper),
                             );
                           }),
                           color: Theme.of(context).colorScheme.primary,
@@ -546,18 +524,6 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                             _editorController.editPublishDate(context);
                           },
                         ),
-                        MarkdownToolbar(
-                          hideImage: true,
-                          useIncludedTextField: false,
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surface,
-                          iconColor: Theme.of(context).colorScheme.onSurface,
-                          controller: _editorController.contentController,
-                          focusNode: _contentFocusNode,
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(20)),
-                          width: 40,
-                        ).paddingSymmetric(horizontal: 2),
                       ],
                     ).paddingSymmetric(horizontal: 6, vertical: 8),
                   ),
@@ -577,3 +543,101 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
     super.dispose();
   }
 }
+
+class _PostEditorTextField extends StatelessWidget {
+  final FocusNode focusNode;
+  final PostEditorController controller;
+  final Function onUpdate;
+
+  const _PostEditorTextField({
+    required this.focusNode,
+    required this.controller,
+    required this.onUpdate,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        Expanded(
+          child: ListView(
+            children: [
+              Container(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 16,
+                  vertical: 8,
+                ),
+                child: TextField(
+                  maxLines: null,
+                  autofocus: true,
+                  autocorrect: true,
+                  keyboardType: TextInputType.multiline,
+                  controller: controller.contentController,
+                  focusNode: focusNode,
+                  decoration: InputDecoration.collapsed(
+                    hintText: 'postContentPlaceholder'.tr,
+                  ),
+                  onTapOutside: (_) =>
+                      FocusManager.instance.primaryFocus?.unfocus(),
+                ),
+              ),
+              const Gap(120)
+            ],
+          ),
+        ),
+        Obx(() {
+          final textStyle = TextStyle(
+            fontSize: 12,
+            color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+          );
+          final showFactors = [
+            controller.isRestoreFromLocal.value,
+            controller.lastSaveTime.value != null,
+          ];
+          final doShow = showFactors.any((x) => x);
+          return Container(
+            padding: const EdgeInsets.symmetric(
+              vertical: 4,
+              horizontal: 16,
+            ),
+            child: Row(
+              children: [
+                if (showFactors[0])
+                  Text('postRestoreFromLocal'.tr, style: textStyle)
+                      .paddingOnly(right: 4),
+                if (showFactors[0])
+                  InkWell(
+                    child: Text('clear'.tr, style: textStyle),
+                    onTap: () {
+                      controller.localClear();
+                      controller.currentClear();
+                      onUpdate();
+                    },
+                  ),
+                if (showFactors.where((x) => x).length > 1)
+                  Text(
+                    '·',
+                    style: textStyle,
+                  ).paddingSymmetric(horizontal: 8),
+                if (showFactors[1])
+                  Text(
+                    'postAutoSaveAt'.trParams({
+                      'date': DateFormat('HH:mm:ss').format(
+                        controller.lastSaveTime.value ?? DateTime.now(),
+                      )
+                    }),
+                    style: textStyle,
+                  ),
+              ],
+            ),
+          )
+              .animate(
+                key: const Key('post-editor-hint-animation'),
+                target: doShow ? 1 : 0,
+              )
+              .fade(curve: Curves.easeInOut, duration: 300.ms);
+        }),
+      ],
+    );
+  }
+}

lib/screens/posts/post_search.dart

@@ -0,0 +1,206 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_list.dart';
+
+import '../../models/post.dart';
+
+class PostSearchScreen extends StatefulWidget {
+  final String? tag;
+  final String? category;
+
+  const PostSearchScreen({super.key, this.tag, this.category});
+
+  @override
+  State<PostSearchScreen> createState() => _PostSearchScreenState();
+}
+
+class _PostSearchScreenState extends State<PostSearchScreen> {
+  int? _totalCount;
+  Duration? _lastTook;
+
+  final TextEditingController _probeController = TextEditingController();
+  final PagingController<int, Post> _pagingController =
+      PagingController(firstPageKey: 0);
+
+  late bool _isBusy = widget.tag != null || widget.category != null;
+
+  _searchPosts(int pageKey) async {
+    if (widget.tag == null &&
+        widget.category == null &&
+        _probeController.text.isEmpty) {
+      _pagingController.appendLastPage([]);
+      return;
+    }
+
+    if (!_isBusy) {
+      setState(() => _isBusy = true);
+    }
+
+    if (pageKey == 0) {
+      _pagingController.itemList?.clear();
+      _pagingController.nextPageKey = 0;
+    }
+
+    final PostProvider posts = Get.find();
+
+    Stopwatch stopwatch = new Stopwatch()..start();
+
+    Response resp;
+    try {
+      if (_probeController.text.isEmpty) {
+        resp = await posts.listPost(
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      } else {
+        resp = await posts.searchPost(
+          _probeController.text,
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      }
+    } catch (e) {
+      _pagingController.error = e;
+      return;
+    }
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    if (parsed != null && parsed.length >= 10) {
+      _pagingController.appendPage(parsed, pageKey + parsed.length);
+    } else if (parsed != null) {
+      _pagingController.appendLastPage(parsed);
+    }
+
+    stopwatch.stop();
+
+    _totalCount = result.count;
+    _lastTook = stopwatch.elapsed;
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _pagingController.addPageRequestListener(_searchPosts);
+  }
+
+  @override
+  void dispose() {
+    _probeController.dispose();
+    _pagingController.dispose();
+    super.dispose();
+  }
+
+  Color get _unFocusColor =>
+      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: Column(
+        children: [
+          if (widget.tag != null)
+            ListTile(
+              leading: const Icon(Icons.label),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithTag'.trParams({'key': widget.tag!})),
+            ),
+          if (widget.category != null)
+            ListTile(
+              leading: const Icon(Icons.category),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithCategory'.trParams({
+                'key': widget.category!,
+              })),
+            ),
+          Container(
+            color: Theme.of(context)
+                .colorScheme
+                .secondaryContainer
+                .withOpacity(0.5),
+            padding: const EdgeInsets.symmetric(horizontal: 24, vertical: 16),
+            child: TextField(
+              controller: _probeController,
+              decoration: InputDecoration(
+                isCollapsed: true,
+                border: InputBorder.none,
+                hintText: 'search'.tr,
+              ),
+              onSubmitted: (_) {
+                _searchPosts(0);
+              },
+            ),
+          ),
+          LoadingIndicator(isActive: _isBusy),
+          if (_totalCount != null || _lastTook != null)
+            Container(
+              padding: const EdgeInsets.symmetric(horizontal: 20, vertical: 4),
+              child: Row(
+                children: [
+                  Icon(
+                    Icons.summarize_outlined,
+                    size: 16,
+                    color: _unFocusColor,
+                  ),
+                  const Gap(4),
+                  if (_totalCount != null)
+                    Text(
+                      'searchResult'.trParams({
+                        'count': _totalCount!.toString(),
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                  const Gap(4),
+                  if (_lastTook != null)
+                    Text(
+                      'searchTook'.trParams({
+                        'time':
+                            '${(_lastTook!.inMilliseconds / 1000).toStringAsFixed(3)}s',
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                ],
+              ),
+            ),
+          Expanded(
+            child: RefreshIndicator(
+              onRefresh: () => Future.sync(() => _pagingController.refresh()),
+              child: CustomScrollView(
+                slivers: [
+                  ControlledPostListWidget(
+                    controller: _pagingController,
+                    onUpdate: () => _pagingController.refresh(),
+                  ),
+                  SliverGap(MediaQuery.of(context).padding.bottom),
+                ],
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/screens/realms.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/realm.dart';
@@ -15,6 +14,8 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 
 class RealmListScreen extends StatefulWidget {
@@ -58,8 +59,7 @@ class _RealmListScreenState extends State<RealmListScreen> {
   Widget build(BuildContext context) {
     final AuthProvider auth = Get.find();
 
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -93,12 +93,13 @@ class _RealmListScreenState extends State<RealmListScreen> {
 
           return Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               Expanded(
                 child: CenteredContainer(
                   child: RefreshIndicator(
                     onRefresh: () => _getRealms(),
                     child: ListView.builder(
+                      padding: const EdgeInsets.symmetric(vertical: 16),
                       itemCount: _realms.length,
                       itemBuilder: (context, index) {
                         final element = _realms[index];
@@ -155,7 +156,7 @@ class _RealmListScreenState extends State<RealmListScreen> {
                                 size: 18,
                               ),
                             )
-                          : AccountAvatar(
+                          : AttachedCircleAvatar(
                               content: element.avatar!,
                               bgColor: Theme.of(context).colorScheme.primary,
                             ),

lib/screens/realms/realm_detail.dart

@@ -7,6 +7,7 @@ import 'package:solian/router.dart';
 import 'package:solian/screens/realms/realm_organize.dart';
 import 'package:solian/widgets/realms/realm_deletion.dart';
 import 'package:solian/widgets/realms/realm_member.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class RealmDetailScreen extends StatefulWidget {
   final String alias;
@@ -86,7 +87,8 @@ class _RealmDetailScreenState extends State<RealmDetailScreen> {
       ),
     ];
 
-    return Column(
+    return RootContainer(
+      child: Column(
         children: [
           Padding(
             padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
@@ -141,6 +143,7 @@ class _RealmDetailScreenState extends State<RealmDetailScreen> {
             ),
           ),
         ],
+      ),
     );
   }
 }

lib/screens/realms/realm_organize.dart

@@ -1,19 +1,19 @@
-import 'dart:io';
-
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
 import 'package:image_picker/image_picker.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/models/realm.dart';
+import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';
 
 class RealmOrganizeArguments {
@@ -84,9 +84,12 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) return;
 
+    XFile file;
+
     final image = await _imagePicker.pickImage(source: ImageSource.gallery);
     if (image == null) return;
 
+    if (PlatformInfo.canCropImage) {
       CroppedFile? croppedFile = await ImageCropper().cropImage(
         sourcePath: image.path,
         uiSettings: [
@@ -113,7 +116,10 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
       );
 
       if (croppedFile == null) return;
-    final file = File(croppedFile.path);
+      file = XFile(croppedFile.path);
+    } else {
+      file = XFile(image.path);
+    }
 
     setState(() => _isBusy = true);
 
@@ -184,8 +190,7 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: Scaffold(
         appBar: AppBar(
           leading: AppBarLeadingButton.adaptive(context),
@@ -203,7 +208,7 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
           top: false,
           child: Column(
             children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
               if (widget.edit != null)
                 MaterialBanner(
                   leading: const Icon(Icons.edit),

lib/screens/realms/realm_view.dart

@@ -16,6 +16,7 @@ import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/channel/channel_list.dart';
 import 'package:solian/widgets/posts/post_list.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class RealmViewScreen extends StatefulWidget {
   final String alias;
@@ -68,12 +69,7 @@ class _RealmViewScreenState extends State<RealmViewScreen> {
       _channels.addAll(
         resp.body.map((e) => Channel.fromJson(e)).toList().cast<Channel>(),
       );
-      _channels.addAll(
-        availableResp.body
-            .map((e) => Channel.fromJson(e))
-            .toList()
-            .cast<Channel>(),
-      );
+      _channels.addAll(availableResp);
       _channels.retainWhere((x) => channelIdx.add(x.id));
     });
 
@@ -91,8 +87,7 @@ class _RealmViewScreenState extends State<RealmViewScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return RootContainer(
       child: DefaultTabController(
         length: 2,
         child: NestedScrollView(
@@ -260,7 +255,6 @@ class RealmChannelListWidget extends StatelessWidget {
             child: ChannelListWidget(
               channels: channels,
               selfId: auth.userProfile.value!['id'],
-              noCategory: true,
             ),
           )
         ],

lib/screens/settings.dart

@@ -1,16 +1,23 @@
+import 'dart:convert';
+import 'dart:io';
+
+import 'package:dropdown_button2/dropdown_button2.dart';
 import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:image_picker/image_picker.dart';
 import 'package:in_app_review/in_app_review.dart';
+import 'package:path_provider/path_provider.dart';
 import 'package:provider/provider.dart';
 import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/database/database.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/router.dart';
-import 'package:solian/theme.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
 
 class SettingScreen extends StatefulWidget {
@@ -22,6 +29,7 @@ class SettingScreen extends StatefulWidget {
 
 class _SettingScreenState extends State<SettingScreen> {
   SharedPreferences? _prefs;
+  String _docBasepath = '/';
 
   Widget _buildCaptionHeader(String title) {
     return Container(
@@ -32,39 +40,38 @@ class _SettingScreenState extends State<SettingScreen> {
     );
   }
 
-  Widget _buildThemeColorButton(String label, Color color) {
-    return IconButton(
-      icon: Icon(Icons.circle, color: color),
-      tooltip: label,
-      onPressed: () {
-        context.read<ThemeSwitcher>().setTheme(
-              AppTheme.build(
-                Brightness.light,
-                seedColor: color,
+  static final List<SolianThemeData> _presentTheme = [
+    SolianThemeData(
+      id: 'themeColorRed',
+      seedColor: const Color.fromRGBO(154, 98, 91, 1),
     ),
-              AppTheme.build(
-                Brightness.dark,
-                seedColor: color,
+    SolianThemeData(
+      id: 'themeColorBlue',
+      seedColor: const Color.fromRGBO(103, 96, 193, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorMiku',
+      seedColor: const Color.fromRGBO(56, 120, 126, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorKagamine',
+      seedColor: const Color.fromRGBO(244, 183, 63, 1),
+    ),
+    SolianThemeData(
+      id: 'themeColorLuka',
+      seedColor: const Color.fromRGBO(243, 174, 218, 1),
     ),
-            );
-        _prefs?.setInt('global_theme_color', color.value);
-        context.clearSnackbar();
-        context.showSnackbar('themeColorApplied'.tr);
-      },
-    );
-  }
-
-  static final List<(String, Color)> _presentTheme = [
-    ('themeColorRed', const Color.fromRGBO(154, 98, 91, 1)),
-    ('themeColorBlue', const Color.fromRGBO(103, 96, 193, 1)),
-    ('themeColorMiku', const Color.fromRGBO(56, 120, 126, 1)),
-    ('themeColorKagamine', const Color.fromRGBO(244, 183, 63, 1)),
-    ('themeColorLuka', const Color.fromRGBO(243, 174, 218, 1)),
   ];
 
   @override
   void initState() {
     super.initState();
+    getApplicationDocumentsDirectory().then((dir) {
+      _docBasepath = dir.path;
+      if (mounted) {
+        setState(() {});
+      }
+    });
     SharedPreferences.getInstance().then((inst) {
       _prefs = inst;
       if (mounted) {
@@ -75,19 +82,103 @@ class _SettingScreenState extends State<SettingScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
-      child: ListView(
+    return ListView(
       children: [
-          _buildCaptionHeader('themeColor'.tr),
-          SizedBox(
-            height: 56,
-            child: ListView(
-              scrollDirection: Axis.horizontal,
-              children: _presentTheme
-                  .map((x) => _buildThemeColorButton(x.$1, x.$2))
+        _buildCaptionHeader('theme'.tr),
+        ListTile(
+          leading: const Icon(Icons.palette),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('globalTheme'.tr),
+          trailing: DropdownButtonHideUnderline(
+            child: DropdownButton2<SolianThemeData>(
+              isExpanded: true,
+              hint: Text(
+                'theme'.tr,
+                style: TextStyle(
+                  fontSize: 14,
+                  color: Theme.of(context).hintColor,
+                ),
+              ),
+              items: _presentTheme
+                  .map((SolianThemeData item) =>
+                      DropdownMenuItem<SolianThemeData>(
+                        value: item,
+                        child: Row(
+                          crossAxisAlignment: CrossAxisAlignment.center,
+                          children: [
+                            Icon(Icons.circle, color: item.seedColor),
+                            const Gap(8),
+                            Expanded(
+                              child: Text(
+                                item.id.tr,
+                                maxLines: 1,
+                                overflow: TextOverflow.ellipsis,
+                                style: const TextStyle(
+                                  fontSize: 14,
+                                ),
+                              ),
+                            ),
+                          ],
+                        ),
+                      ))
                   .toList(),
-            ).paddingSymmetric(horizontal: 12, vertical: 8),
+              value: (_prefs?.containsKey('global_theme') ?? false)
+                  ? SolianThemeData.fromJson(
+                      jsonDecode(_prefs!.getString('global_theme')!),
+                    )
+                  : null,
+              onChanged: (SolianThemeData? value) {
+                context.read<ThemeSwitcher>().setThemeData(value);
+                setState(() {});
+              },
+              buttonStyleData: const ButtonStyleData(
+                padding: EdgeInsets.symmetric(horizontal: 8),
+                height: 40,
+                width: 140,
+              ),
+              menuItemStyleData: const MenuItemStyleData(
+                height: 40,
+              ),
+            ),
+          ),
+        ),
+        CheckboxListTile(
+          secondary: const Icon(Icons.military_tech),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('agedTheme'.tr),
+          subtitle: Text('agedThemeDesc'.tr),
+          value: _prefs?.getBool('aged_theme') ?? false,
+          onChanged: (value) {
+            if (value != null) {
+              context.read<ThemeSwitcher>().setAgedTheme(value);
+            }
+            setState(() {});
+          },
+        ),
+        if (!PlatformInfo.isWeb)
+          ListTile(
+            leading: const Icon(Icons.wallpaper),
+            contentPadding: const EdgeInsets.only(left: 22, right: 31),
+            title: Text('appBackgroundImage'.tr),
+            subtitle: Text('appBackgroundImageDesc'.tr),
+            trailing: File('$_docBasepath/app_background_image').existsSync()
+                ? const Icon(Icons.check_box)
+                : const Icon(Icons.check_box_outline_blank),
+            onTap: () async {
+              if (File('$_docBasepath/app_background_image').existsSync()) {
+                File('$_docBasepath/app_background_image').deleteSync();
+              } else {
+                final image = await ImagePicker().pickImage(
+                  source: ImageSource.gallery,
+                );
+                if (image == null) return;
+
+                await File(image.path)
+                    .copy('$_docBasepath/app_background_image');
+              }
+
+              setState(() {});
+            },
           ),
         _buildCaptionHeader('notification'.tr),
         Tooltip(
@@ -107,8 +198,7 @@ class _SettingScreenState extends State<SettingScreen> {
                 )
               ],
             ),
-              value:
-                  _prefs?.getBool('service_background_notification') ?? false,
+            value: _prefs?.getBool('service_background_notification') ?? false,
             onChanged: (value) {
               _prefs
                   ?.setBool('service_background_notification', value ?? false)
@@ -126,9 +216,7 @@ class _SettingScreenState extends State<SettingScreen> {
           subtitle: Text('updateCheckStrictlyDesc'.tr),
           value: _prefs?.getBool('check_update_strictly') ?? false,
           onChanged: (value) {
-              _prefs
-                  ?.setBool('check_update_strictly', value ?? false)
-                  .then((_) {
+            _prefs?.setBool('check_update_strictly', value ?? false).then((_) {
               setState(() {});
             });
           },
@@ -181,6 +269,21 @@ class _SettingScreenState extends State<SettingScreen> {
             ],
           );
         }),
+        _buildCaptionHeader('performance'.tr),
+        CheckboxListTile(
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          secondary: const Icon(Icons.message),
+          title: Text('animatedMessageList'.tr),
+          subtitle: Text('animatedMessageListDesc'.tr),
+          value: _prefs?.getBool('non_animated_message_list') ?? false,
+          onChanged: (value) {
+            _prefs
+                ?.setBool('non_animated_message_list', value ?? false)
+                .then((_) {
+              setState(() {});
+            });
+          },
+        ),
         _buildCaptionHeader('more'.tr),
         ListTile(
           leading: const Icon(Icons.delete_sweep),
@@ -231,7 +334,6 @@ class _SettingScreenState extends State<SettingScreen> {
           },
         ),
       ],
-      ),
     );
   }
 }

lib/shells/root_shell.dart

@@ -2,7 +2,9 @@ import 'package:firebase_analytics/firebase_analytics.dart';
 import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/theme.dart';
-import 'package:solian/widgets/navigation/app_navigation_drawer.dart';
+import 'package:solian/widgets/navigation/app_navigation.dart';
+import 'package:solian/widgets/navigation/app_navigation_bottom.dart';
+import 'package:solian/widgets/navigation/app_navigation_rail.dart';
 
 final GlobalKey<ScaffoldState> rootScaffoldKey = GlobalKey<ScaffoldState>();
 
@@ -39,17 +41,29 @@ class RootShell extends StatelessWidget {
       );
     }
 
+    final showRailNavigation = AppTheme.isLargeScreen(context);
+
+    final destNames = AppNavigation.destinations.map((x) => x.page).toList();
+    final showBottomNavigation =
+        destNames.contains(routeName) && !showRailNavigation;
+
     return Scaffold(
       key: rootScaffoldKey,
-      drawer: AppTheme.isLargeScreen(context)
-          ? null
-          : AppNavigationDrawer(routeName: routeName),
+      backgroundColor: Theme.of(context).colorScheme.surface,
+      bottomNavigationBar: showBottomNavigation
+          ? AppNavigationBottom(
+              initialIndex: destNames.indexOf(routeName ?? 'page'),
+            )
+          : null,
       body: AppTheme.isLargeScreen(context)
           ? Row(
               children: [
-                if (showNavigation) AppNavigationDrawer(routeName: routeName),
-                if (showNavigation)
-                  const VerticalDivider(thickness: 0.3, width: 1),
+                if (showRailNavigation) const AppNavigationRail(),
+                if (showRailNavigation)
+                  const VerticalDivider(
+                    width: 0.3,
+                    thickness: 0.3,
+                  ),
                 Expanded(child: child),
               ],
             )

lib/shells/sidebar_shell.dart

@@ -1,62 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:go_router/go_router.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/sidebar/sidebar_placeholder.dart';
-
-class SidebarShell extends StatelessWidget {
-  final bool showAppBar;
-  final GoRouterState state;
-  final Widget child;
-
-  final bool sidebarFirst;
-  final Widget? sidebar;
-
-  const SidebarShell({
-    super.key,
-    required this.child,
-    required this.state,
-    this.showAppBar = true,
-    this.sidebarFirst = false,
-    this.sidebar,
-  });
-
-  List<Widget> buildContent(BuildContext context) {
-    return [
-      Flexible(
-        flex: 2,
-        child: child,
-      ),
-      if (AppTheme.isExtraLargeScreen(context))
-        const VerticalDivider(thickness: 0.3, width: 1),
-      if (AppTheme.isExtraLargeScreen(context))
-        Flexible(
-          flex: 1,
-          child: sidebar ?? const SidebarPlaceholder(),
-        ),
-    ];
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      appBar: showAppBar
-          ? AppBar(
-              leading: AppBarLeadingButton.adaptive(context),
-              title: AppBarTitle(state.topRoute?.name?.tr ?? 'page'.tr),
-              centerTitle: false,
-              toolbarHeight: AppTheme.toolbarHeight(context),
-            )
-          : null,
-      body: AppTheme.isLargeScreen(context)
-          ? Row(
-              children: sidebarFirst
-                  ? buildContent(context).reversed.toList()
-                  : buildContent(context),
-            )
-          : child,
-    );
-  }
-}

lib/shells/title_shell.dart

@@ -5,10 +5,12 @@ import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/root_container.dart';
 
 class TitleShell extends StatelessWidget {
   final bool showAppBar;
   final bool isCenteredTitle;
+  final bool isResponsive;
   final String? title;
   final GoRouterState? state;
   final Widget child;
@@ -20,13 +22,14 @@ class TitleShell extends StatelessWidget {
     this.state,
     this.showAppBar = true,
     this.isCenteredTitle = false,
+    this.isResponsive = false,
   });
 
   @override
   Widget build(BuildContext context) {
     assert(state != null || title != null);
 
-    return Scaffold(
+    final widget = Scaffold(
       appBar: showAppBar
           ? AppBar(
               leading: AppBarLeadingButton.adaptive(context),
@@ -45,5 +48,11 @@ class TitleShell extends StatelessWidget {
           : null,
       body: child,
     );
+
+    if (isResponsive) {
+      return ResponsiveRootContainer(child: widget);
+    } else {
+      return RootContainer(child: widget);
+    }
   }
 }

lib/theme.dart

@@ -1,4 +1,5 @@
 import 'package:flutter/material.dart';
+import 'package:solian/models/theme.dart';
 import 'package:solian/platform.dart';
 
 abstract class AppTheme {
@@ -6,7 +7,10 @@ abstract class AppTheme {
       MediaQuery.of(context).size.width > 640;
 
   static bool isExtraLargeScreen(BuildContext context) =>
-      MediaQuery.of(context).size.width > 720;
+      MediaQuery.of(context).size.width > 920;
+
+  static bool isUltraLargeScreen(BuildContext context) =>
+      MediaQuery.of(context).size.width > 1200;
 
   static bool isSpecializedMacOS(BuildContext context) =>
       PlatformInfo.isMacOS && !AppTheme.isLargeScreen(context);
@@ -38,6 +42,10 @@ abstract class AppTheme {
       snackBarTheme: const SnackBarThemeData(
         behavior: SnackBarBehavior.floating,
       ),
+      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(
+        backgroundColor: Colors.transparent,
+      ),
       fontFamily: 'Comfortaa',
       fontFamilyFallback: [
         'NotoSansSC',
@@ -52,4 +60,37 @@ abstract class AppTheme {
       ),
     );
   }
+
+  static ThemeData buildFromData(
+    Brightness brightness,
+    SolianThemeData data, {
+    bool useMaterial3 = true,
+  }) {
+    return ThemeData(
+      brightness: brightness,
+      useMaterial3: useMaterial3,
+      colorScheme: ColorScheme.fromSeed(
+        brightness: brightness,
+        seedColor: data.seedColor,
+      ),
+      snackBarTheme: const SnackBarThemeData(
+        behavior: SnackBarBehavior.floating,
+      ),
+      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(backgroundColor: Colors.transparent),
+      fontFamily: data.fontFamily ?? 'Comfortaa',
+      fontFamilyFallback: data.fontFamilyFallback ??
+          [
+            'NotoSansSC',
+            'NotoSansHK',
+            'NotoSansJP',
+            if (PlatformInfo.isWeb) 'NotoSansEmoji',
+          ],
+      typography: Typography.material2021(
+        colorScheme: brightness == Brightness.light
+            ? const ColorScheme.light()
+            : const ColorScheme.dark(),
+      ),
+    );
+  }
 }

lib/widgets/account/account_avatar.dart

@@ -1,19 +1,22 @@
 import 'package:flutter/material.dart';
 import 'package:solian/services.dart';
+import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 
-class AccountAvatar extends StatelessWidget {
+class AttachedCircleAvatar extends StatelessWidget {
   final dynamic content;
   final Color? bgColor;
   final Color? feColor;
   final double? radius;
+  final Widget? fallbackWidget;
 
-  const AccountAvatar({
+  const AttachedCircleAvatar({
     super.key,
     required this.content,
     this.bgColor,
     this.feColor,
     this.radius,
+    this.fallbackWidget,
   });
 
   @override
@@ -35,12 +38,61 @@ class AccountAvatar extends StatelessWidget {
       backgroundColor: bgColor,
       backgroundImage: !isEmpty ? AutoCacheImage.provider(url) : null,
       child: isEmpty
-          ? Icon(
+          ? (fallbackWidget ??
+              Icon(
+                Icons.image,
+                size: radius != null ? radius! * 1.2 : 24,
+                color: feColor,
+              ))
+          : null,
+    );
+  }
+}
+
+class AccountAvatar extends StatelessWidget {
+  final dynamic content;
+  final String username;
+  final Color? bgColor;
+  final Color? feColor;
+  final double? radius;
+  final Widget? fallbackWidget;
+
+  const AccountAvatar({
+    super.key,
+    required this.content,
+    required this.username,
+    this.bgColor,
+    this.feColor,
+    this.radius,
+    this.fallbackWidget,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: AttachedCircleAvatar(
+        content: content,
+        bgColor: bgColor,
+        feColor: feColor,
+        radius: radius,
+        fallbackWidget: (fallbackWidget ??
+            Icon(
               Icons.account_circle,
               size: radius != null ? radius! * 1.2 : 24,
               color: feColor,
-            )
-          : null,
+            )),
+      ),
+      onTap: () {
+        showModalBottomSheet(
+          useRootNavigator: true,
+          isScrollControlled: true,
+          backgroundColor: Theme.of(context).colorScheme.surface,
+          context: context,
+          builder: (context) => AccountProfilePopup(
+            name: username,
+          ),
+        );
+      },
     );
   }
 }

lib/widgets/account/account_heading.dart

@@ -84,7 +84,7 @@ class AccountHeadingWidget extends StatelessWidget {
               Positioned(
                 bottom: -30,
                 left: 32,
-                child: AccountAvatar(content: avatar, radius: 40),
+                child: AttachedCircleAvatar(content: avatar, radius: 40),
               ),
             ],
           ),

lib/widgets/account/account_profile_popup.dart

@@ -89,8 +89,7 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {
 
     return SizedBox(
       height: MediaQuery.of(context).size.height * 0.75,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
+      child: ListView(
         children: [
           AccountHeadingWidget(
             avatar: _userinfo!.avatar,
@@ -118,7 +117,7 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {
                       const VisualDensity(horizontal: -4, vertical: -2),
                   trailing: const Icon(Icons.chevron_right),
                   onTap: () {
-                    AppRouter.instance.goNamed(
+                    AppRouter.instance.pushNamed(
                       'accountProfilePage',
                       pathParameters: {'name': _userinfo!.name},
                     );

lib/widgets/account/account_select.dart

@@ -138,7 +138,7 @@ class _AccountSelectorState extends State<AccountSelector> {
                 return ListTile(
                   title: Text(element.nick),
                   subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                   trailing: widget.trailingBuilder != null
                       ? widget.trailingBuilder!(element)
                       : _checkSelected(element)

lib/widgets/account/relative_list.dart

@@ -23,7 +23,7 @@ class SilverRelativeList extends StatelessWidget {
       title: Text(element.related.nick),
       subtitle: Text(element.related.name),
       leading: GestureDetector(
-        child: AccountAvatar(content: element.related.avatar),
+        child: AttachedCircleAvatar(content: element.related.avatar),
         onTap: () {
           showModalBottomSheet(
             useRootNavigator: true,

lib/widgets/account/relative_select.dart

@@ -56,7 +56,7 @@ class _RelativeSelectorState extends State<RelativeSelector> {
                 return ListTile(
                   title: Text(element.nick),
                   subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                   trailing: widget.trailingBuilder != null
                       ? widget.trailingBuilder!(element)
                       : null,

lib/widgets/app_bar_leading.dart

@@ -1,28 +1,22 @@
 import 'package:flutter/material.dart';
-import 'package:solian/shells/root_shell.dart';
 
 class AppBarLeadingButton extends StatelessWidget {
-  const AppBarLeadingButton({super.key});
+  final bool forceBack;
 
-  static Widget? adaptive(BuildContext context) {
-    final hasContent =
-        Navigator.canPop(context) || rootScaffoldKey.currentState!.hasDrawer;
-    return hasContent ? const AppBarLeadingButton() : null;
+  const AppBarLeadingButton({super.key, this.forceBack = false});
+
+  static Widget? adaptive(BuildContext context, {bool forceBack = false}) {
+    final hasContent = Navigator.canPop(context) || forceBack;
+    return hasContent ? AppBarLeadingButton(forceBack: forceBack) : null;
   }
 
   @override
   Widget build(BuildContext context) {
-    if (Navigator.canPop(context)) {
+    if (Navigator.canPop(context) || forceBack) {
       return BackButton(
         onPressed: () => Navigator.pop(context),
       );
     }
-    if (rootScaffoldKey.currentState!.hasDrawer) {
-      return DrawerButton(
-        onPressed: () => rootScaffoldKey.currentState!.openDrawer(),
-      );
-    } else {
     return const SizedBox.shrink();
   }
-  }
 }

lib/widgets/attachments/attachment_editor.dart

@@ -21,6 +21,7 @@ import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/widgets/attachments/attachment_attr_editor.dart';
 import 'package:solian/widgets/attachments/attachment_editor_thumbnail.dart';
 import 'package:solian/widgets/attachments/attachment_fullscreen.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class AttachmentEditorPopup extends StatefulWidget {
   final String pool;
@@ -396,7 +397,8 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                     ),
                   if (!element.isCompleted &&
                       element.error == null &&
-                      canBeCrop)
+                      canBeCrop &&
+                      PlatformInfo.canCropImage)
                     Obx(
                       () => IconButton(
                         color: Colors.teal,
@@ -659,7 +661,7 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                 ),
               ],
             ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
             Expanded(
               child: CustomScrollView(
                 slivers: [

lib/widgets/attachments/attachment_fullscreen.dart

@@ -8,6 +8,7 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gal/gal.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/platform.dart';
@@ -103,9 +104,10 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
 
   @override
   Widget build(BuildContext context) {
-    final metaTextStyle = TextStyle(
+    final metaTextStyle = GoogleFonts.roboto(
       fontSize: 12,
       color: _unFocusColor,
+      height: 1,
     );
 
     return DismissiblePage(
@@ -175,7 +177,7 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                       Row(
                         children: [
                           IgnorePointer(
-                            child: AccountAvatar(
+                            child: AttachedCircleAvatar(
                               content: widget.item.account!.avatar,
                               radius: 19,
                             ),
@@ -239,27 +241,43 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                       child: Wrap(
                         spacing: 6,
                         children: [
+                          if (widget.item.metadata?['exif'] == null)
                             Text(
                               '#${widget.item.rid}',
                               style: metaTextStyle,
                             ),
-                          if (widget.item.metadata?['width'] != null &&
-                              widget.item.metadata?['height'] != null)
+                          if (widget.item.metadata?['exif']?['Model'] != null)
                             Text(
-                              '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
+                              'shotOn'.trParams({
+                                'device': widget.item.metadata?['exif']
+                                    ?['Model']
+                              }),
                               style: metaTextStyle,
-                            ),
-                          if (widget.item.metadata?['ratio'] != null)
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ShutterSpeed'] !=
+                              null)
                             Text(
-                              '${_getRatio().toPrecision(2)}',
+                              widget.item.metadata?['exif']?['ShutterSpeed'],
                               style: metaTextStyle,
-                            ),
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ISO'] != null)
+                            Text(
+                              'ISO${widget.item.metadata?['exif']?['ISO']}',
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['Megapixels'] !=
+                              null)
+                            Text(
+                              '${widget.item.metadata?['exif']?['Megapixels']}MP',
+                              style: metaTextStyle,
+                            )
+                          else
                             Text(
                               widget.item.size.formatBytes(),
                               style: metaTextStyle,
                             ),
                           Text(
-                            widget.item.mimetype,
+                            '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
                             style: metaTextStyle,
                           ),
                         ],

lib/widgets/attachments/attachment_item.dart

@@ -155,11 +155,18 @@ class _AttachmentItemImage extends StatelessWidget {
           ),
           if (showBadge && badge != null)
             Positioned(
-              right: 12,
-              bottom: 8,
+              right: 8,
+              bottom: 4,
               child: Material(
                 color: Colors.transparent,
-                child: Chip(label: Text(badge!)),
+                child: Chip(
+                  label: Text(badge!),
+                  labelStyle: GoogleFonts.robotoMono(),
+                  visualDensity: const VisualDensity(
+                    horizontal: -4,
+                    vertical: -2,
+                  ),
+                ),
               ),
             ),
           if (showHideButton && item.isMature)

lib/widgets/attachments/attachment_list.dart

@@ -1,7 +1,6 @@
 import 'dart:math' as math;
 import 'dart:ui';
 
-import 'package:carousel_slider/carousel_slider.dart';
 import 'package:dismissible_page/dismissible_page.dart';
 import 'package:flutter/material.dart' hide CarouselController;
 import 'package:flutter_animate/flutter_animate.dart';
@@ -15,27 +14,29 @@ import 'package:solian/widgets/sized_container.dart';
 
 class AttachmentList extends StatefulWidget {
   final String parentId;
-  final List<String> attachmentsId;
+  final List<String>? attachmentIds;
+  final List<Attachment>? attachments;
   final bool isGrid;
   final bool isColumn;
-  final bool isForceGrid;
+  final bool isFullWidth;
   final bool autoload;
-  final double flatMaxHeight;
   final double columnMaxWidth;
 
+  final EdgeInsets? padding;
   final double? width;
   final double? viewport;
 
   const AttachmentList({
     super.key,
     required this.parentId,
-    required this.attachmentsId,
+    this.attachmentIds,
+    this.attachments,
     this.isGrid = false,
     this.isColumn = false,
-    this.isForceGrid = false,
+    this.isFullWidth = false,
     this.autoload = false,
-    this.flatMaxHeight = 720,
     this.columnMaxWidth = 480,
+    this.padding,
     this.width,
     this.viewport,
   });
@@ -48,23 +49,24 @@ class _AttachmentListState extends State<AttachmentList> {
   bool _isLoading = true;
   bool _showMature = false;
 
+  // ignore: unused_field
   double _aspectRatio = 1;
 
-  List<Attachment?> _attachmentsMeta = List.empty();
+  List<Attachment?> _attachments = List.empty();
 
   void _getMetadataList() {
     final AttachmentProvider attach = Get.find();
 
-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? false) {
       return;
     } else {
-      _attachmentsMeta = List.filled(widget.attachmentsId.length, null);
+      _attachments = List.filled(widget.attachmentIds!.length, null);
     }
 
-    attach.listMetadata(widget.attachmentsId).then((result) {
+    attach.listMetadata(widget.attachmentIds!).then((result) {
       if (mounted) {
         setState(() {
-          _attachmentsMeta = result;
+          _attachments = result;
           _isLoading = false;
         });
       }
@@ -76,7 +78,7 @@ class _AttachmentListState extends State<AttachmentList> {
     bool isConsistent = true;
     double? consistentValue;
     int portrait = 0, square = 0, landscape = 0;
-    for (var entry in _attachmentsMeta) {
+    for (var entry in _attachments) {
       if (entry == null) continue;
       if (entry.metadata?['ratio'] != null) {
         if (entry.metadata?['ratio'] is int) {
@@ -117,10 +119,9 @@ class _AttachmentListState extends State<AttachmentList> {
       item: element,
       parentId: widget.parentId,
       width: width ?? widget.width,
-      badgeContent: '${idx + 1}/${_attachmentsMeta.length}',
-      showBadge:
-          _attachmentsMeta.length > 1 && !widget.isGrid && !widget.isColumn,
-      showBorder: widget.attachmentsId.length > 1,
+      badgeContent: '${idx + 1}/${_attachments.length}',
+      showBadge: _attachments.length > 1 && !widget.isGrid && !widget.isColumn,
+      showBorder: _attachments.length > 1,
       showMature: _showMature,
       autoload: widget.autoload,
       onReveal: (value) {
@@ -132,15 +133,34 @@ class _AttachmentListState extends State<AttachmentList> {
   @override
   void initState() {
     super.initState();
+    assert(widget.attachmentIds != null || widget.attachments != null);
+    if (widget.attachments == null) {
+      final AttachmentProvider attach = Get.find();
+      final cachedResult = attach.listMetadataFromCache(widget.attachmentIds!);
+      if (cachedResult.every((x) => x != null)) {
+        setState(() {
+          _attachments = cachedResult;
+          _isLoading = false;
+        });
+        _calculateAspectRatio();
+      } else {
         _getMetadataList();
       }
+    } else {
+      setState(() {
+        _attachments = widget.attachments!;
+        _isLoading = false;
+      });
+      _calculateAspectRatio();
+    }
+  }
 
   Color get _unFocusColor =>
       Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
 
   @override
   Widget build(BuildContext context) {
-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? widget.attachments!.isEmpty) {
       return const SizedBox.shrink();
     }
 
@@ -153,9 +173,7 @@ class _AttachmentListState extends State<AttachmentList> {
             color: _unFocusColor,
           ).paddingOnly(right: 5),
           Text(
-            'attachmentHint'.trParams(
-              {'count': widget.attachmentsId.length.toString()},
-            ),
+            'attachmentHint'.trParams({'count': _attachments.toString()}),
             style: TextStyle(color: _unFocusColor, fontSize: 12),
           )
         ],
@@ -165,21 +183,90 @@ class _AttachmentListState extends State<AttachmentList> {
           .fadeIn(duration: 1250.ms);
     }
 
+    const radius = BorderRadius.all(Radius.circular(8));
+
+    if (widget.isFullWidth && _attachments.length == 1) {
+      final element = _attachments.first;
+      final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+      double ratio =
+          element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
+      return Container(
+        width: MediaQuery.of(context).size.width,
+        constraints: BoxConstraints(
+          maxHeight: 640,
+        ),
+        child: AspectRatio(
+          aspectRatio: ratio,
+          child: Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.symmetric(
+                horizontal: BorderSide(
+                  color: Theme.of(context).dividerColor,
+                  width: 1,
+                ),
+              ),
+            ),
+            child: _buildEntry(element, 0),
+          ),
+        ),
+      );
+    }
+
+    final isNotPureImage = _attachments.any(
+      (x) => x?.mimetype.split('/').firstOrNull != 'image',
+    );
+    if (widget.isGrid && !isNotPureImage) {
+      return GridView.builder(
+        padding: EdgeInsets.zero,
+        primary: false,
+        physics: const NeverScrollableScrollPhysics(),
+        shrinkWrap: true,
+        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
+          crossAxisCount: math.min(3, _attachments.length),
+          mainAxisSpacing: 8.0,
+          crossAxisSpacing: 8.0,
+        ),
+        itemCount: _attachments.length,
+        itemBuilder: (context, idx) {
+          final element = _attachments[idx];
+          return Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.all(
+                color: Theme.of(context).dividerColor,
+                width: 1,
+              ),
+              borderRadius: radius,
+            ),
+            child: ClipRRect(
+              borderRadius: radius,
+              child: _buildEntry(element, idx),
+            ),
+          );
+        },
+      );
+    }
+
     if (widget.isColumn) {
       var idx = 0;
-      const radius = BorderRadius.all(Radius.circular(8));
       return Wrap(
         spacing: 8,
         runSpacing: 8,
-        children: widget.attachmentsId.map((x) {
-          final element = _attachmentsMeta[idx];
+        children: _attachments.map((x) {
+          final element = _attachments[idx];
           idx++;
           if (element == null) return const SizedBox.shrink();
-          double ratio = element.metadata?['ratio']?.toDouble() ?? 16 / 9;
+          final isImage = element.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
           return Container(
-            decoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
-            ),
             constraints: BoxConstraints(
               maxWidth: widget.columnMaxWidth,
               maxHeight: 640,
@@ -188,6 +275,10 @@ class _AttachmentListState extends State<AttachmentList> {
               aspectRatio: ratio,
               child: Container(
                 decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
                   border: Border.all(
                     color: Theme.of(context).dividerColor,
                     width: 1,
@@ -205,27 +296,37 @@ class _AttachmentListState extends State<AttachmentList> {
       );
     }
 
-    final isNotPureImage = _attachmentsMeta.any(
-      (x) => x?.mimetype.split('/').firstOrNull != 'image',
-    );
-    if (widget.isGrid && (widget.isForceGrid || !isNotPureImage)) {
-      const radius = BorderRadius.all(Radius.circular(8));
-      return GridView.builder(
-        padding: EdgeInsets.zero,
-        primary: false,
-        physics: const NeverScrollableScrollPhysics(),
-        shrinkWrap: true,
-        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
-          crossAxisCount: math.min(3, widget.attachmentsId.length),
-          mainAxisSpacing: 8.0,
-          crossAxisSpacing: 8.0,
-        ),
-        itemCount: widget.attachmentsId.length,
-        itemBuilder: (context, idx) {
-          final element = _attachmentsMeta[idx];
     return Container(
+      constraints: BoxConstraints(
+        maxHeight: 320,
+      ),
+      child: ListView.separated(
+        padding: widget.padding,
+        scrollDirection: Axis.horizontal,
+        shrinkWrap: true,
+        itemCount: _attachments.length,
+        itemBuilder: (context, idx) {
+          final element = _attachments[idx];
+          if (element == null) const SizedBox.shrink();
+          final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
+          return Container(
+            constraints: BoxConstraints(
+              maxWidth: math.min(
+                widget.columnMaxWidth,
+                MediaQuery.of(context).size.width -
+                    (widget.padding?.horizontal ?? 0),
+              ),
+            ),
+            child: AspectRatio(
+              aspectRatio: ratio,
+              child: Container(
                 decoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
                   border: Border.all(
                     color: Theme.of(context).dividerColor,
                     width: 1,
@@ -236,37 +337,11 @@ class _AttachmentListState extends State<AttachmentList> {
                   borderRadius: radius,
                   child: _buildEntry(element, idx),
                 ),
+              ),
+            ),
           );
         },
-      ).paddingSymmetric(horizontal: 24);
-    }
-
-    return Container(
-      width: MediaQuery.of(context).size.width,
-      constraints: BoxConstraints(
-        maxHeight: widget.flatMaxHeight,
-      ),
-      decoration: BoxDecoration(
-        color: Theme.of(context).colorScheme.surfaceContainerHigh,
-        border: Border.symmetric(
-          horizontal: BorderSide(
-            width: 0.3,
-            color: Theme.of(context).dividerColor,
-          ),
-        ),
-      ),
-      child: CarouselSlider.builder(
-        options: CarouselOptions(
-          aspectRatio: _aspectRatio,
-          viewportFraction:
-              widget.viewport ?? (widget.attachmentsId.length > 1 ? 0.95 : 1),
-          enableInfiniteScroll: false,
-        ),
-        itemCount: _attachmentsMeta.length,
-        itemBuilder: (context, idx, _) {
-          final element = _attachmentsMeta[idx];
-          return _buildEntry(element, idx);
-        },
+        separatorBuilder: (context, _) => const Gap(8),
       ),
     );
   }
@@ -319,6 +394,7 @@ class AttachmentListEntry extends StatelessWidget {
         width: width ?? MediaQuery.of(context).size.width,
         height: height,
         decoration: BoxDecoration(
+          color: Colors.transparent,
           border: showBorder
               ? Border.symmetric(
                   vertical: BorderSide(

lib/widgets/channel/channel_call_indicator.dart

@@ -98,12 +98,12 @@ class ChannelCallIndicator extends StatelessWidget {
               child: Text('callJoin'.tr),
             );
           } else if (call.channel.value?.id == channel.id &&
-              !AppTheme.isLargeScreen(context)) {
+              !AppTheme.isUltraLargeScreen(context)) {
             return TextButton(
               onPressed: () => onJoin(),
               child: Text('callResume'.tr),
             );
-          } else if (!AppTheme.isLargeScreen(context)) {
+          } else if (!AppTheme.isUltraLargeScreen(context)) {
             return TextButton(
               onPressed: null,
               child: Text('callJoin'.tr),

lib/widgets/channel/channel_list.dart

@@ -4,18 +4,18 @@ import 'package:flutter/material.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:intl/intl.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/platform.dart';
+import 'package:solian/providers/database/database.dart';
 import 'package:solian/router.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:badges/badges.dart' as badges;
 
 class ChannelListWidget extends StatefulWidget {
   final List<Channel> channels;
   final int selfId;
-  final bool isDense;
-  final bool isCollapsed;
-  final bool noCategory;
   final bool useReplace;
   final Function(Channel)? onSelected;
 
@@ -23,9 +23,6 @@ class ChannelListWidget extends StatefulWidget {
     super.key,
     required this.channels,
     required this.selfId,
-    this.isDense = false,
-    this.isCollapsed = false,
-    this.noCategory = false,
     this.useReplace = false,
     this.onSelected,
   });
@@ -35,43 +32,27 @@ class ChannelListWidget extends StatefulWidget {
 }
 
 class _ChannelListWidgetState extends State<ChannelListWidget> {
-  final List<Channel> _globalChannels = List.empty(growable: true);
-  final Map<String, List<Channel>> _inRealms = {};
+  Map<int, LocalMessageEventTableData>? _lastMessages;
 
   final ChatEventController _eventController = ChatEventController();
 
-  void _mapChannels() {
-    _inRealms.clear();
-    _globalChannels.clear();
-
-    if (widget.noCategory) {
-      _globalChannels.addAll(widget.channels);
-      return;
+  Future<void> _loadLastMessages() async {
+    final messages = await _eventController.src.getLastInAllChannels();
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
     }
-
-    for (final channel in widget.channels) {
-      if (channel.realmId != null) {
-        if (_inRealms[channel.realm!.alias] == null) {
-          _inRealms[channel.realm!.alias] = List.empty(growable: true);
-        }
-        _inRealms[channel.realm!.alias]!.add(channel);
-      } else {
-        _globalChannels.add(channel);
-      }
-    }
-  }
-
-  @override
-  void didUpdateWidget(covariant ChannelListWidget oldWidget) {
-    super.didUpdateWidget(oldWidget);
-    setState(() => _mapChannels());
   }
 
   @override
   void initState() {
     super.initState();
-    _mapChannels();
-    _eventController.initialize();
+    _eventController.initialize().then((_) {
+      _loadLastMessages();
+    });
   }
 
   void _gotoChannel(Channel item) {
@@ -98,107 +79,183 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
     }
   }
 
-  Widget _buildDirectMessageDescription(Channel item, ChannelMember otherside) {
-    if (PlatformInfo.isWeb) {
-      return Text('channelDirectDescription'.trParams(
-        {'username': '@${otherside.account.name}'},
-      ));
-    }
-
-    return FutureBuilder(
-      future: Future.delayed(
-        const Duration(milliseconds: 500),
-        () => _eventController.src.getLastInChannel(item),
+  Widget _buildTitle(Channel item, ChannelMember? otherside) {
+    if (otherside != null) {
+      return Row(
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Expanded(child: Text(otherside.account.nick)),
+          if (_lastMessages != null && _lastMessages![item.id] != null)
+            Text(
+              DateFormat('MM/dd').format(
+                _lastMessages![item.id]!.createdAt.toLocal(),
               ),
-      builder: (context, snapshot) {
-        if (!snapshot.hasData && snapshot.data == null) {
-          return Text('channelDirectDescription'.trParams(
-            {'username': '@${otherside.account.name}'},
-          ));
+              style: TextStyle(
+                fontSize: 12,
+                color:
+                    Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+              ),
+            ),
+        ],
+      );
+    }
+    return Row(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      children: [
+        Expanded(child: Text(item.name)),
+        if (_lastMessages != null && _lastMessages![item.id] != null)
+          Text(
+            DateFormat('MM/dd').format(
+              _lastMessages![item.id]!.createdAt.toLocal(),
+            ),
+            style: TextStyle(
+              fontSize: 12,
+              color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+            ),
+          ),
+      ],
+    );
   }
 
-        final data = snapshot.data!.data!;
-        return Text(
-          '${data.sender.account.nick}: ${data.body['text'] ?? 'Unsupported message to preview'}',
+  Widget _buildSubtitle(Channel item, ChannelMember? otherside) {
+    if (PlatformInfo.isWeb) {
+      return otherside != null
+          ? Text(
+              'channelDirectDescription'.trParams(
+                {'username': '@${otherside.account.name}'},
+              ),
               maxLines: 1,
               overflow: TextOverflow.ellipsis,
+            )
+          : Text(
+              item.description,
+              maxLines: 1,
+              overflow: TextOverflow.ellipsis,
+            );
+    }
+
+    return AnimatedSwitcher(
+      switchInCurve: Curves.easeIn,
+      switchOutCurve: Curves.easeOut,
+      transitionBuilder: (child, animation) {
+        return FadeTransition(opacity: animation, child: child);
+      },
+      duration: const Duration(milliseconds: 300),
+      child: (_lastMessages == null || _lastMessages![item.id] == null)
+          ? Builder(
+              builder: (context) {
+                return otherside != null
+                    ? Text(
+                        'channelDirectDescription'.trParams(
+                          {'username': '@${otherside.account.name}'},
+                        ),
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      )
+                    : Text(
+                        item.description,
+                        maxLines: 1,
+                        overflow: TextOverflow.ellipsis,
+                      );
+              },
+            )
+          : Builder(
+              builder: (context) {
+                final data = _lastMessages![item.id]!.data!;
+                return Row(
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    if (item.type == 0)
+                      Badge(
+                        label: Text(data.sender.account.nick),
+                        backgroundColor:
+                            Theme.of(context).colorScheme.secondaryContainer,
+                        textColor:
+                            Theme.of(context).colorScheme.onSecondaryContainer,
+                      ),
+                    if (item.type == 0) const Gap(6),
+                    if (data.body['text'] != null)
+                      Expanded(
+                        child: Text(
+                          data.body['text'],
+                          maxLines: 1,
+                          overflow: TextOverflow.ellipsis,
+                        ),
+                      )
+                    else
+                      Badge(label: Text('unablePreview'.tr)),
+                  ],
+                );
+              },
+            ),
+      layoutBuilder: (currentChild, previousChildren) {
+        return Stack(
+          alignment: Alignment.centerLeft,
+          children: <Widget>[
+            ...previousChildren,
+            if (currentChild != null) currentChild,
+          ],
         );
       },
     );
   }
 
   Widget _buildEntry(Channel item) {
-    final padding = widget.isDense
-        ? const EdgeInsets.symmetric(horizontal: 20)
-        : const EdgeInsets.symmetric(horizontal: 16);
+    const padding = EdgeInsets.symmetric(horizontal: 20);
 
-    if (item.type == 1) {
     final otherside =
-          item.members!.where((e) => e.account.id != widget.selfId).first;
+        item.members!.where((e) => e.account.id != widget.selfId).firstOrNull;
 
-      final avatar = AccountAvatar(
+    if (item.type == 1 && otherside != null) {
+      final avatar = AttachedCircleAvatar(
         content: otherside.account.avatar,
-        radius: widget.isDense ? 12 : 20,
+        radius: 20,
         bgColor: Theme.of(context).colorScheme.primary,
         feColor: Theme.of(context).colorScheme.onPrimary,
       );
 
-      if (widget.isCollapsed) {
-        return Tooltip(
-          message: otherside.account.nick,
-          child: InkWell(
-            child: avatar.paddingSymmetric(vertical: 12),
-            onTap: () => _gotoChannel(item),
-          ),
-        );
-      }
-
       return ListTile(
         leading: avatar,
         contentPadding: padding,
-        title: Text(otherside.account.nick),
-        subtitle: !widget.isDense
-            ? _buildDirectMessageDescription(item, otherside)
-            : null,
+        title: _buildTitle(item, otherside),
+        subtitle: _buildSubtitle(item, otherside),
         onTap: () => _gotoChannel(item),
       );
     } else {
       final avatar = CircleAvatar(
-        backgroundColor: item.realmId == null
-            ? Theme.of(context).colorScheme.primary
-            : Colors.transparent,
-        radius: widget.isDense ? 12 : 20,
+        backgroundColor: Theme.of(context).colorScheme.primary,
+        radius: 20,
         child: FaIcon(
           FontAwesomeIcons.hashtag,
-          color: item.realmId == null
-              ? Theme.of(context).colorScheme.onPrimary
-              : Theme.of(context).colorScheme.primary,
-          size: widget.isDense ? 12 : 16,
+          color: Theme.of(context).colorScheme.onPrimary,
+          size: 16,
         ),
       );
 
-      if (widget.isCollapsed) {
-        return Tooltip(
-          message: item.name,
-          child: InkWell(
-            child: avatar.paddingSymmetric(vertical: 12),
-            onTap: () => _gotoChannel(item),
-          ),
-        );
-      }
-
       return ListTile(
-        minTileHeight: widget.isDense ? 48 : null,
-        leading: avatar,
+        minTileHeight: null,
+        leading: item.realmId == null
+            ? avatar
+            : badges.Badge(
+                position: badges.BadgePosition.bottomEnd(bottom: -4, end: -6),
+                badgeStyle: badges.BadgeStyle(
+                  badgeColor: Theme.of(context).colorScheme.secondaryContainer,
+                  padding: const EdgeInsets.all(2),
+                  elevation: 8,
+                ),
+                badgeContent: AttachedCircleAvatar(
+                  content: item.realm?.avatar,
+                  radius: 10,
+                  fallbackWidget: const Icon(
+                    Icons.workspaces,
+                    size: 16,
+                  ),
+                ),
+                child: avatar,
+              ),
         contentPadding: padding,
-        title: Text(item.name),
-        subtitle: !widget.isDense
-            ? Text(
-                item.description,
-                maxLines: 1,
-                overflow: TextOverflow.ellipsis,
-              )
-            : null,
+        title: _buildTitle(item, null),
+        subtitle: _buildSubtitle(item, null),
         onTap: () => _gotoChannel(item),
       );
     }
@@ -206,13 +263,12 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
 
   @override
   Widget build(BuildContext context) {
-    if (widget.noCategory) {
     return CustomScrollView(
       slivers: [
         SliverList.builder(
-            itemCount: _globalChannels.length,
+          itemCount: widget.channels.length,
           itemBuilder: (context, index) {
-              final element = _globalChannels[index];
+            final element = widget.channels[index];
             return _buildEntry(element);
           },
         ),
@@ -220,36 +276,4 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
       ],
     );
   }
-
-    return CustomScrollView(
-      slivers: [
-        SliverList.builder(
-          itemCount: _globalChannels.length,
-          itemBuilder: (context, index) {
-            final element = _globalChannels[index];
-            return _buildEntry(element);
-          },
-        ),
-        SliverList.list(
-          children: _inRealms.entries.map((element) {
-            return ExpansionTile(
-              tilePadding: const EdgeInsets.only(left: 20, right: 24),
-              minTileHeight: 48,
-              title: Text(element.value.first.realm!.name),
-              leading: CircleAvatar(
-                backgroundColor: Colors.teal,
-                radius: widget.isDense ? 12 : 24,
-                child: Icon(
-                  Icons.workspaces,
-                  color: Colors.white,
-                  size: widget.isDense ? 12 : 16,
-                ),
-              ),
-              children: element.value.map((x) => _buildEntry(x)).toList(),
-            );
-          }).toList(),
-        ),
-      ],
-    );
-  }
 }

lib/widgets/channel/channel_member.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@@ -8,6 +7,7 @@ import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/account/relative_select.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class ChannelMemberListPopup extends StatefulWidget {
   final Channel channel;
@@ -131,7 +131,7 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
             'channelMembers'.tr,
             style: Theme.of(context).textTheme.headlineSmall,
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
           ListTile(
             tileColor: Theme.of(context).colorScheme.surfaceContainerHigh,
             contentPadding: const EdgeInsets.symmetric(horizontal: 20),
@@ -152,7 +152,8 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
                   title: Text(element.account.nick),
                   subtitle: Text(element.account.name),
                   leading: GestureDetector(
-                    child: AccountAvatar(content: element.account.avatar),
+                    child:
+                        AttachedCircleAvatar(content: element.account.avatar),
                     onTap: () {
                       showModalBottomSheet(
                         useRootNavigator: true,

lib/widgets/chat/call/call_no_content.dart

@@ -74,7 +74,7 @@ class _NoContentWidgetState extends State<NoContentWidget>
               ),
             )
           ],
-          child: AccountAvatar(
+          child: AttachedCircleAvatar(
             content: widget.userinfo!.avatar,
             bgColor: Colors.transparent,
             radius: radius,

lib/widgets/chat/chat_event.dart

@@ -78,7 +78,7 @@ class ChatEvent extends StatelessWidget {
       child: AttachmentList(
         key: Key('m${item.uuid}attachments'),
         parentId: item.uuid,
-        attachmentsId: attachments,
+        attachmentIds: attachments,
         isColumn: true,
       ),
     );
@@ -220,7 +220,7 @@ class ChatEvent extends StatelessWidget {
                 children: [
                   Row(
                     children: [
-                      AccountAvatar(
+                      AttachedCircleAvatar(
                         content: item.sender.account.avatar,
                         radius: 9,
                       ),
@@ -250,7 +250,8 @@ class ChatEvent extends StatelessWidget {
             crossAxisAlignment: CrossAxisAlignment.start,
             children: [
               GestureDetector(
-                child: AccountAvatar(content: item.sender.account.avatar),
+                child:
+                    AttachedCircleAvatar(content: item.sender.account.avatar),
                 onTap: () {
                   showModalBottomSheet(
                     useRootNavigator: true,

lib/widgets/chat/chat_event_action.dart

@@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/channel.dart';
@@ -7,6 +6,7 @@ import 'package:solian/models/event.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/widgets/chat/chat_event_deletion.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 
 class ChatEventAction extends StatefulWidget {
   final Channel channel;
@@ -73,7 +73,7 @@ class _ChatEventActionState extends State<ChatEventAction> {
               ),
             ],
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
           Expanded(
             child: ListView(
               children: [

lib/widgets/chat/chat_event_list.dart

@@ -1,4 +1,6 @@
+import 'package:flutter/gestures.dart';
 import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/controllers/chat_events_controller.dart';
 import 'package:solian/models/channel.dart';
@@ -9,6 +11,7 @@ import 'package:solian/widgets/chat/chat_event_action.dart';
 import 'package:very_good_infinite_list/very_good_infinite_list.dart';
 
 class ChatEventList extends StatelessWidget {
+  final bool noAnimated;
   final String scope;
   final Channel channel;
   final ChatEventController chatController;
@@ -23,6 +26,7 @@ class ChatEventList extends StatelessWidget {
     required this.chatController,
     required this.onEdit,
     required this.onReply,
+    this.noAnimated = false,
   });
 
   bool _checkMessageMergeable(Event? a, Event? b) {
@@ -31,9 +35,28 @@ class ChatEventList extends StatelessWidget {
     return a.createdAt.difference(b.createdAt).inMinutes <= 3;
   }
 
+  void _openActions(BuildContext context, Event item) {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => ChatEventAction(
+        channel: channel,
+        realm: channel.realm,
+        item: item,
+        onEdit: () {
+          onEdit(item);
+        },
+        onReply: () {
+          onReply(item);
+        },
+      ),
+    );
+  }
+
   @override
   Widget build(BuildContext context) {
     return CustomScrollView(
+      cacheExtent: 100,
       reverse: true,
       slivers: [
         Obx(() {
@@ -61,9 +84,11 @@ class ChatEventList extends StatelessWidget {
 
               final item = chatController.currentEvents[index].data;
 
-              return GestureDetector(
+              return TapRegion(
+                child: GestureDetector(
                   behavior: HitTestBehavior.opaque,
-                child: ChatEvent(
+                  child: Builder(builder: (context) {
+                    final widget = ChatEvent(
                       key: Key('m${item!.uuid}'),
                       item: item,
                       isMerged: isMerged,
@@ -71,23 +96,33 @@ class ChatEventList extends StatelessWidget {
                     ).paddingOnly(
                       top: !isMerged ? 8 : 0,
                       bottom: !hasMerged ? 8 : 0,
-                ),
-                onLongPress: () {
-                  showModalBottomSheet(
-                    useRootNavigator: true,
-                    context: context,
-                    builder: (context) => ChatEventAction(
-                      channel: channel,
-                      realm: channel.realm,
-                      item: item,
-                      onEdit: () {
-                        onEdit(item);
-                      },
-                      onReply: () {
-                        onReply(item);
-                      },
-                    ),
                     );
+
+                    if (noAnimated) {
+                      return widget;
+                    } else {
+                      return widget
+                          .animate(
+                            key: Key('animated-m${item.uuid}'),
+                          )
+                          .slideY(
+                            curve: Curves.fastLinearToSlowEaseIn,
+                            duration: 250.ms,
+                            begin: 0.5,
+                            end: 0,
+                          );
+                    }
+                  }),
+                  onLongPress: () {
+                    _openActions(context, item!);
+                  },
+                ),
+                onTapInside: (event) {
+                  if (event.buttons == kSecondaryMouseButton) {
+                    _openActions(context, item!);
+                  } else if (event.buttons == kMiddleMouseButton) {
+                    onReply(item!);
+                  }
                 },
               );
             },

lib/widgets/chat/chat_message_input.dart

@@ -443,7 +443,7 @@ class _ChatMessageInputState extends State<ChatMessageInput> {
                           .map(
                             (x) => ChatMessageSuggestion(
                               type: 'users',
-                              leading: AccountAvatar(content: x.avatar),
+                              leading: AttachedCircleAvatar(content: x.avatar),
                               display: x.nick,
                               content: '@${x.name}',
                             ),

lib/widgets/link_expansion.dart

@@ -2,15 +2,21 @@ import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:flutter_svg/svg.dart';
 import 'package:get/get.dart';
+import 'package:solian/models/link.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
-class LinkExpansion extends StatelessWidget {
+class LinkExpansion extends StatefulWidget {
   final String content;
 
   const LinkExpansion({super.key, required this.content});
 
+  @override
+  State<LinkExpansion> createState() => _LinkExpansionState();
+}
+
+class _LinkExpansionState extends State<LinkExpansion> {
   Widget _buildImage(String url, {double? width, double? height}) {
     if (url.endsWith('svg')) {
       return SvgPicture.network(url, width: width, height: height);
@@ -22,61 +28,74 @@ class LinkExpansion extends StatelessWidget {
     );
   }
 
-  @override
-  Widget build(BuildContext context) {
+  List<LinkMeta>? _meta;
+
+  Future<void> _doExpand() async {
     final linkRegex = RegExp(
       r'(?<!\()(?:(?:https?):\/\/|www\.)(?:[-_a-z0-9]+\.)*(?:[-a-z0-9]+\.[-a-z0-9]+)[^\s<]*[^\s<?!.,:*_~]',
     );
-    final matches = linkRegex.allMatches(content);
-    if (matches.isEmpty) {
-      return const SizedBox.shrink();
-    }
+    final matches = linkRegex.allMatches(widget.content);
+    if (matches.isEmpty) return;
 
     final LinkExpandProvider expandController = Get.find();
 
-    return Wrap(
-      children: matches.map((x) {
-        return Container(
-          constraints: BoxConstraints(
-            maxWidth: matches.length == 1 ? 480 : 340,
-          ),
-          child: FutureBuilder(
-            future: expandController.expandLink(x.group(0)!),
-            builder: (context, snapshot) {
-              if (!snapshot.hasData) {
-                return const SizedBox.shrink();
+    if (matches.isEmpty) return;
+
+    List<LinkMeta> out = List.empty(growable: true);
+    for (final x in matches) {
+      final result = await expandController.expandLink(x.group(0)!);
+      if (result != null) out.add(result);
     }
 
+    setState(() => _meta = out);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _doExpand();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    if (_meta?.isEmpty ?? true) return const SizedBox.shrink();
+
+    return Wrap(
+      children: _meta!.map((x) {
+        return Container(
+          constraints: BoxConstraints(
+            maxWidth: _meta!.length == 1 ? 480 : 340,
+          ),
+          child: Builder(
+            builder: (context) {
               final isRichDescription = [
                 'solsynth.dev',
-              ].contains(Uri.parse(snapshot.data!.url).host);
+              ].contains(Uri.parse(x.url).host);
 
               return GestureDetector(
                 child: Card(
                   child: Column(
                     crossAxisAlignment: CrossAxisAlignment.start,
                     children: [
-                      if ([
-                        (snapshot.data!.icon?.isNotEmpty ?? false),
-                        snapshot.data!.siteName != null
-                      ].any((x) => x))
+                      if ([(x.icon?.isNotEmpty ?? false), x.siteName != null]
+                          .any((x) => x))
                         Row(
                           children: [
-                            if (snapshot.data!.icon?.isNotEmpty ?? false)
+                            if (x.icon?.isNotEmpty ?? false)
                               ClipRRect(
                                 borderRadius: const BorderRadius.all(
                                   Radius.circular(8),
                                 ),
                                 child: _buildImage(
-                                  snapshot.data!.icon!,
+                                  x.icon!,
                                   width: 32,
                                   height: 32,
                                 ),
                               ).paddingOnly(right: 8),
-                            if (snapshot.data!.siteName != null)
+                            if (x.siteName != null)
                               Expanded(
                                 child: Text(
-                                  snapshot.data!.siteName!,
+                                  x.siteName!,
                                   style: Theme.of(context).textTheme.labelLarge,
                                   maxLines: 1,
                                   overflow: TextOverflow.ellipsis,
@@ -84,32 +103,27 @@ class LinkExpansion extends StatelessWidget {
                               ),
                           ],
                         ).paddingOnly(
-                          bottom: (snapshot.data!.icon?.isNotEmpty ?? false)
-                              ? 8
-                              : 4,
+                          bottom: (x.icon?.isNotEmpty ?? false) ? 8 : 4,
                         ),
-                      if (snapshot.data!.image != null &&
-                          (snapshot.data!.image?.startsWith('http') ?? false))
+                      if (x.image != null &&
+                          (x.image?.startsWith('http') ?? false))
                         ClipRRect(
                           borderRadius: const BorderRadius.all(
                             Radius.circular(8),
                           ),
-                          child: _buildImage(
-                            snapshot.data!.image!,
-                          ),
+                          child: _buildImage(x.image!),
                         ).paddingOnly(bottom: 8),
                       Text(
-                        snapshot.data!.title ?? 'No Title',
+                        x.title ?? 'No Title',
                         maxLines: 1,
                         overflow: TextOverflow.fade,
                         style: Theme.of(context).textTheme.bodyLarge,
                       ),
-                      if (snapshot.data!.description != null &&
-                          isRichDescription)
-                        MarkdownBody(data: snapshot.data!.description!)
-                      else if (snapshot.data!.description != null)
+                      if (x.description != null && isRichDescription)
+                        MarkdownBody(data: x.description!)
+                      else if (x.description != null)
                         Text(
-                          snapshot.data!.description!,
+                          x.description!,
                           maxLines: 3,
                           overflow: TextOverflow.ellipsis,
                         ),
@@ -117,7 +131,7 @@ class LinkExpansion extends StatelessWidget {
                   ).paddingAll(12),
                 ),
                 onTap: () {
-                  launchUrlString(x.group(0)!);
+                  launchUrlString(x.url);
                 },
               );
             },

lib/widgets/loading_indicator.dart

@@ -0,0 +1,89 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:gap/gap.dart';
+
+class LoadingIndicator extends StatefulWidget {
+  final bool isActive;
+  final Color? backgroundColor;
+
+  const LoadingIndicator({
+    super.key,
+    this.isActive = true,
+    this.backgroundColor,
+  });
+
+  @override
+  State<LoadingIndicator> createState() => _LoadingIndicatorState();
+}
+
+class _LoadingIndicatorState extends State<LoadingIndicator>
+    with SingleTickerProviderStateMixin {
+  late AnimationController _controller;
+  late Animation<double> _animation;
+
+  @override
+  void initState() {
+    super.initState();
+
+    _controller = AnimationController(
+      vsync: this,
+      duration: const Duration(milliseconds: 300),
+    );
+
+    _animation = CurvedAnimation(
+      parent: _controller,
+      curve: Curves.easeInOut,
+    );
+
+    if (widget.isActive) {
+      _controller.forward();
+    } else {
+      _controller.reverse();
+    }
+  }
+
+  @override
+  void didUpdateWidget(covariant LoadingIndicator oldWidget) {
+    super.didUpdateWidget(oldWidget);
+
+    if (widget.isActive != oldWidget.isActive) {
+      if (widget.isActive) {
+        _controller.forward();
+      } else {
+        _controller.reverse();
+      }
+    }
+  }
+
+  @override
+  void dispose() {
+    _controller.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return SizeTransition(
+      sizeFactor: _animation,
+      axisAlignment: -1, // Align animation from the top
+      child: Container(
+        padding: const EdgeInsets.symmetric(vertical: 16, horizontal: 24),
+        color: widget.backgroundColor ??
+            Theme.of(context).colorScheme.surfaceContainerLow.withOpacity(0.5),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.center,
+          crossAxisAlignment: CrossAxisAlignment.center,
+          children: [
+            const SizedBox(
+              height: 16,
+              width: 16,
+              child: CircularProgressIndicator(strokeWidth: 2.5),
+            ),
+            const Gap(8),
+            Text('loading'.tr),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/widgets/markdown_text_content.dart

@@ -1,12 +1,16 @@
+import 'dart:ui';
+
 import 'package:flutter/material.dart';
-import 'package:flutter_markdown_selectionarea/flutter_markdown.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:markdown/markdown.dart' as markdown;
-import 'package:markdown/markdown.dart';
+import 'package:path/path.dart';
 import 'package:solian/providers/stickers.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
+import 'package:syntax_highlight/syntax_highlight.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
 import 'account/account_profile_popup.dart';
@@ -39,11 +43,6 @@ class MarkdownTextContent extends StatelessWidget {
       // Getting paragraph
       var paragraph = paragraphs[idx];
 
-      // Auto adding new-lines
-      if (isAutoWarp) {
-        paragraph = paragraph.replaceAll('\n', '\\\n');
-      }
-
       // Matching stickers
       final stickerMatch = stickerRegex.allMatches(paragraph);
       final isOnlySticker =
@@ -58,7 +57,7 @@ class MarkdownTextContent extends StatelessWidget {
           styleSheet: MarkdownStyleSheet.fromTheme(
             Theme.of(context),
           ).copyWith(
-            textScaleFactor: isLargeText ? 1.1 : 1,
+              textScaler: TextScaler.linear(isLargeText ? 1.1 : 1),
               blockquote: TextStyle(
                 color: Theme.of(context).colorScheme.onSurfaceVariant,
               ),
@@ -74,15 +73,32 @@ class MarkdownTextContent extends StatelessWidget {
                   ),
                 ),
               ),
+              codeblockDecoration: BoxDecoration(
+                border: Border.all(
+                  color: Theme.of(context).dividerColor,
+                  width: 0.3,
                 ),
+                borderRadius: const BorderRadius.all(Radius.circular(4)),
+                color: Theme.of(context).colorScheme.surface.withOpacity(0.5),
+              )),
+          builders: {
+            'code': _MarkdownTextCodeElement(),
+          },
+          softLineBreak: true,
           extensionSet: markdown.ExtensionSet(
-            markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
+            <markdown.BlockSyntax>[
+              markdown.CodeBlockSyntax(),
+              ...markdown.ExtensionSet.commonMark.blockSyntaxes,
+              ...markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
+            ],
             <markdown.InlineSyntax>[
+              if (isAutoWarp) markdown.LineBreakSyntax(),
               _UserNameCardInlineSyntax(),
               _CustomEmoteInlineSyntax(),
-              markdown.EmojiSyntax(),
               markdown.AutolinkSyntax(),
               markdown.AutolinkExtensionSyntax(),
+              markdown.CodeSyntax(),
+              ...markdown.ExtensionSet.commonMark.inlineSyntaxes,
               ...markdown.ExtensionSet.gitHubFlavored.inlineSyntaxes
             ],
           ),
@@ -184,7 +200,7 @@ class MarkdownTextContent extends StatelessWidget {
       );
 
       if (idx < paragraphs.length - 1) {
-        contentWidgets.add(const Gap(4));
+        contentWidgets.add(isAutoWarp ? const Gap(4) : const Gap(8));
       }
     }
 
@@ -205,7 +221,7 @@ class MarkdownTextContent extends StatelessWidget {
   }
 }
 
-class _UserNameCardInlineSyntax extends InlineSyntax {
+class _UserNameCardInlineSyntax extends markdown.InlineSyntax {
   _UserNameCardInlineSyntax() : super(r'@[a-zA-Z0-9_]+');
 
   @override
@@ -221,7 +237,7 @@ class _UserNameCardInlineSyntax extends InlineSyntax {
   }
 }
 
-class _CustomEmoteInlineSyntax extends InlineSyntax {
+class _CustomEmoteInlineSyntax extends markdown.InlineSyntax {
   _CustomEmoteInlineSyntax() : super(r':([-\w]+):');
 
   @override
@@ -241,3 +257,48 @@ class _CustomEmoteInlineSyntax extends InlineSyntax {
     return true;
   }
 }
+
+class _MarkdownTextCodeElement extends MarkdownElementBuilder {
+  @override
+  Widget? visitElementAfter(
+    markdown.Element element,
+    TextStyle? preferredStyle,
+  ) {
+    var language = '';
+
+    if (element.attributes['class'] != null) {
+      String lg = element.attributes['class'] as String;
+      language = lg.substring(9).trim();
+    }
+    return SizedBox(
+      child: FutureBuilder(
+        future: (() async {
+          final docPath = '../../../';
+          final highlightingPath =
+              join(docPath, 'assets/highlighting', language);
+          await Highlighter.initialize([highlightingPath]);
+          return Highlighter(
+            language: highlightingPath,
+            theme: PlatformDispatcher.instance.platformBrightness ==
+                    Brightness.light
+                ? await HighlighterTheme.loadLightTheme()
+                : await HighlighterTheme.loadDarkTheme(),
+          );
+        })(),
+        builder: (context, snapshot) {
+          if (snapshot.hasData) {
+            final highlighter = snapshot.data!;
+            return Text.rich(
+              highlighter.highlight(element.textContent.trim()),
+              style: GoogleFonts.robotoMono(),
+            );
+          }
+          return Text(
+            element.textContent.trim(),
+            style: GoogleFonts.robotoMono(),
+          );
+        },
+      ),
+    ).paddingAll(8);
+  }
+}

lib/widgets/navigation/app_account_widget.dart

@@ -0,0 +1,80 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/account_status.dart';
+import 'package:solian/providers/account_status.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/relation.dart';
+import 'package:badges/badges.dart' as badges;
+import 'package:solian/widgets/account/account_avatar.dart';
+
+class AppAccountWidget extends StatefulWidget {
+  const AppAccountWidget({super.key});
+
+  @override
+  State<AppAccountWidget> createState() => _AppAccountWidgetState();
+}
+
+class _AppAccountWidgetState extends State<AppAccountWidget> {
+  AccountStatus? _accountStatus;
+
+  Future<void> _getStatus() async {
+    final StatusProvider provider = Get.find();
+
+    final resp = await provider.getCurrentStatus();
+    final status = AccountStatus.fromJson(resp.body);
+
+    if (mounted) {
+      setState(() {
+        _accountStatus = status;
+      });
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getStatus();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+
+    return Obx(() {
+      if (auth.isAuthorized.isFalse || auth.userProfile.value == null) {
+        return const Icon(Icons.account_circle);
+      }
+
+      final statusBadgeColor = _accountStatus != null
+          ? StatusProvider.determineStatus(_accountStatus!).$2
+          : Colors.grey;
+
+      final RelationshipProvider relations = Get.find();
+      final accountNotifications = relations.friendRequestCount.value;
+
+      return badges.Badge(
+        badgeContent: Text(
+          accountNotifications.toString(),
+          style: const TextStyle(color: Colors.white),
+        ),
+        showBadge: accountNotifications > 0,
+        position: badges.BadgePosition.topEnd(
+          top: -10,
+          end: -6,
+        ),
+        child: badges.Badge(
+          showBadge: _accountStatus != null,
+          badgeStyle: badges.BadgeStyle(badgeColor: statusBadgeColor),
+          position: badges.BadgePosition.bottomEnd(
+            bottom: 0,
+            end: -2,
+          ),
+          child: AttachedCircleAvatar(
+            radius: 14,
+            content: auth.userProfile.value!['avatar'],
+          ),
+        ),
+      );
+    });
+  }
+}

lib/widgets/navigation/app_navigation.dart

@@ -1,27 +1,33 @@
 import 'package:flutter/material.dart';
 import 'package:get/utils.dart';
+import 'package:solian/widgets/navigation/app_account_widget.dart';
 
 abstract class AppNavigation {
   static List<AppNavigationDestination> destinations = [
     AppNavigationDestination(
-      icon: Icons.dashboard,
-      label: 'dashboard'.tr,
+      icon: const Icon(Icons.dashboard),
+      label: 'dashboardNav'.tr,
       page: 'dashboard',
     ),
     AppNavigationDestination(
-      icon: Icons.explore,
+      icon: const Icon(Icons.explore),
       label: 'explore'.tr,
       page: 'explore',
     ),
     AppNavigationDestination(
-      icon: Icons.workspaces,
+      icon: const Icon(Icons.forum),
+      label: 'chat'.tr,
+      page: 'chat',
+    ),
+    AppNavigationDestination(
+      icon: const Icon(Icons.workspaces),
       label: 'realms'.tr,
       page: 'realms',
     ),
     AppNavigationDestination(
-      icon: Icons.forum,
-      label: 'chat'.tr,
-      page: 'chat',
+      icon: const AppAccountWidget(),
+      label: 'accountNav'.tr,
+      page: 'account',
     ),
   ];
 
@@ -30,7 +36,7 @@ abstract class AppNavigation {
 }
 
 class AppNavigationDestination {
-  final IconData icon;
+  final Widget icon;
   final String label;
   final String page;
 

lib/widgets/navigation/app_navigation_bottom.dart

@@ -0,0 +1,47 @@
+import 'package:flutter/material.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/navigation/app_navigation.dart';
+
+class AppNavigationBottom extends StatefulWidget {
+  final int initialIndex;
+
+  const AppNavigationBottom({super.key, this.initialIndex = 0});
+
+  @override
+  State<AppNavigationBottom> createState() => _AppNavigationBottomState();
+}
+
+class _AppNavigationBottomState extends State<AppNavigationBottom> {
+  int _currentIndex = 0;
+
+  @override
+  void initState() {
+    super.initState();
+    if (widget.initialIndex >= 0) {
+      _currentIndex = widget.initialIndex;
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return BottomNavigationBar(
+      currentIndex: _currentIndex,
+      type: BottomNavigationBarType.fixed,
+      showUnselectedLabels: false,
+      showSelectedLabels: true,
+      landscapeLayout: BottomNavigationBarLandscapeLayout.centered,
+      items: AppNavigation.destinations
+          .map(
+            (x) => BottomNavigationBarItem(
+              icon: x.icon,
+              label: x.label,
+            ),
+          )
+          .toList(),
+      onTap: (idx) {
+        setState(() => _currentIndex = idx);
+        AppRouter.instance.goNamed(AppNavigation.destinations[idx].page);
+      },
+    );
+  }
+}

lib/widgets/navigation/app_navigation_drawer.dart

@@ -1,330 +0,0 @@
-import 'dart:math' as math;
-
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:solian/models/account_status.dart';
-import 'package:solian/providers/account_status.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/relation.dart';
-import 'package:solian/router.dart';
-import 'package:solian/shells/root_shell.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/account/account_status_action.dart';
-import 'package:solian/widgets/navigation/app_navigation.dart';
-import 'package:badges/badges.dart' as badges;
-import 'package:solian/widgets/navigation/app_navigation_region.dart';
-
-class AppNavigationDrawer extends StatefulWidget {
-  final String? routeName;
-
-  const AppNavigationDrawer({super.key, this.routeName});
-
-  @override
-  State<AppNavigationDrawer> createState() => _AppNavigationDrawerState();
-}
-
-class _AppNavigationDrawerState extends State<AppNavigationDrawer>
-    with TickerProviderStateMixin {
-  bool _isCollapsed = true;
-
-  late final AnimationController _drawerAnimationController =
-      AnimationController(
-    duration: const Duration(milliseconds: 500),
-    vsync: this,
-  );
-  late final Animation<double> _drawerAnimation = Tween<double>(
-    begin: 80.0,
-    end: 304.0,
-  ).animate(CurvedAnimation(
-    parent: _drawerAnimationController,
-    curve: Curves.easeInOut,
-  ));
-
-  AccountStatus? _accountStatus;
-
-  Future<void> _getStatus() async {
-    final StatusProvider provider = Get.find();
-
-    final resp = await provider.getCurrentStatus();
-    final status = AccountStatus.fromJson(resp.body);
-
-    if (mounted) {
-      setState(() {
-        _accountStatus = status;
-      });
-    }
-  }
-
-  Color get _unFocusColor =>
-      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
-
-  Widget _buildUserInfo() {
-    return Obx(() {
-      final AuthProvider auth = Get.find();
-      if (auth.isAuthorized.isFalse || auth.userProfile.value == null) {
-        if (_isCollapsed) {
-          return InkWell(
-            child: const Icon(Icons.account_circle).paddingSymmetric(
-              horizontal: 28,
-              vertical: 20,
-            ),
-            onTap: () {
-              AppRouter.instance.goNamed('account');
-              _closeDrawer();
-            },
-          );
-        }
-
-        return ListTile(
-          contentPadding: const EdgeInsets.symmetric(horizontal: 28),
-          leading: const Icon(Icons.account_circle),
-          title: !_isCollapsed ? Text('guest'.tr) : null,
-          subtitle: !_isCollapsed ? Text('unsignedIn'.tr) : null,
-          onTap: () {
-            AppRouter.instance.goNamed('account');
-            _closeDrawer();
-          },
-        );
-      }
-
-      final leading = Obx(() {
-        final statusBadgeColor = _accountStatus != null
-            ? StatusProvider.determineStatus(_accountStatus!).$2
-            : Colors.grey;
-
-        final RelationshipProvider relations = Get.find();
-        final accountNotifications = relations.friendRequestCount.value;
-
-        return badges.Badge(
-          badgeContent: Text(
-            accountNotifications.toString(),
-            style: const TextStyle(color: Colors.white),
-          ),
-          showBadge: accountNotifications > 0,
-          position: badges.BadgePosition.topEnd(
-            top: -10,
-            end: -6,
-          ),
-          child: badges.Badge(
-            showBadge: _accountStatus != null,
-            badgeStyle: badges.BadgeStyle(badgeColor: statusBadgeColor),
-            position: badges.BadgePosition.bottomEnd(
-              bottom: 0,
-              end: -2,
-            ),
-            child: AccountAvatar(
-              content: auth.userProfile.value!['avatar'],
-            ),
-          ),
-        );
-      });
-
-      return InkWell(
-        child: !_isCollapsed
-            ? Row(
-                children: [
-                  leading,
-                  Expanded(
-                    child: Column(
-                      crossAxisAlignment: CrossAxisAlignment.start,
-                      children: [
-                        Text(
-                          auth.userProfile.value!['nick'],
-                          maxLines: 1,
-                          overflow: TextOverflow.fade,
-                          style: Theme.of(context).textTheme.bodyLarge,
-                        ).paddingOnly(left: 16),
-                        Builder(
-                          builder: (context) {
-                            if (_accountStatus == null) {
-                              return Text(
-                                'loading'.tr,
-                                maxLines: 1,
-                                overflow: TextOverflow.fade,
-                                style: TextStyle(
-                                  color: _unFocusColor,
-                                ),
-                              ).paddingOnly(left: 16);
-                            }
-                            final info = StatusProvider.determineStatus(
-                              _accountStatus!,
-                            );
-                            return Text(
-                              info.$3,
-                              maxLines: 1,
-                              overflow: TextOverflow.fade,
-                              style: TextStyle(
-                                color: _unFocusColor,
-                              ),
-                            ).paddingOnly(left: 16);
-                          },
-                        ),
-                      ],
-                    ),
-                  ),
-                ],
-              ).paddingSymmetric(horizontal: 20, vertical: 16)
-            : leading.paddingSymmetric(horizontal: 20, vertical: 16),
-        onTap: () {
-          AppRouter.instance.goNamed('account');
-          _closeDrawer();
-        },
-        onLongPress: () {
-          showModalBottomSheet(
-            useRootNavigator: true,
-            context: context,
-            builder: (context) => AccountStatusAction(
-              currentStatus: _accountStatus!.status,
-            ),
-          ).then((val) {
-            if (val == true) _getStatus();
-          });
-        },
-      );
-    });
-  }
-
-  void _expandDrawer() {
-    _drawerAnimationController.animateTo(1);
-  }
-
-  void _collapseDrawer() {
-    _drawerAnimationController.animateTo(0);
-  }
-
-  void _closeDrawer() {
-    _autoResize();
-    rootScaffoldKey.currentState!.closeDrawer();
-  }
-
-  void _autoResize() {
-    if (AppTheme.isExtraLargeScreen(context)) {
-      _expandDrawer();
-    } else if (AppTheme.isLargeScreen(context)) {
-      _collapseDrawer();
-    } else {
-      _drawerAnimationController.value = 1;
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.value) _getStatus();
-    Future.delayed(Duration.zero, () => _autoResize());
-    _drawerAnimationController.addListener(() {
-      if (_drawerAnimation.value > 180 && _isCollapsed) {
-        setState(() => _isCollapsed = false);
-      } else if (_drawerAnimation.value < 180 && !_isCollapsed) {
-        setState(() => _isCollapsed = true);
-      }
-    });
-  }
-
-  @override
-  void dispose() {
-    _drawerAnimationController.dispose();
-    super.dispose();
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return AnimatedBuilder(
-      animation: _drawerAnimation,
-      builder: (context, child) {
-        return Drawer(
-          width: _drawerAnimation.value,
-          backgroundColor:
-              AppTheme.isLargeScreen(context) ? Colors.transparent : null,
-          child: child,
-        );
-      },
-      child: SafeArea(
-        bottom: false,
-        child: Column(
-          children: [
-            _buildUserInfo().paddingSymmetric(vertical: 8),
-            const Divider(thickness: 0.3, height: 1),
-            SizedBox(
-              width: double.infinity,
-              child: Wrap(
-                runSpacing: 8,
-                spacing: 8,
-                alignment: WrapAlignment.spaceAround,
-                children: AppNavigation.destinations
-                    .map(
-                      (e) => Tooltip(
-                        message: e.label,
-                        child: InkWell(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(8)),
-                          child: Icon(
-                            e.icon,
-                            size: 22,
-                            color: Theme.of(context).colorScheme.onSurface,
-                          ).paddingAll(16),
-                          onTap: () {
-                            AppRouter.instance.goNamed(e.page);
-                            _closeDrawer();
-                          },
-                        ),
-                      ),
-                    )
-                    .toList(),
-              ).paddingSymmetric(vertical: 8, horizontal: 12),
-            ),
-            const Divider(thickness: 0.3, height: 1),
-            Expanded(
-              child: Material(
-                color: Theme.of(context).colorScheme.surface,
-                child: AppNavigationRegion(
-                  isCollapsed: _isCollapsed,
-                  onSelected: () {
-                    _closeDrawer();
-                  },
-                ),
-              ),
-            ),
-            const Divider(thickness: 0.3, height: 1),
-            Column(
-              children: [
-                if (_isCollapsed)
-                  Tooltip(
-                    message: 'expand'.tr,
-                    child: InkWell(
-                      child: const Icon(Icons.chevron_right, size: 20)
-                          .paddingSymmetric(
-                        horizontal: 28,
-                        vertical: 10,
-                      ),
-                      onTap: () {
-                        _expandDrawer();
-                      },
-                    ),
-                  )
-                else
-                  ListTile(
-                    minTileHeight: 0,
-                    contentPadding: const EdgeInsets.symmetric(
-                      horizontal: 20,
-                    ),
-                    leading:
-                        const Icon(Icons.chevron_left, size: 20).paddingAll(2),
-                    title: Text('collapse'.tr),
-                    onTap: () {
-                      _collapseDrawer();
-                    },
-                  ),
-              ],
-            ).paddingOnly(
-              top: 8,
-              bottom: math.max(8, MediaQuery.of(context).padding.bottom),
-            ),
-          ],
-        ),
-      ),
-    );
-  }
-}

lib/widgets/navigation/app_navigation_rail.dart

@@ -0,0 +1,69 @@
+import 'dart:math';
+
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/navigation/app_navigation.dart';
+
+class AppNavigationRail extends StatefulWidget {
+  final int initialIndex;
+
+  const AppNavigationRail({super.key, this.initialIndex = 0});
+
+  @override
+  State<AppNavigationRail> createState() => _AppNavigationRailState();
+}
+
+class _AppNavigationRailState extends State<AppNavigationRail> {
+  int? _currentIndex = 0;
+
+  @override
+  void initState() {
+    super.initState();
+    if (widget.initialIndex >= 0) {
+      _currentIndex = widget.initialIndex;
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: NavigationRail(
+        selectedIndex: _currentIndex,
+        labelType: NavigationRailLabelType.selected,
+        groupAlignment: -1,
+        destinations: AppNavigation.destinations
+            .sublist(0, AppNavigation.destinations.length - 1)
+            .map(
+              (x) => NavigationRailDestination(
+                icon: x.icon,
+                label: Text(x.label),
+              ),
+            )
+            .toList(),
+        trailing: Expanded(
+          child: Align(
+            alignment: Alignment.bottomCenter,
+            child: IconButton(
+              icon: AppNavigation.destinations.last.icon,
+              tooltip: AppNavigation.destinations.last.label,
+              onPressed: () {
+                setState(() => _currentIndex = null);
+                AppRouter.instance
+                    .goNamed(AppNavigation.destinations.last.page);
+              },
+            ),
+          ),
+        ),
+        onDestinationSelected: (idx) {
+          setState(() => _currentIndex = idx);
+          AppRouter.instance.goNamed(AppNavigation.destinations[idx].page);
+        },
+      ).paddingOnly(
+        top: max(16, MediaQuery.of(context).padding.top),
+        bottom: max(16, MediaQuery.of(context).padding.bottom),
+      ),
+    );
+  }
+}

lib/widgets/navigation/app_navigation_region.dart

@@ -1,230 +0,0 @@
-import 'package:animations/animations.dart';
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:solian/models/realm.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/channel.dart';
-import 'package:solian/providers/content/realm.dart';
-import 'package:solian/providers/navigation.dart';
-import 'package:solian/services.dart';
-import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/auto_cache_image.dart';
-import 'package:solian/widgets/channel/channel_list.dart';
-
-class AppNavigationRegion extends StatefulWidget {
-  final bool isCollapsed;
-  final Function onSelected;
-
-  const AppNavigationRegion({
-    super.key,
-    this.isCollapsed = false,
-    required this.onSelected,
-  });
-
-  @override
-  State<AppNavigationRegion> createState() => _AppNavigationRegionState();
-}
-
-class _AppNavigationRegionState extends State<AppNavigationRegion> {
-  bool _isTryingExit = false;
-
-  void _focusRealm(Realm item) {
-    setState(
-      () => Get.find<NavigationStateProvider>().focusedRealm.value = item,
-    );
-  }
-
-  void _unFocusRealm() {
-    setState(
-      () => Get.find<NavigationStateProvider>().focusedRealm.value = null,
-    );
-  }
-
-  @override
-  void dispose() {
-    super.dispose();
-  }
-
-  Widget _buildRealmFocusAvatar() {
-    final focusedRealm = Get.find<NavigationStateProvider>().focusedRealm.value;
-    return GestureDetector(
-      child: MouseRegion(
-        child: AnimatedSwitcher(
-          switchInCurve: Curves.fastOutSlowIn,
-          switchOutCurve: Curves.fastOutSlowIn,
-          duration: const Duration(milliseconds: 300),
-          transitionBuilder: (child, animation) {
-            return ScaleTransition(
-              scale: animation,
-              child: child,
-            );
-          },
-          child: _isTryingExit
-              ? CircleAvatar(
-                  backgroundColor: Theme.of(context).colorScheme.primary,
-                  child: const Icon(
-                    Icons.arrow_back,
-                    color: Colors.white,
-                    size: 16,
-                  ),
-                ).paddingSymmetric(
-                  vertical: 8,
-                )
-              : _buildEntryAvatar(focusedRealm!),
-        ),
-        onEnter: (_) => setState(() => _isTryingExit = true),
-        onExit: (_) => setState(() => _isTryingExit = false),
-      ),
-      onTap: () => _unFocusRealm(),
-    );
-  }
-
-  Widget _buildEntryAvatar(Realm item) {
-    return Hero(
-      tag: Key('region-realm-avatar-${item.id}'),
-      child: (item.avatar?.isNotEmpty ?? false)
-          ? AccountAvatar(content: item.avatar)
-          : CircleAvatar(
-              backgroundColor: Theme.of(context).colorScheme.primary,
-              child: const Icon(
-                Icons.workspaces,
-                color: Colors.white,
-                size: 16,
-              ),
-            ).paddingSymmetric(
-              vertical: 8,
-            ),
-    );
-  }
-
-  Widget _buildEntry(BuildContext context, Realm item) {
-    const padding = EdgeInsets.symmetric(horizontal: 20, vertical: 8);
-
-    if (widget.isCollapsed) {
-      return InkWell(
-        child: _buildEntryAvatar(item).paddingSymmetric(vertical: 8),
-        onTap: () => _focusRealm(item),
-      );
-    }
-
-    return ListTile(
-      minTileHeight: 0,
-      leading: _buildEntryAvatar(item),
-      contentPadding: padding,
-      title: Text(item.name),
-      subtitle: Text(
-        item.description,
-        maxLines: 1,
-        overflow: TextOverflow.ellipsis,
-      ),
-      onTap: () => _focusRealm(item),
-    );
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    final RealmProvider realms = Get.find();
-    final ChannelProvider channels = Get.find();
-    final AuthProvider auth = Get.find();
-    final NavigationStateProvider navState = Get.find();
-
-    return Obx(
-      () => PageTransitionSwitcher(
-        transitionBuilder: (child, animation, secondaryAnimation) {
-          return SharedAxisTransition(
-            animation: animation,
-            secondaryAnimation: secondaryAnimation,
-            transitionType: SharedAxisTransitionType.horizontal,
-            child: Material(
-              color: Theme.of(context).colorScheme.surface,
-              child: child,
-            ),
-          );
-        },
-        child: navState.focusedRealm.value == null
-            ? widget.isCollapsed
-                ? CustomScrollView(
-                    slivers: [
-                      const SliverPadding(padding: EdgeInsets.only(top: 16)),
-                      SliverList.builder(
-                        itemCount: realms.availableRealms.length,
-                        itemBuilder: (context, index) {
-                          final element = realms.availableRealms[index];
-                          return Tooltip(
-                            message: element.name,
-                            child: _buildEntry(context, element),
-                          );
-                        },
-                      ),
-                    ],
-                  )
-                : CustomScrollView(
-                    slivers: [
-                      SliverList.builder(
-                        itemCount: realms.availableRealms.length,
-                        itemBuilder: (context, index) {
-                          final element = realms.availableRealms[index];
-                          return _buildEntry(context, element);
-                        },
-                      ),
-                    ],
-                  )
-            : Column(
-                children: [
-                  if (!widget.isCollapsed &&
-                      (navState.focusedRealm.value!.banner?.isNotEmpty ??
-                          false))
-                    AspectRatio(
-                      aspectRatio: 16 / 7,
-                      child: AutoCacheImage(
-                        ServiceFinder.buildUrl(
-                          'uc',
-                          '/attachments/${navState.focusedRealm.value!.banner}',
-                        ),
-                        fit: BoxFit.cover,
-                      ),
-                    ),
-                  if (widget.isCollapsed)
-                    Tooltip(
-                      message: navState.focusedRealm.value!.name,
-                      child: _buildRealmFocusAvatar().paddingOnly(
-                        top: 24,
-                        bottom: 8,
-                      ),
-                    )
-                  else
-                    ListTile(
-                      minTileHeight: 0,
-                      tileColor:
-                          Theme.of(context).colorScheme.surfaceContainerLow,
-                      leading: _buildRealmFocusAvatar(),
-                      contentPadding: const EdgeInsets.symmetric(
-                          horizontal: 20, vertical: 8),
-                      title: Text(navState.focusedRealm.value!.name),
-                      subtitle: Text(
-                        navState.focusedRealm.value!.description,
-                        maxLines: 1,
-                        overflow: TextOverflow.ellipsis,
-                      ),
-                    ),
-                  Expanded(
-                    child: Obx(
-                      () => ChannelListWidget(
-                        useReplace: true,
-                        channels: channels.availableChannels
-                            .where((x) =>
-                                x.realm?.id == navState.focusedRealm.value?.id)
-                            .toList(),
-                        isCollapsed: widget.isCollapsed,
-                        selfId: auth.userProfile.value!['id'],
-                        noCategory: true,
-                        onSelected: (_) => widget.onSelected(),
-                      ),
-                    ),
-                  ),
-                ],
-              ),
-      ),
-    );
-  }
-}

lib/widgets/navigation/realm_switcher.dart

@@ -0,0 +1,92 @@
+import 'dart:math';
+
+import 'package:dropdown_button2/dropdown_button2.dart';
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/navigation.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
+
+class RealmSwitcher extends StatelessWidget {
+  const RealmSwitcher({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    final realms = Get.find<RealmProvider>();
+    final navState = Get.find<NavigationStateProvider>();
+
+    return Obx(() {
+      return DropdownButtonHideUnderline(
+        child: DropdownButton2<Realm?>(
+          iconStyleData: const IconStyleData(iconSize: 0),
+          isExpanded: true,
+          hint: Text(
+            'Realm Region',
+            style: TextStyle(
+              fontSize: 14,
+              color: Theme.of(context).hintColor,
+            ),
+          ),
+          items: [null, ...realms.availableRealms]
+              .map((Realm? item) => DropdownMenuItem<Realm?>(
+                    value: item,
+                    child: Row(
+                      mainAxisAlignment: MainAxisAlignment.center,
+                      children: [
+                        if (item != null)
+                          AttachedCircleAvatar(
+                            content: item.avatar,
+                            radius: 14,
+                            fallbackWidget: const Icon(
+                              Icons.workspaces,
+                              size: 16,
+                            ),
+                          )
+                        else
+                          CircleAvatar(
+                            backgroundColor:
+                                Theme.of(context).colorScheme.primary,
+                            radius: 14,
+                            child: const Icon(
+                              Icons.public,
+                              color: Colors.white,
+                              size: 16,
+                            ),
+                          ),
+                        const Gap(8),
+                        Expanded(
+                          child: Text(
+                            item?.name ?? 'global'.tr,
+                            style: const TextStyle(
+                              fontSize: 14,
+                            ),
+                            maxLines: 2,
+                            overflow: TextOverflow.ellipsis,
+                          ),
+                        ),
+                      ],
+                    ),
+                  ))
+              .toList(),
+          value: navState.focusedRealm.value,
+          onChanged: (Realm? value) {
+            navState.focusedRealm.value = value;
+          },
+          buttonStyleData: ButtonStyleData(
+            height: 48,
+            width: max(200, MediaQuery.of(context).size.width * 0.4),
+            padding: const EdgeInsets.symmetric(horizontal: 16),
+            decoration: const BoxDecoration(
+              borderRadius: BorderRadius.all(Radius.circular(16)),
+            ),
+          ),
+          menuItemStyleData: const MenuItemStyleData(
+            height: 48,
+          ),
+        ),
+      );
+    });
+  }
+}

lib/widgets/posts/editor/post_editor_thumbnail.dart

@@ -29,7 +29,7 @@ class _PostEditorThumbnailDialogState extends State<PostEditorThumbnailDialog> {
             _attachmentController.text = value.toString();
           });
 
-          widget.controller.thumbnail.value = value;
+          widget.controller.thumbnail.value = value.isEmpty ? null : value;
         },
         initialAttachments: const [],
         onRemove: (_) {},
@@ -91,7 +91,8 @@ class _PostEditorThumbnailDialogState extends State<PostEditorThumbnailDialog> {
       actions: [
         TextButton(
           onPressed: () {
-            widget.controller.thumbnail.value = _attachmentController.text;
+            final text = _attachmentController.text;
+            widget.controller.thumbnail.value = text.isEmpty ? null : text;
             Navigator.pop(context);
           },
           child: Text('confirm'.tr),

lib/widgets/posts/post_action.dart

@@ -1,17 +1,21 @@
 import 'dart:math';
 
+import 'package:file_saver/file_saver.dart';
 import 'package:firebase_analytics/firebase_analytics.dart';
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
+import 'package:screenshot/screenshot.dart';
 import 'package:share_plus/share_plus.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/content/posts.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/posts/post_editor.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_share.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
 
 class PostAction extends StatefulWidget {
@@ -25,20 +29,14 @@ class PostAction extends StatefulWidget {
 }
 
 class _PostActionState extends State<PostAction> {
-  bool _isBusy = true;
+  bool _isBusy = false;
   bool _canModifyContent = false;
 
   void _checkAbleToModifyContent() async {
     final AuthProvider auth = Get.find();
     if (auth.isAuthorized.isFalse) return;
 
-    setState(() => _isBusy = true);
-
-    setState(() {
-      _canModifyContent =
-          auth.userProfile.value!['id'] == widget.item.author.id;
-      _isBusy = false;
-    });
+    _canModifyContent = auth.userProfile.value!['id'] == widget.item.author.id;
   }
 
   Future<void> _doShare({bool noUri = false}) async {
@@ -69,7 +67,8 @@ class _PostActionState extends State<PostAction> {
           'link': 'https://solsynth.dev/posts/$id',
         }),
         subject: 'postShareSubject'.trParams({
-          'username': widget.item.author.nick,
+          'username': '@${widget.item.author.name}',
+          'title': widget.item.body['title'] ?? '#${widget.item.id}',
         }),
         sharePositionOrigin: box!.localToGlobal(Offset.zero) & box.size,
       );
@@ -84,6 +83,78 @@ class _PostActionState extends State<PostAction> {
     }
   }
 
+  Future<void> _shareImage() async {
+    final List<String> attachments = widget.item.body['attachments'] is List
+        ? List.from(widget.item.body['attachments']?.whereType<String>())
+        : List.empty();
+    final hasMultipleAttachment = attachments.length > 1;
+
+    setState(() => _isBusy = true);
+
+    final double width = hasMultipleAttachment ? 640 : 480;
+
+    final screenshot = ScreenshotController();
+    final image = await screenshot.captureFromLongWidget(
+      MediaQuery(
+        data: MediaQuery.of(context).copyWith(
+          size: Size(width, double.infinity),
+        ),
+        child: PostShareImage(item: widget.item),
+      ),
+      context: context,
+      pixelRatio: 2,
+      constraints: BoxConstraints(
+        minWidth: 480,
+        maxWidth: width,
+        minHeight: 640,
+        maxHeight: double.infinity,
+      ),
+    );
+
+    final filename = 'share_post#${widget.item.id}';
+
+    if (PlatformInfo.isAndroid || PlatformInfo.isIOS) {
+      final box = context.findRenderObject() as RenderBox?;
+
+      final file = XFile.fromData(
+        image,
+        mimeType: 'image/png',
+        name: filename,
+      );
+      await Share.shareXFiles(
+        [file],
+        subject: 'postShareSubject'.trParams({
+          'username': '@${widget.item.author.name}',
+          'title': widget.item.body['title'] ?? '#${widget.item.id}',
+        }),
+        sharePositionOrigin: box!.localToGlobal(Offset.zero) & box.size,
+      );
+    } else {
+      final filepath = await FileSaver.instance.saveFile(
+        name: filename,
+        ext: 'png',
+        mimeType: MimeType.png,
+        bytes: image,
+      );
+      context.showSnackbar('fileSavedAt'.trParams({'path': filepath}));
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<Post> _getFullPost() async {
+    final PostProvider posts = Get.find();
+
+    try {
+      final resp = await posts.getPost(widget.item.id.toString());
+      return Post.fromJson(resp.body);
+    } catch (e) {
+      context.showErrorDialog(e).then((_) => Navigator.pop(context));
+    }
+
+    return widget.item;
+  }
+
   @override
   void initState() {
     super.initState();
@@ -127,7 +198,13 @@ class _PostActionState extends State<PostAction> {
               ),
             ],
           ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(
+            isActive: _isBusy,
+            backgroundColor: Theme.of(context)
+                .colorScheme
+                .surfaceContainerHigh
+                .withOpacity(0.5),
+          ),
           Expanded(
             child: ListView(
               children: [
@@ -135,16 +212,30 @@ class _PostActionState extends State<PostAction> {
                   contentPadding: const EdgeInsets.symmetric(horizontal: 24),
                   leading: const Icon(Icons.share),
                   title: Text('share'.tr),
-                  trailing: PlatformInfo.isIOS || PlatformInfo.isAndroid
-                      ? IconButton(
+                  trailing: Row(
+                    mainAxisSize: MainAxisSize.min,
+                    children: [
+                      if (PlatformInfo.isIOS || PlatformInfo.isAndroid)
+                        IconButton(
                           icon: const Icon(Icons.link_off),
                           tooltip: 'shareNoUri'.tr,
                           onPressed: () async {
                             await _doShare(noUri: true);
                             Navigator.pop(context);
                           },
-                        )
-                      : null,
+                        ),
+                      IconButton(
+                        icon: const Icon(Icons.image),
+                        tooltip: 'shareImage'.tr,
+                        onPressed: _isBusy
+                            ? null
+                            : () async {
+                                await _shareImage();
+                                Navigator.pop(context);
+                              },
+                      ),
+                    ],
+                  ),
                   onTap: () async {
                     await _doShare();
                     Navigator.pop(context);
@@ -221,14 +312,22 @@ class _PostActionState extends State<PostAction> {
                     contentPadding: const EdgeInsets.symmetric(horizontal: 24),
                     leading: const Icon(Icons.edit),
                     title: Text('edit'.tr),
-                    onTap: () async {
+                    onTap: _isBusy
+                        ? null
+                        : () async {
+                            setState(() => _isBusy = true);
+                            var item = widget.item;
+                            if (item.body?['content_truncated'] == true) {
+                              item = await _getFullPost();
+                            }
                             Navigator.pop(
                               context,
                               AppRouter.instance.pushNamed(
                                 'postEditor',
-                          extra: PostPublishArguments(edit: widget.item),
+                                extra: PostPublishArguments(edit: item),
                               ),
                             );
+                            if (mounted) setState(() => _isBusy = false);
                           },
                   ),
                 if (_canModifyContent)