🐛 Bug fixes

👔 Article wont show expand attachment list
🐛 Optimize content render
2024-10-20 16:15:24 +08:00 · 2024-10-19 16:55:14 +08:00 · 2024-10-19 00:32:16 +08:00 · 2024-10-17 23:50:47 +08:00 · 2024-10-17 23:49:20 +08:00 · 2024-10-17 23:01:42 +08:00
110 changed files with 6308 additions and 2942 deletions
--- a/.roadsignrc
+++ b/.roadsignrc
@ -0,0 +1,13 @@
+{
+  "sync": {
+    "region": "solian",
+    "configPath": "roadsign.toml"
+  },
+  "deployments": [
+    {
+      "region": "solian",
+      "site": "solian-web",
+      "path": "build/web"
+    }
+  ]
+}
--- a/.vscode/settings.json
+++ b/.vscode/settings.json
@ -0,0 +1,5 @@
+{
+    "cSpell.words": [
+        "annvisery"
+    ]
+}
--- a/assets/highlighting/cpp.json
+++ b/assets/highlighting/cpp.json
@ -0,0 +1,358 @@
+{
+  "name": "C++",
+  "version": "1.0.0",
+  "fileTypes": ["cpp", "hpp", "cc", "h"],
+  "scopeName": "source.cpp",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.cpp",
+      "match": "^\\s*#\\s*(include|define|if|ifdef|ifndef|else|endif|pragma)\\b"
+    },
+    {
+      "name": "meta.declaration.cpp",
+      "begin": "^\\w*\\b(namespace|class|struct|enum|typedef|template)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.declaration.cpp"
+        }
+      },
+      "end": "(\\{|;)",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.cpp",
+          "match": "\\b(public|private|protected|virtual|override|final)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.cpp",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.cpp"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.cpp",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#comments-inline"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "(//.*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.cpp",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.cpp",
+          "match": "__attribute__\\(\\w+\\)"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.cpp",
+          "match": "\\b(true|false|nullptr)\\b"
+        },
+        {
+          "name": "variable.language.cpp",
+          "match": "\\b(this|super)\\b"
+        },
+        {
+          "name": "constant.numeric.cpp",
+          "match": "\\b((0(x|X)[0-9a-fA-F]+)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "\\b(bool|int|char|double|float|long|short|signed|unsigned|void)\\b",
+          "name": "storage.type.primitive.cpp"
+        },
+        {
+          "begin": "(\\b[A-Z]\\w*\\b)",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.cpp"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "\\b([a-z_][a-zA-Z0-9_]*)\\s*\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.cpp"
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.cpp"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.cpp",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(if|else|for|while|do|switch|case|break|continue|goto|return)\\b"
+        },
+        {
+          "name": "keyword.operator.cpp",
+          "match": "\\b(sizeof|typeid|decltype|new|delete)\\b"
+        },
+        {
+          "name": "keyword.control.try.cpp",
+          "match": "\\b(try|catch|throw)\\b"
+        },
+        {
+          "name": "keyword.control.cpp",
+          "match": "\\b(static|inline|virtual|override|const|volatile|explicit|friend|constexpr)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.comparison.cpp",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.cpp",
+          "match": "(\\+|\\-|\\*|\\/|%)"
+        },
+        {
+          "name": "keyword.operator.assignment.cpp",
+          "match": "(=|\\+=|-=|\\*=|/=|%=)"
+        },
+        {
+          "name": "keyword.operator.logical.cpp",
+          "match": "(\\&\\&|\\|\\||!)"
+        },
+        {
+          "name": "keyword.operator.bitwise.cpp",
+          "match": "(<<|>>|\\&|\\||\\^|~)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.cpp"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.cpp",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.cpp"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.cpp",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.cpp",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.double.cpp",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.cpp",
+          "begin": "'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "constant.character.escape.cpp",
+              "match": "\\\\."
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.cpp",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.cpp",
+          "match": ";"
+        }
+      ]
+    }
+  }
+}
--- a/assets/highlighting/dart.json
+++ b/assets/highlighting/dart.json
@ -0,0 +1,531 @@
+{
+  "name": "Dart",
+  "version": "1.2.3",
+  "fileTypes": ["dart"],
+  "scopeName": "source.dart",
+
+  "foldingStartMarker": "\\{\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+
+  "patterns": [
+    {
+      "name": "meta.preprocessor.script.dart",
+      "match": "^(#!.*)$"
+    },
+    {
+      "name": "meta.declaration.dart",
+      "begin": "^\\w*\\b(library|import|part of|part|export)\\b",
+      "beginCaptures": {
+        "0": {
+          "name": "keyword.other.import.dart"
+        }
+      },
+      "end": ";",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.terminator.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#strings"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "name": "keyword.other.import.dart",
+          "match": "\\b(as|show|hide)\\b"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "\\b(if)\\b"
+        }
+      ]
+    },
+    {
+      "include": "#comments"
+    },
+    {
+      "include": "#punctuation"
+    },
+    {
+      "include": "#annotations"
+    },
+    {
+      "include": "#keywords"
+    },
+    {
+      "include": "#constants-and-special-vars"
+    },
+    {
+      "include": "#operators"
+    },
+    {
+      "include": "#strings"
+    }
+  ],
+
+  "repository": {
+    "dartdoc": {
+      "patterns": [
+        {
+          "match": "(\\[.*?\\])",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "match": "^ {4,}(?![ \\*]).*",
+          "captures": {
+            "0": {
+              "name": "variable.name.source.dart"
+            }
+          }
+        },
+        {
+          "contentName": "variable.other.source.dart",
+          "begin": "```.*?$",
+          "end": "```"
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(`.*?`)",
+          "captures": {
+            "0": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        },
+        {
+          "match": "(\\* ((    ).*))$",
+          "captures": {
+            "2": {
+              "name": "variable.other.source.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "name": "comment.block.empty.dart",
+          "match": "/\\*\\*/",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.dart"
+            }
+          }
+        },
+        {
+          "include": "#comments-doc-oldschool"
+        },
+        {
+          "include": "#comments-doc"
+        },
+        {
+          "include": "#comments-inline"
+        }
+      ]
+    },
+    "comments-doc-oldschool": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "/\\*\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-doc-oldschool"
+            },
+            {
+              "include": "#comments-block"
+            },
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-doc": {
+      "patterns": [
+        {
+          "name": "comment.block.documentation.dart",
+          "begin": "///",
+          "while": "^\\s*///",
+          "patterns": [
+            {
+              "include": "#dartdoc"
+            }
+          ]
+        }
+      ]
+    },
+    "comments-inline": {
+      "patterns": [
+        {
+          "include": "#comments-block"
+        },
+        {
+          "match": "((//).*)$",
+          "captures": {
+            "1": {
+              "name": "comment.line.double-slash.dart"
+            }
+          }
+        }
+      ]
+    },
+    "comments-block": {
+      "patterns": [
+        {
+          "name": "comment.block.dart",
+          "begin": "/\\*",
+          "end": "\\*/",
+          "patterns": [
+            {
+              "include": "#comments-block"
+            }
+          ]
+        }
+      ]
+    },
+    "annotations": {
+      "patterns": [
+        {
+          "name": "storage.type.annotation.dart",
+          "match": "@[a-zA-Z]+"
+        }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.dart",
+          "match": "(?<!\\$)\\b(true|false|null)\\b(?!\\$)"
+        },
+        {
+          "name": "variable.language.dart",
+          "match": "(?<!\\$)\\b(this|super)\\b(?!\\$)"
+        },
+        {
+          "name": "constant.numeric.dart",
+          "match": "(?<!\\$)\\b((0(x|X)[0-9a-fA-F]*)|(([0-9]+\\.?[0-9]*)|(\\.[0-9]+))((e|E)(\\+|-)?[0-9]+)?)\\b(?!\\$)"
+        },
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "include": "#function-identifier"
+        }
+      ]
+    },
+    "class-identifier": {
+      "patterns": [
+        {
+          "match": "(?<!\\$)\\b(bool|num|int|double|dynamic)\\b(?!\\$)",
+          "name": "support.class.dart"
+        },
+        {
+          "match": "(?<!\\$)\\bvoid\\b(?!\\$)",
+          "name": "storage.type.primitive.dart"
+        },
+        {
+          "begin": "(?<![a-zA-Z0-9_$])([_$]*[A-Z][a-zA-Z0-9_$]*)\\b",
+          "end": "(?!<)",
+          "beginCaptures": {
+            "1": {
+              "name": "support.class.dart"
+            }
+          },
+          "patterns": [
+            {
+              "include": "#type-args"
+            }
+          ]
+        }
+      ]
+    },
+    "function-identifier": {
+      "patterns": [
+        {
+          "match": "([_$]*[a-z][a-zA-Z0-9_$]*)(<(?:[a-zA-Z0-9_$<>?]|,\\s*|\\s+extends\\s+)+>)?[!?]?\\(",
+          "captures": {
+            "1": {
+              "name": "entity.name.function.dart"
+            },
+            "2": {
+              "patterns": [
+                {
+                  "include": "#type-args"
+                }
+              ]
+            }
+          }
+        }
+      ]
+    },
+    "type-args": {
+      "begin": "(<)",
+      "end": "(>)",
+      "beginCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "endCaptures": {
+        "1": {
+          "name": "other.source.dart"
+        }
+      },
+      "patterns": [
+        {
+          "include": "#class-identifier"
+        },
+        {
+          "match": ","
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "extends"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.cast.dart",
+          "match": "(?<!\\$)\\bas\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.catch-exception.dart",
+          "match": "(?<!\\$)\\b(try|on|catch|finally|throw|rethrow)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(break|case|continue|default|do|else|for|if|in|return|switch|while|when)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\b(sync(\\*)?|async(\\*)?|await|yield(\\*)?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.dart",
+          "match": "(?<!\\$)\\bassert\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.control.new.dart",
+          "match": "(?<!\\$)\\b(new)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.declaration.dart",
+          "match": "(?<!\\$)\\b(abstract|sealed|base|interface|class|enum|extends|extension type|extension|external|factory|implements|get(?!\\()|mixin|native|operator|set(?!\\()|typedef|with|covariant)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.modifier.dart",
+          "match": "(?<!\\$)\\b(static|final|const|required|late)\\b(?!\\$)"
+        },
+        {
+          "name": "storage.type.primitive.dart",
+          "match": "(?<!\\$)\\b(?:void|var)\\b(?!\\$)"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.dart",
+          "match": "(?<!\\$)\\b(is\\!?)\\b(?!\\$)"
+        },
+        {
+          "name": "keyword.operator.ternary.dart",
+          "match": "\\?|:"
+        },
+        {
+          "name": "keyword.operator.bitwise.dart",
+          "match": "(<<|>>>?|~|\\^|\\||&)"
+        },
+        {
+          "name": "keyword.operator.assignment.bitwise.dart",
+          "match": "((&|\\^|\\||<<|>>>?)=)"
+        },
+        {
+          "name": "keyword.operator.closure.dart",
+          "match": "(=>)"
+        },
+        {
+          "name": "keyword.operator.comparison.dart",
+          "match": "(==|!=|<=?|>=?)"
+        },
+        {
+          "name": "keyword.operator.assignment.arithmetic.dart",
+          "match": "(([+*/%-]|\\~)=)"
+        },
+        {
+          "name": "keyword.operator.assignment.dart",
+          "match": "(=)"
+        },
+        {
+          "name": "keyword.operator.increment-decrement.dart",
+          "match": "(\\-\\-|\\+\\+)"
+        },
+        {
+          "name": "keyword.operator.arithmetic.dart",
+          "match": "(\\-|\\+|\\*|\\/|\\~\\/|%)"
+        },
+        {
+          "name": "keyword.operator.logical.dart",
+          "match": "(!|&&|\\|\\|)"
+        }
+      ]
+    },
+    "string-interp": {
+      "patterns": [
+        {
+          "match": "\\$([a-zA-Z0-9_]+)",
+          "captures": {
+            "1": {
+              "name": "variable.parameter.dart"
+            }
+          }
+        },
+        {
+          "name": "string.interpolated.expression.dart",
+          "begin": "\\$\\{",
+          "end": "\\}",
+          "patterns": [
+            {
+              "include": "#constants-and-special-vars",
+              "name": "variable.parameter.dart"
+            },
+            {
+              "include": "#strings"
+            },
+            {
+              "name": "variable.parameter.dart",
+              "match": "[a-zA-Z0-9_]+"
+            }
+          ]
+        },
+        {
+          "name": "constant.character.escape.dart",
+          "match": "\\\\."
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.interpolated.triple.double.dart",
+          "begin": "(?<!r)\"\"\"",
+          "end": "\"\"\"(?!\")",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.triple.single.dart",
+          "begin": "(?<!r)'''",
+          "end": "'''(?!')",
+          "patterns": [
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.triple.double.dart",
+          "begin": "r\"\"\"",
+          "end": "\"\"\"(?!\")"
+        },
+        {
+          "name": "string.quoted.triple.single.dart",
+          "begin": "r'''",
+          "end": "'''(?!')"
+        },
+        {
+          "name": "string.interpolated.double.dart",
+          "begin": "(?<!\\|r)\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.double.dart",
+          "begin": "r\"",
+          "end": "\"",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        },
+        {
+          "name": "string.interpolated.single.dart",
+          "begin": "(?<!\\|r)'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            },
+            {
+              "include": "#string-interp"
+            }
+          ]
+        },
+        {
+          "name": "string.quoted.single.dart",
+          "begin": "r'",
+          "end": "'",
+          "patterns": [
+            {
+              "name": "invalid.string.newline",
+              "match": "\\n"
+            }
+          ]
+        }
+      ]
+    },
+    "punctuation": {
+      "patterns": [
+        {
+          "name": "punctuation.comma.dart",
+          "match": ","
+        },
+        {
+          "name": "punctuation.terminator.dart",
+          "match": ";"
+        },
+        {
+          "name": "punctuation.dot.dart",
+          "match": "\\."
+        }
+      ]
+    }
+  }
+}
--- a/assets/highlighting/json.json
+++ b/assets/highlighting/json.json
@ -0,0 +1,212 @@
+{
+  "fileTypes": ["json"],
+  "foldingStartMarker": "^\\s*[{\\[](?!.*[}\\]],?\\s*$)|[{\\[]\\s*$",
+  "foldingStopMarker": "^\\s*[}\\]]",
+  "keyEquivalent": "^~J",
+  "name": "JSON (Javascript Next)",
+  "patterns": [
+    {
+      "include": "#value"
+    }
+  ],
+  "repository": {
+    "array": {
+      "begin": "\\[",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.begin.json"
+        }
+      },
+      "end": "\\]",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.array.end.json"
+        }
+      },
+      "name": "meta.structure.array.json",
+      "patterns": [
+        {
+          "include": "#value"
+        },
+        {
+          "match": ",",
+          "name": "punctuation.separator.array.json"
+        },
+        {
+          "match": "[^\\s\\]]",
+          "name": "invalid.illegal.expected-array-separator.json"
+        }
+      ]
+    },
+    "comments": {
+      "patterns": [
+        {
+          "begin": "/\\*\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.documentation.json"
+        },
+        {
+          "begin": "/\\*",
+          "captures": {
+            "0": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "end": "\\*/",
+          "name": "comment.block.json"
+        },
+        {
+          "captures": {
+            "1": {
+              "name": "punctuation.definition.comment.json"
+            }
+          },
+          "match": "(//).*$\\n?",
+          "name": "comment.line.double-slash.js"
+        }
+      ]
+    },
+    "constant": {
+      "match": "\\b(?:true|false|null)\\b",
+      "name": "constant.language.json"
+    },
+    "number": {
+      "match": "-?(?:0|[1-9]\\d*)\n(?:\n(?:\n\\.\\d+)?\n(?:\n[eE][+-]?\\d+)?)?",
+      "name": "constant.numeric.json"
+    },
+    "object": {
+      "begin": "\\{",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.begin.json"
+        }
+      },
+      "end": "\\}",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.dictionary.end.json"
+        }
+      },
+      "name": "meta.structure.dictionary.json",
+      "patterns": [
+        {
+          "comment": "the JSON object key",
+          "include": "#objectkey"
+        },
+        {
+          "include": "#comments"
+        },
+        {
+          "begin": ":",
+          "beginCaptures": {
+            "0": {
+              "name": "punctuation.separator.dictionary.key-value.json"
+            }
+          },
+          "end": "(,)|(?=\\})",
+          "endCaptures": {
+            "1": {
+              "name": "punctuation.separator.dictionary.pair.json"
+            }
+          },
+          "name": "meta.structure.dictionary.value.json",
+          "patterns": [
+            {
+              "comment": "the JSON object value",
+              "include": "#value"
+            },
+            {
+              "match": "[^\\s,]",
+              "name": "invalid.illegal.expected-dictionary-separator.json"
+            }
+          ]
+        },
+        {
+          "match": "[^\\s\\}]",
+          "name": "invalid.illegal.expected-dictionary-separator.json"
+        }
+      ]
+    },
+    "string": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.definition.string.end.json"
+        }
+      },
+      "name": "string.quoted.double.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "objectkey": {
+      "begin": "\"",
+      "beginCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.begin.json"
+        }
+      },
+      "end": "\"",
+      "endCaptures": {
+        "0": {
+          "name": "punctuation.support.type.property-name.end.json"
+        }
+      },
+      "name": "support.type.property-name.json",
+      "patterns": [
+        {
+          "include": "#stringcontent"
+        }
+      ]
+    },
+    "stringcontent": {
+      "patterns": [
+        {
+          "match": "\\\\(?:[\"\\\\/bfnrt]|u[0-9a-fA-F]{4})",
+          "name": "constant.character.escape.json"
+        },
+        {
+          "match": "\\\\.",
+          "name": "invalid.illegal.unrecognized-string-escape.json"
+        }
+      ]
+    },
+    "value": {
+      "patterns": [
+        {
+          "include": "#constant"
+        },
+        {
+          "include": "#number"
+        },
+        {
+          "include": "#string"
+        },
+        {
+          "include": "#array"
+        },
+        {
+          "include": "#object"
+        },
+        {
+          "include": "#comments"
+        }
+      ]
+    }
+  },
+  "scopeName": "source.json",
+  "uuid": "8f97457b-516e-48ce-83c7-08ae12fb327a"
+}
--- a/assets/highlighting/python.json
+++ b/assets/highlighting/python.json
@ -0,0 +1,98 @@
+{
+  "name": "Python",
+  "version": "1.0.0",
+  "fileTypes": ["py"],
+  "scopeName": "source.python",
+  "foldingStartMarker": "\\b(?:def|class)\\s*[^:]*:\\s*$",
+  "foldingStopMarker": "^\\s*\\}",
+  "patterns": [
+    { "include": "#comments" },
+    { "include": "#keywords" },
+    { "include": "#constants-and-special-vars" },
+    { "include": "#operators" },
+    { "include": "#strings" }
+  ],
+  "repository": {
+    "comments": {
+      "patterns": [
+        { "name": "comment.line.hash.python", "match": "#.*$" },
+        { "name": "comment.block.python", "begin": "'''", "end": "'''" },
+        { "name": "comment.block.python", "begin": "\"\"\"", "end": "\"\"\"" }
+      ]
+    },
+    "keywords": {
+      "patterns": [
+        {
+          "name": "keyword.control.python",
+          "match": "\\b(?:if|else|while|for|in|break|continue|return)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        },
+        { "name": "keyword.operator.assignment.python", "match": "=" },
+        { "name": "storage.modifier.python", "match": "\\b(?:def|class)\\b" }
+      ]
+    },
+    "constants-and-special-vars": {
+      "patterns": [
+        {
+          "name": "constant.language.python",
+          "match": "\\b(?:True|False|None)\\b"
+        },
+        { "name": "variable.language.python", "match": "\\b(?:self)\\b" },
+        {
+          "name": "constant.numeric.python",
+          "match": "\\b(?:\\d+\\.?\\d*|\\.\\d+)\\b"
+        }
+      ]
+    },
+    "operators": {
+      "patterns": [
+        {
+          "name": "keyword.operator.arithmetic.python",
+          "match": "\\b(?:\\+|-|\\*|/|%|//)\\b"
+        },
+        {
+          "name": "keyword.operator.comparison.python",
+          "match": "\\b(?:==|!=|<|<=|>|>=)\\b"
+        },
+        {
+          "name": "keyword.operator.logical.python",
+          "match": "\\b(?:and|or|not)\\b"
+        }
+      ]
+    },
+    "strings": {
+      "patterns": [
+        {
+          "name": "string.quoted.triple.double.python",
+          "begin": "\"\"\"",
+          "end": "\"\"\""
+        },
+        {
+          "name": "string.quoted.triple.single.python",
+          "begin": "'''",
+          "end": "'''"
+        },
+        {
+          "name": "string.quoted.double.python",
+          "begin": "\"",
+          "end": "\"",
+          "patterns": [{ "include": "#string-escape" }]
+        },
+        {
+          "name": "string.quoted.single.python",
+          "begin": "'",
+          "end": "'",
+          "patterns": [{ "include": "#string-escape" }]
+        }
+      ]
+    },
+    "string-escape": {
+      "patterns": [
+        { "name": "constant.character.escape.python", "match": "\\\\[\"']" }
+      ]
+    }
+  }
+}
--- a/assets/highlighting/sql.json
+++ b/assets/highlighting/sql.json
@ -0,0 +1,145 @@
+{
+  "fileTypes": ["sql", "ddl", "dml"],
+  "foldingStartMarker": "(?i)^\\s*(begin|if|loop)\\b",
+  "foldingStopMarker": "(?i)^\\s*(end)\\b",
+  "keyEquivalent": "^~S",
+  "name": "PL/pgSQL (Postgres)",
+  "patterns": [
+    {
+      "begin": "/\\*",
+      "end": "\\*/",
+      "name": "comment.block.postgres"
+    },
+    {
+      "match": "--.*$",
+      "name": "comment.line.double-dash.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        }
+      },
+      "match": "(?i)^\\s*(create)(\\s+or\\s+replace)?\\s+",
+      "name": "meta.create.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "keyword.other.postgres"
+        },
+        "3": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(package)(\\s+body)?\\s+(\\S+)",
+      "name": "meta.package.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.type.postgres"
+        }
+      },
+      "match": "(?i)\\b(type)\\s+\"([^\"]+)\"",
+      "name": "meta.type.postgres"
+    },
+    {
+      "captures": {
+        "1": {
+          "name": "keyword.other.postgres"
+        },
+        "2": {
+          "name": "entity.name.function.postgres"
+        }
+      },
+      "match": "(?i)\\s*(function|procedure)\\s+([-a-z0-9_.]+)",
+      "name": "meta.procedure.postgres"
+    },
+    {
+      "match": "[!<>:]?=|<>|<|>|\\+|(?<!\\.)\\*|-|(?<!^)/|@@|\\|\\|",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(true|false|null|found)\\b",
+      "name": "constant.language.postgres"
+    },
+    {
+      "match": "\\b\\d+(\\.\\d+)?\\b",
+      "name": "constant.numeric.postgres"
+    },
+    {
+      "match": "(?i)\\b(if|elsif|else|end\\s+if|loop|end\\s+loop|for|foreach|array|case|end\\s+case|continue|return|goto|alias)\\b",
+      "name": "keyword.control.postgres"
+    },
+    {
+      "match": "(?i)\\b(or|and|not|like)\\b",
+      "name": "keyword.operator.postgres"
+    },
+    {
+      "match": "(?i)\\b(sysdate|%(isopen|found|notfound|rowcount)|commit|rollback|sqlerrm|substr|cast|decode|length|lower|upper|coalesce)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "match": "(?i)\\b(avg|count|sum|max|min|nvl|trim|to_date|to_char|lpad|ltrim|rpad|rtrim|trunc|to_number|regexp_split_to_array|regexp_replace)\\b",
+      "name": "support.function.builtin.postgres"
+    },
+    {
+      "match": "(?i)\\b(sql|sqlcode)\\b",
+      "name": "variable.language.postgres"
+    },
+    {
+      "match": "(?i)\\b(p(i|o|io)_[-a-z0-9_]+)\\b",
+      "name": "variable.parameter.postgres"
+    },
+    {
+      "match": "(?i)\\b(l_[-a-z0-9_]+)\\b",
+      "name": "variable.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(immutable|volatile|stable|serial|primary|key|references|comment|column|schema|authorization|get|diagnostics|returning|drop|all|raise|notice|warning|exception|external|security|definer|language|grant|execute|on|to|function|procedure|returns|end|then|deterministic|exception|when|others|subtype|constant|range|binary_integer|declare|begin|in|out|is|as|exit|open|fetch|into|close|type|rowtype|default|\\.(extend|count|first|last|next|nextval|currval)|cost|alter|owner)\\b",
+      "name": "keyword.other.postgres"
+    },
+    {
+      "match": "(?i)\\b(select|perform|from|where|order\\s+by|group\\s+by|asc|desc|update|set|insert|into|values|delete|from|distinct|union|having|limit|table|of|prepare|(inner|left|outer) join)\\b",
+      "name": "keyword.other.sql.postgres"
+    },
+    {
+      "match": "[$][0-9]+",
+      "name": "storage.type.postgres"
+    },
+    {
+      "match": "(?i)\\b(dbms_lock|dbms_output)\\b",
+      "name": "support.class.postgres"
+    },
+    {
+      "match": "(?i)\\b(put_line)\\b",
+      "name": "support.function.postgres"
+    },
+    {
+      "begin": "'",
+      "end": "'",
+      "name": "string.quoted.single.postgres"
+    },
+    {
+      "begin": "\"",
+      "end": "\"",
+      "name": "string.quoted.double.postgres"
+    },
+    {
+      "match": "(?i)\\b(number|integer|bigint|varchar2|varchar|boolean|date|setof|record|query|numeric|void|character varying|text|([-a-z0-9_.]+%(row)?type))\\b",
+      "name": "storage.type.postgres"
+    }
+  ],
+  "scopeName": "source.plpgsql.postgres",
+  "uuid": "28DCE4DD-F5E1-4ED3-8847-64DA6B1F9163"
+}
--- a/assets/highlighting/yaml.json
+++ b/assets/highlighting/yaml.json
@ -0,0 +1,66 @@
+{
+  "name": "YAML",
+  "fileTypes": ["yaml", "yml"],
+  "scopeName": "source.yaml",
+  "patterns": [
+    {
+      "name": "comment.line.number-sign.yaml",
+      "match": "#.*",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.comment.yaml"
+        }
+      }
+    },
+    {
+      "name": "entity.name.tag.yaml",
+      "match": "^\\s*\\w+",
+      "captures": {
+        "0": {
+          "name": "punctuation.definition.tag.yaml"
+        }
+      }
+    },
+    {
+      "name": "punctuation.separator.key-value.yaml",
+      "match": ":",
+      "captures": {
+        "0": {
+          "name": "punctuation.separator.key-value.yaml"
+        }
+      }
+    },
+    {
+      "name": "string.quoted.double.yaml",
+      "begin": "\"",
+      "end": "\"",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "\\\\(x[0-9A-Fa-f]{2}|u[0-9A-Fa-f]{4}|U[0-9A-Fa-f]{6}|.)"
+        }
+      ]
+    },
+    {
+      "name": "string.quoted.single.yaml",
+      "begin": "'",
+      "end": "'",
+      "patterns": [
+        {
+          "name": "constant.character.escape.yaml",
+          "match": "''"
+        }
+      ]
+    }
+  ],
+  "repository": {
+    "scalar-plain": {
+      "patterns": [
+        {
+          "match": "\\b(\\w+)\\b",
+          "name": "scalar.plain.yaml"
+        }
+      ]
+    }
+  }
+}
--- a/assets/locales/en_us.json
+++ b/assets/locales/en_us.json
@ -54,6 +54,7 @@
  "about": "About",
  "edit": "Edit",
  "delete": "Delete",
+  "insert": "Insert",
  "settings": "Settings",
  "settingsNotificationBgService": "Background notification service",
  "settingsNotificationBgServiceDesc": "A notification service is always installed on the device, so that some devices that do not support push notifications can receive notifications in the background. When this feature is enabled, push notifications will not be registered with the server, and you will always appear to be online in the eyes of others (except for invisible). You may need to turn off power and traffic optimization in the settings.",
@ -140,7 +141,7 @@
  "clear": "Clear",
  "pinPost": "Pin this post",
  "unpinPost": "Unpin this post",
-  "postRestoreFromLocal": "Restore from local",
+  "postRestoreFromLocal": "Restored",
  "postAutoSaveAt": "Auto saved at @date",
  "postCategoriesAndTags": "Categories n' Tags",
  "postPublishDate": "Publish Date",
@ -366,8 +367,9 @@
  "bsPreparingData": "Preparing User Data",
  "bsRegisteringPushNotify": "Enabling Push Notifications",
  "bsDismissibleErrorHint": "Click anywhere to ignore this error",
+  "bsContinuable": "Click anywhere to continue",
  "postShareContent": "@content\n\n@username on the Solar Network\nCheck it out: @link",
-  "postShareSubject": "@username posted a post on the Solar Network",
+  "postShareSubject": "@title by @username on Solar Network",
  "themeColor": "Global Theme Color",
  "themeColorRed": "Modern Red",
  "themeColorBlue": "Classic Blue",
@ -477,5 +479,20 @@
  "agedTheme": "Old school style theme",
  "agedThemeDesc": "Downgrade the global theme to Material Design 2. Unexpected issues may occur. For experimental use only.",
  "appBackgroundImage": "Global background image",
-  "appBackgroundImageDesc": "The global background image will be displayed on all pages"
+  "appBackgroundImageDesc": "The global background image will be displayed on all pages",
+  "authPreferences": "Auth preferences",
+  "authPreferencesDesc": "Set the security behavior of your account",
+  "authMaximumAuthSteps": "Maximum authentication steps",
+  "authMaximumAuthStepsDesc": "The maximum number of authentication steps when logging in, higher value is more secure, lower value is more convenient; default is 2",
+  "auditLog": "Audit log",
+  "shareImage": "Share as image",
+  "shareImageFooter": "Only on the Solar Network",
+  "fileSavedAt": "File saved at @path",
+  "showIp": "Show IP Address",
+  "shotOn": "Shot on @device",
+  "unread": "Unread",
+  "searchTook": "Took @time",
+  "searchResult": "@count Matches",
+  "happyBirthday": "Happy birthday @name!",
+  "happyBirthdayDesc": "Today is your @count birthday"
 }
--- a/assets/locales/zh_cn.json
+++ b/assets/locales/zh_cn.json
@ -14,6 +14,7 @@
  "about": "关于",
  "edit": "编辑",
  "delete": "删除",
+  "insert": "插入",
  "settings": "设置",
  "settingsNotificationBgService": "常驻通知服务",
  "settingsNotificationBgServiceDesc": "在设备常驻一个通知服务，使得部分不支持推送通知的设备可以在后台收到通知；启用该功能的情况下不会向服务器注册推送通知，并且你会始终在他人眼中成为在线（隐身除外）；可能需要在设置中关闭电量与流量优化。",
@ -362,8 +363,9 @@
  "bsPreparingData": "正在准备用户资料",
  "bsRegisteringPushNotify": "正在启用推送通知",
  "bsDismissibleErrorHint": "点击任意地方忽略此错误",
+  "bsContinuable": "点击任意处继续",
  "postShareContent": "@content\n\n@username 在 Solar Network\n原帖地址：@link",
-  "postShareSubject": "@username 在 Solar Network 上发布了一篇帖子",
+  "postShareSubject": "@username 在 Solar Network 发表的 @title",
  "themeColor": "全局主题色",
  "themeColorRed": "现代红",
  "themeColorBlue": "经典蓝",
@ -473,5 +475,20 @@
  "agedTheme": "过时主题",
  "agedThemeDesc": "将全局主题降级为 Material Design 2，可能发生意料之外的问题，仅供实验使用",
  "appBackgroundImage": "全局背景图片",
-  "appBackgroundImageDesc": "全局背景图片将会在所有页面中展示"
+  "appBackgroundImageDesc": "全局背景图片将会在所有页面中展示",
+  "authPreferences": "安全偏好设置",
+  "authPreferencesDesc": "调整账号的安全行为模式",
+  "authMaximumAuthSteps": "最大认证步数",
+  "authMaximumAuthStepsDesc": "登陆时最多的验证步数，值越高则越安全，反之则会相对方便；默认设置为 2",
+  "auditLog": "活动日志",
+  "shareImage": "分享图片",
+  "shareImageFooter": "上 Solar Network 看更多有趣帖子",
+  "fileSavedAt": "文件保存于 @path",
+  "showIp": "显示 IP 地址",
+  "shotOn": "由 @device 拍摄",
+  "unread": "未读",
+  "searchTook": "耗时 @time",
+  "searchResult": "匹配到 @count 条结果",
+  "happyBirthday": "生日快乐，@name!",
+  "happyBirthdayDesc": "今天是你的第 @count 个生日"
 }
--- a/ios/Podfile.lock
+++ b/ios/Podfile.lock
@ -38,45 +38,47 @@ PODS:
  - file_picker (0.0.1):
    - DKImagePickerController/PhotoGallery
    - Flutter
-  - Firebase/Analytics (11.0.0):
+  - file_saver (0.0.1):
+    - Flutter
+  - Firebase/Analytics (11.2.0):
    - Firebase/Core
-  - Firebase/Core (11.0.0):
+  - Firebase/Core (11.2.0):
    - Firebase/CoreOnly
-    - FirebaseAnalytics (~> 11.0.0)
-  - Firebase/CoreOnly (11.0.0):
-    - FirebaseCore (= 11.0.0)
-  - Firebase/Crashlytics (11.0.0):
+    - FirebaseAnalytics (~> 11.2.0)
+  - Firebase/CoreOnly (11.2.0):
+    - FirebaseCore (= 11.2.0)
+  - Firebase/Crashlytics (11.2.0):
    - Firebase/CoreOnly
-    - FirebaseCrashlytics (~> 11.0.0)
-  - Firebase/Messaging (11.0.0):
+    - FirebaseCrashlytics (~> 11.2.0)
+  - Firebase/Messaging (11.2.0):
    - Firebase/CoreOnly
-    - FirebaseMessaging (~> 11.0.0)
-  - Firebase/Performance (11.0.0):
+    - FirebaseMessaging (~> 11.2.0)
+  - Firebase/Performance (11.2.0):
    - Firebase/CoreOnly
-    - FirebasePerformance (~> 11.0.0)
-  - firebase_analytics (11.3.2):
-    - Firebase/Analytics (= 11.0.0)
+    - FirebasePerformance (~> 11.2.0)
+  - firebase_analytics (11.3.3):
+    - Firebase/Analytics (= 11.2.0)
    - firebase_core
    - Flutter
-  - firebase_core (3.5.0):
-    - Firebase/CoreOnly (= 11.0.0)
+  - firebase_core (3.6.0):
+    - Firebase/CoreOnly (= 11.2.0)
    - Flutter
-  - firebase_crashlytics (4.1.2):
-    - Firebase/Crashlytics (= 11.0.0)
+  - firebase_crashlytics (4.1.3):
+    - Firebase/Crashlytics (= 11.2.0)
    - firebase_core
    - Flutter
-  - firebase_messaging (15.1.2):
-    - Firebase/Messaging (= 11.0.0)
+  - firebase_messaging (15.1.3):
+    - Firebase/Messaging (= 11.2.0)
    - firebase_core
    - Flutter
-  - firebase_performance (0.10.0-7):
-    - Firebase/Performance (= 11.0.0)
+  - firebase_performance (0.10.0-8):
+    - Firebase/Performance (= 11.2.0)
    - firebase_core
    - Flutter
-  - FirebaseABTesting (11.2.0):
+  - FirebaseABTesting (11.3.0):
    - FirebaseCore (~> 11.0)
-  - FirebaseAnalytics (11.0.0):
-    - FirebaseAnalytics/AdIdSupport (= 11.0.0)
+  - FirebaseAnalytics (11.2.0):
+    - FirebaseAnalytics/AdIdSupport (= 11.2.0)
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
    - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
@ -84,24 +86,24 @@ PODS:
    - GoogleUtilities/Network (~> 8.0)
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
    - nanopb (~> 3.30910.0)
-  - FirebaseAnalytics/AdIdSupport (11.0.0):
+  - FirebaseAnalytics/AdIdSupport (11.2.0):
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
-    - GoogleAppMeasurement (= 11.0.0)
+    - GoogleAppMeasurement (= 11.2.0)
    - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
    - GoogleUtilities/MethodSwizzler (~> 8.0)
    - GoogleUtilities/Network (~> 8.0)
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
    - nanopb (~> 3.30910.0)
-  - FirebaseCore (11.0.0):
+  - FirebaseCore (11.2.0):
    - FirebaseCoreInternal (~> 11.0)
    - GoogleUtilities/Environment (~> 8.0)
    - GoogleUtilities/Logger (~> 8.0)
-  - FirebaseCoreExtension (11.2.0):
+  - FirebaseCoreExtension (11.3.0):
    - FirebaseCore (~> 11.0)
-  - FirebaseCoreInternal (11.2.0):
+  - FirebaseCoreInternal (11.3.0):
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseCrashlytics (11.0.0):
+  - FirebaseCrashlytics (11.2.0):
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
    - FirebaseRemoteConfigInterop (~> 11.0)
@ -110,12 +112,12 @@ PODS:
    - GoogleUtilities/Environment (~> 8.0)
    - nanopb (~> 3.30910.0)
    - PromisesObjC (~> 2.4)
-  - FirebaseInstallations (11.2.0):
+  - FirebaseInstallations (11.3.0):
    - FirebaseCore (~> 11.0)
    - GoogleUtilities/Environment (~> 8.0)
    - GoogleUtilities/UserDefaults (~> 8.0)
    - PromisesObjC (~> 2.4)
-  - FirebaseMessaging (11.0.0):
+  - FirebaseMessaging (11.2.0):
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
    - GoogleDataTransport (~> 10.0)
@ -124,7 +126,7 @@ PODS:
    - GoogleUtilities/Reachability (~> 8.0)
    - GoogleUtilities/UserDefaults (~> 8.0)
    - nanopb (~> 3.30910.0)
-  - FirebasePerformance (11.0.0):
+  - FirebasePerformance (11.2.0):
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
    - FirebaseRemoteConfig (~> 11.0)
@ -134,7 +136,7 @@ PODS:
    - GoogleUtilities/MethodSwizzler (~> 8.0)
    - GoogleUtilities/UserDefaults (~> 8.0)
    - nanopb (~> 3.30910.0)
-  - FirebaseRemoteConfig (11.2.0):
+  - FirebaseRemoteConfig (11.3.0):
    - FirebaseABTesting (~> 11.0)
    - FirebaseCore (~> 11.0)
    - FirebaseInstallations (~> 11.0)
@ -142,8 +144,8 @@ PODS:
    - FirebaseSharedSwift (~> 11.0)
    - GoogleUtilities/Environment (~> 8.0)
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
-  - FirebaseRemoteConfigInterop (11.2.0)
-  - FirebaseSessions (11.2.0):
+  - FirebaseRemoteConfigInterop (11.3.0)
+  - FirebaseSessions (11.3.0):
    - FirebaseCore (~> 11.0)
    - FirebaseCoreExtension (~> 11.0)
    - FirebaseInstallations (~> 11.0)
@ -152,7 +154,7 @@ PODS:
    - GoogleUtilities/UserDefaults (~> 8.0)
    - nanopb (~> 3.30910.0)
    - PromisesSwift (~> 2.1)
-  - FirebaseSharedSwift (11.2.0)
+  - FirebaseSharedSwift (11.3.0)
  - Flutter (1.0.0)
  - flutter_app_update (0.0.1):
    - Flutter
@ -166,27 +168,30 @@ PODS:
    - Flutter
  - flutter_secure_storage (6.0.0):
    - Flutter
+  - flutter_udid (0.0.1):
+    - Flutter
+    - SAMKeychain
  - flutter_webrtc (0.11.3):
    - Flutter
    - WebRTC-SDK (= 125.6422.04)
  - gal (1.0.0):
    - Flutter
    - FlutterMacOS
-  - GoogleAppMeasurement (11.0.0):
-    - GoogleAppMeasurement/AdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement (11.2.0):
+    - GoogleAppMeasurement/AdIdSupport (= 11.2.0)
    - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
    - GoogleUtilities/MethodSwizzler (~> 8.0)
    - GoogleUtilities/Network (~> 8.0)
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
    - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/AdIdSupport (11.0.0):
-    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.0.0)
+  - GoogleAppMeasurement/AdIdSupport (11.2.0):
+    - GoogleAppMeasurement/WithoutAdIdSupport (= 11.2.0)
    - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
    - GoogleUtilities/MethodSwizzler (~> 8.0)
    - GoogleUtilities/Network (~> 8.0)
    - "GoogleUtilities/NSData+zlib (~> 8.0)"
    - nanopb (~> 3.30910.0)
-  - GoogleAppMeasurement/WithoutAdIdSupport (11.0.0):
+  - GoogleAppMeasurement/WithoutAdIdSupport (11.2.0):
    - GoogleUtilities/AppDelegateSwizzler (~> 8.0)
    - GoogleUtilities/MethodSwizzler (~> 8.0)
    - GoogleUtilities/Network (~> 8.0)
@ -259,6 +264,7 @@ PODS:
    - PromisesObjC (= 2.4.0)
  - protocol_handler_ios (0.0.1):
    - Flutter
+  - SAMKeychain (1.5.3)
  - screen_brightness_ios (0.1.0):
    - Flutter
  - SDWebImage (5.19.7):
@ -269,7 +275,7 @@ PODS:
  - shared_preferences_foundation (0.0.1):
    - Flutter
    - FlutterMacOS
-  - sqflite (0.0.3):
+  - sqflite_darwin (0.0.4):
    - Flutter
    - FlutterMacOS
  - "sqlite3 (3.46.1+1)":
@ -304,6 +310,7 @@ DEPENDENCIES:
  - connectivity_plus (from `.symlinks/plugins/connectivity_plus/darwin`)
  - device_info_plus (from `.symlinks/plugins/device_info_plus/ios`)
  - file_picker (from `.symlinks/plugins/file_picker/ios`)
+  - file_saver (from `.symlinks/plugins/file_saver/ios`)
  - firebase_analytics (from `.symlinks/plugins/firebase_analytics/ios`)
  - firebase_core (from `.symlinks/plugins/firebase_core/ios`)
  - firebase_crashlytics (from `.symlinks/plugins/firebase_crashlytics/ios`)
@ -316,6 +323,7 @@ DEPENDENCIES:
  - flutter_local_notifications (from `.symlinks/plugins/flutter_local_notifications/ios`)
  - flutter_native_splash (from `.symlinks/plugins/flutter_native_splash/ios`)
  - flutter_secure_storage (from `.symlinks/plugins/flutter_secure_storage/ios`)
+  - flutter_udid (from `.symlinks/plugins/flutter_udid/ios`)
  - flutter_webrtc (from `.symlinks/plugins/flutter_webrtc/ios`)
  - gal (from `.symlinks/plugins/gal/darwin`)
  - image_cropper (from `.symlinks/plugins/image_cropper/ios`)
@ -334,7 +342,7 @@ DEPENDENCIES:
  - screen_brightness_ios (from `.symlinks/plugins/screen_brightness_ios/ios`)
  - share_plus (from `.symlinks/plugins/share_plus/ios`)
  - shared_preferences_foundation (from `.symlinks/plugins/shared_preferences_foundation/darwin`)
-  - sqflite (from `.symlinks/plugins/sqflite/darwin`)
+  - sqflite_darwin (from `.symlinks/plugins/sqflite_darwin/darwin`)
  - sqlite3_flutter_libs (from `.symlinks/plugins/sqlite3_flutter_libs/ios`)
  - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
  - volume_controller (from `.symlinks/plugins/volume_controller/ios`)
@ -364,6 +372,7 @@ SPEC REPOS:
    - nanopb
    - PromisesObjC
    - PromisesSwift
+    - SAMKeychain
    - SDWebImage
    - sqlite3
    - SwiftyGif
@ -377,6 +386,8 @@ EXTERNAL SOURCES:
    :path: ".symlinks/plugins/device_info_plus/ios"
  file_picker:
    :path: ".symlinks/plugins/file_picker/ios"
+  file_saver:
+    :path: ".symlinks/plugins/file_saver/ios"
  firebase_analytics:
    :path: ".symlinks/plugins/firebase_analytics/ios"
  firebase_core:
@ -401,6 +412,8 @@ EXTERNAL SOURCES:
    :path: ".symlinks/plugins/flutter_native_splash/ios"
  flutter_secure_storage:
    :path: ".symlinks/plugins/flutter_secure_storage/ios"
+  flutter_udid:
+    :path: ".symlinks/plugins/flutter_udid/ios"
  flutter_webrtc:
    :path: ".symlinks/plugins/flutter_webrtc/ios"
  gal:
@ -437,8 +450,8 @@ EXTERNAL SOURCES:
    :path: ".symlinks/plugins/share_plus/ios"
  shared_preferences_foundation:
    :path: ".symlinks/plugins/shared_preferences_foundation/darwin"
-  sqflite:
-    :path: ".symlinks/plugins/sqflite/darwin"
+  sqflite_darwin:
+    :path: ".symlinks/plugins/sqflite_darwin/darwin"
  sqlite3_flutter_libs:
    :path: ".symlinks/plugins/sqlite3_flutter_libs/ios"
  url_launcher_ios:
@ -449,30 +462,31 @@ EXTERNAL SOURCES:
    :path: ".symlinks/plugins/wakelock_plus/ios"

 SPEC CHECKSUMS:
-  connectivity_plus: ddd7f30999e1faaef5967c23d5b6d503d10434db
-  device_info_plus: 97af1d7e84681a90d0693e63169a5d50e0839a0d
+  connectivity_plus: 4c41c08fc6d7c91f63bc7aec70ffe3730b04f563
+  device_info_plus: bf2e3232933866d73fe290f2942f2156cdd10342
  DKImagePickerController: 946cec48c7873164274ecc4624d19e3da4c1ef3c
  DKPhotoGallery: b3834fecb755ee09a593d7c9e389d8b5d6deed60
  file_picker: 09aa5ec1ab24135ccd7a1621c46c84134bfd6655
-  Firebase: 9f574c08c2396885b5e7e100ed4293d956218af9
-  firebase_analytics: 4fd10182fd08bb8358f26ac8aca8dad7b6d0f592
-  firebase_core: 2ec6b789859c7c24766344ec71fdf78639402d56
-  firebase_crashlytics: 60630a0f91ee432275fa1660fd8593079761448a
-  firebase_messaging: a18e1e02b2e8e69097c8173e0c851be223b21c50
-  firebase_performance: 12d45fdf120992fa879d990929bf73d4a5ced053
-  FirebaseABTesting: 2104d957ce33888a3d6f3bde298cdee376dde8f1
-  FirebaseAnalytics: 27eb78b97880ea4a004839b9bac0b58880f5a92a
-  FirebaseCore: 3cf438f431f18c12cdf2aaf64434648b63f7e383
-  FirebaseCoreExtension: cda74ddfb001224bd8fd1d6e74698b4ed07803de
-  FirebaseCoreInternal: 0c569513412da9f3b31bd0b340013bbee8f295c5
-  FirebaseCrashlytics: 745d8f0221fe49c62865391d1bf56f5a12eeec0b
-  FirebaseInstallations: 771177d89d6c451dc6e50085ec82e2fc77ed0a4a
-  FirebaseMessaging: d2d1d9c62c46dd2db49a952f7deb5b16ad2c9742
-  FirebasePerformance: efdc02bacb1b4710588c9f867011605c081cdf79
-  FirebaseRemoteConfig: fca0b2d017fc1de52b28a4e5bcf2007c1a840457
-  FirebaseRemoteConfigInterop: 477b26fdeb8fb5fbaf22fa9db5343b42289dc7db
-  FirebaseSessions: adcec8b72d0066a385e3affcd1bcb1ebb3908ce6
-  FirebaseSharedSwift: 7a0d78d155ede78407f0fdc89fbc914014c7c540
+  file_saver: 503e386464dbe118f630e17b4c2e1190fa0cf808
+  Firebase: 98e6bf5278170668a7983e12971a66b2cd57fc8c
+  firebase_analytics: fbc57838bdb94eef1e0ff504f127d974ff2981ad
+  firebase_core: 2bedc3136ec7c7b8561c6123ed0239387b53f2af
+  firebase_crashlytics: 37d104d457b51760b48504a93a12b3bf70995d77
+  firebase_messaging: 15d114e1a41fc31e4fbabcd48d765a19eec94a38
+  firebase_performance: 26ad47755d3e8d7b04b9bb36bdfbf1cec8d8dfcc
+  FirebaseABTesting: c4559fcd2eba9f6bdaf0599e2c37ded01c343e4c
+  FirebaseAnalytics: c36efd5710c60c17558650fa58c2066eca7e9265
+  FirebaseCore: a282032ae9295c795714ded2ec9c522fc237f8da
+  FirebaseCoreExtension: 30bb063476ef66cd46925243d64ad8b2c8ac3264
+  FirebaseCoreInternal: ac26d09a70c730e497936430af4e60fb0c68ec4e
+  FirebaseCrashlytics: cfc69af5b53565dc6a5e563788809b5778ac4eac
+  FirebaseInstallations: 58cf94dabf1e2bb2fa87725a9be5c2249171cda0
+  FirebaseMessaging: c9ec7b90c399c7a6100297e9d16f8a27fc7f7152
+  FirebasePerformance: c39138c0700b8ef6040f0b80b5707320808e2862
+  FirebaseRemoteConfig: 5be2ca4f9870d475b39214210955fdaeecf7e5ca
+  FirebaseRemoteConfigInterop: c3a5c31b3c22079f41ba1dc645df889d9ce38cb9
+  FirebaseSessions: 655ff17f3cc1a635cbdc2d69b953878001f9e25b
+  FirebaseSharedSwift: d39c2ad64a11a8d936ce25a42b00df47078bb59c
  Flutter: e0871f40cf51350855a761d2e70bf5af5b9b5de7
  flutter_app_update: 65f61da626cb111d1b24674abc4b01728d7723bc
  flutter_background_service_ios: e30e0d3ee69e4cee66272d0c78eacd48c2e94aac
@ -480,9 +494,10 @@ SPEC CHECKSUMS:
  flutter_local_notifications: 4cde75091f6327eb8517fa068a0a5950212d2086
  flutter_native_splash: edf599c81f74d093a4daf8e17bd7a018854bc778
  flutter_secure_storage: d33dac7ae2ea08509be337e775f6b59f1ff45f12
+  flutter_udid: a2482c67a61b9c806ef59dd82ed8d007f1b7ac04
  flutter_webrtc: 75b868e4f9e817c7a9a42ca4b6169063de4eec9f
  gal: 61e868295d28fe67ffa297fae6dacebf56fd53e1
-  GoogleAppMeasurement: 6e49ffac7d3f2c3ded9cc663f912a13b67bbd0de
+  GoogleAppMeasurement: 76d4f8b36b03bd8381fa9a7fe2cc7f99c0a2e93a
  GoogleDataTransport: aae35b7ea0c09004c3797d53c8c41f66f219d6a7
  GoogleUtilities: 26a3abef001b6533cf678d3eb38fd3f614b7872d
  image_cropper: 37d40f62177c101ff4c164906d259ea2c3aa70cf
@ -493,7 +508,7 @@ SPEC CHECKSUMS:
  media_kit_native_event_loop: e6b2ab20cf0746eb1c33be961fcf79667304fa2a
  media_kit_video: 5da63f157170e5bf303bf85453b7ef6971218a2e
  nanopb: fad817b59e0457d11a5dfbde799381cd727c1275
-  package_info_plus: 58f0028419748fad15bf008b270aaa8e54380b1c
+  package_info_plus: c0502532a26c7662a62a356cebe2692ec5fe4ec4
  pasteboard: 982969ebaa7c78af3e6cc7761e8f5e77565d9ce0
  path_provider_foundation: 2b6b4c569c0fb62ec74538f866245ac84301af46
  permission_handler_apple: 9878588469a2b0d0fc1e048d9f43605f92e6cec2
@ -501,11 +516,12 @@ SPEC CHECKSUMS:
  PromisesObjC: f5707f49cb48b9636751c5b2e7d227e43fba9f47
  PromisesSwift: 9d77319bbe72ebf6d872900551f7eeba9bce2851
  protocol_handler_ios: a5db8abc38526ee326988b808be621e5fd568990
+  SAMKeychain: 483e1c9f32984d50ca961e26818a534283b4cd5c
  screen_brightness_ios: 715ca807df953bf676d339f11464e438143ee625
  SDWebImage: 8a6b7b160b4d710e2a22b6900e25301075c34cb3
-  share_plus: 8875f4f2500512ea181eef553c3e27dba5135aad
+  share_plus: 8b6f8b3447e494cca5317c8c3073de39b3600d1f
  shared_preferences_foundation: fcdcbc04712aee1108ac7fda236f363274528f78
-  sqflite: 673a0e54cc04b7d6dba8d24fb8095b31c3a99eec
+  sqflite_darwin: a553b1fd6fe66f53bbb0fe5b4f5bab93f08d7a13
  sqlite3: 0bb0e6389d824e40296f531b858a2a0b71c0d2fb
  sqlite3_flutter_libs: c00457ebd31e59fa6bb830380ddba24d44fbcd3b
  SwiftyGif: 706c60cf65fa2bc5ee0313beece843c8eb8194d4
--- a/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
+++ b/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme
@ -59,6 +59,7 @@
      ignoresPersistentStateOnLaunch = "NO"
      debugDocumentVersioning = "YES"
      debugServiceExtension = "internal"
+      showGraphicsOverview = "Yes"
      allowLocationSimulation = "YES">
      <BuildableProductRunnable
         runnableDebuggingMode = "0">
--- a/ios/Runner/Info.plist
+++ b/ios/Runner/Info.plist
@ -83,7 +83,6 @@
 	</array>
 	<key>CFBundleLocalizations</key>
 	<array>
-		<string>zh_CN</string>
 		<string>en</string>
 	</array>
 	<key>UIStatusBarHidden</key>
--- a/lib/bootstrapper.dart
+++ b/lib/bootstrapper.dart
@ -1,6 +1,7 @@
 import 'dart:async';
 import 'dart:developer';

+import 'package:confetti/confetti.dart';
 import 'package:flutter/material.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
@ -10,9 +11,11 @@ import 'package:provider/provider.dart';
 import 'package:shared_preferences/shared_preferences.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
+import 'package:solian/models/account.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/providers/websocket.dart';
@ -22,6 +25,11 @@ import 'package:solian/widgets/sized_container.dart';
 import 'package:flutter_app_update/flutter_app_update.dart';
 import 'package:version/version.dart';

+enum BootstrapperSpecialState {
+  userBirthday,
+  appAnniversary,
+}
+
 class BootstrapperShell extends StatefulWidget {
  final Widget child;

@ -42,6 +50,9 @@ class _BootstrapperShellState extends State<BootstrapperShell> {

  int _periodCursor = 0;

+  // Special state is some special event triggered after bootstrapping
+  BootstrapperSpecialState? _specialState;
+
  final Completer _bootCompleter = Completer();

  void _requestRating() async {
@ -198,11 +209,26 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
        final AuthProvider auth = Get.find();
        try {
          await Future.wait([
+            if (auth.isAuthorized.isTrue)
+              Get.find<NotificationProvider>().fetchNotification(),
            if (auth.isAuthorized.isTrue)
              Get.find<RelationshipProvider>().refreshRelativeList(),
            if (auth.isAuthorized.isTrue)
              Get.find<RealmProvider>().refreshAvailableRealms(),
          ]);
+
+          if (auth.isAuthorized.isTrue && auth.userProfile.value != null) {
+            final account = Account.fromJson(auth.userProfile.value!);
+            if (account.profile?.birthday != null) {
+              final birthDate = account.profile!.birthday!.toLocal();
+              final isBirthday = birthDate.day == DateTime.now().day;
+              if (isBirthday) {
+                setState(
+                  () => _specialState = BootstrapperSpecialState.userBirthday,
+                );
+              }
+            }
+          }
        } catch (e) {
          context.showErrorDialog(e);
        }
@ -214,7 +240,7 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
        final AuthProvider auth = Get.find();
        if (auth.isAuthorized.isTrue) {
          try {
-            Get.find<WebSocketProvider>().registerPushNotifications();
+            Get.find<NotificationProvider>().registerPushNotifications();
          } catch (err) {
            context.showSnackbar(
              'pushNotifyRegisterFailed'.trParams({'reason': err.toString()}),
@ -352,8 +378,142 @@ class _BootstrapperShellState extends State<BootstrapperShell> {
          }
        },
      );
+    } else if (_specialState != null) {
+      return GestureDetector(
+        child: RootContainer(
+          child: switch (_specialState) {
+            BootstrapperSpecialState.appAnniversary => const Placeholder(),
+            _ => _BirthdaySpecialScreen(),
+          },
+        ),
+        onTap: () {
+          setState(() => _specialState = null);
+        },
+      );
    }

    return widget.child;
  }
 }
+
+class _BirthdaySpecialScreen extends StatefulWidget {
+  const _BirthdaySpecialScreen();
+
+  @override
+  State<_BirthdaySpecialScreen> createState() => _BirthdaySpecialScreenState();
+}
+
+class _BirthdaySpecialScreenState extends State<_BirthdaySpecialScreen> {
+  late final ConfettiController _confettiController =
+      ConfettiController(duration: const Duration(seconds: 10));
+
+  @override
+  void initState() {
+    _confettiController.play();
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController.dispose();
+    super.dispose();
+  }
+
+  Color get _unFocusColor =>
+      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+  String _toOrdinal(int num) {
+    if (num >= 11 && num <= 13) {
+      return '${num}th';
+    }
+
+    switch (num % 10) {
+      case 1:
+        return '${num}st';
+      case 2:
+        return '${num}nd';
+      case 3:
+        return '${num}rd';
+      default:
+        return '${num}th';
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+    final account = Account.fromJson(auth.userProfile.value!);
+
+    final birthDate = account.profile!.birthday!.toLocal();
+    final birthdayCount = DateTime.now().difference(birthDate).inDays ~/ 365;
+
+    return Stack(
+      children: <Widget>[
+        Align(
+          alignment: Alignment.center,
+          child: ConfettiWidget(
+            confettiController: _confettiController,
+            blastDirectionality: BlastDirectionality.explosive,
+            shouldLoop: true,
+            colors: const [
+              Colors.green,
+              Colors.blue,
+              Colors.pink,
+              Colors.orange,
+              Colors.purple
+            ],
+            maxBlastForce: 30,
+            minBlastForce: 15,
+            emissionFrequency: 0.05,
+            numberOfParticles: 20,
+            gravity: 0.2,
+          ),
+        ),
+        Align(
+          child: CenteredContainer(
+            maxWidth: 320,
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.center,
+              mainAxisAlignment: MainAxisAlignment.center,
+              children: [
+                Text(
+                  '🎂',
+                  style: TextStyle(fontSize: 60),
+                ),
+                const Gap(8),
+                Text(
+                  'happyBirthday'.trParams({
+                    'name': account.profile?.firstName != null
+                        ? [
+                            account.profile?.firstName,
+                            account.profile?.lastName
+                          ].join(' ')
+                        : '@${account.name}',
+                  }),
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.titleLarge,
+                ),
+                Text(
+                  'happyBirthdayDesc'.trParams({
+                    'count': _toOrdinal(birthdayCount),
+                  }),
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.bodyMedium,
+                ),
+                const Gap(8),
+                Text(
+                  'bsContinuable'.tr,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontSize: 13,
+                    color: _unFocusColor,
+                  ),
+                ).paddingOnly(bottom: 5),
+              ],
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+}
--- a/lib/controllers/post_editor_controller.dart
+++ b/lib/controllers/post_editor_controller.dart
@ -43,14 +43,17 @@ class PostEditorController extends GetxController {

  RxBool isRestoreFromLocal = false.obs;
  Rx<DateTime?> lastSaveTime = Rx(null);
-  Timer? _saveTimer;
+  Future? _saveFuture;

  PostEditorController() {
    SharedPreferences.getInstance().then((inst) {
      _prefs = inst;
-      _saveTimer = Timer.periodic(
-        const Duration(seconds: 3),
-        (Timer t) {
+    });
+    contentController.addListener(() {
+      contentLength.value = contentController.text.length;
+      _saveFuture ??= Future.delayed(
+        const Duration(seconds: 1),
+        () {
          if (isNotEmpty) {
            localSave();
            lastSaveTime.value = DateTime.now();
@ -59,12 +62,10 @@ class PostEditorController extends GetxController {
            localClear();
            lastSaveTime.value = null;
          }
+          _saveFuture = null;
        },
      );
    });
-    contentController.addListener(() {
-      contentLength.value = contentController.text.length;
-    });
  }

  Future<void> editOverview(BuildContext context) {
@ -124,6 +125,21 @@ class PostEditorController extends GetxController {
        onRemove: (String value) {
          attachments.remove(value);
        },
+        onInsert: (String str) {
+          final text = contentController.text;
+          final selection = contentController.selection;
+          final newText = text.replaceRange(
+            selection.start,
+            selection.end,
+            str,
+          );
+          contentController.value = TextEditingValue(
+            text: newText,
+            selection: TextSelection.collapsed(
+              offset: selection.baseOffset + str.length,
+            ),
+          );
+        },
      ),
    );
  }
@ -355,8 +371,6 @@ class PostEditorController extends GetxController {

  @override
  void dispose() {
-    _saveTimer?.cancel();
-
    titleController.dispose();
    descriptionController.dispose();
    contentController.dispose();
--- a/lib/controllers/post_list_controller.dart
+++ b/lib/controllers/post_list_controller.dart
@ -1,9 +1,12 @@
+import 'dart:async';
 import 'dart:math';

 import 'package:get/get.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';

@ -31,9 +34,18 @@ class PostListController extends GetxController {
    pagingController.addPageRequestListener(_onPagingControllerRequest);
  }

+  Completer<void>? _pagingLoadCompleter;
+
  Future<void> _onPagingControllerRequest(int pageKey) async {
    try {
+      if (_pagingLoadCompleter != null) {
+        await _pagingLoadCompleter!.future;
+        return;
+      }
+      _pagingLoadCompleter = Completer();
      final result = await loadMore();
+      _pagingLoadCompleter!.complete();
+      _pagingLoadCompleter = null;

      if (result != null && hasMore.value) {
        pagingController.appendPage(result, nextPageKey.value);
@ -97,9 +109,6 @@ class PostListController extends GetxController {
      hasMore.value = false;
    }

-    final idx = <dynamic>{};
-    postList.retainWhere((x) => idx.add(x.id));
-
    if (postList.isNotEmpty) {
      var lastId = postList.map((x) => x.id).reduce(max);
      Get.find<LastReadProvider>().feedLastReadAt = lastId;
@ -111,35 +120,39 @@ class PostListController extends GetxController {
  Future<List<Post>?> _loadPosts(int pageKey) async {
    isBusy.value = true;

-    final PostProvider provider = Get.find();
+    final PostProvider posts = Get.find();

    Response resp;
    try {
      if (author != null) {
-        resp = await provider.listPost(
+        resp = await posts.listPost(
          pageKey,
          author: author,
+          take: 10,
        );
      } else {
        switch (mode.value) {
          case 2:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
              pageKey,
              channel: 'shuffle',
              realm: realm,
+              take: 10,
            );
            break;
          case 1:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
              pageKey,
              channel: 'friends',
              realm: realm,
+              take: 10,
            );
            break;
          default:
-            resp = await provider.listRecommendations(
+            resp = await posts.listRecommendations(
              pageKey,
              realm: realm,
+              take: 10,
            );
            break;
        }
@ -153,6 +166,27 @@ class PostListController extends GetxController {
    final result = PaginationResult.fromJson(resp.body);
    final out = result.data?.map((e) => Post.fromJson(e)).toList();

+    final AttachmentProvider attach = Get.find();
+
+    if (out != null) {
+      final attachmentIds = out
+          .mapMany((x) => x.body['attachments'] ?? [])
+          .cast<String>()
+          .toSet()
+          .toList();
+      final attachmentOut = await attach.listMetadata(attachmentIds);
+
+      for (var idx = 0; idx < out.length; idx++) {
+        final rids = List<String>.from(out[idx].body['attachments'] ?? []);
+        out[idx].preload = PostPreload(
+          attachments: attachmentOut
+              .where((x) => x != null && rids.contains(x.rid))
+              .cast<Attachment>()
+              .toList(),
+        );
+      }
+    }
+
    postTotal.value = result.count;

    return out;
--- a/lib/main.dart
+++ b/lib/main.dart
@ -18,6 +18,7 @@ import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/providers/navigation.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/stickers.dart';
 import 'package:solian/providers/subscription.dart';
 import 'package:solian/providers/theme_switcher.dart';
@ -138,11 +139,12 @@ class SolianApp extends StatelessWidget {
    Get.put(NavigationStateProvider());

    Get.lazyPut(() => AuthProvider());
+    Get.lazyPut(() => WebSocketProvider());
    Get.lazyPut(() => RelationshipProvider());
    Get.lazyPut(() => PostProvider());
    Get.lazyPut(() => StickerProvider());
    Get.lazyPut(() => AttachmentProvider());
-    Get.lazyPut(() => WebSocketProvider());
+    Get.lazyPut(() => NotificationProvider());
    Get.lazyPut(() => StatusProvider());
    Get.lazyPut(() => ChannelProvider());
    Get.lazyPut(() => RealmProvider());
@ -154,6 +156,6 @@ class SolianApp extends StatelessWidget {
    Get.lazyPut(() => LastReadProvider());
    Get.lazyPut(() => SubscriptionProvider());

-    Get.find<WebSocketProvider>().requestPermissions();
+    Get.find<NotificationProvider>().requestPermissions();
  }
 }
--- a/lib/models/audit_log.dart
+++ b/lib/models/audit_log.dart
@ -0,0 +1,38 @@
+import 'package:json_annotation/json_annotation.dart';
+import 'package:solian/models/account.dart';
+
+part 'audit_log.g.dart';
+
+@JsonSerializable()
+class AuditEvent {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String type;
+  String target;
+  String location;
+  String ipAddress;
+  String userAgent;
+  Account account;
+  int accountId;
+
+  AuditEvent({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    required this.deletedAt,
+    required this.type,
+    required this.target,
+    required this.location,
+    required this.ipAddress,
+    required this.userAgent,
+    required this.account,
+    required this.accountId,
+  });
+
+  static AuditEvent fromJson(Map<String, dynamic> json) =>
+      _$AuditEventFromJson(json);
+
+  Map<String, dynamic> toJson() => _$AuditEventToJson(this);
+}
--- a/lib/models/audit_log.g.dart
+++ b/lib/models/audit_log.g.dart
@ -0,0 +1,38 @@
+// GENERATED CODE - DO NOT MODIFY BY HAND
+
+part of 'audit_log.dart';
+
+// **************************************************************************
+// JsonSerializableGenerator
+// **************************************************************************
+
+AuditEvent _$AuditEventFromJson(Map<String, dynamic> json) => AuditEvent(
+      id: (json['id'] as num).toInt(),
+      createdAt: DateTime.parse(json['created_at'] as String),
+      updatedAt: DateTime.parse(json['updated_at'] as String),
+      deletedAt: json['deleted_at'] == null
+          ? null
+          : DateTime.parse(json['deleted_at'] as String),
+      type: json['type'] as String,
+      target: json['target'] as String,
+      location: json['location'] as String,
+      ipAddress: json['ip_address'] as String,
+      userAgent: json['user_agent'] as String,
+      account: Account.fromJson(json['account'] as Map<String, dynamic>),
+      accountId: (json['account_id'] as num).toInt(),
+    );
+
+Map<String, dynamic> _$AuditEventToJson(AuditEvent instance) =>
+    <String, dynamic>{
+      'id': instance.id,
+      'created_at': instance.createdAt.toIso8601String(),
+      'updated_at': instance.updatedAt.toIso8601String(),
+      'deleted_at': instance.deletedAt?.toIso8601String(),
+      'type': instance.type,
+      'target': instance.target,
+      'location': instance.location,
+      'ip_address': instance.ipAddress,
+      'user_agent': instance.userAgent,
+      'account': instance.account.toJson(),
+      'account_id': instance.accountId,
+    };
--- a/lib/models/notification.dart
+++ b/lib/models/notification.dart
@ -1,18 +1,29 @@
+import 'package:flutter/material.dart';
 import 'package:json_annotation/json_annotation.dart';

 part 'notification.g.dart';

+const Map<String, IconData> NotificationTopicIcons = {
+  'passport.security.alert': Icons.gpp_maybe,
+  'interactive.subscription': Icons.subscriptions,
+  'interactive.feedback': Icons.add_reaction,
+  'messaging.callStart': Icons.call_received,
+};
+
@JsonSerializable()
 class Notification {
  int id;
  DateTime createdAt;
  DateTime updatedAt;
  DateTime? deletedAt;
+  DateTime? readAt;
+  String topic;
  String title;
  String? subtitle;
  String body;
  String? avatar;
  String? picture;
+  Map<String, dynamic>? metadata;
  int? senderId;
  int accountId;

@ -21,11 +32,14 @@ class Notification {
    required this.createdAt,
    required this.updatedAt,
    required this.deletedAt,
+    required this.readAt,
+    required this.topic,
    required this.title,
    required this.subtitle,
    required this.body,
    required this.avatar,
    required this.picture,
+    required this.metadata,
    required this.senderId,
    required this.accountId,
  });
--- a/lib/models/notification.g.dart
+++ b/lib/models/notification.g.dart
@ -13,11 +13,16 @@ Notification _$NotificationFromJson(Map<String, dynamic> json) => Notification(
      deletedAt: json['deleted_at'] == null
          ? null
          : DateTime.parse(json['deleted_at'] as String),
+      readAt: json['read_at'] == null
+          ? null
+          : DateTime.parse(json['read_at'] as String),
+      topic: json['topic'] as String,
      title: json['title'] as String,
      subtitle: json['subtitle'] as String?,
      body: json['body'] as String,
      avatar: json['avatar'] as String?,
      picture: json['picture'] as String?,
+      metadata: json['metadata'] as Map<String, dynamic>?,
      senderId: (json['sender_id'] as num?)?.toInt(),
      accountId: (json['account_id'] as num).toInt(),
    );
@ -28,11 +33,14 @@ Map<String, dynamic> _$NotificationToJson(Notification instance) =>
      'created_at': instance.createdAt.toIso8601String(),
      'updated_at': instance.updatedAt.toIso8601String(),
      'deleted_at': instance.deletedAt?.toIso8601String(),
+      'read_at': instance.readAt?.toIso8601String(),
+      'topic': instance.topic,
      'title': instance.title,
      'subtitle': instance.subtitle,
      'body': instance.body,
      'avatar': instance.avatar,
      'picture': instance.picture,
+      'metadata': instance.metadata,
      'sender_id': instance.senderId,
      'account_id': instance.accountId,
    };
--- a/lib/models/post.dart
+++ b/lib/models/post.dart
@ -1,10 +1,19 @@
 import 'package:json_annotation/json_annotation.dart';
 import 'package:solian/models/account.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/models/post_categories.dart';
 import 'package:solian/models/realm.dart';

 part 'post.g.dart';

+class PostPreload {
+  List<Attachment> attachments;
+
+  PostPreload({
+    required this.attachments,
+  });
+}
+
@JsonSerializable()
 class Post {
  int id;
@ -15,6 +24,7 @@ class Post {
  String? alias;
  String? areaAlias;
  dynamic body;
+  int visibility;
  List<Tag>? tags;
  List<Category>? categories;
  List<Post>? replies;
@ -33,6 +43,9 @@ class Post {
  Account author;
  PostMetric? metric;

+  @JsonKey(includeFromJson: false, includeToJson: false)
+  PostPreload? preload;
+
  Post({
    required this.id,
    required this.createdAt,
@ -43,6 +56,7 @@ class Post {
    required this.areaAlias,
    required this.type,
    required this.body,
+    required this.visibility,
    required this.tags,
    required this.categories,
    required this.replies,
--- a/lib/models/post.g.dart
+++ b/lib/models/post.g.dart
@ -20,6 +20,7 @@ Post _$PostFromJson(Map<String, dynamic> json) => Post(
      areaAlias: json['area_alias'] as String?,
      type: json['type'] as String,
      body: json['body'],
+      visibility: (json['visibility'] as num).toInt(),
      tags: (json['tags'] as List<dynamic>?)
          ?.map((e) => Tag.fromJson(e as Map<String, dynamic>))
          .toList(),
@ -67,6 +68,7 @@ Map<String, dynamic> _$PostToJson(Post instance) => <String, dynamic>{
      'alias': instance.alias,
      'area_alias': instance.areaAlias,
      'body': instance.body,
+      'visibility': instance.visibility,
      'tags': instance.tags?.map((e) => e.toJson()).toList(),
      'categories': instance.categories?.map((e) => e.toJson()).toList(),
      'replies': instance.replies?.map((e) => e.toJson()).toList(),
--- a/lib/providers/auth.dart
+++ b/lib/providers/auth.dart
@ -11,6 +11,7 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/database/database.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';

@ -125,7 +126,7 @@ class AuthProvider extends GetConnect {
      userAgent: await ServiceFinder.getUserAgent(),
      sendUserAgent: true,
    );
-    client.httpClient.addAuthenticator(requestAuthenticator);
+    client.httpClient.addRequestModifier(requestAuthenticator);
    client.httpClient.baseUrl = ServiceFinder.buildUrl(service, null);

    return client;
@ -174,7 +175,7 @@ class AuthProvider extends GetConnect {
    );

    Get.find<WebSocketProvider>().connect();
-    Get.find<WebSocketProvider>().notifyPrefetch();
+    Get.find<NotificationProvider>().fetchNotification();

    return credentials!;
  }
@ -184,8 +185,8 @@ class AuthProvider extends GetConnect {
    userProfile.value = null;

    Get.find<WebSocketProvider>().disconnect();
-    Get.find<WebSocketProvider>().notifications.clear();
-    Get.find<WebSocketProvider>().notificationUnread.value = 0;
+    Get.find<NotificationProvider>().notifications.clear();
+    Get.find<NotificationProvider>().notificationUnread.value = 0;

    AppDatabase.removeDatabase();
    autoStopBackgroundNotificationService();
--- a/lib/providers/content/attachment.dart
+++ b/lib/providers/content/attachment.dart
@ -23,6 +23,21 @@ class AttachmentProvider extends GetConnect {

  final Map<String, Attachment> _cachedResponses = {};

+  List<Attachment?> listMetadataFromCache(List<String> rid) {
+    if (rid.isEmpty) return List.empty();
+
+    List<Attachment?> result = List.filled(rid.length, null);
+    for (var idx = 0; idx < rid.length; idx++) {
+      if (_cachedResponses.containsKey(rid[idx])) {
+        result[idx] = _cachedResponses[rid[idx]];
+      } else {
+        result[idx] = null;
+      }
+    }
+
+    return result;
+  }
+
  Future<List<Attachment?>> listMetadata(
    List<String> rid, {
    noCache = false,
@ -41,25 +56,27 @@ class AttachmentProvider extends GetConnect {
      }
    }

-    final resp = await get(
-      '/attachments?take=${pendingQuery.length}&id=${pendingQuery.join(',')}',
-    );
-    if (resp.statusCode != 200) return result;
+    if (pendingQuery.isNotEmpty) {
+      final resp = await get(
+        '/attachments?take=${pendingQuery.length}&id=${pendingQuery.join(',')}',
+      );
+      if (resp.statusCode != 200) return result;

-    final rawOut = PaginationResult.fromJson(resp.body);
-    if (rawOut.data == null) return result;
+      final rawOut = PaginationResult.fromJson(resp.body);
+      if (rawOut.data == null) return result;

-    final List<Attachment> out =
-        rawOut.data!.map((x) => Attachment.fromJson(x)).toList();
-    for (final item in out) {
-      if (item.destination != 0 && item.isAnalyzed) {
-        _cachedResponses[item.rid] = item;
+      final List<Attachment> out =
+          rawOut.data!.map((x) => Attachment.fromJson(x)).toList();
+      for (final item in out) {
+        if (item.destination != 0 && item.isAnalyzed) {
+          _cachedResponses[item.rid] = item;
+        }
      }
-    }
-    for (var i = 0; i < out.length; i++) {
-      for (var j = 0; j < rid.length; j++) {
-        if (out[i].rid == rid[j]) {
-          result[j] = out[i];
+      for (var i = 0; i < out.length; i++) {
+        for (var j = 0; j < rid.length; j++) {
+          if (out[i].rid == rid[j]) {
+            result[j] = out[i];
+          }
        }
      }
    }
--- a/lib/providers/content/posts.dart
+++ b/lib/providers/content/posts.dart
@ -3,22 +3,11 @@ import 'package:solian/exceptions/request.dart';
 import 'package:solian/exceptions/unauthorized.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/services.dart';
-
-class PostProvider extends GetConnect {
-  @override
-  void onInit() {
-    httpClient.baseUrl = ServiceFinder.buildUrl('interactive', null);
-  }

+class PostProvider extends GetxController {
  Future<Response> seeWhatsNew(int pivot) async {
-    GetConnect client;
    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final client = await auth.configureClient('co');
    final resp = await client.get('/whats-new?pivot=$pivot');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
@ -28,19 +17,14 @@ class PostProvider extends GetConnect {
  }

  Future<Response> listRecommendations(int page,
-      {String? realm, String? channel}) async {
-    GetConnect client;
-    final AuthProvider auth = Get.find();
+      {String? realm, String? channel, int take = 10}) async {
    final queries = [
-      'take=${10}',
+      'take=$take',
      'offset=$page',
      if (realm != null) 'realm=$realm',
    ];
-    if (auth.isAuthorized.value) {
-      client = await auth.configureClient('co');
-    } else {
-      client = await ServiceFinder.configureClient('co');
-    }
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('interactive');
    final resp = await client.get(
      channel == null
          ? '/recommendations?${queries.join('&')}'
@ -60,9 +44,33 @@ class PostProvider extends GetConnect {
    final queries = [
      'take=${10}',
      'offset=$page',
+      'truncate=false',
    ];
    final client = await auth.configureClient('interactive');
-    final resp = await client.get('/posts/drafts?${queries.join('&')}');
+    final resp = await client.get(
+      '/posts/drafts?${queries.join('&')}',
+    );
+    if (resp.statusCode != 200) {
+      throw RequestException(resp);
+    }
+
+    return resp;
+  }
+
+  Future<Response> searchPost(String probe, int page,
+      {String? realm, String? author, tag, category, int take = 10}) async {
+    final queries = [
+      'probe=$probe',
+      'take=$take',
+      'offset=$page',
+      if (tag != null) 'tag=$tag',
+      if (category != null) 'category=$category',
+      if (author != null) 'author=$author',
+      if (realm != null) 'realm=$realm',
+    ];
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/search?${queries.join('&')}');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
    }
@ -71,16 +79,18 @@ class PostProvider extends GetConnect {
  }

  Future<Response> listPost(int page,
-      {String? realm, String? author, tag, category}) async {
+      {String? realm, String? author, tag, category, int take = 10}) async {
    final queries = [
-      'take=${10}',
+      'take=$take',
      'offset=$page',
      if (tag != null) 'tag=$tag',
      if (category != null) 'category=$category',
      if (author != null) 'author=$author',
      if (realm != null) 'realm=$realm',
    ];
-    final resp = await get('/posts?${queries.join('&')}');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts?${queries.join('&')}');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
    }
@ -89,7 +99,10 @@ class PostProvider extends GetConnect {
  }

  Future<Response> listPostReplies(String alias, int page) async {
-    final resp = await get('/posts/$alias/replies?take=${10}&offset=$page');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp =
+        await client.get('/posts/$alias/replies?take=${10}&offset=$page');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
    }
@ -98,7 +111,9 @@ class PostProvider extends GetConnect {
  }

  Future<List<Post>> listPostFeaturedReply(String alias, {int take = 1}) async {
-    final resp = await get('/posts/$alias/replies/featured?take=$take');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias/replies/featured?take=$take');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
    }
@ -107,16 +122,9 @@ class PostProvider extends GetConnect {
  }

  Future<Response> getPost(String alias) async {
-    final resp = await get('/posts/$alias');
-    if (resp.statusCode != 200) {
-      throw RequestException(resp);
-    }
-
-    return resp;
-  }
-
-  Future<Response> getArticle(String alias) async {
-    final resp = await get('/articles/$alias');
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('co');
+    final resp = await client.get('/posts/$alias');
    if (resp.statusCode != 200) {
      throw RequestException(resp);
    }
--- a/lib/providers/database/database.g.dart
+++ b/lib/providers/database/database.g.dart
@ -299,53 +299,71 @@ typedef $$LocalMessageEventTableTableUpdateCompanionBuilder
 });

 class $$LocalMessageEventTableTableFilterComposer
-    extends FilterComposer<_$AppDatabase, $LocalMessageEventTableTable> {
-  $$LocalMessageEventTableTableFilterComposer(super.$state);
-  ColumnFilters<int> get id => $state.composableBuilder(
-      column: $state.table.id,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableFilterComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  ColumnFilters<int> get id => $composableBuilder(
+      column: $table.id, builder: (column) => ColumnFilters(column));

-  ColumnFilters<int> get channelId => $state.composableBuilder(
-      column: $state.table.channelId,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+  ColumnFilters<int> get channelId => $composableBuilder(
+      column: $table.channelId, builder: (column) => ColumnFilters(column));

  ColumnWithTypeConverterFilters<Event?, Event, String> get data =>
-      $state.composableBuilder(
-          column: $state.table.data,
-          builder: (column, joinBuilders) => ColumnWithTypeConverterFilters(
-              column,
-              joinBuilders: joinBuilders));
+      $composableBuilder(
+          column: $table.data,
+          builder: (column) => ColumnWithTypeConverterFilters(column));

-  ColumnFilters<DateTime> get createdAt => $state.composableBuilder(
-      column: $state.table.createdAt,
-      builder: (column, joinBuilders) =>
-          ColumnFilters(column, joinBuilders: joinBuilders));
+  ColumnFilters<DateTime> get createdAt => $composableBuilder(
+      column: $table.createdAt, builder: (column) => ColumnFilters(column));
 }

 class $$LocalMessageEventTableTableOrderingComposer
-    extends OrderingComposer<_$AppDatabase, $LocalMessageEventTableTable> {
-  $$LocalMessageEventTableTableOrderingComposer(super.$state);
-  ColumnOrderings<int> get id => $state.composableBuilder(
-      column: $state.table.id,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableOrderingComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  ColumnOrderings<int> get id => $composableBuilder(
+      column: $table.id, builder: (column) => ColumnOrderings(column));

-  ColumnOrderings<int> get channelId => $state.composableBuilder(
-      column: $state.table.channelId,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<int> get channelId => $composableBuilder(
+      column: $table.channelId, builder: (column) => ColumnOrderings(column));

-  ColumnOrderings<String> get data => $state.composableBuilder(
-      column: $state.table.data,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<String> get data => $composableBuilder(
+      column: $table.data, builder: (column) => ColumnOrderings(column));

-  ColumnOrderings<DateTime> get createdAt => $state.composableBuilder(
-      column: $state.table.createdAt,
-      builder: (column, joinBuilders) =>
-          ColumnOrderings(column, joinBuilders: joinBuilders));
+  ColumnOrderings<DateTime> get createdAt => $composableBuilder(
+      column: $table.createdAt, builder: (column) => ColumnOrderings(column));
+}
+
+class $$LocalMessageEventTableTableAnnotationComposer
+    extends Composer<_$AppDatabase, $LocalMessageEventTableTable> {
+  $$LocalMessageEventTableTableAnnotationComposer({
+    required super.$db,
+    required super.$table,
+    super.joinBuilder,
+    super.$addJoinBuilderToRootComposer,
+    super.$removeJoinBuilderFromRootComposer,
+  });
+  GeneratedColumn<int> get id =>
+      $composableBuilder(column: $table.id, builder: (column) => column);
+
+  GeneratedColumn<int> get channelId =>
+      $composableBuilder(column: $table.channelId, builder: (column) => column);
+
+  GeneratedColumnWithTypeConverter<Event?, String> get data =>
+      $composableBuilder(column: $table.data, builder: (column) => column);
+
+  GeneratedColumn<DateTime> get createdAt =>
+      $composableBuilder(column: $table.createdAt, builder: (column) => column);
 }

 class $$LocalMessageEventTableTableTableManager extends RootTableManager<
@ -354,6 +372,7 @@ class $$LocalMessageEventTableTableTableManager extends RootTableManager<
    LocalMessageEventTableData,
    $$LocalMessageEventTableTableFilterComposer,
    $$LocalMessageEventTableTableOrderingComposer,
+    $$LocalMessageEventTableTableAnnotationComposer,
    $$LocalMessageEventTableTableCreateCompanionBuilder,
    $$LocalMessageEventTableTableUpdateCompanionBuilder,
    (
@ -368,10 +387,15 @@ class $$LocalMessageEventTableTableTableManager extends RootTableManager<
      : super(TableManagerState(
          db: db,
          table: table,
-          filteringComposer: $$LocalMessageEventTableTableFilterComposer(
-              ComposerState(db, table)),
-          orderingComposer: $$LocalMessageEventTableTableOrderingComposer(
-              ComposerState(db, table)),
+          createFilteringComposer: () =>
+              $$LocalMessageEventTableTableFilterComposer(
+                  $db: db, $table: table),
+          createOrderingComposer: () =>
+              $$LocalMessageEventTableTableOrderingComposer(
+                  $db: db, $table: table),
+          createComputedFieldComposer: () =>
+              $$LocalMessageEventTableTableAnnotationComposer(
+                  $db: db, $table: table),
          updateCompanionCallback: ({
            Value<int> id = const Value.absent(),
            Value<int> channelId = const Value.absent(),
@ -410,6 +434,7 @@ typedef $$LocalMessageEventTableTableProcessedTableManager
        LocalMessageEventTableData,
        $$LocalMessageEventTableTableFilterComposer,
        $$LocalMessageEventTableTableOrderingComposer,
+        $$LocalMessageEventTableTableAnnotationComposer,
        $$LocalMessageEventTableTableCreateCompanionBuilder,
        $$LocalMessageEventTableTableUpdateCompanionBuilder,
        (
--- a/lib/providers/experience.dart
+++ b/lib/providers/experience.dart
@ -4,19 +4,19 @@ import 'package:intl/intl.dart';
 class ExperienceProvider extends GetxController {
  static List<int> experienceToLevelRequirements = [
    0, // Level 0
-    100, // Level 1
-    400, // Level 2
-    900, // Level 3
-    1600, // Level 4
-    2500, // Level 5
-    3600, // Level 6
-    4900, // Level 7
-    6400, // Level 8
-    8100, // Level 9
-    10000, // Level 10
-    12100, // Level 11
-    14400, // Level 12
-    36800 // Level 13
+    1000, // Level 1
+    4000, // Level 2
+    9000, // Level 3
+    16000, // Level 4
+    25000, // Level 5
+    36000, // Level 6
+    49000, // Level 7
+    64000, // Level 8
+    81000, // Level 9
+    100000, // Level 10
+    121000, // Level 11
+    144000, // Level 12
+    368000 // Level 13
  ];

  static List<String> levelLabelMapping =
@ -35,7 +35,7 @@ class ExperienceProvider extends GetxController {
    final idx = experienceToLevelRequirements.indexOf(exp);
    if (idx + 1 >= experienceToLevelRequirements.length) return 1;
    final nextExp = experienceToLevelRequirements[idx + 1];
-    return exp / nextExp;
+    return (experience - exp).abs() / (exp - nextExp).abs();
  }

  static String calcLevelUpProgressLevel(int experience) {
@ -43,9 +43,9 @@ class ExperienceProvider extends GetxController {
        .firstWhere((x) => x <= experience);
    final idx = experienceToLevelRequirements.indexOf(exp);
    if (idx + 1 >= experienceToLevelRequirements.length) return 'Infinity';
-    final nextExp = experienceToLevelRequirements[idx + 1];
+    final nextExp = exp - experienceToLevelRequirements[idx + 1];
    final formatter =
        NumberFormat.compactCurrency(symbol: '', decimalDigits: 1);
-    return '${formatter.format(exp)}/${formatter.format(nextExp)}';
+    return '${formatter.format((exp - experience).abs())}/${formatter.format(nextExp.abs())}';
  }
 }
--- a/lib/providers/notifications.dart
+++ b/lib/providers/notifications.dart
@ -0,0 +1,175 @@
+import 'dart:developer';
+
+import 'package:firebase_messaging/firebase_messaging.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+import 'package:flutter_udid/flutter_udid.dart';
+import 'package:get/get.dart';
+import 'package:shared_preferences/shared_preferences.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/platform.dart';
+import 'package:solian/providers/auth.dart';
+
+class NotificationProvider extends GetxController {
+  RxBool isBusy = false.obs;
+
+  RxInt notificationUnread = 0.obs;
+  RxList<Notification> notifications =
+      List<Notification>.empty(growable: true).obs;
+
+  Future<void> fetchNotification() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.get('/notifications?skip=0&take=100');
+    if (resp.statusCode == 200) {
+      final result = PaginationResult.fromJson(resp.body);
+      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
+      if (data != null) {
+        notifications.addAll(data);
+        notificationUnread.value = data.where((x) => x.readAt == null).length;
+      }
+    }
+  }
+
+  Future<void> markAllRead() async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    isBusy.value = true;
+
+    final NotificationProvider nty = Get.find();
+
+    List<int> markList = List.empty(growable: true);
+    for (final element in nty.notifications) {
+      if (element.id <= 0) continue;
+      if (element.readAt != null) continue;
+      markList.add(element.id);
+    }
+
+    if (markList.isNotEmpty) {
+      final client = await auth.configureClient('auth');
+      await client.put('/notifications/read', {'messages': markList});
+    }
+
+    nty.notifications.value = nty.notifications.map((x) {
+      x.readAt = DateTime.now();
+      return x;
+    }).toList();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  Future<void> markOneRead(Notification element, int index) async {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    final NotificationProvider nty = Get.find();
+
+    if (element.id <= 0) {
+      nty.notifications.removeAt(index);
+      return;
+    } else if (element.readAt != null) {
+      return;
+    }
+
+    isBusy.value = true;
+
+    final client = await auth.configureClient('auth');
+
+    await client.put('/notifications/read/${element.id}', {});
+
+    nty.notifications[0].readAt = DateTime.now();
+    nty.notifications.refresh();
+
+    isBusy.value = false;
+  }
+
+  void requestPermissions() {
+    try {
+      FirebaseMessaging.instance.requestPermission(
+          alert: true,
+          announcement: true,
+          carPlay: true,
+          badge: true,
+          sound: true);
+    } catch (_) {
+      // When firebase isn't initialized (background service)
+      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
+          FlutterLocalNotificationsPlugin();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              AndroidFlutterLocalNotificationsPlugin>()
+          ?.requestNotificationsPermission();
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              IOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+      flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              MacOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: true,
+            badge: true,
+            sound: true,
+          );
+    }
+  }
+
+  Future<void> registerPushNotifications() async {
+    if (PlatformInfo.isWeb) return;
+
+    final prefs = await SharedPreferences.getInstance();
+    if (prefs.getBool('service_background_notification') == true) {
+      log('Background notification service has been enabled, skip register push notifications');
+      return;
+    }
+
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    late final String? token;
+    late final String provider;
+    var deviceUuid = await _getDeviceUuid();
+
+    if (deviceUuid == null || deviceUuid.isEmpty) {
+      log("Unable to active push notifications, couldn't get device uuid");
+      return;
+    } else {
+      log('Device UUID is $deviceUuid');
+    }
+
+    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
+      provider = 'apple';
+      token = await FirebaseMessaging.instance.getAPNSToken();
+    } else {
+      provider = 'firebase';
+      token = await FirebaseMessaging.instance.getToken();
+    }
+    log('Device Push Token is $token');
+
+    final client = await auth.configureClient('auth');
+
+    final resp = await client.post('/notifications/subscribe', {
+      'provider': provider,
+      'device_token': token,
+      'device_id': deviceUuid,
+    });
+    if (resp.statusCode != 200 && resp.statusCode != 400) {
+      throw RequestException(resp);
+    }
+  }
+
+  Future<String?> _getDeviceUuid() async {
+    if (PlatformInfo.isWeb) return null;
+    return await FlutterUdid.consistentUdid;
+  }
+}
--- a/lib/providers/websocket.dart
+++ b/lib/providers/websocket.dart
@ -3,17 +3,11 @@ import 'dart:convert';
 import 'dart:developer';
 import 'dart:io';

-import 'package:device_info_plus/device_info_plus.dart';
-import 'package:firebase_messaging/firebase_messaging.dart';
-import 'package:flutter_local_notifications/flutter_local_notifications.dart';
 import 'package:get/get.dart';
-import 'package:shared_preferences/shared_preferences.dart';
-import 'package:solian/exceptions/request.dart';
 import 'package:solian/models/notification.dart';
 import 'package:solian/models/packet.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/services.dart';
 import 'package:web_socket_channel/web_socket_channel.dart';

@ -21,56 +15,10 @@ class WebSocketProvider extends GetxController {
  RxBool isConnected = false.obs;
  RxBool isConnecting = false.obs;

-  RxInt notificationUnread = 0.obs;
-  RxList<Notification> notifications =
-      List<Notification>.empty(growable: true).obs;
-
  WebSocketChannel? websocket;

  StreamController<NetworkPackage> stream = StreamController.broadcast();

-  @override
-  onInit() {
-    notifyPrefetch();
-
-    super.onInit();
-  }
-
-  void requestPermissions() {
-    try {
-      FirebaseMessaging.instance.requestPermission(
-          alert: true,
-          announcement: true,
-          carPlay: true,
-          badge: true,
-          sound: true);
-    } catch (_) {
-      // When firebase isn't initialized (background service)
-      FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
-          FlutterLocalNotificationsPlugin();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              AndroidFlutterLocalNotificationsPlugin>()
-          ?.requestNotificationsPermission();
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              IOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-      flutterLocalNotificationsPlugin
-          .resolvePlatformSpecificImplementation<
-              MacOSFlutterLocalNotificationsPlugin>()
-          ?.requestPermissions(
-            alert: true,
-            badge: true,
-            sound: true,
-          );
-    }
-  }
-
  Future<void> connect({noRetry = false}) async {
    if (isConnected.value) {
      return;
@ -119,8 +67,9 @@ class WebSocketProvider extends GetxController {
        log('Websocket incoming message: ${packet.method} ${packet.message}');
        stream.sink.add(packet);
        if (packet.method == 'notifications.new') {
-          notifications.add(Notification.fromJson(packet.payload!));
-          notificationUnread.value++;
+          final NotificationProvider nty = Get.find();
+          nty.notifications.add(Notification.fromJson(packet.payload!));
+          nty.notificationUnread.value++;
        }
      },
      onDone: () {
@ -133,95 +82,4 @@ class WebSocketProvider extends GetxController {
      },
    );
  }
-
-  Future<void> notifyPrefetch() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.get('/notifications?skip=0&take=100');
-    if (resp.statusCode == 200) {
-      final result = PaginationResult.fromJson(resp.body);
-      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
-      if (data != null) {
-        notifications.addAll(data);
-        notificationUnread.value = data.length;
-      }
-    }
-  }
-
-  Future<void> registerPushNotifications() async {
-    if (PlatformInfo.isWeb) return;
-
-    final prefs = await SharedPreferences.getInstance();
-    if (prefs.getBool('service_background_notification') == true) {
-      log('Background notification service has been enabled, skip register push notifications');
-      return;
-    }
-
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    late final String? token;
-    late final String provider;
-    final deviceUuid = await _getDeviceUuid();
-
-    if (deviceUuid == null || deviceUuid.isEmpty) {
-      log("Unable to active push notifications, couldn't get device uuid");
-    } else {
-      log('Device UUID is $deviceUuid');
-    }
-
-    if (PlatformInfo.isIOS || PlatformInfo.isMacOS) {
-      provider = 'apple';
-      token = await FirebaseMessaging.instance.getAPNSToken();
-    } else {
-      provider = 'firebase';
-      token = await FirebaseMessaging.instance.getToken();
-    }
-    log('Device Push Token is $token');
-
-    final client = await auth.configureClient('auth');
-
-    final resp = await client.post('/notifications/subscribe', {
-      'provider': provider,
-      'device_token': token,
-      'device_id': deviceUuid,
-    });
-    if (resp.statusCode != 200 && resp.statusCode != 400) {
-      throw RequestException(resp);
-    }
-  }
-
-  Future<String?> _getDeviceUuid() async {
-    DeviceInfoPlugin deviceInfo = DeviceInfoPlugin();
-    if (PlatformInfo.isWeb) {
-      final webInfo = await deviceInfo.webBrowserInfo;
-      return webInfo.vendor! +
-          webInfo.userAgent! +
-          webInfo.hardwareConcurrency.toString();
-    }
-    if (PlatformInfo.isAndroid) {
-      final androidInfo = await deviceInfo.androidInfo;
-      return androidInfo.id;
-    }
-    if (PlatformInfo.isIOS) {
-      final iosInfo = await deviceInfo.iosInfo;
-      return iosInfo.identifierForVendor!;
-    }
-    if (PlatformInfo.isLinux) {
-      final linuxInfo = await deviceInfo.linuxInfo;
-      return linuxInfo.machineId!;
-    }
-    if (PlatformInfo.isWindows) {
-      final windowsInfo = await deviceInfo.windowsInfo;
-      return windowsInfo.deviceId;
-    }
-    if (PlatformInfo.isMacOS) {
-      final macosInfo = await deviceInfo.macOsInfo;
-      return macosInfo.systemGUID;
-    }
-    return null;
-  }
 }
--- a/lib/router.dart
+++ b/lib/router.dart
@ -2,11 +2,14 @@ import 'package:animations/animations.dart';
 import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/bootstrapper.dart';
+import 'package:solian/models/post.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/screens/about.dart';
 import 'package:solian/screens/account.dart';
+import 'package:solian/screens/account/audit_log.dart';
 import 'package:solian/screens/account/friend.dart';
 import 'package:solian/screens/account/preferences/notifications.dart';
+import 'package:solian/screens/account/preferences/security.dart';
 import 'package:solian/screens/account/profile_edit.dart';
 import 'package:solian/screens/account/profile_page.dart';
 import 'package:solian/screens/auth/signin.dart';
@ -16,9 +19,9 @@ import 'package:solian/screens/channel/channel_detail.dart';
 import 'package:solian/screens/channel/channel_organize.dart';
 import 'package:solian/screens/chat.dart';
 import 'package:solian/screens/dashboard.dart';
-import 'package:solian/screens/feed/search.dart';
+import 'package:solian/screens/posts/post_search.dart';
 import 'package:solian/screens/posts/post_detail.dart';
-import 'package:solian/screens/feed/draft_box.dart';
+import 'package:solian/screens/posts/draft_box.dart';
 import 'package:solian/screens/realms.dart';
 import 'package:solian/screens/realms/realm_detail.dart';
 import 'package:solian/screens/realms/realm_organize.dart';
@ -94,7 +97,7 @@ abstract class AppRouter {
        name: 'postSearch',
        builder: (context, state) => TitleShell(
          state: state,
-          child: FeedSearchScreen(
+          child: PostSearchScreen(
            tag: state.uri.queryParameters['tag'],
            category: state.uri.queryParameters['category'],
          ),
@ -107,6 +110,7 @@ abstract class AppRouter {
          state: state,
          child: PostDetailScreen(
            id: state.pathParameters['id']!,
+            post: state.extra as Post?,
          ),
        ),
      ),
@ -178,6 +182,7 @@ abstract class AppRouter {
          final arguments = state.extra as ChannelDetailArguments;
          return TitleShell(
            state: state,
+            isResponsive: true,
            child: ChannelDetailScreen(
              channel: arguments.channel,
              profile: arguments.profile,
@ -263,6 +268,22 @@ abstract class AppRouter {
          child: const NotificationPreferencesScreen(),
        ),
      ),
+      GoRoute(
+        path: '/account/preferences/auth',
+        name: 'authPreferences',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuthPreferencesScreen(),
+        ),
+      ),
+      GoRoute(
+        path: '/account/audit',
+        name: 'auditLog',
+        builder: (context, state) => TitleShell(
+          state: state,
+          child: const AuditLogScreen(),
+        ),
+      ),
      GoRoute(
        path: '/account/view/:name',
        name: 'accountProfilePage',
--- a/lib/screens/about.dart
+++ b/lib/screens/about.dart
@ -4,7 +4,6 @@ import 'package:get/get.dart';
 import 'package:intl/intl.dart';
 import 'package:package_info_plus/package_info_plus.dart';
 import 'package:shared_preferences/shared_preferences.dart';
-import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';

@ -16,132 +15,130 @@ class AboutScreen extends StatelessWidget {
    const denseButtonStyle =
        ButtonStyle(visualDensity: VisualDensity(vertical: -4));

-    return RootContainer(
-      child: SizedBox(
-        width: double.infinity,
-        child: Column(
-          mainAxisAlignment: MainAxisAlignment.center,
-          children: [
-            ClipRRect(
-              borderRadius: const BorderRadius.all(Radius.circular(16)),
-              child: Image.asset('assets/logo.png', width: 120, height: 120),
-            ),
-            const Gap(8),
-            Text(
-              'Solian',
-              style: Theme.of(context).textTheme.headlineMedium,
-            ),
-            const Text(
-              'The Solar Network',
-              style: TextStyle(fontWeight: FontWeight.bold, fontSize: 16),
-            ),
-            const Gap(8),
-            FutureBuilder(
-              future: PackageInfo.fromPlatform(),
-              builder: (context, snapshot) {
-                if (!snapshot.hasData) {
-                  return const SizedBox.shrink();
-                }
+    return SizedBox(
+      width: double.infinity,
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        children: [
+          ClipRRect(
+            borderRadius: const BorderRadius.all(Radius.circular(16)),
+            child: Image.asset('assets/logo.png', width: 120, height: 120),
+          ),
+          const Gap(8),
+          Text(
+            'Solian',
+            style: Theme.of(context).textTheme.headlineMedium,
+          ),
+          const Text(
+            'The Solar Network',
+            style: TextStyle(fontWeight: FontWeight.bold, fontSize: 16),
+          ),
+          const Gap(8),
+          FutureBuilder(
+            future: PackageInfo.fromPlatform(),
+            builder: (context, snapshot) {
+              if (!snapshot.hasData) {
+                return const SizedBox.shrink();
+              }

-                return Text(
-                  'v${snapshot.data!.version} · ${snapshot.data!.buildNumber}',
-                  style: const TextStyle(fontFamily: 'monospace'),
-                );
-              },
-            ),
-            Text('Copyright © ${DateTime.now().year} Solsynth LLC'),
-            const Gap(16),
-            CenteredContainer(
-              maxWidth: 280,
-              child: Wrap(
-                spacing: 4,
-                runSpacing: 4,
-                alignment: WrapAlignment.center,
-                children: [
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('appDetails'.tr),
-                    onPressed: () async {
-                      final info = await PackageInfo.fromPlatform();
+              return Text(
+                'v${snapshot.data!.version} · ${snapshot.data!.buildNumber}',
+                style: const TextStyle(fontFamily: 'monospace'),
+              );
+            },
+          ),
+          Text('Copyright © ${DateTime.now().year} Solsynth LLC'),
+          const Gap(16),
+          CenteredContainer(
+            maxWidth: 280,
+            child: Wrap(
+              spacing: 4,
+              runSpacing: 4,
+              alignment: WrapAlignment.center,
+              children: [
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('appDetails'.tr),
+                  onPressed: () async {
+                    final info = await PackageInfo.fromPlatform();

-                      showAboutDialog(
-                        context: context,
-                        applicationVersion:
-                            '${info.version} (${info.buildNumber})',
-                        applicationLegalese:
-                            'The Solar Network App is an intuitive and open-source social network and computing platform. Experience the freedom of a user-friendly design that empowers you to create and connect with communities on your own terms. Embrace the future of social networking with a platform that prioritizes your independence and privacy.',
-                        applicationIcon: ClipRRect(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(16)),
-                          child: Image.asset('assets/logo.png',
-                              width: 60, height: 60),
-                        ),
-                      );
-                    },
-                  ),
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('projectWebsite'.tr),
-                    onPressed: () {
-                      launchUrlString(
-                          'https://solsynth.dev/products/solar-network');
-                    },
-                  ),
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('termRelated'.tr),
-                    onPressed: () {
-                      launchUrlString('https://solsynth.dev/terms');
-                    },
-                  ),
-                  TextButton(
-                    style: denseButtonStyle,
-                    child: Text('serviceStatus'.tr),
-                    onPressed: () {
-                      launchUrlString('https://status.solsynth.dev');
-                    },
-                  ),
-                ],
-              ),
+                    showAboutDialog(
+                      context: context,
+                      applicationVersion:
+                          '${info.version} (${info.buildNumber})',
+                      applicationLegalese:
+                          'The Solar Network App is an intuitive and open-source social network and computing platform. Experience the freedom of a user-friendly design that empowers you to create and connect with communities on your own terms. Embrace the future of social networking with a platform that prioritizes your independence and privacy.',
+                      applicationIcon: ClipRRect(
+                        borderRadius:
+                            const BorderRadius.all(Radius.circular(16)),
+                        child: Image.asset('assets/logo.png',
+                            width: 60, height: 60),
+                      ),
+                    );
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('projectWebsite'.tr),
+                  onPressed: () {
+                    launchUrlString(
+                        'https://solsynth.dev/products/solar-network');
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('termRelated'.tr),
+                  onPressed: () {
+                    launchUrlString('https://solsynth.dev/terms');
+                  },
+                ),
+                TextButton(
+                  style: denseButtonStyle,
+                  child: Text('serviceStatus'.tr),
+                  onPressed: () {
+                    launchUrlString('https://status.solsynth.dev');
+                  },
+                ),
+              ],
            ),
-            const Gap(16),
-            const Text(
-              'Open-sourced under AGPLv3',
-              style: TextStyle(
+          ),
+          const Gap(16),
+          const Text(
+            'Open-sourced under AGPLv3',
+            style: TextStyle(
+              fontWeight: FontWeight.w300,
+              fontSize: 12,
+            ),
+          ),
+          FutureBuilder(
+            future: SharedPreferences.getInstance(),
+            builder: (context, snapshot) {
+              const textStyle = TextStyle(
                fontWeight: FontWeight.w300,
                fontSize: 12,
-              ),
-            ),
-            FutureBuilder(
-              future: SharedPreferences.getInstance(),
-              builder: (context, snapshot) {
-                const textStyle = TextStyle(
-                  fontWeight: FontWeight.w300,
-                  fontSize: 12,
+              );
+              if (!snapshot.hasData ||
+                  !snapshot.data!.containsKey('first_boot_time')) {
+                return Text(
+                  'firstBootTime'.trParams({'time': 'unknown'.tr}),
+                  style: textStyle,
                );
-                if (!snapshot.hasData ||
-                    !snapshot.data!.containsKey('first_boot_time')) {
-                  return Text(
-                    'firstBootTime'.trParams({'time': 'unknown'.tr}),
-                    style: textStyle,
-                  );
-                } else {
-                  return Text(
-                    'firstBootTime'.trParams({
-                      'time': DateFormat('yyyy-MM-dd').format(
-                        DateTime.tryParse(
-                              snapshot.data!.getString('first_boot_time')!,
-                            )?.toLocal() ??
-                            DateTime.now(),
-                      ),
-                    }),
-                    style: textStyle,
-                  );
-                }
-              },
-            ),
-          ],
-        ),
+              } else {
+                return Text(
+                  'firstBootTime'.trParams({
+                    'time': DateFormat('yyyy-MM-dd').format(
+                      DateTime.tryParse(
+                            snapshot.data!.getString('first_boot_time')!,
+                          )?.toLocal() ??
+                          DateTime.now(),
+                    ),
+                  }),
+                  style: textStyle,
+                );
+              }
+            },
+          ),
+        ],
      ),
    );
  }
--- a/lib/screens/account.dart
+++ b/lib/screens/account.dart
@ -7,7 +7,6 @@ import 'package:solian/providers/account_status.dart';
 import 'package:solian/providers/relation.dart';
 import 'package:solian/router.dart';
 import 'package:solian/widgets/account/account_heading.dart';
-import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:badges/badges.dart' as badges;

@ -50,112 +49,128 @@ class _AccountScreenState extends State<AccountScreen> {

    final AuthProvider auth = Get.find();

-    return RootContainer(
-      child: SafeArea(
-        child: Obx(() {
-          if (auth.isAuthorized.isFalse) {
-            return Center(
-              child: Column(
-                mainAxisSize: MainAxisSize.min,
-                children: [
-                  _ActionCard(
-                    icon: Icon(
-                      Icons.login,
-                      color: Theme.of(context).colorScheme.onPrimary,
-                    ),
-                    title: 'signin'.tr,
-                    caption: 'signinCaption'.tr,
-                    onTap: () {
-                      AppRouter.instance.pushNamed('signin').then((val) async {
-                        if (val == true) {
-                          await auth.refreshUserProfile();
-                        }
-                      });
-                    },
-                  ),
-                  _ActionCard(
-                    icon: Icon(
-                      Icons.add,
-                      color: Theme.of(context).colorScheme.onPrimary,
-                    ),
-                    title: 'signup'.tr,
-                    caption: 'signupCaption'.tr,
-                    onTap: () {
-                      AppRouter.instance.pushNamed('signup').then((_) {
-                        setState(() {});
-                      });
-                    },
-                  ),
-                  const Gap(4),
-                  TextButton(
-                    style: const ButtonStyle(
-                      visualDensity: VisualDensity(
-                        horizontal: -4,
-                        vertical: -2,
-                      ),
-                    ),
-                    onPressed: () {
-                      AppRouter.instance.pushNamed('settings');
-                    },
-                    child: Text('settings'.tr),
-                  ),
-                ],
-              ),
-            );
-          }
-
-          return CenteredContainer(
-            child: ListView(
+    return SafeArea(
+      child: Obx(() {
+        if (auth.isAuthorized.isFalse) {
+          return Center(
+            child: Column(
+              mainAxisSize: MainAxisSize.min,
              children: [
-                if (auth.userProfile.value != null)
-                  const AccountHeading().paddingOnly(bottom: 8, top: 8),
-                ...(actionItems.map(
-                  (x) => ListTile(
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                    leading: x.$1,
-                    title: Text(x.$2),
-                    onTap: () {
-                      AppRouter.instance
-                          .pushNamed(x.$3)
-                          .then((_) => setState(() {}));
-                    },
+                _ActionCard(
+                  icon: Icon(
+                    Icons.login,
+                    color: Theme.of(context).colorScheme.onPrimary,
                  ),
-                )),
-                const Divider(thickness: 0.3, height: 1)
-                    .paddingSymmetric(vertical: 4),
-                ListTile(
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                  leading: const Icon(Icons.settings),
-                  title: Text('settings'.tr),
+                  title: 'signin'.tr,
+                  caption: 'signinCaption'.tr,
                  onTap: () {
-                    AppRouter.instance.pushNamed('settings');
+                    AppRouter.instance.pushNamed('signin').then((val) async {
+                      if (val == true) {
+                        await auth.refreshUserProfile();
+                      }
+                    });
                  },
                ),
-                if (auth.isAuthorized.value)
-                  ListTile(
-                    contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                    leading: const Icon(Icons.edit_notifications),
-                    title: Text('notificationPreferences'.tr),
-                    onTap: () {
-                      AppRouter.instance.pushNamed('notificationPreferences');
-                    },
+                _ActionCard(
+                  icon: Icon(
+                    Icons.add,
+                    color: Theme.of(context).colorScheme.onPrimary,
                  ),
-                const Divider(thickness: 0.3, height: 1)
-                    .paddingSymmetric(vertical: 4),
-                ListTile(
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-                  leading: const Icon(Icons.logout),
-                  title: Text('signout'.tr),
+                  title: 'signup'.tr,
+                  caption: 'signupCaption'.tr,
                  onTap: () {
-                    auth.signout();
-                    setState(() {});
+                    AppRouter.instance.pushNamed('signup').then((_) {
+                      setState(() {});
+                    });
                  },
                ),
+                const Gap(4),
+                TextButton(
+                  style: const ButtonStyle(
+                    visualDensity: VisualDensity(
+                      horizontal: -4,
+                      vertical: -2,
+                    ),
+                  ),
+                  onPressed: () {
+                    AppRouter.instance.pushNamed('settings');
+                  },
+                  child: Text('settings'.tr),
+                ),
              ],
            ),
          );
-        }),
-      ),
+        }
+
+        return CenteredContainer(
+          child: ListView(
+            children: [
+              if (auth.userProfile.value != null)
+                const AccountHeading().paddingOnly(bottom: 8, top: 16),
+              ...(actionItems.map(
+                (x) => ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  leading: x.$1,
+                  title: Text(x.$2),
+                  onTap: () {
+                    AppRouter.instance
+                        .pushNamed(x.$3)
+                        .then((_) => setState(() {}));
+                  },
+                ),
+              )),
+              const Divider(thickness: 0.3, height: 1)
+                  .paddingSymmetric(vertical: 4),
+              ListTile(
+                contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                leading: const Icon(Icons.settings),
+                title: Text('settings'.tr),
+                onTap: () {
+                  AppRouter.instance.pushNamed('settings');
+                },
+              ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.event_repeat),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('auditLog'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('auditLog');
+                  },
+                ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  leading: const Icon(Icons.lock),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  title: Text('authPreferences'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('authPreferences');
+                  },
+                ),
+              if (auth.isAuthorized.value)
+                ListTile(
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                  leading: const Icon(Icons.edit_notifications),
+                  title: Text('notificationPreferences'.tr),
+                  onTap: () {
+                    AppRouter.instance.pushNamed('notificationPreferences');
+                  },
+                ),
+              const Divider(thickness: 0.3, height: 1)
+                  .paddingSymmetric(vertical: 4),
+              ListTile(
+                contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+                leading: const Icon(Icons.logout),
+                title: Text('signout'.tr),
+                onTap: () {
+                  auth.signout();
+                  setState(() {});
+                },
+              ),
+            ],
+          ),
+        );
+      }),
    );
  }
 }
--- a/lib/screens/account/audit_log.dart
+++ b/lib/screens/account/audit_log.dart
@ -0,0 +1,154 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
+import 'package:marquee/marquee.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/audit_log.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/relative_date.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+import 'package:timeline_tile/timeline_tile.dart';
+
+class AuditLogScreen extends StatefulWidget {
+  const AuditLogScreen({super.key});
+
+  @override
+  State<AuditLogScreen> createState() => _AuditLogScreenState();
+}
+
+class _AuditLogScreenState extends State<AuditLogScreen> {
+  bool _isBusy = true;
+
+  final List<AuditEvent> _events = List.empty(growable: true);
+
+  Future<void> _getEvents() async {
+    if (!_isBusy) setState(() => _isBusy = true);
+
+    final AuthProvider auth = Get.find();
+    final client = await auth.configureClient('id');
+    final resp =
+        await client.get('/users/me/events?take=15&offset=${_events.length}');
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    final result = PaginationResult.fromJson(resp.body);
+
+    setState(() {
+      _events.addAll(
+        result.data?.map((x) => AuditEvent.fromJson(x)).toList() ??
+            List.empty(),
+      );
+      _isBusy = false;
+    });
+  }
+
+  bool _showIp = false;
+
+  String _censorIpAddress(String ip) {
+    List<String> parts = ip.split('.');
+
+    if (parts.length == 4) {
+      String censoredPart1 = '*' * parts[1].length;
+      String censoredPart2 = '*' * parts[2].length;
+      String censoredPart3 = '*' * parts[3].length;
+
+      return '${parts[0]}.$censoredPart1.$censoredPart2.$censoredPart3';
+    } else {
+      return '***.***.***.***';
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getEvents();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        CheckboxListTile(
+          value: _showIp,
+          title: Text('showIp'.tr),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          secondary: const Icon(Icons.alternate_email),
+          tileColor:
+              Theme.of(context).colorScheme.surfaceContainer.withOpacity(0.5),
+          onChanged: (val) {
+            setState(() => _showIp = val ?? false);
+          },
+        ),
+        Expanded(
+          child: RefreshIndicator(
+            onRefresh: () {
+              _events.clear();
+              return _getEvents();
+            },
+            child: InfiniteList(
+              padding: const EdgeInsets.symmetric(vertical: 12),
+              itemCount: _events.length,
+              isLoading: _isBusy,
+              onFetchData: () {
+                _getEvents();
+              },
+              itemBuilder: (context, idx) {
+                final element = _events[idx];
+                return TimelineTile(
+                  isFirst: idx == 0,
+                  isLast: _events.length - 1 == idx,
+                  alignment: TimelineAlign.start,
+                  indicatorStyle: IndicatorStyle(width: 15),
+                  endChild: Container(
+                    child: Card(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            element.type,
+                            style: GoogleFonts.robotoMono(fontSize: 15),
+                          ),
+                          Text(
+                            _showIp
+                                ? element.ipAddress
+                                : _censorIpAddress(element.ipAddress),
+                            style: GoogleFonts.sourceCodePro(
+                              fontWeight: FontWeight.bold,
+                            ),
+                          ),
+                          SizedBox(
+                            height: 20,
+                            width: double.maxFinite,
+                            child: Marquee(
+                              text: element.userAgent,
+                              velocity: 25,
+                              startAfter: Duration(milliseconds: 500),
+                              pauseAfterRound: Duration(milliseconds: 3000),
+                            ),
+                          ),
+                          Row(
+                            children: [
+                              RelativeDate(element.createdAt),
+                              const Gap(6),
+                              Text('·'),
+                              const Gap(6),
+                              RelativeDate(element.createdAt, isFull: true),
+                            ],
+                          ),
+                        ],
+                      ).paddingSymmetric(horizontal: 12, vertical: 8),
+                    ).paddingOnly(left: 16),
+                  ),
+                ).paddingSymmetric(horizontal: 18);
+              },
+            ),
+          ),
+        ),
+      ],
+    );
+  }
+}
--- a/lib/screens/account/notification.dart
+++ b/lib/screens/account/notification.dart
@ -1,9 +1,14 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
+import 'package:gap/gap.dart';
 import 'package:get/get.dart';
-import 'package:solian/providers/websocket.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/models/notification.dart' as notify;
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/notifications.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/markdown_text_content.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/relative_date.dart';
 import 'package:uuid/uuid.dart';

 class NotificationScreen extends StatefulWidget {
@ -14,57 +19,9 @@ class NotificationScreen extends StatefulWidget {
 }

 class _NotificationScreenState extends State<NotificationScreen> {
-  bool _isBusy = false;
-
-  Future<void> _markAllRead() async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    setState(() => _isBusy = true);
-
-    final WebSocketProvider provider = Get.find();
-
-    List<int> markList = List.empty(growable: true);
-    for (final element in provider.notifications) {
-      if (element.id <= 0) continue;
-      markList.add(element.id);
-    }
-
-    if (markList.isNotEmpty) {
-      final client = await auth.configureClient('auth');
-      await client.put('/notifications/read', {'messages': markList});
-    }
-
-    provider.notifications.clear();
-
-    setState(() => _isBusy = false);
-  }
-
-  Future<void> _markOneRead(notify.Notification element, int index) async {
-    final AuthProvider auth = Get.find();
-    if (auth.isAuthorized.isFalse) return;
-
-    final WebSocketProvider provider = Get.find();
-
-    if (element.id <= 0) {
-      provider.notifications.removeAt(index);
-      return;
-    }
-
-    setState(() => _isBusy = true);
-
-    final client = await auth.configureClient('auth');
-
-    await client.put('/notifications/read/${element.id}', {});
-
-    provider.notifications.removeAt(index);
-
-    setState(() => _isBusy = false);
-  }
-
  @override
  Widget build(BuildContext context) {
-    final WebSocketProvider ws = Get.find();
+    final NotificationProvider nty = Get.find();

    return SizedBox(
      height: MediaQuery.of(context).size.height * 0.85,
@ -77,71 +34,174 @@ class _NotificationScreenState extends State<NotificationScreen> {
          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
          Expanded(
            child: Obx(() {
-              return CustomScrollView(
-                slivers: [
-                  if (_isBusy)
+              return RefreshIndicator(
+                onRefresh: () => nty.fetchNotification(),
+                child: CustomScrollView(
+                  slivers: [
                    SliverToBoxAdapter(
-                      child: const LinearProgressIndicator().animate().scaleX(),
-                    ),
-                  if (ws.notifications.isEmpty)
-                    SliverToBoxAdapter(
-                      child: Container(
-                        padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color:
-                            Theme.of(context).colorScheme.surfaceContainerHigh,
-                        child: ListTile(
-                          leading: const Icon(Icons.check),
-                          title: Text('notifyEmpty'.tr),
-                          subtitle: Text('notifyEmptyCaption'.tr),
-                        ),
+                      child: LoadingIndicator(
+                        isActive: nty.isBusy.value,
                      ),
                    ),
-                  if (ws.notifications.isNotEmpty)
-                    SliverToBoxAdapter(
-                      child: Container(
-                        padding: const EdgeInsets.symmetric(horizontal: 10),
-                        color: Theme.of(context).colorScheme.secondaryContainer,
-                        child: ListTile(
-                          leading: const Icon(Icons.checklist),
-                          title: Text('notifyAllRead'.tr),
-                          onTap: _isBusy ? null : () => _markAllRead(),
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isEmpty)
+                      SliverToBoxAdapter(
+                        child: Container(
+                          padding: const EdgeInsets.symmetric(horizontal: 10),
+                          color: Theme.of(context)
+                              .colorScheme
+                              .surfaceContainerHigh,
+                          child: ListTile(
+                            leading: const Icon(Icons.check),
+                            title: Text('notifyEmpty'.tr),
+                            subtitle: Text('notifyEmptyCaption'.tr),
+                          ),
                        ),
                      ),
+                    if (nty.notifications
+                        .where((x) => x.readAt == null)
+                        .isNotEmpty)
+                      SliverToBoxAdapter(
+                        child: Container(
+                          padding: const EdgeInsets.symmetric(horizontal: 10),
+                          color:
+                              Theme.of(context).colorScheme.secondaryContainer,
+                          child: ListTile(
+                            leading: const Icon(Icons.checklist),
+                            title: Text('notifyAllRead'.tr),
+                            onTap: nty.isBusy.value
+                                ? null
+                                : () => nty.markAllRead(),
+                          ),
+                        ),
+                      ),
+                    SliverList.separated(
+                      itemCount: nty.notifications.length,
+                      itemBuilder: (BuildContext context, int index) {
+                        var element = nty.notifications[index];
+                        return ClipRect(
+                          child: Dismissible(
+                            direction: element.readAt == null
+                                ? DismissDirection.horizontal
+                                : DismissDirection.none,
+                            key: Key(const Uuid().v4()),
+                            background: Container(
+                              color: Colors.lightBlue,
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
+                              alignment: Alignment.centerLeft,
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
+                            ),
+                            secondaryBackground: Container(
+                              color: Colors.lightBlue,
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 20),
+                              alignment: Alignment.centerRight,
+                              child:
+                                  const Icon(Icons.check, color: Colors.white),
+                            ),
+                            child: Container(
+                              padding: const EdgeInsets.symmetric(
+                                horizontal: 28,
+                                vertical: 16,
+                              ),
+                              child: Row(
+                                crossAxisAlignment: CrossAxisAlignment.start,
+                                children: [
+                                  Icon(NotificationTopicIcons[element.topic]),
+                                  const Gap(16),
+                                  Expanded(
+                                    child: Column(
+                                      crossAxisAlignment:
+                                          CrossAxisAlignment.start,
+                                      children: [
+                                        if (element.readAt == null)
+                                          Badge(
+                                            label: Row(
+                                              children: [
+                                                Icon(
+                                                  Icons.new_releases_outlined,
+                                                  color: Theme.of(context)
+                                                      .colorScheme
+                                                      .onSurface,
+                                                  size: 12,
+                                                ),
+                                                const Gap(4),
+                                                Text('unread'.tr),
+                                              ],
+                                            ),
+                                          ).paddingOnly(bottom: 4),
+                                        Text(
+                                          element.title,
+                                          style: Theme.of(context)
+                                              .textTheme
+                                              .titleMedium,
+                                        ),
+                                        if (element.subtitle != null)
+                                          Text(
+                                            element.subtitle!,
+                                            style: Theme.of(context)
+                                                .textTheme
+                                                .titleSmall,
+                                          ),
+                                        if (element.subtitle != null)
+                                          const Gap(4),
+                                        MarkdownTextContent(
+                                          content: element.body,
+                                          isAutoWarp: true,
+                                          isSelectable: true,
+                                          parentId:
+                                              'notification-${element.id}',
+                                        ),
+                                        if ([
+                                              'interactive.feedback',
+                                              'interactive.subscription'
+                                            ].contains(element.topic) &&
+                                            element.metadata?['related_post'] !=
+                                                null)
+                                          _PostRelatedNotificationWidget(
+                                            metadata: element.metadata!,
+                                          ),
+                                        const Gap(8),
+                                        Opacity(
+                                          opacity: 0.75,
+                                          child: Row(
+                                            children: [
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              Text(
+                                                '·',
+                                                style: TextStyle(fontSize: 12),
+                                              ),
+                                              const Gap(4),
+                                              RelativeDate(
+                                                element.createdAt,
+                                                style: TextStyle(fontSize: 12),
+                                                isFull: true,
+                                              ),
+                                            ],
+                                          ),
+                                        ),
+                                      ],
+                                    ),
+                                  ),
+                                ],
+                              ),
+                            ),
+                            onDismissed: (_) => nty.markOneRead(element, index),
+                          ),
+                        );
+                      },
+                      separatorBuilder: (_, __) =>
+                          const Divider(thickness: 0.3, height: 0.3),
                    ),
-                  SliverList.separated(
-                    itemCount: ws.notifications.length,
-                    itemBuilder: (BuildContext context, int index) {
-                      var element = ws.notifications[index];
-                      return Dismissible(
-                        key: Key(const Uuid().v4()),
-                        background: Container(
-                          color: Colors.lightBlue,
-                          padding: const EdgeInsets.symmetric(horizontal: 20),
-                          alignment: Alignment.centerLeft,
-                          child: const Icon(Icons.check, color: Colors.white),
-                        ),
-                        child: ListTile(
-                          contentPadding: const EdgeInsets.symmetric(
-                            horizontal: 24,
-                            vertical: 8,
-                          ),
-                          title: Text(element.title),
-                          subtitle: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            children: [
-                              if (element.subtitle != null)
-                                Text(element.subtitle!),
-                              Text(element.body),
-                            ],
-                          ),
-                        ),
-                        onDismissed: (_) => _markOneRead(element, index),
-                      );
-                    },
-                    separatorBuilder: (_, __) =>
-                        const Divider(thickness: 0.3, height: 0.3),
-                  ),
-                ],
+                  ],
+                ),
              );
            }),
          ),
@ -156,7 +216,7 @@ class NotificationButton extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    final WebSocketProvider provider = Get.find();
+    final NotificationProvider nty = Get.find();

    final button = IconButton(
      icon: const Icon(Icons.notifications),
@ -166,16 +226,16 @@ class NotificationButton extends StatelessWidget {
          isScrollControlled: true,
          context: context,
          builder: (context) => const NotificationScreen(),
-        ).then((_) => provider.notificationUnread.value = 0);
+        ).then((_) => nty.notificationUnread.value = 0);
      },
    );

    return Obx(() {
-      if (provider.notificationUnread.value > 0) {
+      if (nty.notificationUnread.value > 0) {
        return Badge(
          isLabelVisible: true,
          offset: const Offset(-8, 2),
-          label: Text(provider.notificationUnread.value.toString()),
+          label: Text(nty.notificationUnread.value.toString()),
          child: button,
        );
      } else {
@ -184,3 +244,31 @@ class NotificationButton extends StatelessWidget {
    });
  }
 }
+
+class _PostRelatedNotificationWidget extends StatelessWidget {
+  final Map<String, dynamic> metadata;
+
+  const _PostRelatedNotificationWidget({super.key, required this.metadata});
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: Card(
+        margin: const EdgeInsets.symmetric(vertical: 4),
+        child: PostItem(
+          item: Post.fromJson(metadata['related_post']),
+          isCompact: true,
+        ).paddingAll(8),
+      ),
+      onTap: () {
+        final data = Post.fromJson(metadata['related_post']);
+        Navigator.pop(context);
+        AppRouter.instance.pushNamed(
+          'postDetail',
+          pathParameters: {'id': data.id.toString()},
+          extra: data,
+        );
+      },
+    );
+  }
+}
--- a/lib/screens/account/preferences/notifications.dart
+++ b/lib/screens/account/preferences/notifications.dart
@ -1,12 +1,11 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
 import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exceptions/request.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/widgets/root_container.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class NotificationPreferencesScreen extends StatefulWidget {
  const NotificationPreferencesScreen({super.key});
@ -60,10 +59,10 @@ class _NotificationPreferencesScreenState
    });
    if (resp.statusCode != 200) {
      context.showErrorDialog(RequestException(resp));
+    } else {
+      context.showSnackbar('preferencesApplied'.tr);
    }

-    context.showSnackbar('preferencesApplied'.tr);
-
    setState(() => _isBusy = false);
  }

@ -75,44 +74,42 @@ class _NotificationPreferencesScreenState

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
-      child: Column(
-        children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
-          ListTile(
-            tileColor: Theme.of(context).colorScheme.surfaceContainer,
-            contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-            leading: const Icon(Icons.save),
-            title: Text('save'.tr),
-            enabled: !_isBusy,
-            onTap: () {
-              _savePreferences();
+    return Column(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        ListTile(
+          tileColor: Theme.of(context).colorScheme.surfaceContainer,
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          leading: const Icon(Icons.save),
+          title: Text('save'.tr),
+          enabled: !_isBusy,
+          onTap: () {
+            _savePreferences();
+          },
+        ),
+        Expanded(
+          child: ListView.builder(
+            itemCount: _topicMap.length,
+            itemBuilder: (context, index) {
+              final element = _topicMap.entries.elementAt(index);
+              return CheckboxListTile(
+                title: Text(element.value),
+                subtitle: Text(
+                  element.key,
+                  style: GoogleFonts.robotoMono(fontSize: 12),
+                ),
+                value: _config[element.key] ?? true,
+                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                onChanged: (value) {
+                  setState(() {
+                    _config[element.key] = value ?? false;
+                  });
+                },
+              );
            },
          ),
-          Expanded(
-            child: ListView.builder(
-              itemCount: _topicMap.length,
-              itemBuilder: (context, index) {
-                final element = _topicMap.entries.elementAt(index);
-                return CheckboxListTile(
-                  title: Text(element.value),
-                  subtitle: Text(
-                    element.key,
-                    style: GoogleFonts.robotoMono(fontSize: 12),
-                  ),
-                  value: _config[element.key] ?? true,
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                  onChanged: (value) {
-                    setState(() {
-                      _config[element.key] = value ?? false;
-                    });
-                  },
-                );
-              },
-            ),
-          ),
-        ],
-      ),
+        ),
+      ],
    );
  }
 }
--- a/lib/screens/account/preferences/security.dart
+++ b/lib/screens/account/preferences/security.dart
@ -0,0 +1,118 @@
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:get/get.dart';
+import 'package:get/get_connect/http/src/exceptions/exceptions.dart';
+import 'package:solian/exceptions/request.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+
+class AuthPreferencesScreen extends StatefulWidget {
+  const AuthPreferencesScreen({super.key});
+
+  @override
+  State<AuthPreferencesScreen> createState() => _AuthPreferencesScreenState();
+}
+
+class _AuthPreferencesScreenState extends State<AuthPreferencesScreen> {
+  bool _isBusy = true;
+
+  Map<String, dynamic> _config = {
+    'maximum_auth_steps': 2,
+  };
+
+  Future<void> _getPreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.get('/preferences/auth');
+    if (resp.statusCode != 200 && resp.statusCode != 404) {
+      context.showErrorDialog(RequestException(resp));
+    }
+
+    if (resp.statusCode == 200) {
+      _config = resp.body;
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _savePreferences() async {
+    setState(() => _isBusy = true);
+
+    final auth = Get.find<AuthProvider>();
+    if (!auth.isAuthorized.value) throw UnauthorizedException();
+
+    final client = await auth.configureClient('id');
+    final resp = await client.put('/preferences/auth', _config);
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(RequestException(resp));
+    } else {
+      context.showSnackbar('preferencesApplied'.tr);
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPreferences();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        ListTile(
+          tileColor: Theme.of(context).colorScheme.surfaceContainer,
+          contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+          leading: const Icon(Icons.save),
+          title: Text('save'.tr),
+          enabled: !_isBusy,
+          onTap: () {
+            _savePreferences();
+          },
+        ),
+        Expanded(
+          child: ListView(
+            children: [
+              ListTile(
+                title: Text('authMaximumAuthSteps'.tr),
+                subtitle: Text('authMaximumAuthStepsDesc'.tr),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+                trailing: SizedBox(
+                  width: 60,
+                  child: _isBusy
+                      ? null
+                      : TextFormField(
+                          decoration: InputDecoration(
+                            border: const OutlineInputBorder(),
+                            isDense: true,
+                          ),
+                          initialValue:
+                              _config['maximum_auth_steps']?.toString() ?? '2',
+                          keyboardType: TextInputType.number,
+                          inputFormatters: [
+                            FilteringTextInputFormatter.digitsOnly
+                          ],
+                          onTapOutside: (_) =>
+                              FocusManager.instance.primaryFocus?.unfocus(),
+                          onChanged: (value) {
+                            _config['maximum_auth_steps'] =
+                                int.tryParse(value) ?? 2;
+                          },
+                        ),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+}
--- a/lib/screens/account/profile_edit.dart
+++ b/lib/screens/account/profile_edit.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
@ -12,7 +11,7 @@ import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/root_container.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class PersonalizeScreen extends StatefulWidget {
  const PersonalizeScreen({super.key});
@ -187,163 +186,161 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
  Widget build(BuildContext context) {
    const double padding = 32;

-    return RootContainer(
-      child: ListView(
-        children: [
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
-          const Gap(24),
-          Stack(
-            children: [
-              AccountAvatar(content: _avatar, radius: 40),
-              Positioned(
-                bottom: 0,
-                left: 40,
-                child: FloatingActionButton.small(
-                  heroTag: const Key('avatar-editor'),
-                  onPressed: () => _editImage('avatar'),
-                  child: const Icon(
-                    Icons.camera,
-                  ),
+    return ListView(
+      children: [
+        LoadingIndicator(isActive: _isBusy),
+        const Gap(24),
+        Stack(
+          children: [
+            AttachedCircleAvatar(content: _avatar, radius: 40),
+            Positioned(
+              bottom: 0,
+              left: 40,
+              child: FloatingActionButton.small(
+                heroTag: const Key('avatar-editor'),
+                onPressed: () => _editImage('avatar'),
+                child: const Icon(
+                  Icons.camera,
                ),
              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Stack(
-            children: [
-              ClipRRect(
-                borderRadius: const BorderRadius.all(Radius.circular(8)),
-                child: AspectRatio(
-                  aspectRatio: 16 / 9,
-                  child: Container(
-                    color: Theme.of(context).colorScheme.surfaceContainerHigh,
-                    child: _banner != null
-                        ? Image.network(
-                            ServiceFinder.buildUrl(
-                                'files', '/attachments/$_banner'),
-                            fit: BoxFit.cover,
-                            loadingBuilder: (BuildContext context, Widget child,
-                                ImageChunkEvent? loadingProgress) {
-                              if (loadingProgress == null) return child;
-                              return Center(
-                                child: CircularProgressIndicator(
-                                  value: loadingProgress.expectedTotalBytes !=
-                                          null
-                                      ? loadingProgress.cumulativeBytesLoaded /
-                                          loadingProgress.expectedTotalBytes!
-                                      : null,
-                                ),
-                              );
-                            },
-                          )
-                        : Container(),
-                  ),
-                ),
-              ),
-              Positioned(
-                bottom: 16,
-                right: 16,
-                child: FloatingActionButton(
-                  heroTag: const Key('banner-editor'),
-                  onPressed: () => _editImage('banner'),
-                  child: const Icon(
-                    Icons.camera_alt,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(24),
-          Row(
-            children: [
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  readOnly: true,
-                  controller: _usernameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'username'.tr,
-                    prefixText: '@',
-                  ),
-                ),
-              ),
-              const Gap(16),
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _nicknameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'nickname'.tr,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Row(
-            children: [
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _firstNameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'firstName'.tr,
-                  ),
-                ),
-              ),
-              const Gap(16),
-              Flexible(
-                flex: 1,
-                child: TextField(
-                  controller: _lastNameController,
-                  decoration: InputDecoration(
-                    border: const OutlineInputBorder(),
-                    labelText: 'lastName'.tr,
-                  ),
-                ),
-              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          TextField(
-            controller: _descriptionController,
-            keyboardType: TextInputType.multiline,
-            maxLines: null,
-            minLines: 3,
-            decoration: InputDecoration(
-              border: const OutlineInputBorder(),
-              labelText: 'description'.tr,
            ),
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          TextField(
-            controller: _birthdayController,
-            readOnly: true,
-            decoration: InputDecoration(
-              border: const OutlineInputBorder(),
-              labelText: 'birthday'.tr,
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Stack(
+          children: [
+            ClipRRect(
+              borderRadius: const BorderRadius.all(Radius.circular(8)),
+              child: AspectRatio(
+                aspectRatio: 16 / 9,
+                child: Container(
+                  color: Theme.of(context).colorScheme.surfaceContainerHigh,
+                  child: _banner != null
+                      ? Image.network(
+                          ServiceFinder.buildUrl(
+                              'files', '/attachments/$_banner'),
+                          fit: BoxFit.cover,
+                          loadingBuilder: (BuildContext context, Widget child,
+                              ImageChunkEvent? loadingProgress) {
+                            if (loadingProgress == null) return child;
+                            return Center(
+                              child: CircularProgressIndicator(
+                                value: loadingProgress.expectedTotalBytes !=
+                                        null
+                                    ? loadingProgress.cumulativeBytesLoaded /
+                                        loadingProgress.expectedTotalBytes!
+                                    : null,
+                              ),
+                            );
+                          },
+                        )
+                      : Container(),
+                ),
+              ),
            ),
-            onTap: () => _selectBirthday(),
-          ).paddingSymmetric(horizontal: padding),
-          const Gap(16),
-          Row(
-            mainAxisAlignment: MainAxisAlignment.end,
-            children: [
-              TextButton(
-                onPressed: _isBusy ? null : () => _syncWidget(),
-                child: Text('reset'.tr),
+            Positioned(
+              bottom: 16,
+              right: 16,
+              child: FloatingActionButton(
+                heroTag: const Key('banner-editor'),
+                onPressed: () => _editImage('banner'),
+                child: const Icon(
+                  Icons.camera_alt,
+                ),
              ),
-              ElevatedButton(
-                onPressed: _isBusy ? null : () => _editUserInfo(),
-                child: Text('apply'.tr),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(24),
+        Row(
+          children: [
+            Flexible(
+              flex: 1,
+              child: TextField(
+                readOnly: true,
+                controller: _usernameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'username'.tr,
+                  prefixText: '@',
+                ),
              ),
-            ],
-          ).paddingSymmetric(horizontal: padding),
-        ],
-      ),
+            ),
+            const Gap(16),
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _nicknameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'nickname'.tr,
+                ),
+              ),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Row(
+          children: [
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _firstNameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'firstName'.tr,
+                ),
+              ),
+            ),
+            const Gap(16),
+            Flexible(
+              flex: 1,
+              child: TextField(
+                controller: _lastNameController,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'lastName'.tr,
+                ),
+              ),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        TextField(
+          controller: _descriptionController,
+          keyboardType: TextInputType.multiline,
+          maxLines: null,
+          minLines: 3,
+          decoration: InputDecoration(
+            border: const OutlineInputBorder(),
+            labelText: 'description'.tr,
+          ),
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        TextField(
+          controller: _birthdayController,
+          readOnly: true,
+          decoration: InputDecoration(
+            border: const OutlineInputBorder(),
+            labelText: 'birthday'.tr,
+          ),
+          onTap: () => _selectBirthday(),
+        ).paddingSymmetric(horizontal: padding),
+        const Gap(16),
+        Row(
+          mainAxisAlignment: MainAxisAlignment.end,
+          children: [
+            TextButton(
+              onPressed: _isBusy ? null : () => _syncWidget(),
+              child: Text('reset'.tr),
+            ),
+            ElevatedButton(
+              onPressed: _isBusy ? null : () => _editUserInfo(),
+              child: Text('apply'.tr),
+            ),
+          ],
+        ).paddingSymmetric(horizontal: padding),
+      ],
    );
  }

--- a/lib/screens/account/profile_page.dart
+++ b/lib/screens/account/profile_page.dart
@ -26,7 +26,6 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/daily_sign/history_chart.dart';
 import 'package:solian/widgets/posts/post_list.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
 import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
@ -231,7 +230,11 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
  @override
  Widget build(BuildContext context) {
    if (_isBusy || _userinfo == null) {
-      return const Center(child: CircularProgressIndicator());
+      return RootContainer(
+        child: const Center(
+          child: CircularProgressIndicator(),
+        ),
+      );
    }

    return RootContainer(
@ -250,10 +253,15 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                  height: 56,
                  child: Row(
                    children: [
-                      AppBarLeadingButton.adaptive(context) ?? const Gap(8),
+                      AppBarLeadingButton.adaptive(
+                            context,
+                            forceBack: true,
+                          ) ??
+                          const Gap(8),
                      const Gap(8),
                      if (_userinfo != null)
-                        AccountAvatar(content: _userinfo!.avatar, radius: 16),
+                        AttachedCircleAvatar(
+                            content: _userinfo!.avatar, radius: 16),
                      const Gap(12),
                      Expanded(
                        child: Column(
@ -340,7 +348,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                      detail: _userinfo,
                      profile: _userinfo!.profile,
                      extraWidgets: [
-                        if (_dailySignRecords.isNotEmpty)
+                        if (_dailySignRecords.length > 1)
                          Card(
                            child: SizedBox(
                              height: 180,
@ -580,8 +588,6 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                        color:
                            Theme.of(context).colorScheme.surfaceContainerLow,
                        child: PostListEntryWidget(
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surfaceContainerLow,
                          item: element,
                          isClickable: true,
                          isNestedClickable: true,
@ -601,7 +607,7 @@ class _AccountProfilePageState extends State<AccountProfilePage> {
                      child: Center(child: CircularProgressIndicator()),
                    ),
                  if (_userinfo != null)
-                    PostWarpedListWidget(
+                    ControlledPostListWidget(
                      isPinned: false,
                      controller: _postController.pagingController,
                      onUpdate: () => _postController.reloadAllOver(),
--- a/lib/screens/auth/signin.dart
+++ b/lib/screens/auth/signin.dart
@ -8,10 +8,9 @@ import 'package:solian/exts.dart';
 import 'package:solian/models/auth.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/providers/relation.dart';
-import 'package:solian/providers/websocket.dart';
 import 'package:solian/services.dart';
-import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';

@ -179,7 +178,7 @@ class _SignInScreenState extends State<SignInScreen> {

          Get.find<RealmProvider>().refreshAvailableRealms();
          Get.find<RelationshipProvider>().refreshRelativeList();
-          Get.find<WebSocketProvider>().registerPushNotifications();
+          Get.find<NotificationProvider>().registerPushNotifications();
          autoConfigureBackgroundNotificationService();
          autoStartBackgroundNotificationService();

@ -217,9 +216,10 @@ class _SignInScreenState extends State<SignInScreen> {

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
-      child: CenteredContainer(
-        maxWidth: 360,
+    return CenteredContainer(
+      maxWidth: 360,
+      child: Theme(
+        data: Theme.of(context).copyWith(canvasColor: Colors.transparent),
        child: PageTransitionSwitcher(
          transitionBuilder: (
            Widget child,
--- a/lib/screens/auth/signup.dart
+++ b/lib/screens/auth/signup.dart
@ -3,7 +3,6 @@ import 'package:gap/gap.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/services.dart';
-import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';
 import 'package:url_launcher/url_launcher_string.dart';

@ -66,147 +65,141 @@ class _SignUpScreenState extends State<SignUpScreen> {

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
-      child: CenteredContainer(
-        maxWidth: 360,
-        child: ListView(
-          shrinkWrap: true,
-          children: [
-            Align(
-              alignment: Alignment.centerLeft,
-              child: ClipRRect(
-                borderRadius: const BorderRadius.all(Radius.circular(8)),
-                child: Image.asset('assets/logo.png', width: 64, height: 64),
-              ).paddingOnly(bottom: 8, left: 4),
+    return CenteredContainer(
+      maxWidth: 360,
+      child: ListView(
+        shrinkWrap: true,
+        children: [
+          Align(
+            alignment: Alignment.centerLeft,
+            child: ClipRRect(
+              borderRadius: const BorderRadius.all(Radius.circular(8)),
+              child: Image.asset('assets/logo.png', width: 64, height: 64),
+            ).paddingOnly(bottom: 8, left: 4),
+          ),
+          Text(
+            'signupGreeting'.tr,
+            style: const TextStyle(
+              fontSize: 28,
+              fontWeight: FontWeight.w900,
            ),
-            Text(
-              'signupGreeting'.tr,
-              style: const TextStyle(
-                fontSize: 28,
-                fontWeight: FontWeight.w900,
-              ),
-            ).paddingOnly(left: 4, bottom: 16),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _usernameController,
-              autofillHints: const [AutofillHints.username],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'username'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+          ).paddingOnly(left: 4, bottom: 16),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _usernameController,
+            autofillHints: const [AutofillHints.username],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'username'.tr,
            ),
-            const Gap(12),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _nicknameController,
-              autofillHints: const [AutofillHints.nickname],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'nickname'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _nicknameController,
+            autofillHints: const [AutofillHints.nickname],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'nickname'.tr,
            ),
-            const Gap(12),
-            TextField(
-              autocorrect: false,
-              enableSuggestions: false,
-              controller: _emailController,
-              autofillHints: const [AutofillHints.email],
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'email'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            autocorrect: false,
+            enableSuggestions: false,
+            controller: _emailController,
+            autofillHints: const [AutofillHints.email],
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'email'.tr,
            ),
-            const Gap(12),
-            TextField(
-              obscureText: true,
-              autocorrect: false,
-              enableSuggestions: false,
-              autofillHints: const [AutofillHints.password],
-              controller: _passwordController,
-              decoration: InputDecoration(
-                isDense: true,
-                border: const OutlineInputBorder(),
-                labelText: 'password'.tr,
-              ),
-              onTapOutside: (_) =>
-                  FocusManager.instance.primaryFocus?.unfocus(),
-              onSubmitted: (_) => _performAction(context),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+          ),
+          const Gap(12),
+          TextField(
+            obscureText: true,
+            autocorrect: false,
+            enableSuggestions: false,
+            autofillHints: const [AutofillHints.password],
+            controller: _passwordController,
+            decoration: InputDecoration(
+              isDense: true,
+              border: const OutlineInputBorder(),
+              labelText: 'password'.tr,
            ),
-            const Gap(8),
-            CheckboxListTile(
-              value: _isTermAccepted,
-              title: Text(
-                'termAccept'.tr,
-                style: const TextStyle(height: 1.2),
-              ).paddingOnly(bottom: 4),
-              shape: const RoundedRectangleBorder(
-                borderRadius: BorderRadius.all(
-                  Radius.circular(8),
-                ),
+            onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+            onSubmitted: (_) => _performAction(context),
+          ),
+          const Gap(8),
+          CheckboxListTile(
+            value: _isTermAccepted,
+            title: Text(
+              'termAccept'.tr,
+              style: const TextStyle(height: 1.2),
+            ).paddingOnly(bottom: 4),
+            shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(
+                Radius.circular(8),
              ),
-              subtitle: RichText(
-                text: TextSpan(
-                  style: Theme.of(context).textTheme.bodySmall!.copyWith(
-                        color: Theme.of(context)
-                            .colorScheme
-                            .onSurface
-                            .withOpacity(0.75),
-                      ),
-                  children: [
-                    TextSpan(text: 'termAcceptDesc'.tr),
-                    WidgetSpan(
-                      child: Material(
-                        color: Colors.transparent,
-                        child: InkWell(
-                          child: Row(
-                            mainAxisSize: MainAxisSize.min,
-                            children: [
-                              Text('termAcceptLink'.tr),
-                              const Gap(4),
-                              const Icon(Icons.launch, size: 14),
-                            ],
-                          ),
-                          onTap: () {
-                            launchUrlString('https://solsynth.dev/terms');
-                          },
+            ),
+            subtitle: RichText(
+              text: TextSpan(
+                style: Theme.of(context).textTheme.bodySmall!.copyWith(
+                      color: Theme.of(context)
+                          .colorScheme
+                          .onSurface
+                          .withOpacity(0.75),
+                    ),
+                children: [
+                  TextSpan(text: 'termAcceptDesc'.tr),
+                  WidgetSpan(
+                    child: Material(
+                      color: Colors.transparent,
+                      child: InkWell(
+                        child: Row(
+                          mainAxisSize: MainAxisSize.min,
+                          children: [
+                            Text('termAcceptLink'.tr),
+                            const Gap(4),
+                            const Icon(Icons.launch, size: 14),
+                          ],
                        ),
+                        onTap: () {
+                          launchUrlString('https://solsynth.dev/terms');
+                        },
                      ),
                    ),
-                  ],
-                ),
+                  ),
+                ],
              ),
-              onChanged: (value) {
-                setState(() => _isTermAccepted = value ?? false);
-              },
            ),
-            const Gap(16),
-            Align(
-              alignment: Alignment.centerRight,
-              child: TextButton(
-                onPressed:
-                    !_isTermAccepted ? null : () => _performAction(context),
-                child: Row(
-                  mainAxisSize: MainAxisSize.min,
-                  children: [
-                    Text('next'.tr),
-                    const Icon(Icons.chevron_right),
-                  ],
-                ),
+            onChanged: (value) {
+              setState(() => _isTermAccepted = value ?? false);
+            },
+          ),
+          const Gap(16),
+          Align(
+            alignment: Alignment.centerRight,
+            child: TextButton(
+              onPressed:
+                  !_isTermAccepted ? null : () => _performAction(context),
+              child: Row(
+                mainAxisSize: MainAxisSize.min,
+                children: [
+                  Text('next'.tr),
+                  const Icon(Icons.chevron_right),
+                ],
              ),
-            )
-          ],
-        ),
+            ),
+          )
+        ],
      ).paddingAll(24),
    );
  }
--- a/lib/screens/channel/call/call.dart
+++ b/lib/screens/channel/call/call.dart
@ -198,7 +198,7 @@ class _CallScreenState extends State<CallScreen> with TickerProviderStateMixin {
  Widget build(BuildContext context) {
    final ChatCallProvider ctrl = Get.find();

-    return RootContainer(
+    return ResponsiveRootContainer(
      child: Scaffold(
        appBar: widget.hideAppBar
            ? null
--- a/lib/screens/channel/channel_chat.dart
+++ b/lib/screens/channel/channel_chat.dart
@ -218,7 +218,7 @@ class _ChannelChatScreenState extends State<ChannelChatScreen>
      );
    }

-    return RootContainer(
+    return ResponsiveRootContainer(
      child: Scaffold(
        appBar: AppBar(
          leading: AppBarLeadingButton.adaptive(context),
--- a/lib/screens/channel/channel_organize.dart
+++ b/lib/screens/channel/channel_organize.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@ -9,6 +8,7 @@ import 'package:solian/providers/content/channel.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';

@ -115,7 +115,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
      ),
    ];

-    return RootContainer(
+    return ResponsiveRootContainer(
      child: Scaffold(
        appBar: AppBar(
          title: AppBarTitle('channelOrganizing'.tr),
@ -132,7 +132,7 @@ class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
          top: false,
          child: Column(
            children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
              if (widget.edit != null)
                MaterialBanner(
                  leading: const Icon(Icons.edit),
--- a/lib/screens/chat.dart
+++ b/lib/screens/chat.dart
@ -1,4 +1,5 @@
 import 'package:flutter/material.dart';
+import 'package:flutter_resizable_container/flutter_resizable_container.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
@ -19,6 +20,7 @@ import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/channel/channel_list.dart';
 import 'package:solian/widgets/chat/call/chat_call_indicator.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sidebar/empty_placeholder.dart';

@ -27,7 +29,7 @@ class ChatScreen extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    return const RootContainer(
+    return const ResponsiveRootContainer(
      child: ChatList(),
    );
  }
@ -41,14 +43,23 @@ class ChatListShell extends StatelessWidget {
  @override
  Widget build(BuildContext context) {
    return RootContainer(
-      child: Row(
+      child: ResizableContainer(
+        direction: Axis.horizontal,
+        divider: ResizableDivider(
+          thickness: 0.3,
+          color: Theme.of(context).dividerColor.withOpacity(0.3),
+        ),
        children: [
-          const SizedBox(
-            width: 360,
+          const ResizableChild(
+            minSize: 280,
+            maxSize: 520,
+            size: ResizableSize.pixels(360),
            child: ChatList(),
          ),
-          const VerticalDivider(thickness: 0.3, width: 0.3),
-          Expanded(child: child ?? const EmptyPagePlaceholder()),
+          ResizableChild(
+            minSize: 280,
+            child: child ?? const EmptyPagePlaceholder(),
+          ),
        ],
      ),
    );
@ -69,6 +80,8 @@ class _ChatListState extends State<ChatList> {

  late final ChannelProvider _channels = Get.find();

+  bool _isBusy = true;
+
  List<Channel> _sortChannels(List<Channel> channels) {
    channels.sort(
      (a, b) =>
@ -117,18 +130,25 @@ class _ChatListState extends State<ChatList> {
    final ctrl = ChatEventController();
    await ctrl.initialize();
    final messages = await ctrl.src.getLastInAllChannels();
-    setState(() {
-      _lastMessages = messages
-          .map((k, v) => MapEntry(k, v.firstOrNull))
-          .cast<int, LocalMessageEventTableData>();
-    });
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
+    }
  }

  @override
  void initState() {
    super.initState();
    _loadLastMessages().then((_) {
-      _loadAllChannels();
+      if (!mounted) return;
+      _loadAllChannels().then((_) {
+        if (mounted) {
+          setState(() => _isBusy = false);
+        }
+      });
    });
  }

@ -140,19 +160,10 @@ class _ChatListState extends State<ChatList> {
    return Obx(
      () => DefaultTabController(
        length: 2 + realms.availableRealms.length,
-        child: RootContainer(
+        child: ResponsiveRootContainer(
          child: Scaffold(
            appBar: AppBar(
-              leading: Obx(() {
-                final adaptive = AppBarLeadingButton.adaptive(context);
-                if (adaptive != null) return adaptive;
-                if (_channels.isLoading.value) {
-                  return const CircularProgressIndicator(
-                    strokeWidth: 3,
-                  ).paddingAll(18);
-                }
-                return const SizedBox.shrink();
-              }),
+              leading: AppBarLeadingButton.adaptive(context),
              title: AppBarTitle('chat'.tr),
              centerTitle: true,
              toolbarHeight: AppTheme.toolbarHeight(context),
@ -252,7 +263,7 @@ class _ChatListState extends State<ChatList> {
                        child: Row(
                          mainAxisSize: MainAxisSize.min,
                          children: [
-                            AccountAvatar(
+                            AttachedCircleAvatar(
                              content: x.avatar,
                              radius: 14,
                              fallbackWidget: const Icon(
@ -280,6 +291,7 @@ class _ChatListState extends State<ChatList> {
              return Column(
                children: [
                  const ChatCallCurrentIndicator(),
+                  LoadingIndicator(isActive: _isBusy),
                  Expanded(
                    child: TabBarView(
                      children: [
--- a/lib/screens/dashboard.dart
+++ b/lib/screens/dashboard.dart
@ -20,7 +20,7 @@ import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/daily_sign.dart';
 import 'package:solian/providers/database/services/messages.dart';
 import 'package:solian/providers/last_read.dart';
-import 'package:solian/providers/websocket.dart';
+import 'package:solian/providers/notifications.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/account/notification.dart';
 import 'package:solian/theme.dart';
@ -38,7 +38,7 @@ class DashboardScreen extends StatefulWidget {
 class _DashboardScreenState extends State<DashboardScreen> {
  late final AuthProvider _auth = Get.find();
  late final LastReadProvider _lastRead = Get.find();
-  late final WebSocketProvider _ws = Get.find();
+  late final NotificationProvider _nty = Get.find();
  late final PostProvider _posts = Get.find();
  late final DailySignProvider _dailySign = Get.find();

@ -46,7 +46,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);

  List<Notification> get _pendingNotifications =>
-      List<Notification>.from(_ws.notifications)
+      List<Notification>.from(_nty.notifications.where((x) => x.readAt == null))
        ..sort((a, b) => b.createdAt.compareTo(a.createdAt));

  List<Post>? _currentPosts;
@ -75,10 +75,12 @@ class _DashboardScreenState extends State<DashboardScreen> {
    final src = Get.find<MessagesFetchingProvider>();
    final out = await src.getWhatsNewEvents(_lastRead.messagesLastReadAt!);
    if (out == null) return;
-    setState(() {
-      _currentMessages = out.$1;
-      _currentMessagesCount = out.$2;
-    });
+    if (mounted) {
+      setState(() {
+        _currentMessages = out.$1;
+        _currentMessagesCount = out.$2;
+      });
+    }
  }

  bool _signingDaily = true;
@ -89,13 +91,17 @@ class _DashboardScreenState extends State<DashboardScreen> {
    try {
      _signRecord = await _dailySign.getToday();
      _dailySign.listLastRecord(14).then((value) {
-        setState(() => _signRecordHistory = value);
+        if (mounted) {
+          setState(() => _signRecordHistory = value);
+        }
      });
    } catch (e) {
      context.showErrorDialog(e);
    }

-    setState(() => _signingDaily = false);
+    if (mounted) {
+      setState(() => _signingDaily = false);
+    }
  }

  Future<void> _signDaily() async {
@ -147,7 +153,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
              ),
              Text(DateFormat('yyyy/MM/dd').format(DateTime.now().toUtc())),
            ],
-          ).paddingOnly(top: 8, left: 18, right: 18, bottom: 12),
+          ).paddingOnly(top: 16, left: 18, right: 18, bottom: 12),
          Card(
            child: Column(
              children: [
@ -248,7 +254,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                        ),
                        Text(
                          'notificationUnreadCount'.trParams({
-                            'count': _ws.notifications.length.toString(),
+                            'count': _pendingNotifications.length.toString(),
                          }),
                        ),
                      ],
@ -261,12 +267,12 @@ class _DashboardScreenState extends State<DashboardScreen> {
                          isScrollControlled: true,
                          context: context,
                          builder: (context) => const NotificationScreen(),
-                        ).then((_) => _ws.notificationUnread.value = 0);
+                        ).then((_) => _nty.notificationUnread.value = 0);
                      },
                    ),
                  ],
                ).paddingOnly(left: 18, right: 18, bottom: 8),
-                if (_ws.notifications.isNotEmpty)
+                if (_pendingNotifications.isNotEmpty)
                  SizedBox(
                    height: 76,
                    child: ListView.separated(
@ -383,9 +389,10 @@ class _DashboardScreenState extends State<DashboardScreen> {
                                onUpdate: (_) {
                                  _pullPosts();
                                },
-                                backgroundColor: Theme.of(context)
-                                    .colorScheme
-                                    .surfaceContainerLow,
+                                padding: EdgeInsets.symmetric(
+                                  vertical: 8,
+                                  horizontal: 4,
+                                ),
                              ),
                            ),
                          ),
@ -519,7 +526,7 @@ class _DashboardScreenState extends State<DashboardScreen> {
                style: TextStyle(color: _unFocusColor, fontSize: 12),
              )
            ],
-          ).paddingAll(8),
+          ).paddingOnly(left: 8, right: 8, top: 8, bottom: 50),
        ],
      ),
    );
--- a/lib/screens/explore.dart
+++ b/lib/screens/explore.dart
@ -1,4 +1,5 @@
 import 'dart:async';
+import 'dart:ui';

 import 'package:flutter/material.dart';
 import 'package:gap/gap.dart';
@ -13,8 +14,9 @@ import 'package:solian/widgets/account/signin_required_overlay.dart';
 import 'package:solian/widgets/current_state_action.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/navigation/realm_switcher.dart';
+import 'package:solian/widgets/posts/post_creation.dart';
+import 'package:solian/widgets/posts/post_list.dart';
 import 'package:solian/widgets/posts/post_shuffle_swiper.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
 import 'package:solian/widgets/root_container.dart';

 class ExploreScreen extends StatefulWidget {
@ -80,62 +82,98 @@ class _ExploreScreenState extends State<ExploreScreen>
        body: NestedScrollView(
          headerSliverBuilder: (BuildContext context, bool innerBoxIsScrolled) {
            return [
-              SliverAppBar(
-                flexibleSpace: SizedBox(
-                  height: 48,
-                  child: const Row(
-                    children: [
-                      RealmSwitcher(),
+              SliverLayoutBuilder(
+                builder: (context, constraints) {
+                  final scrollOffset = constraints.scrollOffset;
+                  final colorChangeOffset = 120;
+
+                  final scrollProgress =
+                      (scrollOffset / colorChangeOffset).clamp(0.0, 1.0);
+                  final blurSigma = lerpDouble(0, 10, scrollProgress) ?? 0;
+
+                  return SliverAppBar(
+                    flexibleSpace: ClipRRect(
+                      child: BackdropFilter(
+                        filter: ImageFilter.blur(
+                          sigmaX: blurSigma,
+                          sigmaY: blurSigma,
+                        ),
+                        child: ListView(
+                          padding: EdgeInsets.zero,
+                          physics: const NeverScrollableScrollPhysics(),
+                          children: [
+                            SizedBox(
+                              height: 48,
+                              child: const Row(
+                                children: [
+                                  RealmSwitcher(),
+                                ],
+                              ).paddingSymmetric(horizontal: 8),
+                            ).paddingSymmetric(vertical: 4),
+                            TabBar(
+                              controller: _tabController,
+                              dividerHeight: scrollProgress > 0 ? 0 : 0.3,
+                              tabAlignment: TabAlignment.fill,
+                              tabs: [
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.feed, size: 20),
+                                      const Gap(8),
+                                      Text('postListNews'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(Icons.people, size: 20),
+                                      const Gap(8),
+                                      Text('postListFriends'.tr),
+                                    ],
+                                  ),
+                                ),
+                                Tab(
+                                  child: Row(
+                                    mainAxisSize: MainAxisSize.min,
+                                    children: [
+                                      const Icon(
+                                        Icons.shuffle_on_outlined,
+                                        size: 20,
+                                      ),
+                                      const Gap(8),
+                                      Text('postListShuffle'.tr),
+                                    ],
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ],
+                        ).paddingOnly(top: MediaQuery.of(context).padding.top),
+                      ),
+                    ),
+                    expandedHeight: 104,
+                    snap: true,
+                    floating: true,
+                    toolbarHeight: AppTheme.toolbarHeight(context),
+                    leading: AppBarLeadingButton.adaptive(context),
+                    actions: [
+                      const BackgroundStateWidget(),
+                      IconButton(
+                        icon: const Icon(Icons.search),
+                        onPressed: () {
+                          AppRouter.instance.pushNamed('postSearch');
+                        },
+                      ),
+                      const NotificationButton(),
+                      SizedBox(
+                        width: AppTheme.isLargeScreen(context) ? 8 : 16,
+                      ),
                    ],
-                  ).paddingSymmetric(horizontal: 8),
-                ).paddingOnly(top: MediaQuery.of(context).padding.top),
-                floating: true,
-                toolbarHeight: AppTheme.toolbarHeight(context),
-                leading: AppBarLeadingButton.adaptive(context),
-                actions: [
-                  const BackgroundStateWidget(),
-                  const NotificationButton(),
-                  SizedBox(
-                    width: AppTheme.isLargeScreen(context) ? 8 : 16,
-                  ),
-                ],
-                bottom: TabBar(
-                  controller: _tabController,
-                  dividerHeight: 0.3,
-                  tabAlignment: TabAlignment.fill,
-                  tabs: [
-                    Tab(
-                      child: Row(
-                        mainAxisSize: MainAxisSize.min,
-                        children: [
-                          const Icon(Icons.feed, size: 20),
-                          const Gap(8),
-                          Text('postListNews'.tr),
-                        ],
-                      ),
-                    ),
-                    Tab(
-                      child: Row(
-                        mainAxisSize: MainAxisSize.min,
-                        children: [
-                          const Icon(Icons.people, size: 20),
-                          const Gap(8),
-                          Text('postListFriends'.tr),
-                        ],
-                      ),
-                    ),
-                    Tab(
-                      child: Row(
-                        mainAxisSize: MainAxisSize.min,
-                        children: [
-                          const Icon(Icons.shuffle_on_outlined, size: 20),
-                          const Gap(8),
-                          Text('postListShuffle'.tr),
-                        ],
-                      ),
-                    ),
-                  ],
-                ),
+                  );
+                },
              )
            ];
          },
@ -156,7 +194,13 @@ class _ExploreScreenState extends State<ExploreScreen>
                      RefreshIndicator(
                        onRefresh: () => _postController.reloadAllOver(),
                        child: CustomScrollView(slivers: [
-                          PostWarpedListWidget(
+                          ControlledPostListWidget(
+                            padding: AppTheme.isLargeScreen(context)
+                                ? EdgeInsets.symmetric(
+                                    horizontal: 4,
+                                    vertical: 8,
+                                  )
+                                : EdgeInsets.zero,
                            controller: _postController.pagingController,
                            onUpdate: () => _postController.reloadAllOver(),
                          ),
@ -167,7 +211,10 @@ class _ExploreScreenState extends State<ExploreScreen>
                          return RefreshIndicator(
                            onRefresh: () => _postController.reloadAllOver(),
                            child: CustomScrollView(slivers: [
-                              PostWarpedListWidget(
+                              ControlledPostListWidget(
+                                padding: AppTheme.isLargeScreen(context)
+                                    ? EdgeInsets.symmetric(horizontal: 16)
+                                    : EdgeInsets.zero,
                                controller: _postController.pagingController,
                                onUpdate: () => _postController.reloadAllOver(),
                              ),
@ -202,106 +249,3 @@ class _ExploreScreenState extends State<ExploreScreen>
    super.dispose();
  }
 }
-
-class PostCreatePopup extends StatelessWidget {
-  final bool hideDraftBox;
-
-  const PostCreatePopup({
-    super.key,
-    this.hideDraftBox = false,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    final AuthProvider auth = Get.find();
-
-    if (auth.isAuthorized.isFalse) {
-      return const SizedBox.shrink();
-    }
-
-    final List<dynamic> actionList = [
-      (
-        icon: const Icon(Icons.post_add),
-        label: 'postEditorModeStory'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 0.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.description),
-        label: 'postEditorModeArticle'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed(
-              'postEditor',
-              queryParameters: {
-                'mode': 1.toString(),
-              },
-            ),
-          );
-        },
-      ),
-      (
-        icon: const Icon(Icons.drafts),
-        label: 'draftBoxOpen'.tr,
-        onTap: () {
-          Navigator.pop(
-            context,
-            AppRouter.instance.pushNamed('draftBox'),
-          );
-        },
-      ),
-    ];
-
-    return SizedBox(
-      height: MediaQuery.of(context).size.height * 0.38,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
-        children: [
-          Text(
-            'postNew'.tr,
-            style: Theme.of(context).textTheme.headlineSmall,
-          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          Expanded(
-            child: GridView.count(
-              physics: const NeverScrollableScrollPhysics(),
-              crossAxisCount: 3,
-              children: actionList
-                  .map((x) => Card(
-                        color: Theme.of(context).colorScheme.surfaceContainer,
-                        child: InkWell(
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(8)),
-                          onTap: x.onTap,
-                          child: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            children: [
-                              x.icon,
-                              const Gap(8),
-                              Expanded(
-                                child: Text(
-                                  x.label,
-                                  overflow: TextOverflow.fade,
-                                ),
-                              ),
-                            ],
-                          ).paddingAll(18),
-                        ),
-                      ))
-                  .toList(),
-            ).paddingSymmetric(horizontal: 20),
-          ),
-        ],
-      ),
-    );
-  }
-}
--- a/lib/screens/feed/draft_box.dart
+++ b/lib/screens/feed/draft_box.dart
@ -1,114 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/models/post.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/theme.dart';
-import 'package:solian/widgets/app_bar_leading.dart';
-import 'package:solian/widgets/app_bar_title.dart';
-import 'package:solian/widgets/posts/post_action.dart';
-import 'package:solian/widgets/posts/post_owned_list.dart';
-import 'package:solian/widgets/root_container.dart';
-
-class DraftBoxScreen extends StatefulWidget {
-  const DraftBoxScreen({super.key});
-
-  @override
-  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
-}
-
-class _DraftBoxScreenState extends State<DraftBoxScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  _getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listDraft(pageKey);
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    if (result.count == 0) {
-      _pagingController.appendLastPage([]);
-      return;
-    }
-
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-    _pagingController.addPageRequestListener(_getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return RootContainer(
-      child: Scaffold(
-        appBar: AppBar(
-          leading: AppBarLeadingButton.adaptive(context),
-          title: AppBarTitle('draftBox'.tr),
-          centerTitle: false,
-          toolbarHeight: AppTheme.toolbarHeight(context),
-          actions: [
-            SizedBox(
-              width: AppTheme.isLargeScreen(context) ? 8 : 16,
-            ),
-          ],
-        ),
-        body: RefreshIndicator(
-          onRefresh: () => Future.sync(() => _pagingController.refresh()),
-          child: PagedListView<int, Post>(
-            pagingController: _pagingController,
-            builderDelegate: PagedChildBuilderDelegate(
-              itemBuilder: (context, item, index) {
-                return PostOwnedListEntry(
-                  item: item,
-                  isFullContent: true,
-                  backgroundColor:
-                      Theme.of(context).colorScheme.surfaceContainerLow,
-                  onTap: () async {
-                    showModalBottomSheet(
-                      useRootNavigator: true,
-                      context: context,
-                      builder: (context) => PostAction(
-                        item: item,
-                        noReact: true,
-                      ),
-                    ).then((value) {
-                      if (value is Future) {
-                        value.then((_) {
-                          _pagingController.refresh();
-                        });
-                      } else if (value != null) {
-                        _pagingController.refresh();
-                      }
-                    });
-                  },
-                ).paddingOnly(left: 12, right: 12, bottom: 4);
-              },
-            ),
-          ),
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}
--- a/lib/screens/feed/search.dart
+++ b/lib/screens/feed/search.dart
@ -1,99 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/pagination.dart';
-import 'package:solian/providers/content/posts.dart';
-import 'package:solian/widgets/posts/post_warped_list.dart';
-
-import '../../models/post.dart';
-
-class FeedSearchScreen extends StatefulWidget {
-  final String? tag;
-  final String? category;
-
-  const FeedSearchScreen({super.key, this.tag, this.category});
-
-  @override
-  State<FeedSearchScreen> createState() => _FeedSearchScreenState();
-}
-
-class _FeedSearchScreenState extends State<FeedSearchScreen> {
-  final PagingController<int, Post> _pagingController =
-      PagingController(firstPageKey: 0);
-
-  getPosts(int pageKey) async {
-    final PostProvider provider = Get.find();
-
-    Response resp;
-    try {
-      resp = await provider.listPost(
-        pageKey,
-        tag: widget.tag,
-        category: widget.category,
-      );
-    } catch (e) {
-      _pagingController.error = e;
-      return;
-    }
-
-    final PaginationResult result = PaginationResult.fromJson(resp.body);
-    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
-    if (parsed != null && parsed.length >= 10) {
-      _pagingController.appendPage(parsed, pageKey + parsed.length);
-    } else if (parsed != null) {
-      _pagingController.appendLastPage(parsed);
-    }
-  }
-
-  @override
-  void initState() {
-    super.initState();
-
-    _pagingController.addPageRequestListener(getPosts);
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return Scaffold(
-      body: Material(
-        color: Theme.of(context).colorScheme.surface,
-        child: Column(
-          children: [
-            if (widget.tag != null)
-              ListTile(
-                leading: const Icon(Icons.label),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('postSearchWithTag'.trParams({'key': widget.tag!})),
-              ),
-            if (widget.category != null)
-              ListTile(
-                leading: const Icon(Icons.category),
-                tileColor: Theme.of(context).colorScheme.surfaceContainer,
-                title: Text('postSearchWithCategory'
-                    .trParams({'key': widget.category!})),
-              ),
-            Expanded(
-              child: RefreshIndicator(
-                onRefresh: () => Future.sync(() => _pagingController.refresh()),
-                child: CustomScrollView(
-                  slivers: [
-                    PostWarpedListWidget(
-                      controller: _pagingController,
-                      onUpdate: () => _pagingController.refresh(),
-                    ),
-                  ],
-                ),
-              ),
-            ),
-          ],
-        ),
-      ),
-    );
-  }
-
-  @override
-  void dispose() {
-    _pagingController.dispose();
-    super.dispose();
-  }
-}
--- a/lib/screens/posts/draft_box.dart
+++ b/lib/screens/posts/draft_box.dart
@ -0,0 +1,128 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/app_bar_leading.dart';
+import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/root_container.dart';
+import 'package:very_good_infinite_list/very_good_infinite_list.dart';
+
+class DraftBoxScreen extends StatefulWidget {
+  const DraftBoxScreen({super.key});
+
+  @override
+  State<DraftBoxScreen> createState() => _DraftBoxScreenState();
+}
+
+class _DraftBoxScreenState extends State<DraftBoxScreen> {
+  bool _isBusy = true;
+  int? _totalPosts;
+  final List<Post> _posts = List.empty(growable: true);
+
+  _getPosts() async {
+    setState(() => _isBusy = true);
+
+    final PostProvider posts = Get.find();
+    final resp = await posts.listDraft(_posts.length);
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    _totalPosts = result.count;
+    _posts.addAll(parsed ?? List.empty());
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> _openActions(Post item) async {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => PostAction(
+        item: item,
+        noReact: true,
+      ),
+    ).then((value) {
+      if (value is Future) {
+        value.then((_) {
+          _posts.clear();
+          _getPosts();
+        });
+      } else if (value != null) {
+        _posts.clear();
+        _getPosts();
+      }
+    });
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _getPosts();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return RootContainer(
+      child: Scaffold(
+        appBar: AppBar(
+          leading: AppBarLeadingButton.adaptive(context),
+          title: AppBarTitle('draftBox'.tr),
+          centerTitle: false,
+          toolbarHeight: AppTheme.toolbarHeight(context),
+          actions: [
+            SizedBox(
+              width: AppTheme.isLargeScreen(context) ? 8 : 16,
+            ),
+          ],
+        ),
+        body: Column(
+          children: [
+            LoadingIndicator(isActive: _isBusy),
+            Expanded(
+              child: RefreshIndicator(
+                onRefresh: () {
+                  _posts.clear();
+                  return _getPosts();
+                },
+                child: InfiniteList(
+                  itemCount: _posts.length,
+                  hasReachedMax: _totalPosts == _posts.length,
+                  isLoading: _isBusy,
+                  onFetchData: () => _getPosts(),
+                  itemBuilder: (context, index) {
+                    final item = _posts[index];
+                    return Card(
+                      child: GestureDetector(
+                        child: Column(
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            PostItem(
+                              key: Key('p${item.id}'),
+                              item: item,
+                              isShowEmbed: false,
+                              isClickable: false,
+                              isShowReply: false,
+                              isReactable: false,
+                              onTapMore: () => _openActions(item),
+                            ).paddingSymmetric(vertical: 8),
+                          ],
+                        ),
+                        onTap: () => _openActions(item),
+                      ),
+                    ).paddingOnly(left: 12, right: 12, bottom: 4);
+                  },
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}
--- a/lib/screens/posts/post_detail.dart
+++ b/lib/screens/posts/post_detail.dart
@ -4,9 +4,11 @@ import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/content/posts.dart';
 import 'package:solian/providers/last_read.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_action.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:solian/widgets/posts/post_replies.dart';
-import 'package:solian/widgets/root_container.dart';

 class PostDetailScreen extends StatefulWidget {
  final String id;
@ -23,75 +25,109 @@ class PostDetailScreen extends StatefulWidget {
 }

 class _PostDetailScreenState extends State<PostDetailScreen> {
-  Post? item;
+  bool _isBusy = true;

-  Future<Post?> getDetail() async {
-    if (widget.post != null) {
-      item = widget.post;
-      Get.find<LastReadProvider>().feedLastReadAt = item?.id;
-      return widget.post;
-    }
+  Post? _item;

-    final PostProvider provider = Get.find();
+  Future<void> _getDetail() async {
+    final PostProvider posts = Get.find();

    try {
-      final resp = await provider.getPost(widget.id);
-      item = Post.fromJson(resp.body);
+      final resp = await posts.getPost(widget.id);
+      _item = Post.fromJson(resp.body);
    } catch (e) {
      context.showErrorDialog(e).then((_) => Navigator.pop(context));
    }

-    Get.find<LastReadProvider>().feedLastReadAt = item?.id;
+    Get.find<LastReadProvider>().feedLastReadAt = _item?.id;

-    return item;
+    if (mounted) setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    if (widget.post != null) {
+      _item = widget.post;
+    }
+    _getDetail();
  }

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
-      child: FutureBuilder(
-        future: getDetail(),
-        builder: (context, snapshot) {
-          if (!snapshot.hasData || snapshot.data == null) {
-            return const Center(
-              child: CircularProgressIndicator(),
-            );
-          }
+    if (_isBusy && _item == null) {
+      return const Center(
+        child: CircularProgressIndicator(),
+      );
+    }

-          return CustomScrollView(
-            slivers: [
-              SliverToBoxAdapter(
-                child: PostItem(
-                  item: item!,
-                  isClickable: false,
-                  isOverrideEmbedClickable: true,
-                  isFullDate: true,
-                  isFullContent: true,
-                  isShowReply: false,
-                  isContentSelectable: true,
+    return CustomScrollView(
+      slivers: [
+        SliverToBoxAdapter(
+          child: LoadingIndicator(isActive: _isBusy),
+        ),
+        SliverToBoxAdapter(
+          child: PostItem(
+            key: ValueKey(_item),
+            item: _item!,
+            isClickable: false,
+            isOverrideEmbedClickable: true,
+            isFullDate: true,
+            isShowReply: false,
+            isContentSelectable: true,
+            padding: AppTheme.isLargeScreen(context)
+                ? EdgeInsets.symmetric(
+                    horizontal: 4,
+                    vertical: 8,
+                  )
+                : EdgeInsets.zero,
+            onTapMore: () {
+              showModalBottomSheet(
+                useRootNavigator: true,
+                context: context,
+                builder: (context) => PostAction(
+                  item: _item!,
+                  noReact: true,
                ),
-              ),
-              SliverToBoxAdapter(
-                child: const Divider(thickness: 0.3, height: 1)
-                    .paddingOnly(top: 4),
-              ),
-              SliverToBoxAdapter(
-                child: Align(
-                  alignment: Alignment.centerLeft,
-                  child: Text(
-                    'postReplies'.tr,
-                    style: Theme.of(context).textTheme.headlineSmall,
-                  ).paddingOnly(left: 24, right: 24, top: 16),
-                ),
-              ),
-              PostReplyList(item: item!),
-              SliverToBoxAdapter(
-                child: SizedBox(height: MediaQuery.of(context).padding.bottom),
-              ),
-            ],
-          );
-        },
-      ),
+              ).then((value) {
+                if (value is Future) {
+                  value.then((_) {
+                    _getDetail();
+                  });
+                } else if (value != null) {
+                  _getDetail();
+                }
+              });
+            },
+          ),
+        ),
+        SliverToBoxAdapter(
+          child: const Divider(thickness: 0.3, height: 1).paddingOnly(
+            top: 8,
+          ),
+        ),
+        SliverToBoxAdapter(
+          child: Align(
+            alignment: Alignment.centerLeft,
+            child: Text(
+              'postReplies'.tr,
+              style: Theme.of(context).textTheme.headlineSmall,
+            ).paddingOnly(left: 24, right: 24, top: 16),
+          ),
+        ),
+        PostReplyList(
+          item: _item!,
+          padding: AppTheme.isLargeScreen(context)
+              ? EdgeInsets.symmetric(
+                  horizontal: 4,
+                  vertical: 8,
+                )
+              : EdgeInsets.zero,
+        ),
+        SliverToBoxAdapter(
+          child: SizedBox(height: MediaQuery.of(context).padding.bottom),
+        ),
+      ],
    );
  }
 }
--- a/lib/screens/posts/post_editor.dart
+++ b/lib/screens/posts/post_editor.dart
@ -16,6 +16,7 @@ import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/markdown_text_content.dart';
 import 'package:solian/widgets/posts/post_item.dart';
 import 'package:badges/badges.dart' as badges;
@ -182,7 +183,10 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
          crossAxisAlignment: CrossAxisAlignment.start,
          children: [
            ListTile(
-              tileColor: Theme.of(context).colorScheme.surfaceContainerLow,
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainerLow
+                  .withOpacity(0.5),
              title: Column(
                crossAxisAlignment: CrossAxisAlignment.start,
                children: [
@ -271,118 +275,71 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                  ),
                ],
              ),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
            Expanded(
-              child: Row(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                children: [
-                  Expanded(
-                    child: Column(
-                      children: [
-                        Expanded(
-                          child: ListView(
-                            children: [
-                              Container(
-                                padding: const EdgeInsets.symmetric(
-                                  horizontal: 16,
-                                  vertical: 8,
-                                ),
-                                child: TextField(
-                                  maxLines: null,
-                                  autofocus: true,
-                                  autocorrect: true,
-                                  keyboardType: TextInputType.multiline,
-                                  controller:
-                                      _editorController.contentController,
-                                  focusNode: _contentFocusNode,
-                                  decoration: InputDecoration.collapsed(
-                                    hintText: 'postContentPlaceholder'.tr,
-                                  ),
-                                  onTapOutside: (_) => FocusManager
-                                      .instance.primaryFocus
-                                      ?.unfocus(),
-                                ),
-                              ),
-                              const Gap(120)
+              child: DefaultTabController(
+                length: 2,
+                child: AppTheme.isLargeScreen(context)
+                    ? Row(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Expanded(
+                            child: _PostEditorTextField(
+                              focusNode: _contentFocusNode,
+                              controller: _editorController,
+                              onUpdate: () => setState(() {}),
+                            ),
+                          ),
+                          const VerticalDivider(width: 0.3, thickness: 0.3)
+                              .paddingSymmetric(horizontal: 16),
+                          Expanded(
+                            child: SingleChildScrollView(
+                              padding:
+                                  const EdgeInsets.only(top: 12, bottom: 64),
+                              child: MarkdownTextContent(
+                                isAutoWarp: _editorController.mode.value == 0,
+                                content:
+                                    _editorController.contentController.text,
+                                parentId: 'post-editor-preview',
+                              ).paddingOnly(right: 16),
+                            ),
+                          ),
+                        ],
+                      )
+                    : Column(
+                        children: [
+                          TabBar(
+                            tabs: [
+                              const Tab(icon: Icon(Icons.edit)),
+                              const Tab(icon: Icon(Icons.preview)),
                            ],
                          ),
-                        ),
-                        Obx(() {
-                          final textStyle = TextStyle(
-                            fontSize: 12,
-                            color: Theme.of(context)
-                                .colorScheme
-                                .onSurface
-                                .withOpacity(0.75),
-                          );
-                          final showFactors = [
-                            _editorController.isRestoreFromLocal.value,
-                            _editorController.lastSaveTime.value != null,
-                          ];
-                          final doShow = showFactors.any((x) => x);
-                          return Container(
-                            padding: const EdgeInsets.symmetric(
-                              vertical: 4,
-                              horizontal: 16,
-                            ),
-                            child: Row(
+                          Expanded(
+                            child: TabBarView(
                              children: [
-                                if (showFactors[0])
-                                  Text('postRestoreFromLocal'.tr,
-                                          style: textStyle)
-                                      .paddingOnly(right: 4),
-                                if (showFactors[0])
-                                  InkWell(
-                                    child: Text('clear'.tr, style: textStyle),
-                                    onTap: () {
-                                      _editorController.localClear();
-                                      _editorController.currentClear();
-                                      setState(() {});
-                                    },
-                                  ),
-                                if (showFactors.where((x) => x).length > 1)
-                                  Text(
-                                    '·',
-                                    style: textStyle,
-                                  ).paddingSymmetric(horizontal: 8),
-                                if (showFactors[1])
-                                  Text(
-                                    'postAutoSaveAt'.trParams({
-                                      'date': DateFormat('HH:mm:ss').format(
-                                        _editorController.lastSaveTime.value ??
-                                            DateTime.now(),
-                                      )
-                                    }),
-                                    style: textStyle,
+                                _PostEditorTextField(
+                                  focusNode: _contentFocusNode,
+                                  controller: _editorController,
+                                  onUpdate: () => setState(() {}),
+                                ),
+                                SingleChildScrollView(
+                                  padding: const EdgeInsets.only(
+                                    top: 12,
+                                    bottom: 64,
                                  ),
+                                  child: MarkdownTextContent(
+                                    isAutoWarp:
+                                        _editorController.mode.value == 0,
+                                    content: _editorController
+                                        .contentController.text,
+                                    parentId: 'post-editor-preview',
+                                  ).paddingOnly(left: 16, right: 16),
+                                )
                              ],
                            ),
-                          )
-                              .animate(
-                                key: const Key('post-editor-hint-animation'),
-                                target: doShow ? 1 : 0,
-                              )
-                              .fade(curve: Curves.easeInOut, duration: 300.ms);
-                        }),
-                      ],
-                    ),
-                  ),
-                  if (AppTheme.isLargeScreen(context))
-                    const VerticalDivider(width: 0.3, thickness: 0.3)
-                        .paddingSymmetric(
-                      horizontal: 16,
-                    ),
-                  if (AppTheme.isLargeScreen(context))
-                    Expanded(
-                      child: SingleChildScrollView(
-                        child: MarkdownTextContent(
-                          isAutoWarp: _editorController.mode.value == 0,
-                          content: _editorController.contentController.text,
-                          parentId: 'post-editor-preview',
-                        ).paddingOnly(top: 12, right: 16),
+                          ),
+                        ],
                      ),
-                    ),
-                ],
              ),
            ),
            Material(
@ -391,6 +348,26 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                crossAxisAlignment: CrossAxisAlignment.start,
                children: [
                  const Divider(thickness: 0.3, height: 0.3),
+                  SizedBox(
+                    height: 40,
+                    child: SingleChildScrollView(
+                      scrollDirection: Axis.horizontal,
+                      child: MarkdownToolbar(
+                        width: 38,
+                        height: 38,
+                        iconSize: 20,
+                        spacing: 8,
+                        hideImage: true,
+                        useIncludedTextField: false,
+                        backgroundColor: Theme.of(context).colorScheme.surface,
+                        iconColor: Theme.of(context).colorScheme.onSurface,
+                        controller: _editorController.contentController,
+                        focusNode: _contentFocusNode,
+                        borderRadius:
+                            const BorderRadius.all(Radius.circular(20)),
+                      ).paddingSymmetric(horizontal: 12),
+                    ),
+                  ).paddingOnly(top: 12),
                  SizedBox(
                    height: 56,
                    child: ListView(
@ -520,7 +497,7 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                                top: -4,
                                end: -6,
                              ),
-                              child: const Icon(Icons.preview),
+                              child: const Icon(Icons.wallpaper),
                            );
                          }),
                          color: Theme.of(context).colorScheme.primary,
@ -547,18 +524,6 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
                            _editorController.editPublishDate(context);
                          },
                        ),
-                        MarkdownToolbar(
-                          hideImage: true,
-                          useIncludedTextField: false,
-                          backgroundColor:
-                              Theme.of(context).colorScheme.surface,
-                          iconColor: Theme.of(context).colorScheme.onSurface,
-                          controller: _editorController.contentController,
-                          focusNode: _contentFocusNode,
-                          borderRadius:
-                              const BorderRadius.all(Radius.circular(20)),
-                          width: 40,
-                        ).paddingSymmetric(horizontal: 2),
                      ],
                    ).paddingSymmetric(horizontal: 6, vertical: 8),
                  ),
@ -578,3 +543,101 @@ class _PostPublishScreenState extends State<PostPublishScreen> {
    super.dispose();
  }
 }
+
+class _PostEditorTextField extends StatelessWidget {
+  final FocusNode focusNode;
+  final PostEditorController controller;
+  final Function onUpdate;
+
+  const _PostEditorTextField({
+    required this.focusNode,
+    required this.controller,
+    required this.onUpdate,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        Expanded(
+          child: ListView(
+            children: [
+              Container(
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 16,
+                  vertical: 8,
+                ),
+                child: TextField(
+                  maxLines: null,
+                  autofocus: true,
+                  autocorrect: true,
+                  keyboardType: TextInputType.multiline,
+                  controller: controller.contentController,
+                  focusNode: focusNode,
+                  decoration: InputDecoration.collapsed(
+                    hintText: 'postContentPlaceholder'.tr,
+                  ),
+                  onTapOutside: (_) =>
+                      FocusManager.instance.primaryFocus?.unfocus(),
+                ),
+              ),
+              const Gap(120)
+            ],
+          ),
+        ),
+        Obx(() {
+          final textStyle = TextStyle(
+            fontSize: 12,
+            color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
+          );
+          final showFactors = [
+            controller.isRestoreFromLocal.value,
+            controller.lastSaveTime.value != null,
+          ];
+          final doShow = showFactors.any((x) => x);
+          return Container(
+            padding: const EdgeInsets.symmetric(
+              vertical: 4,
+              horizontal: 16,
+            ),
+            child: Row(
+              children: [
+                if (showFactors[0])
+                  Text('postRestoreFromLocal'.tr, style: textStyle)
+                      .paddingOnly(right: 4),
+                if (showFactors[0])
+                  InkWell(
+                    child: Text('clear'.tr, style: textStyle),
+                    onTap: () {
+                      controller.localClear();
+                      controller.currentClear();
+                      onUpdate();
+                    },
+                  ),
+                if (showFactors.where((x) => x).length > 1)
+                  Text(
+                    '·',
+                    style: textStyle,
+                  ).paddingSymmetric(horizontal: 8),
+                if (showFactors[1])
+                  Text(
+                    'postAutoSaveAt'.trParams({
+                      'date': DateFormat('HH:mm:ss').format(
+                        controller.lastSaveTime.value ?? DateTime.now(),
+                      )
+                    }),
+                    style: textStyle,
+                  ),
+              ],
+            ),
+          )
+              .animate(
+                key: const Key('post-editor-hint-animation'),
+                target: doShow ? 1 : 0,
+              )
+              .fade(curve: Curves.easeInOut, duration: 300.ms);
+        }),
+      ],
+    );
+  }
+}
--- a/lib/screens/posts/post_search.dart
+++ b/lib/screens/posts/post_search.dart
@ -0,0 +1,206 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/content/posts.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_list.dart';
+
+import '../../models/post.dart';
+
+class PostSearchScreen extends StatefulWidget {
+  final String? tag;
+  final String? category;
+
+  const PostSearchScreen({super.key, this.tag, this.category});
+
+  @override
+  State<PostSearchScreen> createState() => _PostSearchScreenState();
+}
+
+class _PostSearchScreenState extends State<PostSearchScreen> {
+  int? _totalCount;
+  Duration? _lastTook;
+
+  final TextEditingController _probeController = TextEditingController();
+  final PagingController<int, Post> _pagingController =
+      PagingController(firstPageKey: 0);
+
+  late bool _isBusy = widget.tag != null || widget.category != null;
+
+  _searchPosts(int pageKey) async {
+    if (widget.tag == null &&
+        widget.category == null &&
+        _probeController.text.isEmpty) {
+      _pagingController.appendLastPage([]);
+      return;
+    }
+
+    if (!_isBusy) {
+      setState(() => _isBusy = true);
+    }
+
+    if (pageKey == 0) {
+      _pagingController.itemList?.clear();
+      _pagingController.nextPageKey = 0;
+    }
+
+    final PostProvider posts = Get.find();
+
+    Stopwatch stopwatch = new Stopwatch()..start();
+
+    Response resp;
+    try {
+      if (_probeController.text.isEmpty) {
+        resp = await posts.listPost(
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      } else {
+        resp = await posts.searchPost(
+          _probeController.text,
+          pageKey,
+          tag: widget.tag,
+          category: widget.category,
+        );
+      }
+    } catch (e) {
+      _pagingController.error = e;
+      return;
+    }
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    if (parsed != null && parsed.length >= 10) {
+      _pagingController.appendPage(parsed, pageKey + parsed.length);
+    } else if (parsed != null) {
+      _pagingController.appendLastPage(parsed);
+    }
+
+    stopwatch.stop();
+
+    _totalCount = result.count;
+    _lastTook = stopwatch.elapsed;
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _pagingController.addPageRequestListener(_searchPosts);
+  }
+
+  @override
+  void dispose() {
+    _probeController.dispose();
+    _pagingController.dispose();
+    super.dispose();
+  }
+
+  Color get _unFocusColor =>
+      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: Column(
+        children: [
+          if (widget.tag != null)
+            ListTile(
+              leading: const Icon(Icons.label),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithTag'.trParams({'key': widget.tag!})),
+            ),
+          if (widget.category != null)
+            ListTile(
+              leading: const Icon(Icons.category),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 24),
+              tileColor: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              title: Text('postSearchWithCategory'.trParams({
+                'key': widget.category!,
+              })),
+            ),
+          Container(
+            color: Theme.of(context)
+                .colorScheme
+                .secondaryContainer
+                .withOpacity(0.5),
+            padding: const EdgeInsets.symmetric(horizontal: 24, vertical: 16),
+            child: TextField(
+              controller: _probeController,
+              decoration: InputDecoration(
+                isCollapsed: true,
+                border: InputBorder.none,
+                hintText: 'search'.tr,
+              ),
+              onSubmitted: (_) {
+                _searchPosts(0);
+              },
+            ),
+          ),
+          LoadingIndicator(isActive: _isBusy),
+          if (_totalCount != null || _lastTook != null)
+            Container(
+              padding: const EdgeInsets.symmetric(horizontal: 20, vertical: 4),
+              child: Row(
+                children: [
+                  Icon(
+                    Icons.summarize_outlined,
+                    size: 16,
+                    color: _unFocusColor,
+                  ),
+                  const Gap(4),
+                  if (_totalCount != null)
+                    Text(
+                      'searchResult'.trParams({
+                        'count': _totalCount!.toString(),
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                  const Gap(4),
+                  if (_lastTook != null)
+                    Text(
+                      'searchTook'.trParams({
+                        'time':
+                            '${(_lastTook!.inMilliseconds / 1000).toStringAsFixed(3)}s',
+                      }),
+                      style: TextStyle(
+                        fontSize: 13,
+                        color: _unFocusColor,
+                      ),
+                    ),
+                ],
+              ),
+            ),
+          Expanded(
+            child: RefreshIndicator(
+              onRefresh: () => Future.sync(() => _pagingController.refresh()),
+              child: CustomScrollView(
+                slivers: [
+                  ControlledPostListWidget(
+                    controller: _pagingController,
+                    onUpdate: () => _pagingController.refresh(),
+                  ),
+                  SliverGap(MediaQuery.of(context).padding.bottom),
+                ],
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}
--- a/lib/screens/realms.dart
+++ b/lib/screens/realms.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/realm.dart';
@ -15,6 +14,7 @@ import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:solian/widgets/current_state_action.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/root_container.dart';
 import 'package:solian/widgets/sized_container.dart';

@ -93,12 +93,13 @@ class _RealmListScreenState extends State<RealmListScreen> {

          return Column(
            children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
              Expanded(
                child: CenteredContainer(
                  child: RefreshIndicator(
                    onRefresh: () => _getRealms(),
                    child: ListView.builder(
+                      padding: const EdgeInsets.symmetric(vertical: 16),
                      itemCount: _realms.length,
                      itemBuilder: (context, index) {
                        final element = _realms[index];
@ -155,7 +156,7 @@ class _RealmListScreenState extends State<RealmListScreen> {
                                size: 18,
                              ),
                            )
-                          : AccountAvatar(
+                          : AttachedCircleAvatar(
                              content: element.avatar!,
                              bgColor: Theme.of(context).colorScheme.primary,
                            ),
--- a/lib/screens/realms/realm_organize.dart
+++ b/lib/screens/realms/realm_organize.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:image_cropper/image_cropper.dart';
 import 'package:image_picker/image_picker.dart';
@ -13,6 +12,7 @@ import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/app_bar_leading.dart';
 import 'package:solian/widgets/app_bar_title.dart';
+import 'package:solian/widgets/loading_indicator.dart';
 import 'package:solian/widgets/root_container.dart';
 import 'package:uuid/uuid.dart';

@ -208,7 +208,7 @@ class _RealmOrganizeScreenState extends State<RealmOrganizeScreen> {
          top: false,
          child: Column(
            children: [
-              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              LoadingIndicator(isActive: _isBusy),
              if (widget.edit != null)
                MaterialBanner(
                  leading: const Icon(Icons.edit),
--- a/lib/screens/settings.dart
+++ b/lib/screens/settings.dart
@ -19,7 +19,6 @@ import 'package:solian/providers/database/database.dart';
 import 'package:solian/providers/theme_switcher.dart';
 import 'package:solian/router.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';
-import 'package:solian/widgets/root_container.dart';

 class SettingScreen extends StatefulWidget {
  const SettingScreen({super.key});
@ -83,259 +82,258 @@ class _SettingScreenState extends State<SettingScreen> {

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
-      child: ListView(
-        children: [
-          _buildCaptionHeader('theme'.tr),
-          ListTile(
-            leading: const Icon(Icons.palette),
-            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('globalTheme'.tr),
-            trailing: DropdownButtonHideUnderline(
-              child: DropdownButton2<SolianThemeData>(
-                isExpanded: true,
-                hint: Text(
-                  'theme'.tr,
-                  style: TextStyle(
-                    fontSize: 14,
-                    color: Theme.of(context).hintColor,
-                  ),
+    return ListView(
+      children: [
+        _buildCaptionHeader('theme'.tr),
+        ListTile(
+          leading: const Icon(Icons.palette),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('globalTheme'.tr),
+          trailing: DropdownButtonHideUnderline(
+            child: DropdownButton2<SolianThemeData>(
+              isExpanded: true,
+              hint: Text(
+                'theme'.tr,
+                style: TextStyle(
+                  fontSize: 14,
+                  color: Theme.of(context).hintColor,
                ),
-                items: _presentTheme
-                    .map((SolianThemeData item) =>
-                        DropdownMenuItem<SolianThemeData>(
-                          value: item,
-                          child: Row(
-                            crossAxisAlignment: CrossAxisAlignment.center,
-                            children: [
-                              Icon(Icons.circle, color: item.seedColor),
-                              const Gap(8),
-                              Text(
+              ),
+              items: _presentTheme
+                  .map((SolianThemeData item) =>
+                      DropdownMenuItem<SolianThemeData>(
+                        value: item,
+                        child: Row(
+                          crossAxisAlignment: CrossAxisAlignment.center,
+                          children: [
+                            Icon(Icons.circle, color: item.seedColor),
+                            const Gap(8),
+                            Expanded(
+                              child: Text(
                                item.id.tr,
+                                maxLines: 1,
+                                overflow: TextOverflow.ellipsis,
                                style: const TextStyle(
                                  fontSize: 14,
                                ),
                              ),
-                            ],
-                          ),
-                        ))
-                    .toList(),
-                value: (_prefs?.containsKey('global_theme') ?? false)
-                    ? SolianThemeData.fromJson(
-                        jsonDecode(_prefs!.getString('global_theme')!),
-                      )
-                    : null,
-                onChanged: (SolianThemeData? value) {
-                  context.read<ThemeSwitcher>().setThemeData(value);
-                  setState(() {});
-                },
-                buttonStyleData: const ButtonStyleData(
-                  padding: EdgeInsets.symmetric(horizontal: 8),
-                  height: 40,
-                  width: 140,
-                ),
-                menuItemStyleData: const MenuItemStyleData(
-                  height: 40,
-                ),
+                            ),
+                          ],
+                        ),
+                      ))
+                  .toList(),
+              value: (_prefs?.containsKey('global_theme') ?? false)
+                  ? SolianThemeData.fromJson(
+                      jsonDecode(_prefs!.getString('global_theme')!),
+                    )
+                  : null,
+              onChanged: (SolianThemeData? value) {
+                context.read<ThemeSwitcher>().setThemeData(value);
+                setState(() {});
+              },
+              buttonStyleData: const ButtonStyleData(
+                padding: EdgeInsets.symmetric(horizontal: 8),
+                height: 40,
+                width: 140,
+              ),
+              menuItemStyleData: const MenuItemStyleData(
+                height: 40,
              ),
            ),
          ),
-          CheckboxListTile(
-            secondary: const Icon(Icons.military_tech),
-            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('agedTheme'.tr),
-            subtitle: Text('agedThemeDesc'.tr),
-            value: _prefs?.getBool('aged_theme') ?? false,
-            onChanged: (value) {
-              if (value != null) {
-                context.read<ThemeSwitcher>().setAgedTheme(value);
+        ),
+        CheckboxListTile(
+          secondary: const Icon(Icons.military_tech),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('agedTheme'.tr),
+          subtitle: Text('agedThemeDesc'.tr),
+          value: _prefs?.getBool('aged_theme') ?? false,
+          onChanged: (value) {
+            if (value != null) {
+              context.read<ThemeSwitcher>().setAgedTheme(value);
+            }
+            setState(() {});
+          },
+        ),
+        if (!PlatformInfo.isWeb)
+          ListTile(
+            leading: const Icon(Icons.wallpaper),
+            contentPadding: const EdgeInsets.only(left: 22, right: 31),
+            title: Text('appBackgroundImage'.tr),
+            subtitle: Text('appBackgroundImageDesc'.tr),
+            trailing: File('$_docBasepath/app_background_image').existsSync()
+                ? const Icon(Icons.check_box)
+                : const Icon(Icons.check_box_outline_blank),
+            onTap: () async {
+              if (File('$_docBasepath/app_background_image').existsSync()) {
+                File('$_docBasepath/app_background_image').deleteSync();
+              } else {
+                final image = await ImagePicker().pickImage(
+                  source: ImageSource.gallery,
+                );
+                if (image == null) return;
+
+                await File(image.path)
+                    .copy('$_docBasepath/app_background_image');
              }
+
              setState(() {});
            },
          ),
-          if (!PlatformInfo.isWeb)
-            ListTile(
-              leading: const Icon(Icons.wallpaper),
-              contentPadding: const EdgeInsets.only(left: 22, right: 31),
-              title: Text('appBackgroundImage'.tr),
-              subtitle: Text('appBackgroundImageDesc'.tr),
-              trailing: File('$_docBasepath/app_background_image').existsSync()
-                  ? const Icon(Icons.check_box)
-                  : const Icon(Icons.check_box_outline_blank),
-              onTap: () async {
-                if (File('$_docBasepath/app_background_image').existsSync()) {
-                  File('$_docBasepath/app_background_image').deleteSync();
-                } else {
-                  final image = await ImagePicker().pickImage(
-                    source: ImageSource.gallery,
-                  );
-                  if (image == null) return;
-
-                  await File(image.path)
-                      .copy('$_docBasepath/app_background_image');
-                }
-
-                setState(() {});
-              },
-            ),
-          _buildCaptionHeader('notification'.tr),
-          Tooltip(
-            message: 'settingsNotificationBgServiceDesc'.tr,
-            child: CheckboxListTile(
-              contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-              secondary: const Icon(Icons.system_security_update_warning),
-              enabled: PlatformInfo.isAndroid,
-              title: Text('settingsNotificationBgService'.tr),
-              subtitle: Column(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                children: [
-                  Text('holdToSeeDetail'.tr),
-                  Text(
-                    'needRestartToApply'.tr,
-                    style: const TextStyle(fontWeight: FontWeight.bold),
-                  )
-                ],
-              ),
-              value:
-                  _prefs?.getBool('service_background_notification') ?? false,
-              onChanged: (value) {
-                _prefs
-                    ?.setBool('service_background_notification', value ?? false)
-                    .then((_) {
-                  setState(() {});
-                });
-              },
-            ),
-          ),
-          _buildCaptionHeader('update'.tr),
-          CheckboxListTile(
+        _buildCaptionHeader('notification'.tr),
+        Tooltip(
+          message: 'settingsNotificationBgServiceDesc'.tr,
+          child: CheckboxListTile(
            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            secondary: const Icon(Icons.sync_alt),
-            title: Text('updateCheckStrictly'.tr),
-            subtitle: Text('updateCheckStrictlyDesc'.tr),
-            value: _prefs?.getBool('check_update_strictly') ?? false,
-            onChanged: (value) {
-              _prefs
-                  ?.setBool('check_update_strictly', value ?? false)
-                  .then((_) {
-                setState(() {});
-              });
-            },
-          ),
-          Obx(() {
-            final AuthProvider auth = Get.find<AuthProvider>();
-            if (!auth.isAuthorized.value) return const SizedBox.shrink();
-            return Column(
+            secondary: const Icon(Icons.system_security_update_warning),
+            enabled: PlatformInfo.isAndroid,
+            title: Text('settingsNotificationBgService'.tr),
+            subtitle: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
              children: [
-                _buildCaptionHeader('account'.tr),
-                ListTile(
-                  leading: const Icon(Icons.flag),
-                  trailing: const Icon(Icons.chevron_right),
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-                  title: Text('reportAbuse'.tr),
-                  subtitle: Text('reportAbuseDesc'.tr),
-                  onTap: () {
-                    showDialog(
-                      context: context,
-                      builder: (context) => const AbuseReportDialog(),
-                    );
-                  },
-                ),
-                ListTile(
-                  leading: const Icon(Icons.person_remove),
-                  trailing: const Icon(Icons.chevron_right),
-                  contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-                  title: Text('accountDeletion'.tr),
-                  subtitle: Text('accountDeletionDesc'.tr),
-                  onTap: () {
-                    context
-                        .showSlideToConfirmDialog(
-                      'accountDeletionConfirm'.tr,
-                      'accountDeletionConfirmDesc'.trParams({
-                        'account': '@${auth.userProfile.value!['name']}',
-                      }),
-                    )
-                        .then((value) async {
-                      if (value != true) return;
-                      final client = await auth.configureClient('id');
-                      final resp = await client.post('/users/me/deletion', {});
-                      if (resp.statusCode != 200) {
-                        context.showErrorDialog(RequestException(resp));
-                      } else {
-                        context.showSnackbar('accountDeletionRequested'.tr);
-                      }
-                    });
-                  },
-                ),
+                Text('holdToSeeDetail'.tr),
+                Text(
+                  'needRestartToApply'.tr,
+                  style: const TextStyle(fontWeight: FontWeight.bold),
+                )
              ],
-            );
-          }),
-          _buildCaptionHeader('performance'.tr),
-          CheckboxListTile(
-            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            secondary: const Icon(Icons.message),
-            title: Text('animatedMessageList'.tr),
-            subtitle: Text('animatedMessageListDesc'.tr),
-            value: _prefs?.getBool('non_animated_message_list') ?? false,
+            ),
+            value: _prefs?.getBool('service_background_notification') ?? false,
            onChanged: (value) {
              _prefs
-                  ?.setBool('non_animated_message_list', value ?? false)
+                  ?.setBool('service_background_notification', value ?? false)
                  .then((_) {
                setState(() {});
              });
            },
          ),
-          _buildCaptionHeader('more'.tr),
-          ListTile(
-            leading: const Icon(Icons.delete_sweep),
-            trailing: const Icon(Icons.chevron_right),
-            subtitle: FutureBuilder(
-              future: AppDatabase.getDatabaseSize(),
-              builder: (context, snapshot) {
-                if (!snapshot.hasData) {
-                  return Text('localDatabaseSize'.trParams(
-                    {'size': 'unknown'.tr},
-                  ));
-                }
+        ),
+        _buildCaptionHeader('update'.tr),
+        CheckboxListTile(
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          secondary: const Icon(Icons.sync_alt),
+          title: Text('updateCheckStrictly'.tr),
+          subtitle: Text('updateCheckStrictlyDesc'.tr),
+          value: _prefs?.getBool('check_update_strictly') ?? false,
+          onChanged: (value) {
+            _prefs?.setBool('check_update_strictly', value ?? false).then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        Obx(() {
+          final AuthProvider auth = Get.find<AuthProvider>();
+          if (!auth.isAuthorized.value) return const SizedBox.shrink();
+          return Column(
+            children: [
+              _buildCaptionHeader('account'.tr),
+              ListTile(
+                leading: const Icon(Icons.flag),
+                trailing: const Icon(Icons.chevron_right),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+                title: Text('reportAbuse'.tr),
+                subtitle: Text('reportAbuseDesc'.tr),
+                onTap: () {
+                  showDialog(
+                    context: context,
+                    builder: (context) => const AbuseReportDialog(),
+                  );
+                },
+              ),
+              ListTile(
+                leading: const Icon(Icons.person_remove),
+                trailing: const Icon(Icons.chevron_right),
+                contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+                title: Text('accountDeletion'.tr),
+                subtitle: Text('accountDeletionDesc'.tr),
+                onTap: () {
+                  context
+                      .showSlideToConfirmDialog(
+                    'accountDeletionConfirm'.tr,
+                    'accountDeletionConfirmDesc'.trParams({
+                      'account': '@${auth.userProfile.value!['name']}',
+                    }),
+                  )
+                      .then((value) async {
+                    if (value != true) return;
+                    final client = await auth.configureClient('id');
+                    final resp = await client.post('/users/me/deletion', {});
+                    if (resp.statusCode != 200) {
+                      context.showErrorDialog(RequestException(resp));
+                    } else {
+                      context.showSnackbar('accountDeletionRequested'.tr);
+                    }
+                  });
+                },
+              ),
+            ],
+          );
+        }),
+        _buildCaptionHeader('performance'.tr),
+        CheckboxListTile(
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          secondary: const Icon(Icons.message),
+          title: Text('animatedMessageList'.tr),
+          subtitle: Text('animatedMessageListDesc'.tr),
+          value: _prefs?.getBool('non_animated_message_list') ?? false,
+          onChanged: (value) {
+            _prefs
+                ?.setBool('non_animated_message_list', value ?? false)
+                .then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        _buildCaptionHeader('more'.tr),
+        ListTile(
+          leading: const Icon(Icons.delete_sweep),
+          trailing: const Icon(Icons.chevron_right),
+          subtitle: FutureBuilder(
+            future: AppDatabase.getDatabaseSize(),
+            builder: (context, snapshot) {
+              if (!snapshot.hasData) {
                return Text('localDatabaseSize'.trParams(
-                  {'size': snapshot.data!.formatBytes()},
+                  {'size': 'unknown'.tr},
                ));
-              },
-            ),
-            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('localDatabaseWipe'.tr),
-            onTap: () {
-              AppDatabase.removeDatabase().then((_) {
-                setState(() {});
-              });
+              }
+              return Text('localDatabaseSize'.trParams(
+                {'size': snapshot.data!.formatBytes()},
+              ));
            },
          ),
-          if (PlatformInfo.canRateTheApp)
-            ListTile(
-              leading: const Icon(Icons.star),
-              trailing: const Icon(Icons.chevron_right),
-              contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-              title: Text('rateTheApp'.tr),
-              subtitle: Text('rateTheAppDesc'.tr),
-              onTap: () {
-                final inAppReview = InAppReview.instance;
-
-                inAppReview.openStoreListing(
-                  appStoreId: '6499032345',
-                );
-              },
-            ),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('localDatabaseWipe'.tr),
+          onTap: () {
+            AppDatabase.removeDatabase().then((_) {
+              setState(() {});
+            });
+          },
+        ),
+        if (PlatformInfo.canRateTheApp)
          ListTile(
-            leading: const Icon(Icons.info_outline),
+            leading: const Icon(Icons.star),
            trailing: const Icon(Icons.chevron_right),
            contentPadding: const EdgeInsets.symmetric(horizontal: 22),
-            title: Text('about'.tr),
+            title: Text('rateTheApp'.tr),
+            subtitle: Text('rateTheAppDesc'.tr),
            onTap: () {
-              AppRouter.instance.pushNamed('about');
+              final inAppReview = InAppReview.instance;
+
+              inAppReview.openStoreListing(
+                appStoreId: '6499032345',
+              );
            },
          ),
-        ],
-      ),
+        ListTile(
+          leading: const Icon(Icons.info_outline),
+          trailing: const Icon(Icons.chevron_right),
+          contentPadding: const EdgeInsets.symmetric(horizontal: 22),
+          title: Text('about'.tr),
+          onTap: () {
+            AppRouter.instance.pushNamed('about');
+          },
+        ),
+      ],
    );
  }
 }
--- a/lib/shells/root_shell.dart
+++ b/lib/shells/root_shell.dart
@ -43,21 +43,34 @@ class RootShell extends StatelessWidget {

    final showRailNavigation = AppTheme.isLargeScreen(context);

-    final destNames = AppNavigation.destinations.map((x) => x.page).toList();
+    final destNames = [
+      'postDetail',
+      ...AppNavigation.destinations.map((x) => x.page),
+    ];
    final showBottomNavigation =
        destNames.contains(routeName) && !showRailNavigation;

    return Scaffold(
      key: rootScaffoldKey,
+      backgroundColor: Theme.of(context).colorScheme.surface,
      bottomNavigationBar: showBottomNavigation
          ? AppNavigationBottom(
-              initialIndex: destNames.indexOf(routeName ?? 'page'),
+              initialIndex: AppNavigation.destinations
+                  .map((x) => x.page)
+                  .toList()
+                  .indexOf(routeName ?? 'page'),
            )
          : null,
      body: AppTheme.isLargeScreen(context)
          ? Row(
              children: [
-                if (showRailNavigation) const AppNavigationRail(),
+                if (showRailNavigation)
+                  AppNavigationRail(
+                    initialIndex: AppNavigation.destinations
+                        .map((x) => x.page)
+                        .toList()
+                        .indexOf(routeName ?? 'page'),
+                  ),
                if (showRailNavigation)
                  const VerticalDivider(
                    width: 0.3,
--- a/lib/shells/title_shell.dart
+++ b/lib/shells/title_shell.dart
@ -10,6 +10,7 @@ import 'package:solian/widgets/root_container.dart';
 class TitleShell extends StatelessWidget {
  final bool showAppBar;
  final bool isCenteredTitle;
+  final bool isResponsive;
  final String? title;
  final GoRouterState? state;
  final Widget child;
@ -21,32 +22,37 @@ class TitleShell extends StatelessWidget {
    this.state,
    this.showAppBar = true,
    this.isCenteredTitle = false,
+    this.isResponsive = false,
  });

  @override
  Widget build(BuildContext context) {
    assert(state != null || title != null);

-    return RootContainer(
-      child: Scaffold(
-        appBar: showAppBar
-            ? AppBar(
-                leading: AppBarLeadingButton.adaptive(context),
-                title: AppBarTitle(
-                  title ?? (state!.topRoute?.name?.tr ?? 'page'.tr),
+    final widget = Scaffold(
+      appBar: showAppBar
+          ? AppBar(
+              leading: AppBarLeadingButton.adaptive(context),
+              title: AppBarTitle(
+                title ?? (state!.topRoute?.name?.tr ?? 'page'.tr),
+              ),
+              centerTitle: isCenteredTitle,
+              toolbarHeight: AppTheme.toolbarHeight(context),
+              actions: [
+                const BackgroundStateWidget(),
+                SizedBox(
+                  width: AppTheme.isLargeScreen(context) ? 8 : 16,
                ),
-                centerTitle: isCenteredTitle,
-                toolbarHeight: AppTheme.toolbarHeight(context),
-                actions: [
-                  const BackgroundStateWidget(),
-                  SizedBox(
-                    width: AppTheme.isLargeScreen(context) ? 8 : 16,
-                  ),
-                ],
-              )
-            : null,
-        body: child,
-      ),
+              ],
+            )
+          : null,
+      body: child,
    );
+
+    if (isResponsive) {
+      return ResponsiveRootContainer(child: widget);
+    } else {
+      return RootContainer(child: widget);
+    }
  }
 }
--- a/lib/theme.dart
+++ b/lib/theme.dart
@ -39,10 +39,13 @@ abstract class AppTheme {
        brightness: brightness,
        seedColor: seedColor ?? const Color.fromRGBO(154, 98, 91, 1),
      ),
-      scaffoldBackgroundColor: Colors.transparent,
      snackBarTheme: const SnackBarThemeData(
        behavior: SnackBarBehavior.floating,
      ),
+      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(
+        backgroundColor: Colors.transparent,
+      ),
      fontFamily: 'Comfortaa',
      fontFamilyFallback: [
        'NotoSansSC',
@ -74,6 +77,7 @@ abstract class AppTheme {
        behavior: SnackBarBehavior.floating,
      ),
      scaffoldBackgroundColor: Colors.transparent,
+      appBarTheme: const AppBarTheme(backgroundColor: Colors.transparent),
      fontFamily: data.fontFamily ?? 'Comfortaa',
      fontFamilyFallback: data.fontFamilyFallback ??
          [
--- a/lib/widgets/account/account_avatar.dart
+++ b/lib/widgets/account/account_avatar.dart
@ -1,15 +1,16 @@
 import 'package:flutter/material.dart';
 import 'package:solian/services.dart';
+import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/auto_cache_image.dart';

-class AccountAvatar extends StatelessWidget {
+class AttachedCircleAvatar extends StatelessWidget {
  final dynamic content;
  final Color? bgColor;
  final Color? feColor;
  final double? radius;
  final Widget? fallbackWidget;

-  const AccountAvatar({
+  const AttachedCircleAvatar({
    super.key,
    required this.content,
    this.bgColor,
@ -39,7 +40,7 @@ class AccountAvatar extends StatelessWidget {
      child: isEmpty
          ? (fallbackWidget ??
              Icon(
-                Icons.account_circle,
+                Icons.image,
                size: radius != null ? radius! * 1.2 : 24,
                color: feColor,
              ))
@ -48,6 +49,54 @@ class AccountAvatar extends StatelessWidget {
  }
 }

+class AccountAvatar extends StatelessWidget {
+  final dynamic content;
+  final String username;
+  final Color? bgColor;
+  final Color? feColor;
+  final double? radius;
+  final Widget? fallbackWidget;
+
+  const AccountAvatar({
+    super.key,
+    required this.content,
+    required this.username,
+    this.bgColor,
+    this.feColor,
+    this.radius,
+    this.fallbackWidget,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      child: AttachedCircleAvatar(
+        content: content,
+        bgColor: bgColor,
+        feColor: feColor,
+        radius: radius,
+        fallbackWidget: (fallbackWidget ??
+            Icon(
+              Icons.account_circle,
+              size: radius != null ? radius! * 1.2 : 24,
+              color: feColor,
+            )),
+      ),
+      onTap: () {
+        showModalBottomSheet(
+          useRootNavigator: true,
+          isScrollControlled: true,
+          backgroundColor: Theme.of(context).colorScheme.surface,
+          context: context,
+          builder: (context) => AccountProfilePopup(
+            name: username,
+          ),
+        );
+      },
+    );
+  }
+}
+
 class AccountProfileImage extends StatelessWidget {
  final dynamic content;
  final BoxFit fit;
--- a/lib/widgets/account/account_heading.dart
+++ b/lib/widgets/account/account_heading.dart
@ -84,7 +84,7 @@ class AccountHeadingWidget extends StatelessWidget {
              Positioned(
                bottom: -30,
                left: 32,
-                child: AccountAvatar(content: avatar, radius: 40),
+                child: AttachedCircleAvatar(content: avatar, radius: 40),
              ),
            ],
          ),
--- a/lib/widgets/account/account_profile_popup.dart
+++ b/lib/widgets/account/account_profile_popup.dart
@ -89,8 +89,7 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {

    return SizedBox(
      height: MediaQuery.of(context).size.height * 0.75,
-      child: Column(
-        crossAxisAlignment: CrossAxisAlignment.start,
+      child: ListView(
        children: [
          AccountHeadingWidget(
            avatar: _userinfo!.avatar,
@ -118,7 +117,7 @@ class _AccountProfilePopupState extends State<AccountProfilePopup> {
                      const VisualDensity(horizontal: -4, vertical: -2),
                  trailing: const Icon(Icons.chevron_right),
                  onTap: () {
-                    AppRouter.instance.goNamed(
+                    AppRouter.instance.pushNamed(
                      'accountProfilePage',
                      pathParameters: {'name': _userinfo!.name},
                    );
--- a/lib/widgets/account/account_select.dart
+++ b/lib/widgets/account/account_select.dart
@ -138,7 +138,7 @@ class _AccountSelectorState extends State<AccountSelector> {
                return ListTile(
                  title: Text(element.nick),
                  subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                  trailing: widget.trailingBuilder != null
                      ? widget.trailingBuilder!(element)
                      : _checkSelected(element)
--- a/lib/widgets/account/relative_list.dart
+++ b/lib/widgets/account/relative_list.dart
@ -23,7 +23,7 @@ class SilverRelativeList extends StatelessWidget {
      title: Text(element.related.nick),
      subtitle: Text(element.related.name),
      leading: GestureDetector(
-        child: AccountAvatar(content: element.related.avatar),
+        child: AttachedCircleAvatar(content: element.related.avatar),
        onTap: () {
          showModalBottomSheet(
            useRootNavigator: true,
--- a/lib/widgets/account/relative_select.dart
+++ b/lib/widgets/account/relative_select.dart
@ -56,7 +56,7 @@ class _RelativeSelectorState extends State<RelativeSelector> {
                return ListTile(
                  title: Text(element.nick),
                  subtitle: Text(element.name),
-                  leading: AccountAvatar(content: element.avatar),
+                  leading: AttachedCircleAvatar(content: element.avatar),
                  trailing: widget.trailingBuilder != null
                      ? widget.trailingBuilder!(element)
                      : null,
--- a/lib/widgets/app_bar_leading.dart
+++ b/lib/widgets/app_bar_leading.dart
@ -1,28 +1,22 @@
 import 'package:flutter/material.dart';
-import 'package:solian/shells/root_shell.dart';

 class AppBarLeadingButton extends StatelessWidget {
-  const AppBarLeadingButton({super.key});
+  final bool forceBack;

-  static Widget? adaptive(BuildContext context) {
-    final hasContent =
-        Navigator.canPop(context) || rootScaffoldKey.currentState!.hasDrawer;
-    return hasContent ? const AppBarLeadingButton() : null;
+  const AppBarLeadingButton({super.key, this.forceBack = false});
+
+  static Widget? adaptive(BuildContext context, {bool forceBack = false}) {
+    final hasContent = Navigator.canPop(context) || forceBack;
+    return hasContent ? AppBarLeadingButton(forceBack: forceBack) : null;
  }

  @override
  Widget build(BuildContext context) {
-    if (Navigator.canPop(context)) {
+    if (Navigator.canPop(context) || forceBack) {
      return BackButton(
        onPressed: () => Navigator.pop(context),
      );
    }
-    if (rootScaffoldKey.currentState!.hasDrawer) {
-      return DrawerButton(
-        onPressed: () => rootScaffoldKey.currentState!.openDrawer(),
-      );
-    } else {
-      return const SizedBox.shrink();
-    }
+    return const SizedBox.shrink();
  }
 }
--- a/lib/widgets/attachments/attachment_editor.dart
+++ b/lib/widgets/attachments/attachment_editor.dart
@ -21,6 +21,7 @@ import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/widgets/attachments/attachment_attr_editor.dart';
 import 'package:solian/widgets/attachments/attachment_editor_thumbnail.dart';
 import 'package:solian/widgets/attachments/attachment_fullscreen.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class AttachmentEditorPopup extends StatefulWidget {
  final String pool;
@ -32,12 +33,14 @@ class AttachmentEditorPopup extends StatefulWidget {
  final List<String>? initialAttachments;
  final void Function(String) onAdd;
  final void Function(String) onRemove;
+  final void Function(String)? onInsert;

  const AttachmentEditorPopup({
    super.key,
    required this.pool,
    required this.onAdd,
    required this.onRemove,
+    this.onInsert,
    this.singleMode = false,
    this.imageOnly = false,
    this.autoUpload = false,
@ -228,7 +231,10 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
        .listMetadata(widget.initialAttachments ?? List.empty())
        .then((result) {
      setState(() {
-        _attachments = List.from(result, growable: true);
+        _attachments = List.from(
+          result.where((x) => x != null),
+          growable: true,
+        );
        _isBusy = false;
        _isFirstTimeBusy = false;
      });
@ -553,6 +559,22 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                          setState(() => _attachments.removeAt(idx));
                        },
                      ),
+                      if (widget.onInsert != null)
+                        PopupMenuItem(
+                          child: ListTile(
+                            title: Text('insert'.tr),
+                            leading: const Icon(Icons.insert_link),
+                            contentPadding: const EdgeInsets.symmetric(
+                              horizontal: 8,
+                            ),
+                          ),
+                          onTap: () {
+                            widget.onInsert!(
+                              '![](solink://attachments/${element.rid})',
+                            );
+                            Navigator.pop(context);
+                          },
+                        ),
                    ],
                  ),
                ],
@ -660,7 +682,7 @@ class _AttachmentEditorPopupState extends State<AttachmentEditorPopup> {
                ),
              ],
            ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-            if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+            LoadingIndicator(isActive: _isBusy),
            Expanded(
              child: CustomScrollView(
                slivers: [
--- a/lib/widgets/attachments/attachment_fullscreen.dart
+++ b/lib/widgets/attachments/attachment_fullscreen.dart
@ -8,6 +8,7 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:gal/gal.dart';
 import 'package:gap/gap.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/platform.dart';
@ -103,9 +104,10 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {

  @override
  Widget build(BuildContext context) {
-    final metaTextStyle = TextStyle(
+    final metaTextStyle = GoogleFonts.roboto(
      fontSize: 12,
      color: _unFocusColor,
+      height: 1,
    );

    return DismissiblePage(
@ -175,7 +177,7 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                      Row(
                        children: [
                          IgnorePointer(
-                            child: AccountAvatar(
+                            child: AttachedCircleAvatar(
                              content: widget.item.account!.avatar,
                              radius: 19,
                            ),
@ -239,25 +241,58 @@ class _AttachmentFullScreenState extends State<AttachmentFullScreen> {
                      child: Wrap(
                        spacing: 6,
                        children: [
-                          Text(
-                            '#${widget.item.rid}',
-                            style: metaTextStyle,
-                          ),
-                          if (widget.item.metadata?['width'] != null &&
-                              widget.item.metadata?['height'] != null)
+                          if (widget.item.metadata?['exif'] == null)
                            Text(
-                              '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
+                              '#${widget.item.rid}',
                              style: metaTextStyle,
                            ),
+                          if (widget.item.metadata?['exif']?['Model'] != null)
+                            Text(
+                              'shotOn'.trParams({
+                                'device': widget.item.metadata?['exif']
+                                    ?['Model']
+                              }),
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ShutterSpeed'] !=
+                              null)
+                            Text(
+                              widget.item.metadata?['exif']?['ShutterSpeed'],
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['ISO'] != null)
+                            Text(
+                              'ISO${widget.item.metadata?['exif']?['ISO']}',
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['Aperture'] !=
+                              null)
+                            Text(
+                              'f/${widget.item.metadata?['exif']?['Aperture']}',
+                              style: metaTextStyle,
+                            ).paddingOnly(right: 2),
+                          if (widget.item.metadata?['exif']?['Megapixels'] !=
+                                  null &&
+                              widget.item.metadata?['exif']?['Model'] != null)
+                            Text(
+                              '${widget.item.metadata?['exif']?['Megapixels']}MP',
+                              style: metaTextStyle,
+                            )
+                          else
+                            Text(
+                              widget.item.size.formatBytes(),
+                              style: metaTextStyle,
+                            ),
+                          Text(
+                            '${widget.item.metadata?['width']}x${widget.item.metadata?['height']}',
+                            style: metaTextStyle,
+                          ),
                          if (widget.item.metadata?['ratio'] != null)
                            Text(
-                              '${_getRatio().toPrecision(2)}',
+                              (widget.item.metadata?['ratio'] as num)
+                                  .toStringAsFixed(2),
                              style: metaTextStyle,
                            ),
-                          Text(
-                            widget.item.size.formatBytes(),
-                            style: metaTextStyle,
-                          ),
                          Text(
                            widget.item.mimetype,
                            style: metaTextStyle,
--- a/lib/widgets/attachments/attachment_item.dart
+++ b/lib/widgets/attachments/attachment_item.dart
@ -155,11 +155,18 @@ class _AttachmentItemImage extends StatelessWidget {
          ),
          if (showBadge && badge != null)
            Positioned(
-              right: 12,
-              bottom: 8,
+              right: 8,
+              bottom: 4,
              child: Material(
                color: Colors.transparent,
-                child: Chip(label: Text(badge!)),
+                child: Chip(
+                  label: Text(badge!),
+                  labelStyle: GoogleFonts.robotoMono(),
+                  visualDensity: const VisualDensity(
+                    horizontal: -4,
+                    vertical: -2,
+                  ),
+                ),
              ),
            ),
          if (showHideButton && item.isMature)
--- a/lib/widgets/attachments/attachment_list.dart
+++ b/lib/widgets/attachments/attachment_list.dart
@ -1,7 +1,6 @@
 import 'dart:math' as math;
 import 'dart:ui';

-import 'package:carousel_slider/carousel_slider.dart';
 import 'package:dismissible_page/dismissible_page.dart';
 import 'package:flutter/material.dart' hide CarouselController;
 import 'package:flutter_animate/flutter_animate.dart';
@ -15,27 +14,29 @@ import 'package:solian/widgets/sized_container.dart';

 class AttachmentList extends StatefulWidget {
  final String parentId;
-  final List<String> attachmentsId;
+  final List<String>? attachmentIds;
+  final List<Attachment>? attachments;
  final bool isGrid;
  final bool isColumn;
-  final bool isForceGrid;
+  final bool isFullWidth;
  final bool autoload;
-  final double flatMaxHeight;
  final double columnMaxWidth;

+  final EdgeInsets? padding;
  final double? width;
  final double? viewport;

  const AttachmentList({
    super.key,
    required this.parentId,
-    required this.attachmentsId,
+    this.attachmentIds,
+    this.attachments,
    this.isGrid = false,
    this.isColumn = false,
-    this.isForceGrid = false,
+    this.isFullWidth = false,
    this.autoload = false,
-    this.flatMaxHeight = 720,
    this.columnMaxWidth = 480,
+    this.padding,
    this.width,
    this.viewport,
  });
@ -48,23 +49,24 @@ class _AttachmentListState extends State<AttachmentList> {
  bool _isLoading = true;
  bool _showMature = false;

+  // ignore: unused_field
  double _aspectRatio = 1;

-  List<Attachment?> _attachmentsMeta = List.empty();
+  List<Attachment?> _attachments = List.empty();

  void _getMetadataList() {
    final AttachmentProvider attach = Get.find();

-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? false) {
      return;
    } else {
-      _attachmentsMeta = List.filled(widget.attachmentsId.length, null);
+      _attachments = List.filled(widget.attachmentIds!.length, null);
    }

-    attach.listMetadata(widget.attachmentsId).then((result) {
+    attach.listMetadata(widget.attachmentIds!).then((result) {
      if (mounted) {
        setState(() {
-          _attachmentsMeta = result;
+          _attachments = result;
          _isLoading = false;
        });
      }
@ -76,7 +78,7 @@ class _AttachmentListState extends State<AttachmentList> {
    bool isConsistent = true;
    double? consistentValue;
    int portrait = 0, square = 0, landscape = 0;
-    for (var entry in _attachmentsMeta) {
+    for (var entry in _attachments) {
      if (entry == null) continue;
      if (entry.metadata?['ratio'] != null) {
        if (entry.metadata?['ratio'] is int) {
@ -117,10 +119,9 @@ class _AttachmentListState extends State<AttachmentList> {
      item: element,
      parentId: widget.parentId,
      width: width ?? widget.width,
-      badgeContent: '${idx + 1}/${_attachmentsMeta.length}',
-      showBadge:
-          _attachmentsMeta.length > 1 && !widget.isGrid && !widget.isColumn,
-      showBorder: widget.attachmentsId.length > 1,
+      badgeContent: '${idx + 1}/${_attachments.length}',
+      showBadge: _attachments.length > 1 && !widget.isGrid && !widget.isColumn,
+      showBorder: _attachments.length > 1,
      showMature: _showMature,
      autoload: widget.autoload,
      onReveal: (value) {
@ -132,7 +133,26 @@ class _AttachmentListState extends State<AttachmentList> {
  @override
  void initState() {
    super.initState();
-    _getMetadataList();
+    assert(widget.attachmentIds != null || widget.attachments != null);
+    if (widget.attachments == null) {
+      final AttachmentProvider attach = Get.find();
+      final cachedResult = attach.listMetadataFromCache(widget.attachmentIds!);
+      if (cachedResult.every((x) => x != null)) {
+        setState(() {
+          _attachments = cachedResult;
+          _isLoading = false;
+        });
+        _calculateAspectRatio();
+      } else {
+        _getMetadataList();
+      }
+    } else {
+      setState(() {
+        _attachments = widget.attachments!;
+        _isLoading = false;
+      });
+      _calculateAspectRatio();
+    }
  }

  Color get _unFocusColor =>
@ -140,7 +160,7 @@ class _AttachmentListState extends State<AttachmentList> {

  @override
  Widget build(BuildContext context) {
-    if (widget.attachmentsId.isEmpty) {
+    if (widget.attachmentIds?.isEmpty ?? widget.attachments!.isEmpty) {
      return const SizedBox.shrink();
    }

@ -153,9 +173,7 @@ class _AttachmentListState extends State<AttachmentList> {
            color: _unFocusColor,
          ).paddingOnly(right: 5),
          Text(
-            'attachmentHint'.trParams(
-              {'count': widget.attachmentsId.length.toString()},
-            ),
+            'attachmentHint'.trParams({'count': _attachments.toString()}),
            style: TextStyle(color: _unFocusColor, fontSize: 12),
          )
        ],
@ -165,17 +183,89 @@ class _AttachmentListState extends State<AttachmentList> {
          .fadeIn(duration: 1250.ms);
    }

+    const radius = BorderRadius.all(Radius.circular(8));
+
+    if (widget.isFullWidth && _attachments.length == 1) {
+      final element = _attachments.first;
+      final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+      double ratio =
+          element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
+      return Container(
+        width: MediaQuery.of(context).size.width,
+        constraints: BoxConstraints(
+          maxHeight: 640,
+        ),
+        child: AspectRatio(
+          aspectRatio: ratio,
+          child: Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.symmetric(
+                horizontal: BorderSide(
+                  color: Theme.of(context).dividerColor,
+                  width: 1,
+                ),
+              ),
+            ),
+            child: _buildEntry(element, 0),
+          ),
+        ),
+      );
+    }
+
+    final isNotPureImage = _attachments.any(
+      (x) => x?.mimetype.split('/').firstOrNull != 'image',
+    );
+    if (widget.isGrid && !isNotPureImage) {
+      return GridView.builder(
+        padding: EdgeInsets.zero,
+        primary: false,
+        physics: const NeverScrollableScrollPhysics(),
+        shrinkWrap: true,
+        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
+          crossAxisCount: math.min(3, _attachments.length),
+          mainAxisSpacing: 8.0,
+          crossAxisSpacing: 8.0,
+        ),
+        itemCount: _attachments.length,
+        itemBuilder: (context, idx) {
+          final element = _attachments[idx];
+          return Container(
+            decoration: BoxDecoration(
+              color: Theme.of(context)
+                  .colorScheme
+                  .surfaceContainer
+                  .withOpacity(0.5),
+              border: Border.all(
+                color: Theme.of(context).dividerColor,
+                width: 1,
+              ),
+              borderRadius: radius,
+            ),
+            child: ClipRRect(
+              borderRadius: radius,
+              child: _buildEntry(element, idx),
+            ),
+          );
+        },
+      );
+    }
+
    if (widget.isColumn) {
      var idx = 0;
-      const radius = BorderRadius.all(Radius.circular(8));
      return Wrap(
        spacing: 8,
        runSpacing: 8,
-        children: widget.attachmentsId.map((x) {
-          final element = _attachmentsMeta[idx];
+        children: _attachments.map((x) {
+          final element = _attachments[idx];
          idx++;
          if (element == null) return const SizedBox.shrink();
-          double ratio = element.metadata?['ratio']?.toDouble() ?? 16 / 9;
+          final isImage = element.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
          return Container(
            constraints: BoxConstraints(
              maxWidth: widget.columnMaxWidth,
@ -185,6 +275,10 @@ class _AttachmentListState extends State<AttachmentList> {
              aspectRatio: ratio,
              child: Container(
                decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
                  border: Border.all(
                    color: Theme.of(context).dividerColor,
                    width: 1,
@ -202,69 +296,52 @@ class _AttachmentListState extends State<AttachmentList> {
      );
    }

-    final isNotPureImage = _attachmentsMeta.any(
-      (x) => x?.mimetype.split('/').firstOrNull != 'image',
-    );
-    if (widget.isGrid && (widget.isForceGrid || !isNotPureImage)) {
-      const radius = BorderRadius.all(Radius.circular(8));
-      return GridView.builder(
-        padding: EdgeInsets.zero,
-        primary: false,
-        physics: const NeverScrollableScrollPhysics(),
+    return Container(
+      constraints: BoxConstraints(
+        maxHeight: 320,
+      ),
+      child: ListView.separated(
+        padding: widget.padding,
+        scrollDirection: Axis.horizontal,
        shrinkWrap: true,
-        gridDelegate: SliverGridDelegateWithFixedCrossAxisCount(
-          crossAxisCount: math.min(3, widget.attachmentsId.length),
-          mainAxisSpacing: 8.0,
-          crossAxisSpacing: 8.0,
-        ),
-        itemCount: widget.attachmentsId.length,
+        itemCount: _attachments.length,
        itemBuilder: (context, idx) {
-          final element = _attachmentsMeta[idx];
+          final element = _attachments[idx];
+          if (element == null) const SizedBox.shrink();
+          final isImage = element!.mimetype.split('/').firstOrNull == 'image';
+          double ratio =
+              element.metadata?['ratio']?.toDouble() ?? (isImage ? 1 : 16 / 9);
          return Container(
-            decoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
-              border: Border.all(
-                color: Theme.of(context).dividerColor,
-                width: 1,
+            constraints: BoxConstraints(
+              maxWidth: math.min(
+                widget.columnMaxWidth,
+                MediaQuery.of(context).size.width -
+                    (widget.padding?.horizontal ?? 0),
              ),
-              borderRadius: radius,
            ),
-            child: ClipRRect(
-              borderRadius: radius,
-              child: _buildEntry(element, idx),
+            child: AspectRatio(
+              aspectRatio: ratio,
+              child: Container(
+                decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .surfaceContainer
+                      .withOpacity(0.5),
+                  border: Border.all(
+                    color: Theme.of(context).dividerColor,
+                    width: 1,
+                  ),
+                  borderRadius: radius,
+                ),
+                child: ClipRRect(
+                  borderRadius: radius,
+                  child: _buildEntry(element, idx),
+                ),
+              ),
            ),
          );
        },
-      ).paddingSymmetric(horizontal: 24);
-    }
-
-    return Container(
-      width: MediaQuery.of(context).size.width,
-      constraints: BoxConstraints(
-        maxHeight: widget.flatMaxHeight,
-      ),
-      decoration: BoxDecoration(
-        color: Colors.transparent,
-        border: Border.symmetric(
-          horizontal: BorderSide(
-            width: 0.3,
-            color: Theme.of(context).dividerColor,
-          ),
-        ),
-      ),
-      child: CarouselSlider.builder(
-        options: CarouselOptions(
-          animateToClosest: true,
-          aspectRatio: _aspectRatio,
-          viewportFraction:
-              widget.viewport ?? (widget.attachmentsId.length > 1 ? 0.95 : 1),
-          enableInfiniteScroll: false,
-        ),
-        itemCount: _attachmentsMeta.length,
-        itemBuilder: (context, idx, _) {
-          final element = _attachmentsMeta[idx];
-          return _buildEntry(element, idx);
-        },
+        separatorBuilder: (context, _) => const Gap(8),
      ),
    );
  }
@ -343,11 +420,13 @@ class AttachmentListEntry extends StatelessWidget {
              },
            ),
            if (item!.isMature && !showMature)
-              BackdropFilter(
-                filter: ImageFilter.blur(sigmaX: 100, sigmaY: 100),
-                child: Container(
-                  decoration: BoxDecoration(
-                    color: Colors.black.withOpacity(0.5),
+              ClipRect(
+                child: BackdropFilter(
+                  filter: ImageFilter.blur(sigmaX: 100, sigmaY: 100),
+                  child: Container(
+                    decoration: BoxDecoration(
+                      color: Colors.black.withOpacity(0.5),
+                    ),
                  ),
                ),
              ),
--- a/lib/widgets/channel/channel_list.dart
+++ b/lib/widgets/channel/channel_list.dart
@ -38,11 +38,13 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {

  Future<void> _loadLastMessages() async {
    final messages = await _eventController.src.getLastInAllChannels();
-    setState(() {
-      _lastMessages = messages
-          .map((k, v) => MapEntry(k, v.firstOrNull))
-          .cast<int, LocalMessageEventTableData>();
-    });
+    if (mounted) {
+      setState(() {
+        _lastMessages = messages
+            .map((k, v) => MapEntry(k, v.firstOrNull))
+            .cast<int, LocalMessageEventTableData>();
+      });
+    }
  }

  @override
@ -205,7 +207,7 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
        item.members!.where((e) => e.account.id != widget.selfId).firstOrNull;

    if (item.type == 1 && otherside != null) {
-      final avatar = AccountAvatar(
+      final avatar = AttachedCircleAvatar(
        content: otherside.account.avatar,
        radius: 20,
        bgColor: Theme.of(context).colorScheme.primary,
@ -241,7 +243,7 @@ class _ChannelListWidgetState extends State<ChannelListWidget> {
                  padding: const EdgeInsets.all(2),
                  elevation: 8,
                ),
-                badgeContent: AccountAvatar(
+                badgeContent: AttachedCircleAvatar(
                  content: item.realm?.avatar,
                  radius: 10,
                  fallbackWidget: const Icon(
--- a/lib/widgets/channel/channel_member.dart
+++ b/lib/widgets/channel/channel_member.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/channel.dart';
@ -8,6 +7,7 @@ import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/account/relative_select.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class ChannelMemberListPopup extends StatefulWidget {
  final Channel channel;
@ -131,7 +131,7 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
            'channelMembers'.tr,
            style: Theme.of(context).textTheme.headlineSmall,
          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
          ListTile(
            tileColor: Theme.of(context).colorScheme.surfaceContainerHigh,
            contentPadding: const EdgeInsets.symmetric(horizontal: 20),
@ -152,7 +152,8 @@ class _ChannelMemberListPopupState extends State<ChannelMemberListPopup> {
                  title: Text(element.account.nick),
                  subtitle: Text(element.account.name),
                  leading: GestureDetector(
-                    child: AccountAvatar(content: element.account.avatar),
+                    child:
+                        AttachedCircleAvatar(content: element.account.avatar),
                    onTap: () {
                      showModalBottomSheet(
                        useRootNavigator: true,
--- a/lib/widgets/chat/call/call_no_content.dart
+++ b/lib/widgets/chat/call/call_no_content.dart
@ -74,7 +74,7 @@ class _NoContentWidgetState extends State<NoContentWidget>
              ),
            )
          ],
-          child: AccountAvatar(
+          child: AttachedCircleAvatar(
            content: widget.userinfo!.avatar,
            bgColor: Colors.transparent,
            radius: radius,
--- a/lib/widgets/chat/chat_event.dart
+++ b/lib/widgets/chat/chat_event.dart
@ -78,7 +78,7 @@ class ChatEvent extends StatelessWidget {
      child: AttachmentList(
        key: Key('m${item.uuid}attachments'),
        parentId: item.uuid,
-        attachmentsId: attachments,
+        attachmentIds: attachments,
        isColumn: true,
      ),
    );
@ -220,7 +220,7 @@ class ChatEvent extends StatelessWidget {
                children: [
                  Row(
                    children: [
-                      AccountAvatar(
+                      AttachedCircleAvatar(
                        content: item.sender.account.avatar,
                        radius: 9,
                      ),
@ -250,7 +250,8 @@ class ChatEvent extends StatelessWidget {
            crossAxisAlignment: CrossAxisAlignment.start,
            children: [
              GestureDetector(
-                child: AccountAvatar(content: item.sender.account.avatar),
+                child:
+                    AttachedCircleAvatar(content: item.sender.account.avatar),
                onTap: () {
                  showModalBottomSheet(
                    useRootNavigator: true,
--- a/lib/widgets/chat/chat_event_action.dart
+++ b/lib/widgets/chat/chat_event_action.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/models/channel.dart';
@ -7,6 +6,7 @@ import 'package:solian/models/event.dart';
 import 'package:solian/models/realm.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/widgets/chat/chat_event_deletion.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class ChatEventAction extends StatefulWidget {
  final Channel channel;
@ -73,7 +73,7 @@ class _ChatEventActionState extends State<ChatEventAction> {
              ),
            ],
          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
          Expanded(
            child: ListView(
              children: [
--- a/lib/widgets/chat/chat_event_list.dart
+++ b/lib/widgets/chat/chat_event_list.dart
@ -1,3 +1,4 @@
+import 'package:flutter/gestures.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
@ -34,9 +35,28 @@ class ChatEventList extends StatelessWidget {
    return a.createdAt.difference(b.createdAt).inMinutes <= 3;
  }

+  void _openActions(BuildContext context, Event item) {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => ChatEventAction(
+        channel: channel,
+        realm: channel.realm,
+        item: item,
+        onEdit: () {
+          onEdit(item);
+        },
+        onReply: () {
+          onReply(item);
+        },
+      ),
+    );
+  }
+
  @override
  Widget build(BuildContext context) {
    return CustomScrollView(
+      cacheExtent: 100,
      reverse: true,
      slivers: [
        Obx(() {
@ -64,50 +84,45 @@ class ChatEventList extends StatelessWidget {

              final item = chatController.currentEvents[index].data;

-              return GestureDetector(
-                behavior: HitTestBehavior.opaque,
-                child: Builder(builder: (context) {
-                  final widget = ChatEvent(
-                    key: Key('m${item!.uuid}'),
-                    item: item,
-                    isMerged: isMerged,
-                    chatController: chatController,
-                  ).paddingOnly(
-                    top: !isMerged ? 8 : 0,
-                    bottom: !hasMerged ? 8 : 0,
-                  );
+              return TapRegion(
+                child: GestureDetector(
+                  behavior: HitTestBehavior.opaque,
+                  child: Builder(builder: (context) {
+                    final widget = ChatEvent(
+                      key: Key('m${item!.uuid}'),
+                      item: item,
+                      isMerged: isMerged,
+                      chatController: chatController,
+                    ).paddingOnly(
+                      top: !isMerged ? 8 : 0,
+                      bottom: !hasMerged ? 8 : 0,
+                    );

-                  if (noAnimated) {
-                    return widget;
-                  } else {
-                    return widget
-                        .animate(
-                          key: Key('animated-m${item.uuid}'),
-                        )
-                        .slideY(
-                          curve: Curves.fastLinearToSlowEaseIn,
-                          duration: 250.ms,
-                          begin: 0.5,
-                          end: 0,
-                        );
+                    if (noAnimated) {
+                      return widget;
+                    } else {
+                      return widget
+                          .animate(
+                            key: Key('animated-m${item.uuid}'),
+                          )
+                          .slideY(
+                            curve: Curves.fastLinearToSlowEaseIn,
+                            duration: 250.ms,
+                            begin: 0.5,
+                            end: 0,
+                          );
+                    }
+                  }),
+                  onLongPress: () {
+                    _openActions(context, item!);
+                  },
+                ),
+                onTapInside: (event) {
+                  if (event.buttons == kSecondaryMouseButton) {
+                    _openActions(context, item!);
+                  } else if (event.buttons == kMiddleMouseButton) {
+                    onReply(item!);
                  }
-                }),
-                onLongPress: () {
-                  showModalBottomSheet(
-                    useRootNavigator: true,
-                    context: context,
-                    builder: (context) => ChatEventAction(
-                      channel: channel,
-                      realm: channel.realm,
-                      item: item!,
-                      onEdit: () {
-                        onEdit(item);
-                      },
-                      onReply: () {
-                        onReply(item);
-                      },
-                    ),
-                  );
                },
              );
            },
--- a/lib/widgets/chat/chat_message_input.dart
+++ b/lib/widgets/chat/chat_message_input.dart
@ -443,7 +443,7 @@ class _ChatMessageInputState extends State<ChatMessageInput> {
                          .map(
                            (x) => ChatMessageSuggestion(
                              type: 'users',
-                              leading: AccountAvatar(content: x.avatar),
+                              leading: AttachedCircleAvatar(content: x.avatar),
                              display: x.nick,
                              content: '@${x.name}',
                            ),
--- a/lib/widgets/link_expansion.dart
+++ b/lib/widgets/link_expansion.dart
@ -2,15 +2,21 @@ import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:flutter_svg/svg.dart';
 import 'package:get/get.dart';
+import 'package:solian/models/link.dart';
 import 'package:solian/providers/link_expander.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
 import 'package:url_launcher/url_launcher_string.dart';

-class LinkExpansion extends StatelessWidget {
+class LinkExpansion extends StatefulWidget {
  final String content;

  const LinkExpansion({super.key, required this.content});

+  @override
+  State<LinkExpansion> createState() => _LinkExpansionState();
+}
+
+class _LinkExpansionState extends State<LinkExpansion> {
  Widget _buildImage(String url, {double? width, double? height}) {
    if (url.endsWith('svg')) {
      return SvgPicture.network(url, width: width, height: height);
@ -22,61 +28,74 @@ class LinkExpansion extends StatelessWidget {
    );
  }

-  @override
-  Widget build(BuildContext context) {
+  List<LinkMeta>? _meta;
+
+  Future<void> _doExpand() async {
    final linkRegex = RegExp(
      r'(?<!\()(?:(?:https?):\/\/|www\.)(?:[-_a-z0-9]+\.)*(?:[-a-z0-9]+\.[-a-z0-9]+)[^\s<]*[^\s<?!.,:*_~]',
    );
-    final matches = linkRegex.allMatches(content);
-    if (matches.isEmpty) {
-      return const SizedBox.shrink();
-    }
+    final matches = linkRegex.allMatches(widget.content);
+    if (matches.isEmpty) return;

    final LinkExpandProvider expandController = Get.find();

+    if (matches.isEmpty) return;
+
+    List<LinkMeta> out = List.empty(growable: true);
+    for (final x in matches) {
+      final result = await expandController.expandLink(x.group(0)!);
+      if (result != null) out.add(result);
+    }
+
+    setState(() => _meta = out);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    _doExpand();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    if (_meta?.isEmpty ?? true) return const SizedBox.shrink();
+
    return Wrap(
-      children: matches.map((x) {
+      children: _meta!.map((x) {
        return Container(
          constraints: BoxConstraints(
-            maxWidth: matches.length == 1 ? 480 : 340,
+            maxWidth: _meta!.length == 1 ? 480 : 340,
          ),
-          child: FutureBuilder(
-            future: expandController.expandLink(x.group(0)!),
-            builder: (context, snapshot) {
-              if (!snapshot.hasData) {
-                return const SizedBox.shrink();
-              }
-
+          child: Builder(
+            builder: (context) {
              final isRichDescription = [
                'solsynth.dev',
-              ].contains(Uri.parse(snapshot.data!.url).host);
+              ].contains(Uri.parse(x.url).host);

              return GestureDetector(
                child: Card(
                  child: Column(
                    crossAxisAlignment: CrossAxisAlignment.start,
                    children: [
-                      if ([
-                        (snapshot.data!.icon?.isNotEmpty ?? false),
-                        snapshot.data!.siteName != null
-                      ].any((x) => x))
+                      if ([(x.icon?.isNotEmpty ?? false), x.siteName != null]
+                          .any((x) => x))
                        Row(
                          children: [
-                            if (snapshot.data!.icon?.isNotEmpty ?? false)
+                            if (x.icon?.isNotEmpty ?? false)
                              ClipRRect(
                                borderRadius: const BorderRadius.all(
                                  Radius.circular(8),
                                ),
                                child: _buildImage(
-                                  snapshot.data!.icon!,
+                                  x.icon!,
                                  width: 32,
                                  height: 32,
                                ),
                              ).paddingOnly(right: 8),
-                            if (snapshot.data!.siteName != null)
+                            if (x.siteName != null)
                              Expanded(
                                child: Text(
-                                  snapshot.data!.siteName!,
+                                  x.siteName!,
                                  style: Theme.of(context).textTheme.labelLarge,
                                  maxLines: 1,
                                  overflow: TextOverflow.ellipsis,
@ -84,32 +103,27 @@ class LinkExpansion extends StatelessWidget {
                              ),
                          ],
                        ).paddingOnly(
-                          bottom: (snapshot.data!.icon?.isNotEmpty ?? false)
-                              ? 8
-                              : 4,
+                          bottom: (x.icon?.isNotEmpty ?? false) ? 8 : 4,
                        ),
-                      if (snapshot.data!.image != null &&
-                          (snapshot.data!.image?.startsWith('http') ?? false))
+                      if (x.image != null &&
+                          (x.image?.startsWith('http') ?? false))
                        ClipRRect(
                          borderRadius: const BorderRadius.all(
                            Radius.circular(8),
                          ),
-                          child: _buildImage(
-                            snapshot.data!.image!,
-                          ),
+                          child: _buildImage(x.image!),
                        ).paddingOnly(bottom: 8),
                      Text(
-                        snapshot.data!.title ?? 'No Title',
+                        x.title ?? 'No Title',
                        maxLines: 1,
                        overflow: TextOverflow.fade,
                        style: Theme.of(context).textTheme.bodyLarge,
                      ),
-                      if (snapshot.data!.description != null &&
-                          isRichDescription)
-                        MarkdownBody(data: snapshot.data!.description!)
-                      else if (snapshot.data!.description != null)
+                      if (x.description != null && isRichDescription)
+                        MarkdownBody(data: x.description!)
+                      else if (x.description != null)
                        Text(
-                          snapshot.data!.description!,
+                          x.description!,
                          maxLines: 3,
                          overflow: TextOverflow.ellipsis,
                        ),
@ -117,7 +131,7 @@ class LinkExpansion extends StatelessWidget {
                  ).paddingAll(12),
                ),
                onTap: () {
-                  launchUrlString(x.group(0)!);
+                  launchUrlString(x.url);
                },
              );
            },
--- a/lib/widgets/loading_indicator.dart
+++ b/lib/widgets/loading_indicator.dart
@ -0,0 +1,89 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:gap/gap.dart';
+
+class LoadingIndicator extends StatefulWidget {
+  final bool isActive;
+  final Color? backgroundColor;
+
+  const LoadingIndicator({
+    super.key,
+    this.isActive = true,
+    this.backgroundColor,
+  });
+
+  @override
+  State<LoadingIndicator> createState() => _LoadingIndicatorState();
+}
+
+class _LoadingIndicatorState extends State<LoadingIndicator>
+    with SingleTickerProviderStateMixin {
+  late AnimationController _controller;
+  late Animation<double> _animation;
+
+  @override
+  void initState() {
+    super.initState();
+
+    _controller = AnimationController(
+      vsync: this,
+      duration: const Duration(milliseconds: 300),
+    );
+
+    _animation = CurvedAnimation(
+      parent: _controller,
+      curve: Curves.easeInOut,
+    );
+
+    if (widget.isActive) {
+      _controller.forward();
+    } else {
+      _controller.reverse();
+    }
+  }
+
+  @override
+  void didUpdateWidget(covariant LoadingIndicator oldWidget) {
+    super.didUpdateWidget(oldWidget);
+
+    if (widget.isActive != oldWidget.isActive) {
+      if (widget.isActive) {
+        _controller.forward();
+      } else {
+        _controller.reverse();
+      }
+    }
+  }
+
+  @override
+  void dispose() {
+    _controller.dispose();
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return SizeTransition(
+      sizeFactor: _animation,
+      axisAlignment: -1, // Align animation from the top
+      child: Container(
+        padding: const EdgeInsets.symmetric(vertical: 16, horizontal: 24),
+        color: widget.backgroundColor ??
+            Theme.of(context).colorScheme.surfaceContainerLow.withOpacity(0.5),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.center,
+          crossAxisAlignment: CrossAxisAlignment.center,
+          children: [
+            const SizedBox(
+              height: 16,
+              width: 16,
+              child: CircularProgressIndicator(strokeWidth: 2.5),
+            ),
+            const Gap(8),
+            Text('loading'.tr),
+          ],
+        ),
+      ),
+    );
+  }
+}
--- a/lib/widgets/markdown_text_content.dart
+++ b/lib/widgets/markdown_text_content.dart
@ -1,19 +1,25 @@
+import 'dart:ui';
+
 import 'package:flutter/material.dart';
-import 'package:flutter_markdown_selectionarea/flutter_markdown.dart';
-import 'package:gap/gap.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:get/get.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:markdown/markdown.dart' as markdown;
-import 'package:markdown/markdown.dart';
+import 'package:path/path.dart';
+import 'package:solian/models/attachment.dart';
 import 'package:solian/providers/stickers.dart';
+import 'package:solian/widgets/attachments/attachment_item.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/auto_cache_image.dart';
+import 'package:syntax_highlight/syntax_highlight.dart';
 import 'package:url_launcher/url_launcher_string.dart';

 import 'account/account_profile_popup.dart';

-class MarkdownTextContent extends StatelessWidget {
+class MarkdownTextContent extends StatefulWidget {
  final String content;
  final String parentId;
+  final List<Attachment>? attachments;
  final bool isSelectable;
  final bool isLargeText;
  final bool isAutoWarp;
@ -22,190 +28,228 @@ class MarkdownTextContent extends StatelessWidget {
    super.key,
    required this.content,
    required this.parentId,
+    this.attachments,
    this.isSelectable = false,
    this.isLargeText = false,
    this.isAutoWarp = false,
  });

-  Widget _buildContent(BuildContext context) {
+  @override
+  State<MarkdownTextContent> createState() => _MarkdownTextContentState();
+}
+
+class _MarkdownTextContentState extends State<MarkdownTextContent> {
+  final List<int> _stickerSizes = [];
+
+  @override
+  initState() {
+    super.initState();
    final stickerRegex = RegExp(r':([-\w]+):');

    // Split the content into paragraphs
-    final paragraphs = content.split(RegExp(r'\n\s*\n'));
+    final paragraphs = widget.content.split(RegExp(r'\n\s*\n'));

    // Iterate over each paragraph to process stickers individually
-    List<Widget> contentWidgets = [];
+
    for (var idx = 0; idx < paragraphs.length; idx++) {
      // Getting paragraph
      var paragraph = paragraphs[idx];

-      // Auto adding new-lines
-      if (isAutoWarp) {
-        paragraph = paragraph.replaceAll('\n', '\\\n');
-      }
-
      // Matching stickers
      final stickerMatch = stickerRegex.allMatches(paragraph);
-      final isOnlySticker =
-          paragraph.replaceAll(stickerRegex, '').trim().isEmpty;
+      if (stickerMatch.length > 3) {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 16));
+      } else if (stickerMatch.length > 1) {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 32));
+      } else {
+        _stickerSizes.addAll(List.filled(stickerMatch.length, 128));
+      }
+    }
+  }

-      contentWidgets.add(
-        Markdown(
-          shrinkWrap: true,
-          physics: const NeverScrollableScrollPhysics(),
-          data: paragraph,
-          padding: EdgeInsets.zero,
-          styleSheet: MarkdownStyleSheet.fromTheme(
-            Theme.of(context),
-          ).copyWith(
-            textScaleFactor: isLargeText ? 1.1 : 1,
-            blockquote: TextStyle(
-              color: Theme.of(context).colorScheme.onSurfaceVariant,
-            ),
-            blockquoteDecoration: BoxDecoration(
-              color: Theme.of(context).colorScheme.surfaceContainerHigh,
-              borderRadius: const BorderRadius.all(Radius.circular(4)),
-            ),
-            horizontalRuleDecoration: BoxDecoration(
-              border: Border(
-                top: BorderSide(
-                  width: 1.0,
-                  color: Theme.of(context).dividerColor,
-                ),
+  Widget _buildContent(BuildContext context) {
+    var stickerIdx = 0;
+
+    return Markdown(
+      shrinkWrap: true,
+      physics: const NeverScrollableScrollPhysics(),
+      data: widget.content,
+      padding: EdgeInsets.zero,
+      styleSheet: MarkdownStyleSheet.fromTheme(
+        Theme.of(context),
+      ).copyWith(
+          textScaler: TextScaler.linear(widget.isLargeText ? 1.1 : 1),
+          blockquote: TextStyle(
+            color: Theme.of(context).colorScheme.onSurfaceVariant,
+          ),
+          blockquoteDecoration: BoxDecoration(
+            color: Theme.of(context).colorScheme.surfaceContainerHigh,
+            borderRadius: const BorderRadius.all(Radius.circular(4)),
+          ),
+          horizontalRuleDecoration: BoxDecoration(
+            border: Border(
+              top: BorderSide(
+                width: 1.0,
+                color: Theme.of(context).dividerColor,
              ),
            ),
          ),
-          extensionSet: markdown.ExtensionSet(
-            markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
-            <markdown.InlineSyntax>[
-              _UserNameCardInlineSyntax(),
-              _CustomEmoteInlineSyntax(),
-              markdown.EmojiSyntax(),
-              markdown.AutolinkSyntax(),
-              markdown.AutolinkExtensionSyntax(),
-              ...markdown.ExtensionSet.gitHubFlavored.inlineSyntaxes
-            ],
-          ),
-          onTapLink: (text, href, title) async {
-            if (href == null) return;
-            if (href.startsWith('solink://')) {
-              final segments = href.replaceFirst('solink://', '').split('/');
-              switch (segments[0]) {
-                case 'users':
-                  showModalBottomSheet(
-                    useRootNavigator: true,
-                    isScrollControlled: true,
-                    backgroundColor: Theme.of(context).colorScheme.surface,
-                    context: context,
-                    builder: (context) => AccountProfilePopup(
-                      name: segments[1],
-                    ),
-                  );
+          codeblockDecoration: BoxDecoration(
+            border: Border.all(
+              color: Theme.of(context).dividerColor,
+              width: 0.3,
+            ),
+            borderRadius: const BorderRadius.all(Radius.circular(4)),
+            color: Theme.of(context).colorScheme.surface.withOpacity(0.5),
+          )),
+      builders: {
+        'code': _MarkdownTextCodeElement(),
+      },
+      softLineBreak: true,
+      extensionSet: markdown.ExtensionSet(
+        <markdown.BlockSyntax>[
+          markdown.CodeBlockSyntax(),
+          ...markdown.ExtensionSet.commonMark.blockSyntaxes,
+          ...markdown.ExtensionSet.gitHubFlavored.blockSyntaxes,
+        ],
+        <markdown.InlineSyntax>[
+          if (widget.isAutoWarp) markdown.LineBreakSyntax(),
+          _UserNameCardInlineSyntax(),
+          _CustomEmoteInlineSyntax(),
+          markdown.AutolinkSyntax(),
+          markdown.AutolinkExtensionSyntax(),
+          markdown.CodeSyntax(),
+          ...markdown.ExtensionSet.commonMark.inlineSyntaxes,
+          ...markdown.ExtensionSet.gitHubFlavored.inlineSyntaxes
+        ],
+      ),
+      onTapLink: (text, href, title) async {
+        if (href == null) return;
+        if (href.startsWith('solink://')) {
+          final segments = href.replaceFirst('solink://', '').split('/');
+          switch (segments[0]) {
+            case 'users':
+              showModalBottomSheet(
+                useRootNavigator: true,
+                isScrollControlled: true,
+                backgroundColor: Theme.of(context).colorScheme.surface,
+                context: context,
+                builder: (context) => AccountProfilePopup(
+                  name: segments[1],
+                ),
+              );
+          }
+          return;
+        }
+
+        await launchUrlString(
+          href,
+          mode: LaunchMode.externalApplication,
+        );
+      },
+      imageBuilder: (uri, title, alt) {
+        var url = uri.toString();
+        double? width, height;
+        BoxFit? fit;
+        if (url.startsWith('solink://')) {
+          final segments = url.replaceFirst('solink://', '').split('/');
+          switch (segments[0]) {
+            case 'stickers':
+              double radius = 4;
+              final StickerProvider sticker = Get.find();
+
+              // Adjust sticker size based on the sticker count in this paragraph
+              width =
+                  _stickerSizes.elementAtOrNull(stickerIdx)?.toDouble() ?? 16;
+              height =
+                  _stickerSizes.elementAtOrNull(stickerIdx)?.toDouble() ?? 16;
+              if (width > 16) {
+                radius = 8;
              }
-              return;
-            }
-
-            await launchUrlString(
-              href,
-              mode: LaunchMode.externalApplication,
-            );
-          },
-          imageBuilder: (uri, title, alt) {
-            var url = uri.toString();
-            double? width, height;
-            BoxFit? fit;
-            if (url.startsWith('solink://')) {
-              final segments = url.replaceFirst('solink://', '').split('/');
-              switch (segments[0]) {
-                case 'stickers':
-                  double radius = 8;
-                  final StickerProvider sticker = Get.find();
-
-                  // Adjust sticker size based on the sticker count in this paragraph
-                  if (stickerMatch.length <= 1 && isOnlySticker) {
-                    width = 128;
-                    height = 128;
-                  } else if (stickerMatch.length <= 3 && isOnlySticker) {
-                    width = 32;
-                    height = 32;
-                  } else {
-                    radius = 4;
-                    width = 16;
-                    height = 16;
-                  }
-                  fit = BoxFit.contain;
-                  return ClipRRect(
-                    borderRadius: BorderRadius.all(Radius.circular(radius)),
-                    child: Container(
-                      width: width,
-                      height: height,
-                      color: Theme.of(context).colorScheme.surfaceContainer,
-                      child: FutureBuilder(
-                        future: sticker.getStickerByAlias(segments[1]),
-                        builder: (context, snapshot) {
-                          if (!snapshot.hasData) {
-                            return const Center(
-                                child: CircularProgressIndicator());
-                          }
-                          return AutoCacheImage(
-                            snapshot.data!.imageUrl,
-                            width: width,
-                            height: height,
-                            fit: fit,
-                            noErrorWidget: true,
-                          );
-                        },
-                      ),
-                    ),
-                  ).paddingSymmetric(vertical: 4);
-                case 'attachments':
-                  const radius = BorderRadius.all(Radius.circular(8));
-                  return LimitedBox(
-                    maxHeight: MediaQuery.of(context).size.width,
+              stickerIdx++;
+              fit = BoxFit.contain;
+              return ClipRRect(
+                borderRadius: BorderRadius.all(Radius.circular(radius)),
+                child: Container(
+                  width: width,
+                  height: height,
+                  color: Theme.of(context).colorScheme.surfaceContainer,
+                  child: FutureBuilder(
+                    future: sticker.getStickerByAlias(segments[1]),
+                    builder: (context, snapshot) {
+                      if (!snapshot.hasData) {
+                        return const Center(child: CircularProgressIndicator());
+                      }
+                      return AutoCacheImage(
+                        snapshot.data!.imageUrl,
+                        width: width,
+                        height: height,
+                        fit: fit,
+                        noErrorWidget: true,
+                      );
+                    },
+                  ),
+                ),
+              ).paddingSymmetric(vertical: 4);
+            case 'attachments':
+              final match = widget.attachments
+                  ?.where((x) => x.rid == segments[1])
+                  .firstOrNull;
+              const radius = BorderRadius.all(Radius.circular(8));
+              if (match != null) {
+                final isImage =
+                    match.mimetype.split('/').firstOrNull == 'image';
+                double ratio = match.metadata?['ratio']?.toDouble() ??
+                    (isImage ? 1 : 16 / 9);
+                return LimitedBox(
+                  maxWidth: 480,
+                  maxHeight: 640,
+                  child: AspectRatio(
+                    aspectRatio: ratio,
                    child: ClipRRect(
                      borderRadius: radius,
-                      child: AttachmentSelfContainedEntry(
-                        isDense: true,
-                        parentId: parentId,
-                        rid: segments[1],
+                      child: AttachmentItem(
+                        parentId: widget.parentId,
+                        item: match,
                      ),
                    ),
-                  ).paddingSymmetric(vertical: 4);
+                  ),
+                ).paddingSymmetric(vertical: 4);
+              } else {
+                return LimitedBox(
+                  maxHeight: MediaQuery.of(context).size.width,
+                  child: ClipRRect(
+                    borderRadius: radius,
+                    child: AttachmentSelfContainedEntry(
+                      isDense: true,
+                      parentId: widget.parentId,
+                      rid: segments[1],
+                    ),
+                  ),
+                ).paddingSymmetric(vertical: 4);
              }
-            }
-            return AutoCacheImage(
-              url,
-              width: width,
-              height: height,
-              fit: fit,
-            );
-          },
-        ),
-      );
-
-      if (idx < paragraphs.length - 1) {
-        contentWidgets.add(const Gap(4));
-      }
-    }
-
-    // Return the list of widgets for the paragraphs
-    return Column(
-      mainAxisSize: MainAxisSize.min,
-      crossAxisAlignment: CrossAxisAlignment.start,
-      children: contentWidgets,
+          }
+        }
+        return AutoCacheImage(
+          url,
+          width: width,
+          height: height,
+          fit: fit,
+        );
+      },
    );
  }

  @override
  Widget build(BuildContext context) {
-    if (isSelectable) {
+    if (widget.isSelectable) {
      return SelectionArea(child: _buildContent(context));
    }
    return _buildContent(context);
  }
 }

-class _UserNameCardInlineSyntax extends InlineSyntax {
+class _UserNameCardInlineSyntax extends markdown.InlineSyntax {
  _UserNameCardInlineSyntax() : super(r'@[a-zA-Z0-9_]+');

  @override
@ -221,7 +265,7 @@ class _UserNameCardInlineSyntax extends InlineSyntax {
  }
 }

-class _CustomEmoteInlineSyntax extends InlineSyntax {
+class _CustomEmoteInlineSyntax extends markdown.InlineSyntax {
  _CustomEmoteInlineSyntax() : super(r':([-\w]+):');

  @override
@ -241,3 +285,48 @@ class _CustomEmoteInlineSyntax extends InlineSyntax {
    return true;
  }
 }
+
+class _MarkdownTextCodeElement extends MarkdownElementBuilder {
+  @override
+  Widget? visitElementAfter(
+    markdown.Element element,
+    TextStyle? preferredStyle,
+  ) {
+    var language = '';
+
+    if (element.attributes['class'] != null) {
+      String lg = element.attributes['class'] as String;
+      language = lg.substring(9).trim();
+    }
+    return SizedBox(
+      child: FutureBuilder(
+        future: (() async {
+          final docPath = '../../../';
+          final highlightingPath =
+              join(docPath, 'assets/highlighting', language);
+          await Highlighter.initialize([highlightingPath]);
+          return Highlighter(
+            language: highlightingPath,
+            theme: PlatformDispatcher.instance.platformBrightness ==
+                    Brightness.light
+                ? await HighlighterTheme.loadLightTheme()
+                : await HighlighterTheme.loadDarkTheme(),
+          );
+        })(),
+        builder: (context, snapshot) {
+          if (snapshot.hasData) {
+            final highlighter = snapshot.data!;
+            return Text.rich(
+              highlighter.highlight(element.textContent.trim()),
+              style: GoogleFonts.robotoMono(),
+            );
+          }
+          return Text(
+            element.textContent.trim(),
+            style: GoogleFonts.robotoMono(),
+          );
+        },
+      ),
+    ).paddingAll(8);
+  }
+}
--- a/lib/widgets/navigation/app_account_widget.dart
+++ b/lib/widgets/navigation/app_account_widget.dart
@ -69,7 +69,7 @@ class _AppAccountWidgetState extends State<AppAccountWidget> {
            bottom: 0,
            end: -2,
          ),
-          child: AccountAvatar(
+          child: AttachedCircleAvatar(
            radius: 14,
            content: auth.userProfile.value!['avatar'],
          ),
--- a/lib/widgets/navigation/app_navigation_rail.dart
+++ b/lib/widgets/navigation/app_navigation_rail.dart
@ -27,39 +27,43 @@ class _AppNavigationRailState extends State<AppNavigationRail> {

  @override
  Widget build(BuildContext context) {
-    return NavigationRail(
-      selectedIndex: _currentIndex,
-      labelType: NavigationRailLabelType.selected,
-      groupAlignment: -1,
-      destinations: AppNavigation.destinations
-          .sublist(0, AppNavigation.destinations.length - 1)
-          .map(
-            (x) => NavigationRailDestination(
-              icon: x.icon,
-              label: Text(x.label),
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: NavigationRail(
+        selectedIndex: _currentIndex,
+        labelType: NavigationRailLabelType.selected,
+        groupAlignment: -1,
+        destinations: AppNavigation.destinations
+            .sublist(0, AppNavigation.destinations.length - 1)
+            .map(
+              (x) => NavigationRailDestination(
+                icon: x.icon,
+                label: Text(x.label),
+              ),
+            )
+            .toList(),
+        trailing: Expanded(
+          child: Align(
+            alignment: Alignment.bottomCenter,
+            child: IconButton(
+              icon: AppNavigation.destinations.last.icon,
+              tooltip: AppNavigation.destinations.last.label,
+              onPressed: () {
+                setState(() => _currentIndex = null);
+                AppRouter.instance
+                    .goNamed(AppNavigation.destinations.last.page);
+              },
            ),
-          )
-          .toList(),
-      trailing: Expanded(
-        child: Align(
-          alignment: Alignment.bottomCenter,
-          child: IconButton(
-            icon: AppNavigation.destinations.last.icon,
-            tooltip: AppNavigation.destinations.last.label,
-            onPressed: () {
-              setState(() => _currentIndex = null);
-              AppRouter.instance.goNamed(AppNavigation.destinations.last.page);
-            },
          ),
        ),
+        onDestinationSelected: (idx) {
+          setState(() => _currentIndex = idx);
+          AppRouter.instance.goNamed(AppNavigation.destinations[idx].page);
+        },
+      ).paddingOnly(
+        top: max(16, MediaQuery.of(context).padding.top),
+        bottom: max(16, MediaQuery.of(context).padding.bottom),
      ),
-      onDestinationSelected: (idx) {
-        setState(() => _currentIndex = idx);
-        AppRouter.instance.goNamed(AppNavigation.destinations[idx].page);
-      },
-    ).paddingOnly(
-      top: max(16, MediaQuery.of(context).padding.top),
-      bottom: max(16, MediaQuery.of(context).padding.bottom),
    );
  }
 }
--- a/lib/widgets/navigation/realm_switcher.dart
+++ b/lib/widgets/navigation/realm_switcher.dart
@ -36,7 +36,7 @@ class RealmSwitcher extends StatelessWidget {
                      mainAxisAlignment: MainAxisAlignment.center,
                      children: [
                        if (item != null)
-                          AccountAvatar(
+                          AttachedCircleAvatar(
                            content: item.avatar,
                            radius: 14,
                            fallbackWidget: const Icon(
--- a/lib/widgets/posts/post_action.dart
+++ b/lib/widgets/posts/post_action.dart
@ -1,17 +1,21 @@
 import 'dart:math';

+import 'package:file_saver/file_saver.dart';
 import 'package:firebase_analytics/firebase_analytics.dart';
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
+import 'package:screenshot/screenshot.dart';
 import 'package:share_plus/share_plus.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/platform.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/content/posts.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/posts/post_editor.dart';
+import 'package:solian/widgets/loading_indicator.dart';
+import 'package:solian/widgets/posts/post_share.dart';
 import 'package:solian/widgets/reports/abuse_report.dart';

 class PostAction extends StatefulWidget {
@ -25,20 +29,14 @@ class PostAction extends StatefulWidget {
 }

 class _PostActionState extends State<PostAction> {
-  bool _isBusy = true;
+  bool _isBusy = false;
  bool _canModifyContent = false;

  void _checkAbleToModifyContent() async {
    final AuthProvider auth = Get.find();
    if (auth.isAuthorized.isFalse) return;

-    setState(() => _isBusy = true);
-
-    setState(() {
-      _canModifyContent =
-          auth.userProfile.value!['id'] == widget.item.author.id;
-      _isBusy = false;
-    });
+    _canModifyContent = auth.userProfile.value!['id'] == widget.item.author.id;
  }

  Future<void> _doShare({bool noUri = false}) async {
@ -69,7 +67,8 @@ class _PostActionState extends State<PostAction> {
          'link': 'https://solsynth.dev/posts/$id',
        }),
        subject: 'postShareSubject'.trParams({
-          'username': widget.item.author.nick,
+          'username': '@${widget.item.author.name}',
+          'title': widget.item.body['title'] ?? '#${widget.item.id}',
        }),
        sharePositionOrigin: box!.localToGlobal(Offset.zero) & box.size,
      );
@ -84,6 +83,78 @@ class _PostActionState extends State<PostAction> {
    }
  }

+  Future<void> _shareImage() async {
+    final List<String> attachments = widget.item.body['attachments'] is List
+        ? List.from(widget.item.body['attachments']?.whereType<String>())
+        : List.empty();
+    final hasMultipleAttachment = attachments.length > 1;
+
+    setState(() => _isBusy = true);
+
+    final double width = hasMultipleAttachment ? 640 : 480;
+
+    final screenshot = ScreenshotController();
+    final image = await screenshot.captureFromLongWidget(
+      MediaQuery(
+        data: MediaQuery.of(context).copyWith(
+          size: Size(width, double.infinity),
+        ),
+        child: PostShareImage(item: widget.item),
+      ),
+      context: context,
+      pixelRatio: 2,
+      constraints: BoxConstraints(
+        minWidth: 480,
+        maxWidth: width,
+        minHeight: 640,
+        maxHeight: double.infinity,
+      ),
+    );
+
+    final filename = 'share_post#${widget.item.id}';
+
+    if (PlatformInfo.isAndroid || PlatformInfo.isIOS) {
+      final box = context.findRenderObject() as RenderBox?;
+
+      final file = XFile.fromData(
+        image,
+        mimeType: 'image/png',
+        name: filename,
+      );
+      await Share.shareXFiles(
+        [file],
+        subject: 'postShareSubject'.trParams({
+          'username': '@${widget.item.author.name}',
+          'title': widget.item.body['title'] ?? '#${widget.item.id}',
+        }),
+        sharePositionOrigin: box!.localToGlobal(Offset.zero) & box.size,
+      );
+    } else {
+      final filepath = await FileSaver.instance.saveFile(
+        name: filename,
+        ext: 'png',
+        mimeType: MimeType.png,
+        bytes: image,
+      );
+      context.showSnackbar('fileSavedAt'.trParams({'path': filepath}));
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<Post> _getFullPost() async {
+    final PostProvider posts = Get.find();
+
+    try {
+      final resp = await posts.getPost(widget.item.id.toString());
+      return Post.fromJson(resp.body);
+    } catch (e) {
+      context.showErrorDialog(e).then((_) => Navigator.pop(context));
+    }
+
+    return widget.item;
+  }
+
  @override
  void initState() {
    super.initState();
@ -127,7 +198,13 @@ class _PostActionState extends State<PostAction> {
              ),
            ],
          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(
+            isActive: _isBusy,
+            backgroundColor: Theme.of(context)
+                .colorScheme
+                .surfaceContainerHigh
+                .withOpacity(0.5),
+          ),
          Expanded(
            child: ListView(
              children: [
@ -135,16 +212,30 @@ class _PostActionState extends State<PostAction> {
                  contentPadding: const EdgeInsets.symmetric(horizontal: 24),
                  leading: const Icon(Icons.share),
                  title: Text('share'.tr),
-                  trailing: PlatformInfo.isIOS || PlatformInfo.isAndroid
-                      ? IconButton(
+                  trailing: Row(
+                    mainAxisSize: MainAxisSize.min,
+                    children: [
+                      if (PlatformInfo.isIOS || PlatformInfo.isAndroid)
+                        IconButton(
                          icon: const Icon(Icons.link_off),
                          tooltip: 'shareNoUri'.tr,
                          onPressed: () async {
                            await _doShare(noUri: true);
                            Navigator.pop(context);
                          },
-                        )
-                      : null,
+                        ),
+                      IconButton(
+                        icon: const Icon(Icons.image),
+                        tooltip: 'shareImage'.tr,
+                        onPressed: _isBusy
+                            ? null
+                            : () async {
+                                await _shareImage();
+                                Navigator.pop(context);
+                              },
+                      ),
+                    ],
+                  ),
                  onTap: () async {
                    await _doShare();
                    Navigator.pop(context);
@ -221,15 +312,23 @@ class _PostActionState extends State<PostAction> {
                    contentPadding: const EdgeInsets.symmetric(horizontal: 24),
                    leading: const Icon(Icons.edit),
                    title: Text('edit'.tr),
-                    onTap: () async {
-                      Navigator.pop(
-                        context,
-                        AppRouter.instance.pushNamed(
-                          'postEditor',
-                          extra: PostPublishArguments(edit: widget.item),
-                        ),
-                      );
-                    },
+                    onTap: _isBusy
+                        ? null
+                        : () async {
+                            setState(() => _isBusy = true);
+                            var item = widget.item;
+                            if (item.body?['content_truncated'] == true) {
+                              item = await _getFullPost();
+                            }
+                            Navigator.pop(
+                              context,
+                              AppRouter.instance.pushNamed(
+                                'postEditor',
+                                extra: PostPublishArguments(edit: item),
+                              ),
+                            );
+                            if (mounted) setState(() => _isBusy = false);
+                          },
                  ),
                if (_canModifyContent)
                  ListTile(
--- a/lib/widgets/posts/post_creation.dart
+++ b/lib/widgets/posts/post_creation.dart
@ -0,0 +1,108 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/router.dart';
+
+class PostCreatePopup extends StatelessWidget {
+  final bool hideDraftBox;
+
+  const PostCreatePopup({
+    super.key,
+    this.hideDraftBox = false,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+
+    if (auth.isAuthorized.isFalse) {
+      return const SizedBox.shrink();
+    }
+
+    final List<dynamic> actionList = [
+      (
+        icon: const Icon(Icons.post_add),
+        label: 'postEditorModeStory'.tr,
+        onTap: () {
+          Navigator.pop(
+            context,
+            AppRouter.instance.pushNamed(
+              'postEditor',
+              queryParameters: {
+                'mode': 0.toString(),
+              },
+            ),
+          );
+        },
+      ),
+      (
+        icon: const Icon(Icons.description),
+        label: 'postEditorModeArticle'.tr,
+        onTap: () {
+          Navigator.pop(
+            context,
+            AppRouter.instance.pushNamed(
+              'postEditor',
+              queryParameters: {
+                'mode': 1.toString(),
+              },
+            ),
+          );
+        },
+      ),
+      (
+        icon: const Icon(Icons.drafts),
+        label: 'draftBoxOpen'.tr,
+        onTap: () {
+          Navigator.pop(
+            context,
+            AppRouter.instance.pushNamed('draftBox'),
+          );
+        },
+      ),
+    ];
+
+    return SizedBox(
+      height: MediaQuery.of(context).size.height * 0.38,
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            'postNew'.tr,
+            style: Theme.of(context).textTheme.headlineSmall,
+          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+          Expanded(
+            child: GridView.count(
+              physics: const NeverScrollableScrollPhysics(),
+              crossAxisCount: 3,
+              children: actionList
+                  .map((x) => Card(
+                        color: Theme.of(context).colorScheme.surfaceContainer,
+                        child: InkWell(
+                          borderRadius:
+                              const BorderRadius.all(Radius.circular(8)),
+                          onTap: x.onTap,
+                          child: Column(
+                            crossAxisAlignment: CrossAxisAlignment.start,
+                            children: [
+                              x.icon,
+                              const Gap(8),
+                              Expanded(
+                                child: Text(
+                                  x.label,
+                                  overflow: TextOverflow.fade,
+                                ),
+                              ),
+                            ],
+                          ).paddingAll(18),
+                        ),
+                      ))
+                  .toList(),
+            ).paddingSymmetric(horizontal: 20),
+          ),
+        ],
+      ),
+    );
+  }
+}
--- a/lib/widgets/posts/post_item.dart
+++ b/lib/widgets/posts/post_item.dart
@ -1,6 +1,5 @@
 import 'package:animations/animations.dart';
 import 'package:flutter/material.dart';
-import 'package:flutter/rendering.dart';
 import 'package:flutter_animate/flutter_animate.dart';
 import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:gap/gap.dart';
@ -8,11 +7,11 @@ import 'package:get/get.dart';
 import 'package:intl/intl.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/content/posts.dart';
+import 'package:solian/router.dart';
 import 'package:solian/screens/posts/post_detail.dart';
 import 'package:solian/shells/title_shell.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/link_expansion.dart';
 import 'package:solian/widgets/markdown_text_content.dart';
@ -31,11 +30,15 @@ class PostItem extends StatefulWidget {
  final bool isShowEmbed;
  final bool isOverrideEmbedClickable;
  final bool isFullDate;
-  final bool isFullContent;
  final bool isContentSelectable;
+  final bool isNonScrollAttachment;
  final bool showFeaturedReply;
  final String? attachmentParent;
-  final Color? backgroundColor;
+
+  final EdgeInsets? padding;
+
+  final Function? onComment;
+  final Function? onTapMore;

  const PostItem({
    super.key,
@ -47,11 +50,13 @@ class PostItem extends StatefulWidget {
    this.isShowEmbed = true,
    this.isOverrideEmbedClickable = false,
    this.isFullDate = false,
-    this.isFullContent = false,
    this.isContentSelectable = false,
+    this.isNonScrollAttachment = false,
    this.showFeaturedReply = false,
    this.attachmentParent,
-    this.backgroundColor,
+    this.padding,
+    this.onComment,
+    this.onTapMore,
  });

  @override
@ -64,14 +69,20 @@ class _PostItemState extends State<PostItem> {
  Color get _unFocusColor =>
      Theme.of(context).colorScheme.onSurface.withOpacity(0.75);

+  static final visibilityIcons = [
+    Icons.public,
+    Icons.group,
+    Icons.visibility,
+    Icons.visibility_off,
+    Icons.lock,
+  ];
+
  @override
  void initState() {
    item = widget.item;
    super.initState();
  }

-  double _contentHeight = 0;
-
  @override
  Widget build(BuildContext context) {
    final List<String> attachments = item.body['attachments'] is List
@ -89,37 +100,26 @@ class _PostItemState extends State<PostItem> {
          ).paddingOnly(bottom: 8),
          _PostHeaderWidget(
            isCompact: widget.isCompact,
+            isFullDate: widget.isFullDate,
+            onTapMore: widget.onTapMore,
            item: item,
          ).paddingSymmetric(horizontal: 12),
          _PostHeaderDividerWidget(item: item).paddingSymmetric(horizontal: 12),
-          Stack(
-            children: [
-              SizedContainer(
-                maxWidth: 640,
-                maxHeight: widget.isFullContent ? double.infinity : 80,
-                child: _MeasureSize(
-                  onChange: (size) {
-                    setState(() => _contentHeight = size.height);
-                  },
-                  child: SingleChildScrollView(
-                    physics: const NeverScrollableScrollPhysics(),
-                    child: MarkdownTextContent(
-                      parentId: 'p${item.id}',
-                      content: item.body['content'],
-                      isAutoWarp: item.type == 'story',
-                      isSelectable: widget.isContentSelectable,
-                    ),
-                  ).paddingOnly(
-                    left: 16,
-                    right: 12,
-                    top: 2,
-                    bottom: hasAttachment ? 4 : 0,
-                  ),
-                ),
-              ),
-            ],
+          SizedContainer(
+            maxWidth: 640,
+            child: MarkdownTextContent(
+              parentId: 'p${item.id}',
+              content: item.body['content'],
+              attachments: item.preload?.attachments,
+              isAutoWarp: item.type == 'story',
+              isSelectable: widget.isContentSelectable,
+            ),
+          ).paddingOnly(
+            left: 12,
+            right: 12,
+            bottom: hasAttachment ? 4 : 0,
          ),
-          if (_contentHeight >= 80 && !widget.isFullContent)
+          if (widget.item.body?['content_truncated'] == true)
            Opacity(
              opacity: 0.8,
              child: InkWell(child: Text('readMore'.tr)),
@ -130,145 +130,96 @@ class _PostItemState extends State<PostItem> {
          LinkExpansion(content: item.body['content']).paddingOnly(
            left: 8,
            right: 8,
-            top: 4,
          ),
-          _PostFooterWidget(item: item).paddingOnly(left: 16),
          if (attachments.isNotEmpty)
-            Row(
-              children: [
-                Icon(
-                  Icons.file_copy,
-                  size: 15,
-                  color: _unFocusColor,
-                ).paddingOnly(right: 5),
-                Text(
-                  'attachmentHint'.trParams(
-                    {'count': attachments.length.toString()},
-                  ),
-                  style: TextStyle(color: _unFocusColor),
-                )
-              ],
-            ).paddingOnly(left: 16, top: 4),
+            _PostAttachmentWidget(
+              item: item,
+              padding: widget.padding,
+              isCompact: true,
+              isNonScrollAttachment: widget.isNonScrollAttachment,
+            ).paddingOnly(top: 4),
        ],
      );
    }

-    return OpenContainer(
-      tappable: widget.isClickable,
-      closedBuilder: (_, openContainer) => Column(
+    return GestureDetector(
+      child: Column(
        crossAxisAlignment: CrossAxisAlignment.start,
        children: [
          _PostThumbnail(
            rid: item.body['thumbnail'],
            parentId: widget.item.id.toString(),
          ).paddingOnly(bottom: 4),
-          Row(
+          Column(
            crossAxisAlignment: CrossAxisAlignment.start,
            children: [
-              GestureDetector(
-                child: AccountAvatar(content: item.author.avatar),
-                onTap: () {
-                  showModalBottomSheet(
-                    useRootNavigator: true,
-                    isScrollControlled: true,
-                    backgroundColor: Theme.of(context).colorScheme.surface,
-                    context: context,
-                    builder: (context) => AccountProfilePopup(
-                      name: item.author.name,
-                    ),
-                  );
-                },
+              _PostHeaderWidget(
+                isCompact: widget.isCompact,
+                isFullDate: widget.isFullDate,
+                onTapMore: widget.onTapMore,
+                item: item,
              ),
-              Expanded(
-                child: Column(
-                  crossAxisAlignment: CrossAxisAlignment.start,
-                  children: [
-                    _PostHeaderWidget(
-                      isCompact: widget.isCompact,
-                      item: item,
-                    ),
-                    _PostHeaderDividerWidget(item: item),
-                    Stack(
-                      children: [
-                        SizedContainer(
-                          maxWidth: 640,
-                          maxHeight:
-                              widget.isFullContent ? double.infinity : 320,
-                          child: _MeasureSize(
-                            onChange: (size) {
-                              setState(() => _contentHeight = size.height);
-                            },
-                            child: SingleChildScrollView(
-                              physics: const NeverScrollableScrollPhysics(),
-                              child: MarkdownTextContent(
-                                parentId: 'p${item.id}-embed',
-                                content: item.body['content'],
-                                isAutoWarp: item.type == 'story',
-                                isSelectable: widget.isContentSelectable,
-                                isLargeText: item.type == 'article' &&
-                                    widget.isFullContent,
-                              ).paddingOnly(left: 12, right: 8),
-                            ),
-                          ),
-                        ),
-                      ],
-                    ),
-                    if (_contentHeight >= 320 && !widget.isFullContent)
-                      Opacity(
-                        opacity: 0.8,
-                        child: InkWell(child: Text('readMore'.tr)),
-                      ).paddingOnly(
-                        left: 12,
-                        top: 4,
-                      ),
-                    if (widget.item.replyTo != null && widget.isShowEmbed)
-                      Container(
-                        constraints: const BoxConstraints(maxWidth: 480),
-                        padding: const EdgeInsets.only(top: 4),
-                        child: _PostEmbedWidget(
-                          isClickable: widget.isClickable,
-                          isOverrideEmbedClickable:
-                              widget.isOverrideEmbedClickable,
-                          item: widget.item.replyTo!,
-                          username: widget.item.replyTo!.author.name,
-                          hintText: 'postRepliedNotify',
-                          icon: FontAwesomeIcons.reply,
-                          id: widget.item.replyTo!.id.toString(),
-                        ),
-                      ),
-                    if (widget.item.repostTo != null && widget.isShowEmbed)
-                      Container(
-                        constraints: const BoxConstraints(maxWidth: 480),
-                        padding: const EdgeInsets.only(top: 4),
-                        child: _PostEmbedWidget(
-                          isClickable: widget.isClickable,
-                          isOverrideEmbedClickable:
-                              widget.isOverrideEmbedClickable,
-                          item: widget.item.repostTo!,
-                          username: widget.item.repostTo!.author.name,
-                          hintText: 'postRepostedNotify',
-                          icon: FontAwesomeIcons.retweet,
-                          id: widget.item.repostTo!.id.toString(),
-                        ),
-                      ),
-                    _PostFooterWidget(item: item).paddingOnly(left: 12),
-                    LinkExpansion(content: item.body['content'])
-                        .paddingOnly(top: 4),
-                  ],
+              _PostHeaderDividerWidget(item: item),
+              SizedContainer(
+                maxWidth: 640,
+                child: MarkdownTextContent(
+                  parentId: 'p${item.id}-embed',
+                  content: item.body['content'],
+                  attachments: item.preload?.attachments,
+                  isAutoWarp: item.type == 'story',
+                  isSelectable: widget.isContentSelectable,
                ),
              ),
+              if (widget.item.body?['content_truncated'] == true)
+                Opacity(
+                  opacity: 0.8,
+                  child: InkWell(child: Text('readMore'.tr)),
+                ).paddingOnly(top: 4),
+              if (widget.item.replyTo != null && widget.isShowEmbed)
+                Container(
+                  constraints: const BoxConstraints(maxWidth: 480),
+                  padding: const EdgeInsets.only(top: 8),
+                  child: _PostEmbedWidget(
+                    isClickable: widget.isClickable,
+                    isOverrideEmbedClickable: widget.isOverrideEmbedClickable,
+                    item: widget.item.replyTo!,
+                    username: widget.item.replyTo!.author.name,
+                    hintText: 'postRepliedNotify',
+                    icon: FontAwesomeIcons.reply,
+                    id: widget.item.replyTo!.id.toString(),
+                  ),
+                ),
+              if (widget.item.repostTo != null && widget.isShowEmbed)
+                Container(
+                  constraints: const BoxConstraints(maxWidth: 480),
+                  padding: const EdgeInsets.only(top: 8),
+                  child: _PostEmbedWidget(
+                    isClickable: widget.isClickable,
+                    isOverrideEmbedClickable: widget.isOverrideEmbedClickable,
+                    item: widget.item.repostTo!,
+                    username: widget.item.repostTo!.author.name,
+                    hintText: 'postRepostedNotify',
+                    icon: FontAwesomeIcons.retweet,
+                    id: widget.item.repostTo!.id.toString(),
+                  ),
+                ),
+              _PostFooterWidget(item: item),
+              LinkExpansion(content: item.body['content']),
            ],
-          ).paddingOnly(
-            top: 10,
-            bottom:
-                (attachments.length == 1 && !AppTheme.isLargeScreen(context))
-                    ? 10
-                    : 0,
-            right: 16,
-            left: 16,
+          ).paddingSymmetric(
+            horizontal: (widget.padding?.horizontal ?? 0) + 16,
          ),
-          _PostAttachmentWidget(item: item),
-          if (widget.showFeaturedReply) _PostFeaturedReplyWidget(item: item),
+          if (hasAttachment) const Gap(8),
+          _PostAttachmentWidget(
+            item: item,
+            padding: widget.padding,
+            isCompact: item.type == 'article',
+            isNonScrollAttachment: widget.isNonScrollAttachment,
+          ),
+          if (widget.showFeaturedReply)
+            _PostFeaturedReplyWidget(item: item).paddingSymmetric(
+              horizontal: (widget.padding?.horizontal ?? 0) + 12,
+            ),
          if (widget.isShowReply || widget.isReactable)
            PostQuickAction(
              isShowReply: widget.isShowReply,
@ -280,32 +231,30 @@ class _PostItemState extends State<PostItem> {
                      (item.metric!.reactionList[symbol] ?? 0) + changes;
                });
              },
+              onComment: () {
+                if (widget.onComment != null) {
+                  widget.onComment!();
+                }
+              },
            ).paddingOnly(
-              top: (attachments.length == 1 && !AppTheme.isLargeScreen(context))
-                  ? 10
-                  : 6,
-              left:
-                  (attachments.length == 1 && !AppTheme.isLargeScreen(context))
-                      ? 24
-                      : 60,
-              right: 16,
-              bottom: 10,
+              top: 8,
+              left: (widget.padding?.left ?? 0) + 14,
+              right: (widget.padding?.right ?? 0) + 14,
            )
-          else
-            const Gap(10),
        ],
+      ).paddingOnly(
+        top: widget.padding?.top ?? 0,
+        bottom: widget.padding?.bottom ?? 0,
      ),
-      openBuilder: (_, __) => TitleShell(
-        title: 'postDetail'.tr,
-        child: PostDetailScreen(
-          id: item.id.toString(),
-          post: item,
-        ),
-      ),
-      closedElevation: 0,
-      openElevation: 0,
-      closedColor: Colors.transparent,
-      openColor: Theme.of(context).colorScheme.surface,
+      onTap: () {
+        if (widget.isClickable) {
+          AppRouter.instance.pushNamed(
+            'postDetail',
+            pathParameters: {'id': item.id.toString()},
+            extra: item,
+          );
+        }
+      },
    );
  }
 }
@ -317,7 +266,6 @@ class _PostFeaturedReplyWidget extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    final isLargeScreen = AppTheme.isLargeScreen(context);
    final unFocusColor =
        Theme.of(context).colorScheme.onSurface.withOpacity(0.75);

@ -325,19 +273,17 @@ class _PostFeaturedReplyWidget extends StatelessWidget {
      return const SizedBox.shrink();
    }

-    final List<String> attachments = item.body['attachments'] is List
-        ? List.from(item.body['attachments']?.whereType<String>())
-        : List.empty();
-
    return FutureBuilder(
-      future:
-          Get.find<PostProvider>().listPostFeaturedReply(item.id.toString()),
+      future: Get.find<PostProvider>().listPostFeaturedReply(
+        item.id.toString(),
+      ),
      builder: (context, snapshot) {
        if (!snapshot.hasData || snapshot.data!.isEmpty) {
          return const SizedBox.shrink();
        }

        return Container(
+          padding: EdgeInsets.only(top: 8),
          constraints: const BoxConstraints(maxWidth: 480),
          child: Card(
            margin: EdgeInsets.zero,
@ -351,7 +297,7 @@ class _PostFeaturedReplyWidget extends StatelessWidget {
                          mainAxisAlignment: MainAxisAlignment.center,
                          crossAxisAlignment: CrossAxisAlignment.start,
                          children: [
-                            AccountAvatar(
+                            AttachedCircleAvatar(
                              content: reply.author.avatar,
                              radius: 10,
                            ),
@ -423,16 +369,9 @@ class _PostFeaturedReplyWidget extends StatelessWidget {
                  .toList(),
            ),
          ),
-        )
-            .animate()
-            .fadeIn(
+        ).animate().fadeIn(
              duration: 300.ms,
              curve: Curves.easeIn,
-            )
-            .paddingOnly(
-              top: (attachments.length == 1 && !isLargeScreen) ? 10 : 6,
-              left: (attachments.length == 1 && !isLargeScreen) ? 24 : 60,
-              right: 16,
            );
      },
    );
@ -441,8 +380,16 @@ class _PostFeaturedReplyWidget extends StatelessWidget {

 class _PostAttachmentWidget extends StatelessWidget {
  final Post item;
+  final EdgeInsets? padding;
+  final bool isNonScrollAttachment;
+  final bool isCompact;

-  const _PostAttachmentWidget({required this.item});
+  const _PostAttachmentWidget({
+    required this.item,
+    required this.padding,
+    required this.isNonScrollAttachment,
+    this.isCompact = false,
+  });

  @override
  Widget build(BuildContext context) {
@ -452,25 +399,72 @@ class _PostAttachmentWidget extends StatelessWidget {
        ? List.from(item.body['attachments']?.whereType<String>())
        : List.empty();

-    if (attachments.length > 3) {
+    final unFocusColor =
+        Theme.of(context).colorScheme.onSurface.withOpacity(0.75);
+
+    if (attachments.isEmpty) return const SizedBox.shrink();
+
+    if (isCompact) {
+      return Row(
+        children: [
+          Icon(
+            Icons.file_copy,
+            size: 13,
+            color: unFocusColor,
+          ).paddingOnly(right: 5),
+          Text(
+            'attachmentHint'.trParams(
+              {'count': attachments.length.toString()},
+            ),
+            style: TextStyle(color: unFocusColor, fontSize: 13),
+          )
+        ],
+      ).paddingOnly(
+        left: (padding?.left ?? 0) + 17,
+        right: (padding?.right ?? 0) + 17,
+      );
+    }
+
+    if (attachments.length == 1 && !isLargeScreen) {
      return AttachmentList(
        parentId: item.id.toString(),
-        attachmentsId: attachments,
+        attachmentIds: item.preload == null ? attachments : null,
+        attachments: item.preload?.attachments,
+        autoload: false,
+        isFullWidth: true,
+      );
+    } else if (attachments.length > 1 &&
+        attachments.length % 3 == 0 &&
+        !isLargeScreen) {
+      return AttachmentList(
+        parentId: item.id.toString(),
+        attachmentIds: item.preload == null ? attachments : null,
+        attachments: item.preload?.attachments,
        autoload: false,
        isGrid: true,
-      ).paddingOnly(left: 36, top: 4, bottom: 4);
-    } else if (attachments.length > 1 || isLargeScreen) {
+      ).paddingOnly(
+        left: (padding?.left ?? 0) + 14,
+        right: (padding?.right ?? 0) + 14,
+      );
+    } else if (attachments.length == 1 || isNonScrollAttachment) {
      return AttachmentList(
        parentId: item.id.toString(),
-        attachmentsId: attachments,
+        attachmentIds: item.preload == null ? attachments : null,
+        attachments: item.preload?.attachments,
        autoload: false,
        isColumn: true,
-      ).paddingOnly(left: 60, right: 24, top: 4, bottom: 4);
+      ).paddingOnly(
+        left: (padding?.left ?? 0) + 14,
+        right: (padding?.right ?? 0) + 14,
+      );
    } else {
      return AttachmentList(
-        flatMaxHeight: MediaQuery.of(context).size.width,
        parentId: item.id.toString(),
-        attachmentsId: attachments,
+        attachmentIds: item.preload == null ? attachments : null,
+        attachments: item.preload?.attachments,
+        padding: EdgeInsets.symmetric(
+          horizontal: (padding?.horizontal ?? 0) + 14,
+        ),
        autoload: false,
      );
    }
@ -512,16 +506,17 @@ class _PostEmbedWidget extends StatelessWidget {
                size: 16,
                color: unFocusColor,
              ),
+              const Gap(6),
              Expanded(
                child: Text(
                  hintText.trParams(
                    {'username': '@$username'},
                  ),
                  style: TextStyle(color: unFocusColor),
-                ).paddingOnly(left: 6),
+                ),
              ),
            ],
-          ).paddingOnly(left: 12),
+          ).paddingOnly(left: 2),
          Card(
            elevation: 1,
            child: PostItem(
@ -557,9 +552,7 @@ class _PostHeaderDividerWidget extends StatelessWidget {
  @override
  Widget build(BuildContext context) {
    if (item.body['description'] != null || item.body['title'] != null) {
-      return const Divider(thickness: 0.3, height: 1).paddingSymmetric(
-        vertical: 8,
-      );
+      return const SizedBox(height: 8);
    }
    return const SizedBox.shrink();
  }
@ -615,64 +608,104 @@ class _PostFooterWidget extends StatelessWidget {
      return Column(
        crossAxisAlignment: CrossAxisAlignment.start,
        children: widgets,
-      ).paddingOnly(top: 4);
+      ).paddingSymmetric(vertical: 4);
    }
  }
 }

 class _PostHeaderWidget extends StatelessWidget {
  final bool isCompact;
+  final bool isFullDate;
  final Post item;

+  final Function? onTapMore;
+
  const _PostHeaderWidget({
    required this.isCompact,
+    required this.isFullDate,
    required this.item,
+    required this.onTapMore,
  });

  @override
  Widget build(BuildContext context) {
-    return Row(
+    return Column(
      crossAxisAlignment: CrossAxisAlignment.start,
      children: [
-        if (isCompact)
-          AccountAvatar(
-            content: item.author.avatar,
-            radius: 10,
-          ).paddingOnly(left: 2, top: 1),
-        Expanded(
-          child: Column(
-            crossAxisAlignment: CrossAxisAlignment.start,
-            children: [
-              Row(
+        Row(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            AccountAvatar(
+              content: item.author.avatar,
+              username: item.author.name,
+              radius: isCompact ? 10 : null,
+            ),
+            Gap(isCompact ? 6 : 8),
+            Expanded(
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
                children: [
-                  Text(
-                    item.author.nick,
-                    style: const TextStyle(fontWeight: FontWeight.bold),
+                  Row(
+                    crossAxisAlignment: CrossAxisAlignment.center,
+                    children: [
+                      Text(
+                        item.author.nick,
+                        style: const TextStyle(fontWeight: FontWeight.bold),
+                      ),
+                      if (isCompact) const Gap(4),
+                      if (isCompact)
+                        RelativeDate(
+                          item.publishedAt?.toLocal() ?? DateTime.now(),
+                          isFull: isFullDate,
+                        ).paddingOnly(top: 1),
+                    ],
                  ),
-                  RelativeDate(item.publishedAt?.toLocal() ?? DateTime.now())
-                      .paddingOnly(left: 4),
+                  if (!isCompact)
+                    Row(
+                      crossAxisAlignment: CrossAxisAlignment.center,
+                      children: [
+                        RelativeDate(
+                          item.publishedAt?.toLocal() ?? DateTime.now(),
+                          isFull: isFullDate,
+                        ),
+                        const Gap(4),
+                        Icon(
+                          _PostItemState.visibilityIcons[item.visibility],
+                          size: 16,
+                          color: Theme.of(context)
+                              .colorScheme
+                              .onSurface
+                              .withOpacity(0.75),
+                        ),
+                      ],
+                    ),
                ],
              ),
-              if (item.body['title'] != null)
-                Text(
-                  item.body['title'],
-                  style: Theme.of(context)
-                      .textTheme
-                      .bodyMedium!
-                      .copyWith(fontSize: 15),
+            ),
+            if (onTapMore != null)
+              IconButton(
+                color: Theme.of(context).colorScheme.primary,
+                icon: const Icon(Icons.more_vert),
+                padding: const EdgeInsets.symmetric(horizontal: 4),
+                visualDensity: const VisualDensity(
+                  horizontal: -4,
+                  vertical: -2,
                ),
-              if (item.body['description'] != null)
-                Text(
-                  item.body['description'],
-                  style: Theme.of(context).textTheme.bodySmall,
-                ),
-            ],
-          ).paddingOnly(left: isCompact ? 6 : 12),
+                onPressed: () => onTapMore!(),
+              ),
+          ],
        ),
-        if (item.type == 'article')
-          Badge(
-            label: Text('article'.tr),
-          ).paddingOnly(top: 3),
+        const Gap(8),
+        if (item.body['title'] != null)
+          Text(
+            item.body['title'],
+            style: Theme.of(context).textTheme.titleMedium,
+          ),
+        if (item.body['description'] != null)
+          Text(
+            item.body['description'],
+            style: Theme.of(context).textTheme.titleSmall,
+          ),
      ],
    );
  }
@ -703,45 +736,3 @@ class _PostThumbnail extends StatelessWidget {
    );
  }
 }
-
-typedef _OnWidgetSizeChange = void Function(Size size);
-
-class _MeasureSizeRenderObject extends RenderProxyBox {
-  Size? oldSize;
-  _OnWidgetSizeChange onChange;
-
-  _MeasureSizeRenderObject(this.onChange);
-
-  @override
-  void performLayout() {
-    super.performLayout();
-
-    Size newSize = child!.size;
-    if (oldSize == newSize) return;
-
-    oldSize = newSize;
-    WidgetsBinding.instance.addPostFrameCallback((_) {
-      onChange(newSize);
-    });
-  }
-}
-
-class _MeasureSize extends SingleChildRenderObjectWidget {
-  final _OnWidgetSizeChange onChange;
-
-  const _MeasureSize({
-    required this.onChange,
-    required Widget super.child,
-  });
-
-  @override
-  RenderObject createRenderObject(BuildContext context) {
-    return _MeasureSizeRenderObject(onChange);
-  }
-
-  @override
-  void updateRenderObject(
-      BuildContext context, covariant _MeasureSizeRenderObject renderObject) {
-    renderObject.onChange = onChange;
-  }
-}
--- a/lib/widgets/posts/post_list.dart
+++ b/lib/widgets/posts/post_list.dart
@ -1,8 +1,11 @@
+import 'package:flutter/gestures.dart';
 import 'package:flutter/material.dart';
 import 'package:get/get.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/router.dart';
+import 'package:solian/screens/posts/post_editor.dart';
 import 'package:solian/widgets/posts/post_action.dart';
 import 'package:solian/widgets/posts/post_item.dart';

@ -12,6 +15,7 @@ class PostListWidget extends StatelessWidget {
  final bool isNestedClickable;
  final PagingController<int, Post> controller;
  final Color? backgroundColor;
+  final EdgeInsets? padding;

  const PostListWidget({
    super.key,
@ -20,6 +24,7 @@ class PostListWidget extends StatelessWidget {
    this.isClickable = true,
    this.isNestedClickable = true,
    this.backgroundColor,
+    this.padding,
  });

  @override
@ -29,16 +34,18 @@ class PostListWidget extends StatelessWidget {
      pagingController: controller,
      builderDelegate: PagedChildBuilderDelegate<Post>(
        itemBuilder: (context, item, index) {
-          return PostListEntryWidget(
-            isShowEmbed: isShowEmbed,
-            isNestedClickable: isNestedClickable,
-            isClickable: isClickable,
-            showFeaturedReply: true,
-            item: item,
-            backgroundColor: backgroundColor,
-            onUpdate: () {
-              controller.refresh();
-            },
+          return Padding(
+            padding: padding ?? EdgeInsets.zero,
+            child: PostListEntryWidget(
+              isShowEmbed: isShowEmbed,
+              isNestedClickable: isNestedClickable,
+              isClickable: isClickable,
+              showFeaturedReply: true,
+              item: item,
+              onUpdate: () {
+                controller.refresh();
+              },
+            ),
          );
        },
      ),
@ -48,56 +55,126 @@ class PostListWidget extends StatelessWidget {
 }

 class PostListEntryWidget extends StatelessWidget {
-  final int renderOrder;
  final bool isShowEmbed;
  final bool isNestedClickable;
  final bool isClickable;
  final bool showFeaturedReply;
  final Post item;
+  final EdgeInsets? padding;
  final Function onUpdate;
-  final Color? backgroundColor;

  const PostListEntryWidget({
    super.key,
-    this.renderOrder = 0,
    required this.isShowEmbed,
    required this.isNestedClickable,
    required this.isClickable,
    required this.showFeaturedReply,
    required this.item,
+    this.padding,
    required this.onUpdate,
-    this.backgroundColor,
  });

+  void _openActions(BuildContext context) {
+    final AuthProvider auth = Get.find();
+    if (auth.isAuthorized.isFalse) return;
+
+    showModalBottomSheet(
+      useRootNavigator: true,
+      context: context,
+      builder: (context) => PostAction(item: item),
+    ).then((value) {
+      if (value is Future) {
+        value.then((_) {
+          onUpdate();
+        });
+      } else if (value != null) {
+        onUpdate();
+      }
+    });
+  }
+
  @override
  Widget build(BuildContext context) {
-    return GestureDetector(
-      child: PostItem(
-        key: Key('p${item.id}'),
-        item: item,
-        isShowEmbed: isShowEmbed,
-        isClickable: isNestedClickable,
-        showFeaturedReply: showFeaturedReply,
-        backgroundColor: backgroundColor,
-      ).paddingSymmetric(vertical: 8),
-      onLongPress: () {
-        final AuthProvider auth = Get.find();
-        if (auth.isAuthorized.isFalse) return;
-
-        showModalBottomSheet(
-          useRootNavigator: true,
-          context: context,
-          builder: (context) => PostAction(item: item),
-        ).then((value) {
-          if (value is Future) {
-            value.then((_) {
-              onUpdate();
+    return TapRegion(
+      child: GestureDetector(
+        onLongPress: () => _openActions(context),
+        child: PostItem(
+          key: Key('p${item.id}'),
+          item: item,
+          isShowEmbed: isShowEmbed,
+          isClickable: isNestedClickable,
+          showFeaturedReply: showFeaturedReply,
+          padding: padding,
+          onTapMore: () => _openActions(context),
+          onComment: () {
+            AppRouter.instance
+                .pushNamed(
+              'postEditor',
+              extra: PostPublishArguments(reply: item),
+            )
+                .then((value) {
+              if (value is Future) {
+                value.then((_) {
+                  onUpdate();
+                });
+              } else if (value != null) {
+                onUpdate();
+              }
            });
-          } else if (value != null) {
-            onUpdate();
-          }
-        });
+          },
+        ).paddingSymmetric(vertical: 8),
+      ),
+      onTapInside: (event) {
+        if (event.buttons == kSecondaryMouseButton) {
+          _openActions(context);
+        }
      },
    );
  }
 }
+
+class ControlledPostListWidget extends StatelessWidget {
+  final bool isShowEmbed;
+  final bool isClickable;
+  final bool isNestedClickable;
+  final bool isPinned;
+  final PagingController<int, Post> controller;
+  final EdgeInsets? padding;
+  final Function? onUpdate;
+
+  const ControlledPostListWidget({
+    super.key,
+    required this.controller,
+    this.isShowEmbed = true,
+    this.isClickable = true,
+    this.isNestedClickable = true,
+    this.isPinned = true,
+    this.padding,
+    this.onUpdate,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return PagedSliverList<int, Post>.separated(
+      addRepaintBoundaries: true,
+      pagingController: controller,
+      builderDelegate: PagedChildBuilderDelegate<Post>(
+        itemBuilder: (context, item, index) {
+          if (item.pinnedAt != null && !isPinned) {
+            return const SizedBox.shrink();
+          }
+          return PostListEntryWidget(
+            isShowEmbed: isShowEmbed,
+            isNestedClickable: isNestedClickable,
+            isClickable: isClickable,
+            showFeaturedReply: true,
+            padding: padding,
+            item: item,
+            onUpdate: onUpdate ?? () {},
+          );
+        },
+      ),
+      separatorBuilder: (_, __) => const Divider(thickness: 0.3, height: 0.3),
+    );
+  }
+}
--- a/lib/widgets/posts/post_owned_list.dart
+++ b/lib/widgets/posts/post_owned_list.dart
@ -1,43 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:get/get.dart';
-import 'package:solian/models/post.dart';
-import 'package:solian/widgets/posts/post_item.dart';
-
-class PostOwnedListEntry extends StatelessWidget {
-  final Post item;
-  final Function onTap;
-  final bool isFullContent;
-  final Color? backgroundColor;
-
-  const PostOwnedListEntry({
-    super.key,
-    required this.item,
-    required this.onTap,
-    this.isFullContent = false,
-    this.backgroundColor,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    return Card(
-      child: GestureDetector(
-        child: Column(
-          crossAxisAlignment: CrossAxisAlignment.start,
-          children: [
-            PostItem(
-              key: Key('p${item.id}'),
-              item: item,
-              isShowEmbed: false,
-              isClickable: false,
-              isShowReply: false,
-              isReactable: false,
-              isFullContent: isFullContent,
-              backgroundColor: backgroundColor,
-            ).paddingSymmetric(vertical: 8),
-          ],
-        ),
-        onTap: () => onTap(),
-      ),
-    );
-  }
-}
--- a/lib/widgets/posts/post_quick_action.dart
+++ b/lib/widgets/posts/post_quick_action.dart
@ -11,6 +11,7 @@ class PostQuickAction extends StatefulWidget {
  final Post item;
  final bool isReactable;
  final bool isShowReply;
+  final Function onComment;
  final void Function(String symbol, int num) onReact;

  const PostQuickAction({
@ -18,6 +19,7 @@ class PostQuickAction extends StatefulWidget {
    required this.item,
    this.isShowReply = true,
    this.isReactable = true,
+    required this.onComment,
    required this.onReact,
  });

@ -106,7 +108,11 @@ class _PostQuickActionState extends State<PostQuickAction> {
                    builder: (context) {
                      return PostReplyListPopup(item: widget.item);
                    },
-                  );
+                  ).then((signal) {
+                    if (signal == true) {
+                      widget.onComment();
+                    }
+                  });
                },
              ),
            ),
--- a/lib/widgets/posts/post_replies.dart
+++ b/lib/widgets/posts/post_replies.dart
@ -8,11 +8,13 @@ import 'package:solian/widgets/posts/post_list.dart';

 class PostReplyList extends StatefulWidget {
  final Post item;
+  final EdgeInsets? padding;
  final Color? backgroundColor;

  const PostReplyList({
    super.key,
    required this.item,
+    this.padding,
    this.backgroundColor,
  });

@ -53,6 +55,7 @@ class _PostReplyListState extends State<PostReplyList> {
  @override
  Widget build(BuildContext context) {
    return PostListWidget(
+      padding: widget.padding,
      isShowEmbed: false,
      controller: _pagingController,
      backgroundColor: widget.backgroundColor,
@ -70,16 +73,31 @@ class PostReplyListPopup extends StatelessWidget {
    return Column(
      crossAxisAlignment: CrossAxisAlignment.start,
      children: [
-        Text(
-          'postReplies'.tr,
-          style: Theme.of(context).textTheme.headlineSmall,
-        ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+        Row(
+          children: [
+            Expanded(
+              child: Text(
+                'postReplies'.tr,
+                style: Theme.of(context).textTheme.headlineSmall,
+              ),
+            ),
+            IconButton(
+              icon: const Icon(Icons.add_comment),
+              visualDensity: const VisualDensity(horizontal: -4),
+              onPressed: () {
+                Navigator.pop(context, true);
+              },
+            ),
+          ],
+        ).paddingOnly(left: 24, right: 24, top: 24, bottom: 8),
        Expanded(
          child: CustomScrollView(
            slivers: [
              PostReplyList(
                item: item,
-                backgroundColor: Theme.of(context).colorScheme.surfaceContainerLow,
+                padding: EdgeInsets.symmetric(horizontal: 10),
+                backgroundColor:
+                    Theme.of(context).colorScheme.surfaceContainerLow,
              ),
            ],
          ),
--- a/lib/widgets/posts/post_share.dart
+++ b/lib/widgets/posts/post_share.dart
@ -0,0 +1,103 @@
+import 'package:flutter/material.dart';
+import 'package:gap/gap.dart';
+import 'package:get/get.dart';
+import 'package:qr_flutter/qr_flutter.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/root_container.dart';
+
+class PostShareImage extends StatelessWidget {
+  final Post item;
+
+  const PostShareImage({super.key, required this.item});
+
+  @override
+  Widget build(BuildContext context) {
+    final textColor = Theme.of(context).colorScheme.onSurface.withOpacity(0.3);
+    return RootContainer(
+      child: Wrap(
+        alignment: WrapAlignment.spaceBetween,
+        runAlignment: WrapAlignment.center,
+        children: [
+          const SizedBox(height: 40),
+          Material(
+            color: Colors.transparent,
+            child: Card(
+              margin: EdgeInsets.zero,
+              child: PostItem(
+                item: item,
+                isShowEmbed: true,
+                isClickable: false,
+                showFeaturedReply: false,
+                isReactable: false,
+                isShowReply: false,
+                isNonScrollAttachment: true,
+                padding: const EdgeInsets.symmetric(
+                  horizontal: 4,
+                  vertical: 16,
+                ),
+                onComment: () {},
+              ),
+            ),
+          ).paddingOnly(bottom: 24),
+          Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Row(
+                children: [
+                  ClipRRect(
+                    borderRadius: const BorderRadius.all(Radius.circular(8)),
+                    child: Image.asset(
+                      'assets/logo.png',
+                      width: 48,
+                      height: 48,
+                    ),
+                  ),
+                  const Gap(16),
+                  Column(
+                    crossAxisAlignment: CrossAxisAlignment.start,
+                    mainAxisSize: MainAxisSize.min,
+                    children: [
+                      Text(
+                        'shareImageFooter'.tr,
+                        style: TextStyle(
+                          fontSize: 13,
+                          color: textColor,
+                        ),
+                      ),
+                      Text(
+                        'Solsynth LLC © ${DateTime.now().year}',
+                        style: TextStyle(
+                          fontSize: 11,
+                          color: textColor,
+                        ),
+                      ),
+                    ],
+                  ),
+                ],
+              ),
+              ClipRRect(
+                borderRadius: const BorderRadius.all(Radius.circular(8)),
+                child: Material(
+                  color: Theme.of(context).colorScheme.surface,
+                  child: QrImageView(
+                    data: 'https://solsynth.dev/posts/${item.id}',
+                    version: QrVersions.auto,
+                    padding: const EdgeInsets.all(4),
+                    size: 48,
+                    dataModuleStyle: QrDataModuleStyle(
+                      color: Theme.of(context).colorScheme.onSurface,
+                    ),
+                    eyeStyle: QrEyeStyle(
+                      color: Theme.of(context).colorScheme.onSurface,
+                    ),
+                  ),
+                ),
+              ),
+            ],
+          ),
+        ],
+      ).paddingSymmetric(horizontal: 36, vertical: 24),
+    );
+  }
+}
--- a/lib/widgets/posts/post_single_display.dart
+++ b/lib/widgets/posts/post_single_display.dart
@ -25,7 +25,6 @@ class PostSingleDisplay extends StatelessWidget {
            isNestedClickable: true,
            showFeaturedReply: true,
            onUpdate: onUpdate,
-            backgroundColor: Theme.of(context).colorScheme.surfaceContainerLow,
          ),
        ),
      ),
--- a/lib/widgets/posts/post_warped_list.dart
+++ b/lib/widgets/posts/post_warped_list.dart
@ -1,48 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
-import 'package:solian/models/post.dart';
-import 'package:solian/widgets/posts/post_list.dart';
-
-class PostWarpedListWidget extends StatelessWidget {
-  final bool isShowEmbed;
-  final bool isClickable;
-  final bool isNestedClickable;
-  final bool isPinned;
-  final PagingController<int, Post> controller;
-  final Function? onUpdate;
-
-  const PostWarpedListWidget({
-    super.key,
-    required this.controller,
-    this.isShowEmbed = true,
-    this.isClickable = true,
-    this.isNestedClickable = true,
-    this.isPinned = true,
-    this.onUpdate,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    return PagedSliverList<int, Post>.separated(
-      addRepaintBoundaries: true,
-      pagingController: controller,
-      builderDelegate: PagedChildBuilderDelegate<Post>(
-        itemBuilder: (context, item, index) {
-          if (item.pinnedAt != null && !isPinned) {
-            return const SizedBox.shrink();
-          }
-          return PostListEntryWidget(
-            renderOrder: index,
-            isShowEmbed: isShowEmbed,
-            isNestedClickable: isNestedClickable,
-            isClickable: isClickable,
-            showFeaturedReply: true,
-            item: item,
-            onUpdate: onUpdate ?? () {},
-          );
-        },
-      ),
-      separatorBuilder: (_, __) => const Divider(thickness: 0.3, height: 0.3),
-    );
-  }
-}
--- a/lib/widgets/realms/realm_member.dart
+++ b/lib/widgets/realms/realm_member.dart
@ -1,5 +1,4 @@
 import 'package:flutter/material.dart';
-import 'package:flutter_animate/flutter_animate.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/realm.dart';
@ -8,6 +7,7 @@ import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/account_profile_popup.dart';
 import 'package:solian/widgets/account/relative_select.dart';
+import 'package:solian/widgets/loading_indicator.dart';

 class RealmMemberListPopup extends StatefulWidget {
  final Realm realm;
@ -128,7 +128,7 @@ class _RealmMemberListPopupState extends State<RealmMemberListPopup> {
            'realmMembers'.tr,
            style: Theme.of(context).textTheme.headlineSmall,
          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
-          if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+          LoadingIndicator(isActive: _isBusy),
          ListTile(
            tileColor: Theme.of(context).colorScheme.surfaceContainerHigh,
            contentPadding: const EdgeInsets.symmetric(horizontal: 20),
@ -149,7 +149,8 @@ class _RealmMemberListPopupState extends State<RealmMemberListPopup> {
                  title: Text(element.account.nick),
                  subtitle: Text(element.account.name),
                  leading: GestureDetector(
-                    child: AccountAvatar(content: element.account.avatar),
+                    child:
+                        AttachedCircleAvatar(content: element.account.avatar),
                    onTap: () {
                      showModalBottomSheet(
                        useRootNavigator: true,
--- a/lib/widgets/relative_date.dart
+++ b/lib/widgets/relative_date.dart
@ -4,20 +4,25 @@ import 'package:timeago/timeago.dart';

 class RelativeDate extends StatelessWidget {
  final DateTime date;
+  final TextStyle? style;
  final bool isFull;

-  const RelativeDate(this.date, {super.key, this.isFull = false});
+  const RelativeDate(this.date, {super.key, this.style, this.isFull = false});

  @override
  Widget build(BuildContext context) {
    if (isFull) {
-      return Text(DateFormat('y/M/d HH:mm').format(date));
+      return Text(
+        DateFormat('y/M/d HH:mm').format(date),
+        style: style,
+      );
    }
    return Text(
      format(
        date,
        locale: 'en_short',
      ),
+      style: style,
    );
  }
 }
--- a/lib/widgets/root_container.dart
+++ b/lib/widgets/root_container.dart
@ -3,6 +3,7 @@ import 'dart:io';
 import 'package:flutter/material.dart';
 import 'package:path_provider/path_provider.dart';
 import 'package:solian/platform.dart';
+import 'package:solian/theme.dart';

 class RootContainer extends StatelessWidget {
  final Widget? child;
@ -46,3 +47,18 @@ class RootContainer extends StatelessWidget {
    );
  }
 }
+
+class ResponsiveRootContainer extends StatelessWidget {
+  final Widget? child;
+
+  const ResponsiveRootContainer({super.key, this.child});
+
+  @override
+  Widget build(BuildContext context) {
+    if (AppTheme.isLargeScreen(context)) {
+      return child ?? SizedBox.shrink();
+    } else {
+      return RootContainer(child: child);
+    }
+  }
+}
--- a/lib/widgets/sidebar/empty_placeholder.dart
+++ b/lib/widgets/sidebar/empty_placeholder.dart
@ -6,7 +6,7 @@ class EmptyPagePlaceholder extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    return RootContainer(
+    return ResponsiveRootContainer(
      child: Center(
        child: ClipRRect(
          borderRadius: const BorderRadius.all(Radius.circular(12)),
--- a/linux/flutter/generated_plugin_registrant.cc
+++ b/linux/flutter/generated_plugin_registrant.cc
@ -7,9 +7,11 @@
 #include "generated_plugin_registrant.h"

 #include <desktop_drop/desktop_drop_plugin.h>
+#include <file_saver/file_saver_plugin.h>
 #include <file_selector_linux/file_selector_plugin.h>
 #include <flutter_acrylic/flutter_acrylic_plugin.h>
 #include <flutter_secure_storage_linux/flutter_secure_storage_linux_plugin.h>
+#include <flutter_udid/flutter_udid_plugin.h>
 #include <flutter_webrtc/flutter_web_r_t_c_plugin.h>
 #include <media_kit_libs_linux/media_kit_libs_linux_plugin.h>
 #include <media_kit_video/media_kit_video_plugin.h>
@ -21,6 +23,9 @@ void fl_register_plugins(FlPluginRegistry* registry) {
  g_autoptr(FlPluginRegistrar) desktop_drop_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "DesktopDropPlugin");
  desktop_drop_plugin_register_with_registrar(desktop_drop_registrar);
+  g_autoptr(FlPluginRegistrar) file_saver_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "FileSaverPlugin");
+  file_saver_plugin_register_with_registrar(file_saver_registrar);
  g_autoptr(FlPluginRegistrar) file_selector_linux_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "FileSelectorPlugin");
  file_selector_plugin_register_with_registrar(file_selector_linux_registrar);
@ -30,6 +35,9 @@ void fl_register_plugins(FlPluginRegistry* registry) {
  g_autoptr(FlPluginRegistrar) flutter_secure_storage_linux_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "FlutterSecureStorageLinuxPlugin");
  flutter_secure_storage_linux_plugin_register_with_registrar(flutter_secure_storage_linux_registrar);
+  g_autoptr(FlPluginRegistrar) flutter_udid_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "FlutterUdidPlugin");
+  flutter_udid_plugin_register_with_registrar(flutter_udid_registrar);
  g_autoptr(FlPluginRegistrar) flutter_webrtc_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "FlutterWebRTCPlugin");
  flutter_web_r_t_c_plugin_register_with_registrar(flutter_webrtc_registrar);
--- a/linux/flutter/generated_plugins.cmake
+++ b/linux/flutter/generated_plugins.cmake
@ -4,9 +4,11 @@

 list(APPEND FLUTTER_PLUGIN_LIST
  desktop_drop
+  file_saver
  file_selector_linux
  flutter_acrylic
  flutter_secure_storage_linux
+  flutter_udid
  flutter_webrtc
  media_kit_libs_linux
  media_kit_video
--- a/macos/Flutter/GeneratedPluginRegistrant.swift
+++ b/macos/Flutter/GeneratedPluginRegistrant.swift
@ -8,6 +8,7 @@ import Foundation
 import connectivity_plus
 import desktop_drop
 import device_info_plus
+import file_saver
 import file_selector_macos
 import firebase_analytics
 import firebase_core
@ -15,6 +16,7 @@ import firebase_crashlytics
 import firebase_messaging
 import flutter_local_notifications
 import flutter_secure_storage_macos
+import flutter_udid
 import flutter_webrtc
 import gal
 import in_app_review
@ -29,7 +31,7 @@ import protocol_handler_macos
 import screen_brightness_macos
 import share_plus
 import shared_preferences_foundation
-import sqflite
+import sqflite_darwin
 import sqlite3_flutter_libs
 import url_launcher_macos
 import wakelock_plus
@ -38,6 +40,7 @@ func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
  ConnectivityPlusPlugin.register(with: registry.registrar(forPlugin: "ConnectivityPlusPlugin"))
  DesktopDropPlugin.register(with: registry.registrar(forPlugin: "DesktopDropPlugin"))
  DeviceInfoPlusMacosPlugin.register(with: registry.registrar(forPlugin: "DeviceInfoPlusMacosPlugin"))
+  FileSaverPlugin.register(with: registry.registrar(forPlugin: "FileSaverPlugin"))
  FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
  FLTFirebaseAnalyticsPlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseAnalyticsPlugin"))
  FLTFirebaseCorePlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseCorePlugin"))
@ -45,6 +48,7 @@ func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
  FLTFirebaseMessagingPlugin.register(with: registry.registrar(forPlugin: "FLTFirebaseMessagingPlugin"))
  FlutterLocalNotificationsPlugin.register(with: registry.registrar(forPlugin: "FlutterLocalNotificationsPlugin"))
  FlutterSecureStoragePlugin.register(with: registry.registrar(forPlugin: "FlutterSecureStoragePlugin"))
+  FlutterUdidPlugin.register(with: registry.registrar(forPlugin: "FlutterUdidPlugin"))
  FlutterWebRTCPlugin.register(with: registry.registrar(forPlugin: "FlutterWebRTCPlugin"))
  GalPlugin.register(with: registry.registrar(forPlugin: "GalPlugin"))
  InAppReviewPlugin.register(with: registry.registrar(forPlugin: "InAppReviewPlugin"))
--- a/Show More
+++ b/Show More
Author	SHA1	Message	Date
LittleSheep	107379d9fe	🐛 Bug fixes	2024-10-20 16:15:24 +08:00
LittleSheep	0d807b8708	👔 Article wont show expand attachment list	2024-10-19 16:55:14 +08:00
LittleSheep	ac1b3fe15c	🐛 Optimize content render	2024-10-19 00:32:16 +08:00
LittleSheep	5853de32a2	🐛 Fix localization issue	2024-10-17 23:50:47 +08:00
LittleSheep	eac1be365e	✨ Birthday celebration screen	2024-10-17 23:49:20 +08:00
LittleSheep	3fb1d7a6d4	🚀 Launch 1.4.0+16	2024-10-17 23:01:42 +08:00
LittleSheep	0480b5244f	🐛 Fix draft box	2024-10-17 22:44:00 +08:00
LittleSheep	56fb92c6b9	🚀 Launch 1.4.0+15	2024-10-16 23:06:31 +08:00
LittleSheep	b3267f0026	✨ Summary on search post	2024-10-16 22:49:34 +08:00
LittleSheep	88587c10da	✨ Notification embed post	2024-10-16 22:38:01 +08:00
LittleSheep	9012566dbf	💄 Optimized notification list	2024-10-16 22:32:44 +08:00
LittleSheep	6e00a99803	✨ Better attachment fullscreen (support exif meta)	2024-10-16 22:16:03 +08:00
LittleSheep	aa17a5d52a	🐛 Bug fixes on notifications	2024-10-16 00:53:29 +08:00
LittleSheep	ebeffbe1aa	♻️ Refactored notification	2024-10-16 00:50:48 +08:00
LittleSheep	d22eac5c10	🚀 Launch 1.4.0+14	2024-10-16 00:02:36 +08:00
LittleSheep	e5381dd5e0	✨ Support more mouse related actions	2024-10-16 00:02:18 +08:00
LittleSheep	1c26944a05	🐛 Fix draft box	2024-10-15 21:14:56 +08:00
LittleSheep	df787f02a1	🚀 Launch 1.3.8+13	2024-10-14 23:48:15 +08:00
LittleSheep	db43b7dca5	💄 Better auto save	2024-10-14 23:08:53 +08:00
LittleSheep	59c4d667f6	🐛 Bug fixes on edit content truncated post	2024-10-14 23:04:55 +08:00
LittleSheep	063c087089	✨ Post show more button	2024-10-14 22:58:37 +08:00
LittleSheep	48e3b510cf	✨ Better audit logs	2024-10-14 22:05:49 +08:00
LittleSheep	77288713e1	💫 Better loading animation	2024-10-14 21:13:57 +08:00
LittleSheep	1abc65f8fa	♿ Share post as image on web	2024-10-14 20:51:56 +08:00
LittleSheep	a6b17f2c05	✨ Multi-platform support share as image	2024-10-14 13:26:30 +08:00
LittleSheep	d8dd4060c0	🚀 Launch 1.3.7+12	2024-10-14 00:39:35 +08:00
LittleSheep	c8e131c1ab	🐛 Fix share image size issue	2024-10-14 00:37:42 +08:00
LittleSheep	f4621dd2b4	🚀 Launch 1.3.7+11	2024-10-14 00:18:46 +08:00
LittleSheep	6e442c144e	✨ Chat shell resizable	2024-10-14 00:13:01 +08:00
LittleSheep	8bbd964026	🐛 Fix share as image on iPad	2024-10-14 00:10:13 +08:00
LittleSheep	0b8a5a3303	💄 Optimize share as image	2024-10-14 00:03:45 +08:00
LittleSheep	65c6083640	🚀 Launch 1.3.7+10	2024-10-13 23:19:03 +08:00
LittleSheep	ad7a34ec18	✨ Share via image	2024-10-13 23:12:23 +08:00
LittleSheep	6c32d76f78	✨ Audit logs	2024-10-13 22:17:23 +08:00
LittleSheep	2aa699547c	🐛 Bug fixing on searching	2024-10-13 21:50:47 +08:00
LittleSheep	1f4aa8916d	✨ Search posts	2024-10-13 21:48:53 +08:00
LittleSheep	e2c2e41f89	⚡ Improve post detail page first time loading	2024-10-13 21:31:15 +08:00
LittleSheep	0f2b854e45	👔 Update level requirements	2024-10-13 20:54:26 +08:00
LittleSheep	c21ca5573c	✨ Show post visibility	2024-10-13 20:45:00 +08:00
LittleSheep	1809f2557d	👽 Support server-side truncate content	2024-10-13 20:36:10 +08:00
LittleSheep	1fc84099fe	♻️ Better push token uuid	2024-10-13 20:03:36 +08:00
LittleSheep	f8755f5220	🐛 Bug fixes	2024-10-13 19:56:37 +08:00
LittleSheep	4041d6dc4e	⚡ Optimize chat list and attachment loading	2024-10-13 16:26:46 +08:00
LittleSheep	cc1071d86e	🚀 Launch 1.3.7+9	2024-10-13 14:58:47 +08:00
LittleSheep	e334b862df	✨ Auth preferences	2024-10-13 14:13:16 +08:00
LittleSheep	32c33a963a	💄 Optimized post list	2024-10-13 01:31:59 +08:00
LittleSheep	a04bfe4cf9	🚀 Launch 1.3.7+8	2024-10-12 00:56:30 +08:00
LittleSheep	7b7988e6cb	♻️ Refactored post layout	2024-10-12 00:41:03 +08:00
LittleSheep	81a616157e	🚀 Launch v1.3.7+7	2024-10-11 01:10:23 +08:00
LittleSheep	52312662fb	🐛 Fix post visibility issue	2024-10-11 00:28:09 +08:00
LittleSheep	ca18d6ade4	💄 Chat channels loading indicator	2024-10-10 23:48:37 +08:00
LittleSheep	af7cc8dab0	💄 Optimize the explore page app bar behavior	2024-10-10 23:36:07 +08:00
LittleSheep	382e3c4a4c	⚡ Optimize post attachment loading	2024-10-10 22:52:05 +08:00
LittleSheep	1e37c6ddae	🚀 Launch 1.3.6+6 (to App Store)	2024-10-08 00:52:13 +08:00
LittleSheep	442ef06147	💄 Optimize post editor	2024-10-08 00:06:08 +08:00
LittleSheep	606a0d708a	🍱 Add cpp highlight file	2024-10-07 23:35:06 +08:00
LittleSheep	558828f3e0	🚀 Launch 1.3.6+5	2024-10-07 16:54:29 +08:00
LittleSheep	09dc7d2a0d	💄 Brightness of code block	2024-10-07 16:29:36 +08:00
LittleSheep	6876d2e7c0	✨ Syntax highlighting in markdown 💄 Optimize content rendering	2024-10-07 16:23:25 +08:00
LittleSheep	3a5964730c	🚀 1.3.6+4	2024-10-07 02:12:50 +08:00
LittleSheep	271c722df3	🐛 Bug fixes on background image	2024-10-07 01:47:34 +08:00
LittleSheep	97656249f2	⬆️ Upgrade deps	2024-10-06 23:23:11 +08:00
LittleSheep	d7e6fe2d8f	💄 More transparency	2024-10-06 23:06:33 +08:00
LittleSheep	2e9c4d166e	💄 Optimize designs and bug fixes with background image	2024-10-06 22:38:37 +08:00