✨ Channel organize

ios/Podfile.lock

@@ -34,6 +34,8 @@ PODS:
     - DKImagePickerController/PhotoGallery
     - Flutter
   - Flutter (1.0.0)
+  - flutter_local_notifications (0.0.1):
+    - Flutter
   - flutter_secure_storage (6.0.0):
     - Flutter
   - image_picker_ios (0.0.1):
@@ -41,6 +43,8 @@ PODS:
   - path_provider_foundation (0.0.1):
     - Flutter
     - FlutterMacOS
+  - permission_handler_apple (9.3.0):
+    - Flutter
   - SDWebImage (5.19.2):
     - SDWebImage/Core (= 5.19.2)
   - SDWebImage/Core (5.19.2)
@@ -51,9 +55,11 @@ PODS:
 DEPENDENCIES:
   - file_picker (from `.symlinks/plugins/file_picker/ios`)
   - Flutter (from `Flutter`)
+  - flutter_local_notifications (from `.symlinks/plugins/flutter_local_notifications/ios`)
   - flutter_secure_storage (from `.symlinks/plugins/flutter_secure_storage/ios`)
   - image_picker_ios (from `.symlinks/plugins/image_picker_ios/ios`)
   - path_provider_foundation (from `.symlinks/plugins/path_provider_foundation/darwin`)
+  - permission_handler_apple (from `.symlinks/plugins/permission_handler_apple/ios`)
   - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
 
 SPEC REPOS:
@@ -68,12 +74,16 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/file_picker/ios"
   Flutter:
     :path: Flutter
+  flutter_local_notifications:
+    :path: ".symlinks/plugins/flutter_local_notifications/ios"
   flutter_secure_storage:
     :path: ".symlinks/plugins/flutter_secure_storage/ios"
   image_picker_ios:
     :path: ".symlinks/plugins/image_picker_ios/ios"
   path_provider_foundation:
     :path: ".symlinks/plugins/path_provider_foundation/darwin"
+  permission_handler_apple:
+    :path: ".symlinks/plugins/permission_handler_apple/ios"
   url_launcher_ios:
     :path: ".symlinks/plugins/url_launcher_ios/ios"
 
@@ -82,9 +92,11 @@ SPEC CHECKSUMS:
   DKPhotoGallery: b3834fecb755ee09a593d7c9e389d8b5d6deed60
   file_picker: 09aa5ec1ab24135ccd7a1621c46c84134bfd6655
   Flutter: e0871f40cf51350855a761d2e70bf5af5b9b5de7
+  flutter_local_notifications: 4cde75091f6327eb8517fa068a0a5950212d2086
   flutter_secure_storage: d33dac7ae2ea08509be337e775f6b59f1ff45f12
   image_picker_ios: c560581cceedb403a6ff17f2f816d7fea1421fc1
   path_provider_foundation: 2b6b4c569c0fb62ec74538f866245ac84301af46
+  permission_handler_apple: 9878588469a2b0d0fc1e048d9f43605f92e6cec2
   SDWebImage: dfe95b2466a9823cf9f0c6d01217c06550d7b29a
   SwiftyGif: 706c60cf65fa2bc5ee0313beece843c8eb8194d4
   url_launcher_ios: 5334b05cef931de560670eeae103fd3e431ac3fe

ios/Runner.xcodeproj/project.pbxproj

@@ -199,6 +199,7 @@
 				9705A1C41CF9048500538489 /* Embed Frameworks */,
 				3B06AD1E1E4923F5004D2608 /* Thin Binary */,
 				287A33C298CA352A7E7F32A4 /* [CP] Embed Pods Frameworks */,
+				0818E8E4321C0D7433E07576 /* [CP] Copy Pods Resources */,
 			);
 			buildRules = (
 			);
@@ -270,6 +271,23 @@
 /* End PBXResourcesBuildPhase section */
 
 /* Begin PBXShellScriptBuildPhase section */
+		0818E8E4321C0D7433E07576 /* [CP] Copy Pods Resources */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+				"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-resources-${CONFIGURATION}-input-files.xcfilelist",
+			);
+			name = "[CP] Copy Pods Resources";
+			outputFileListPaths = (
+				"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-resources-${CONFIGURATION}-output-files.xcfilelist",
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "\"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-resources.sh\"\n";
+			showEnvVarsInLog = 0;
+		};
 		259653AE41D478F4C6BAE9B2 /* [CP] Check Pods Manifest.lock */ = {
 			isa = PBXShellScriptBuildPhase;
 			buildActionMask = 2147483647;

lib/main.dart

@@ -1,7 +1,12 @@
 import 'package:flutter/material.dart';
 import 'package:get/get.dart';
+import 'package:solian/providers/account.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/content/attachment.dart';
+import 'package:solian/providers/content/channel.dart';
+import 'package:solian/providers/content/post.dart';
+import 'package:solian/providers/content/realm.dart';
+import 'package:solian/providers/friend.dart';
 import 'package:solian/router.dart';
 import 'package:solian/theme.dart';
 import 'package:solian/translations.dart';
@@ -28,7 +33,19 @@ class SolianApp extends StatelessWidget {
       fallbackLocale: const Locale('en', 'US'),
       onInit: () {
         Get.lazyPut(() => AuthProvider());
+        Get.lazyPut(() => FriendProvider());
+        Get.lazyPut(() => PostProvider());
         Get.lazyPut(() => AttachmentProvider());
+        Get.lazyPut(() => AccountProvider());
+        Get.lazyPut(() => ChannelProvider());
+        Get.lazyPut(() => RealmProvider());
+
+        final AuthProvider auth = Get.find();
+        auth.isAuthorized.then((value) async {
+          if (value) {
+            Get.find<AccountProvider>().connect();
+          }
+        });
       },
       builder: (context, child) {
         return ScaffoldMessenger(

lib/models/channel.dart

@@ -1,3 +1,5 @@
+import 'package:flutter/material.dart';
+import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:solian/models/account.dart';
 
 class Channel {
@@ -60,6 +62,15 @@ class Channel {
         'realm_id': realmId,
         'is_encrypted': isEncrypted,
       };
+
+  IconData get icon {
+    switch (type) {
+      case 1:
+        return FontAwesomeIcons.userGroup;
+      default:
+        return FontAwesomeIcons.hashtag;
+    }
+  }
 }
 
 class ChannelMember {

lib/providers/account.dart

@@ -0,0 +1,161 @@
+import 'dart:convert';
+import 'dart:io';
+import 'dart:math' as math;
+
+import 'package:get/get.dart';
+import 'package:permission_handler/permission_handler.dart';
+import 'package:solian/models/notification.dart';
+import 'package:solian/models/packet.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/services.dart';
+import 'package:web_socket_channel/io.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+
+class AccountProvider extends GetxController {
+  final FlutterLocalNotificationsPlugin localNotify =
+      FlutterLocalNotificationsPlugin();
+
+  RxBool isConnected = false.obs;
+  RxBool isConnecting = false.obs;
+
+  RxInt notificationUnread = 0.obs;
+  RxList<Notification> notifications =
+      List<Notification>.empty(growable: true).obs;
+
+  IOWebSocketChannel? websocket;
+
+  @override
+  onInit() {
+    Permission.notification.request().then((status) {
+      notifyInitialization();
+      notifyPrefetch();
+    });
+
+    super.onInit();
+  }
+
+  void connect({noRetry = false}) async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) throw Exception('unauthorized');
+
+    if (auth.credentials == null) await auth.loadCredentials();
+
+    final uri = Uri.parse(
+      '${ServiceFinder.services['passport']}/api/ws?tk=${auth.credentials!.accessToken}'
+          .replaceFirst('http', 'ws'),
+    );
+
+    isConnecting.value = true;
+
+    try {
+      websocket = IOWebSocketChannel.connect(uri);
+      await websocket?.ready;
+    } catch (e) {
+      if (!noRetry) {
+        await auth.refreshCredentials();
+        return connect(noRetry: true);
+      }
+    }
+
+    listen();
+
+    isConnected.value = true;
+    isConnecting.value = false;
+  }
+
+  void disconnect() {
+    websocket?.sink.close(WebSocketStatus.normalClosure);
+    isConnected.value = false;
+  }
+
+  void listen() {
+    websocket?.stream.listen(
+      (event) {
+        final packet = NetworkPackage.fromJson(jsonDecode(event));
+        switch (packet.method) {
+          case 'notifications.new':
+            final notification = Notification.fromJson(packet.payload!);
+            notificationUnread++;
+            notifications.add(notification);
+            notifyMessage(notification.subject, notification.content);
+            break;
+        }
+      },
+      onDone: () {
+        isConnected.value = false;
+      },
+      onError: (err) {
+        isConnected.value = false;
+      },
+    );
+  }
+
+  void notifyInitialization() {
+    const androidSettings = AndroidInitializationSettings('app_icon');
+    const darwinSettings = DarwinInitializationSettings(
+      notificationCategories: [
+        DarwinNotificationCategory('general'),
+      ],
+    );
+    const linuxSettings =
+        LinuxInitializationSettings(defaultActionName: 'Open notification');
+    const InitializationSettings initializationSettings =
+        InitializationSettings(
+      android: androidSettings,
+      iOS: darwinSettings,
+      macOS: darwinSettings,
+      linux: linuxSettings,
+    );
+
+    localNotify.initialize(initializationSettings);
+  }
+
+  void notifyMessage(String title, String body) {
+    const androidSettings = AndroidNotificationDetails(
+      'general',
+      'General',
+      importance: Importance.high,
+      priority: Priority.high,
+      silent: true,
+    );
+    const darwinSettings = DarwinNotificationDetails(
+      presentAlert: true,
+      presentBanner: true,
+      presentBadge: true,
+      presentSound: false,
+    );
+    const linuxSettings = LinuxNotificationDetails();
+
+    localNotify.show(
+      math.max(1, math.Random().nextInt(100000000)),
+      title,
+      body,
+      const NotificationDetails(
+        android: androidSettings,
+        iOS: darwinSettings,
+        macOS: darwinSettings,
+        linux: linuxSettings,
+      ),
+    );
+  }
+
+  Future<void> notifyPrefetch() async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) return;
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['passport'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    final resp = await client.get('/api/notifications?skip=0&take=100');
+    if (resp.statusCode == 200) {
+      final result = PaginationResult.fromJson(resp.body);
+      final data = result.data?.map((x) => Notification.fromJson(x)).toList();
+      if (data != null) {
+        notifications.addAll(data);
+        notificationUnread.value = data.length;
+      }
+    }
+  }
+}

lib/providers/auth.dart

@@ -5,17 +5,13 @@ import 'package:flutter/material.dart';
 import 'package:flutter_secure_storage/flutter_secure_storage.dart';
 import 'package:get/get.dart';
 import 'package:get/get_connect/http/src/request/request.dart';
+import 'package:solian/providers/account.dart';
 import 'package:solian/services.dart';
 import 'package:oauth2/oauth2.dart' as oauth2;
 
 class AuthProvider extends GetConnect {
-  final deviceEndpoint = Uri.parse(
-      '${ServiceFinder.services['passport']}/api/notifications/subscribe');
   final tokenEndpoint =
       Uri.parse('${ServiceFinder.services['passport']}/api/auth/token');
-  final userinfoEndpoint =
-      Uri.parse('${ServiceFinder.services['passport']}/api/users/me');
-  final redirectUrl = Uri.parse('solian://auth');
 
   static const clientId = 'solian';
   static const clientSecret = '_F4%q2Eea3';
@@ -25,14 +21,12 @@ class AuthProvider extends GetConnect {
   @override
   void onInit() {
     httpClient.baseUrl = ServiceFinder.services['passport'];
-
-    applyAuthenticator();
+    loadCredentials();
   }
 
   oauth2.Credentials? credentials;
 
-  Future<Request<T?>> reqAuthenticator<T>(Request<T?> request) async {
-    if (credentials != null && credentials!.isExpired) {
+  Future<void> refreshCredentials() async {
     final resp = await post('/api/auth/token', {
       'refresh_token': credentials!.refreshToken,
       'grant_type': 'refresh_token',
@@ -48,7 +42,14 @@ class AuthProvider extends GetConnect {
       expiration: DateTime.now().add(const Duration(minutes: 3)),
     );
     storage.write(
-          key: 'auth_credentials', value: jsonEncode(credentials!.toJson()));
+      key: 'auth_credentials',
+      value: jsonEncode(credentials!.toJson()),
+    );
+  }
+
+  Future<Request<T?>> requestAuthenticator<T>(Request<T?> request) async {
+    if (credentials != null && credentials!.isExpired) {
+      refreshCredentials();
     }
 
     if (credentials != null) {
@@ -58,18 +59,20 @@ class AuthProvider extends GetConnect {
     return request;
   }
 
-  void applyAuthenticator() {
-    isAuthorized.then((status) async {
-      if (status) {
+  Future<void> loadCredentials() async {
+    if (await isAuthorized) {
       final content = await storage.read(key: 'auth_credentials');
       credentials = oauth2.Credentials.fromJson(jsonDecode(content!));
-        httpClient.addAuthenticator(reqAuthenticator);
     }
-    });
   }
 
   Future<oauth2.Credentials> signin(
-      BuildContext context, String username, String password) async {
+    BuildContext context,
+    String username,
+    String password,
+  ) async {
+    _cacheUserProfileResponse = null;
+
     final resp = await oauth2.resourceOwnerPasswordGrant(
       tokenEndpoint,
       username,
@@ -89,13 +92,23 @@ class AuthProvider extends GetConnect {
     );
 
     storage.write(
-        key: 'auth_credentials', value: jsonEncode(credentials!.toJson()));
-    applyAuthenticator();
+      key: 'auth_credentials',
+      value: jsonEncode(credentials!.toJson()),
+    );
+
+    Get.find<AccountProvider>().connect();
+    Get.find<AccountProvider>().notifyPrefetch();
 
     return credentials!;
   }
 
   void signout() {
+    _cacheUserProfileResponse = null;
+
+    Get.find<AccountProvider>().disconnect();
+    Get.find<AccountProvider>().notifications.clear();
+    Get.find<AccountProvider>().notificationUnread.value = 0;
+
     storage.deleteAll();
   }
 
@@ -108,7 +121,11 @@ class AuthProvider extends GetConnect {
       return _cacheUserProfileResponse!;
     }
 
-    final resp = await get('/api/users/me');
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['passport'];
+    client.httpClient.addAuthenticator(requestAuthenticator);
+
+    final resp = await client.get('/api/users/me');
     _cacheUserProfileResponse = resp;
     return resp;
   }

lib/providers/content/attachment.dart

@@ -39,7 +39,7 @@ class AttachmentProvider extends GetConnect {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['paperclip'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     final filePayload =
         MultipartFile(await file.readAsBytes(), filename: basename(file.path));
@@ -78,7 +78,7 @@ class AttachmentProvider extends GetConnect {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['paperclip'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     var resp = await client.put('/api/attachments/$id', {
       'metadata': {
@@ -102,7 +102,7 @@ class AttachmentProvider extends GetConnect {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['paperclip'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     var resp = await client.delete('/api/attachments/$id');
     if (resp.statusCode != 200) {

lib/providers/content/channel.dart

@@ -0,0 +1,21 @@
+import 'package:get/get.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/services.dart';
+
+class ChannelProvider extends GetxController {
+  Future<Response> listAvailableChannel({String realm = 'global'}) async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) throw Exception('unauthorized');
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['messaging'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    final resp = await client.get('/api/channels/$realm/me/available');
+    if (resp.statusCode != 200) {
+      throw Exception(resp.bodyString);
+    }
+
+    return resp;
+  }
+}

lib/providers/content/post.dart

@@ -0,0 +1,36 @@
+import 'package:get/get.dart';
+import 'package:solian/services.dart';
+
+class PostProvider extends GetConnect {
+  @override
+  void onInit() {
+    httpClient.baseUrl = ServiceFinder.services['interactive'];
+  }
+
+  Future<Response> listPost(int page) async {
+    final resp = await get('/api/feed?take=${10}&offset=$page');
+    if (resp.statusCode != 200) {
+      throw Exception(resp.body);
+    }
+
+    return resp;
+  }
+
+  Future<Response> listPostReplies(String alias, int page) async {
+    final resp = await get('/api/posts/$alias/replies?take=${10}&offset=$page');
+    if (resp.statusCode != 200) {
+      throw Exception(resp.body);
+    }
+
+    return resp;
+  }
+
+  Future<Response> getPost(String alias) async {
+    final resp = await get('/api/posts/$alias');
+    if (resp.statusCode != 200) {
+      throw Exception(resp.body);
+    }
+
+    return resp;
+  }
+}

lib/providers/content/post_explore.dart

@@ -1,11 +0,0 @@
-import 'package:get/get.dart';
-import 'package:solian/services.dart';
-
-class PostExploreProvider extends GetConnect {
-  @override
-  void onInit() {
-    httpClient.baseUrl = ServiceFinder.services['interactive'];
-  }
-
-  Future<Response> listPost(int page) => get('/api/feed?take=${10}&offset=$page');
-}

lib/providers/content/realm.dart

@@ -0,0 +1,21 @@
+import 'package:get/get.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/services.dart';
+
+class RealmProvider extends GetxController {
+  Future<Response> listAvailableRealm() async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) throw Exception('unauthorized');
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['passport'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    final resp = await client.get('/realms/me/available');
+    if (resp.statusCode != 200) {
+      throw Exception(resp.bodyString);
+    }
+
+    return resp;
+  }
+}

lib/providers/friend.dart

@@ -0,0 +1,43 @@
+import 'package:get/get.dart';
+import 'package:solian/models/friendship.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/services.dart';
+
+class FriendProvider extends GetConnect {
+  @override
+  void onInit() {
+    final AuthProvider auth = Get.find();
+
+    httpClient.baseUrl = ServiceFinder.services['passport'];
+    httpClient.addAuthenticator(auth.requestAuthenticator);
+  }
+
+  Future<Response> listFriendship() => get('/api/users/me/friends');
+
+  Future<Response> listFriendshipWithStatus(int status) =>
+      get('/api/users/me/friends?status=$status');
+
+  Future<Response> createFriendship(String username) async {
+    final resp = await post('/api/users/me/friends?related=$username', {});
+    if (resp.statusCode != 200) {
+      throw Exception(resp.bodyString);
+    }
+
+    return resp;
+  }
+
+  Future<Response> updateFriendship(Friendship relationship, int status) async {
+    final AuthProvider auth = Get.find();
+    final prof = await auth.getProfile();
+    final otherside = relationship.getOtherside(prof.body['id']);
+
+    final resp = await put('/api/users/me/friends/${otherside.id}', {
+      'status': status,
+    });
+    if (resp.statusCode != 200) {
+      throw Exception(resp.bodyString);
+    }
+
+    return resp;
+  }
+}

lib/router.dart

@@ -1,10 +1,12 @@
 import 'package:go_router/go_router.dart';
 import 'package:solian/screens/account.dart';
+import 'package:solian/screens/account/friend.dart';
 import 'package:solian/screens/account/personalize.dart';
-import 'package:solian/screens/auth/signin.dart';
-import 'package:solian/screens/auth/signup.dart';
-import 'package:solian/screens/home.dart';
-import 'package:solian/screens/posts/publish.dart';
+import 'package:solian/screens/channel/channel_organize.dart';
+import 'package:solian/screens/contact.dart';
+import 'package:solian/screens/posts/post_detail.dart';
+import 'package:solian/screens/social.dart';
+import 'package:solian/screens/posts/post_publish.dart';
 import 'package:solian/shells/basic_shell.dart';
 import 'package:solian/shells/nav_shell.dart';
 
@@ -13,12 +15,17 @@ abstract class AppRouter {
     routes: [
       ShellRoute(
         builder: (context, state, child) =>
-            NavShell(state: state, child: child),
+            NavShell(state: state, child: child, showAppBar: false),
         routes: [
           GoRoute(
             path: '/',
-            name: 'home',
-            builder: (context, state) => const HomeScreen(),
+            name: 'social',
+            builder: (context, state) => const SocialScreen(),
+          ),
+          GoRoute(
+            path: '/contact',
+            name: 'contact',
+            builder: (context, state) => const ContactScreen(),
           ),
           GoRoute(
             path: '/account',
@@ -31,21 +38,29 @@ abstract class AppRouter {
         builder: (context, state, child) =>
             BasicShell(state: state, child: child),
         routes: [
+          GoRoute(
+            path: '/posts/:alias',
+            name: 'postDetail',
+            builder: (context, state) => PostDetailScreen(
+              alias: state.pathParameters['alias']!,
+            ),
+          ),
+        ],
+      ),
+      ShellRoute(
+        builder: (context, state, child) =>
+            BasicShell(state: state, child: child),
+        routes: [
+          GoRoute(
+            path: '/account/friend',
+            name: 'accountFriend',
+            builder: (context, state) => const FriendScreen(),
+          ),
           GoRoute(
             path: '/account/personalize',
             name: 'accountPersonalize',
             builder: (context, state) => const PersonalizeScreen(),
           ),
-          GoRoute(
-            path: '/auth/sign-in',
-            name: 'signin',
-            builder: (context, state) => const SignInScreen(),
-          ),
-          GoRoute(
-            path: '/auth/sign-up',
-            name: 'signup',
-            builder: (context, state) => const SignUpScreen(),
-          ),
         ],
       ),
       GoRoute(
@@ -61,6 +76,17 @@ abstract class AppRouter {
           );
         },
       ),
+      GoRoute(
+        path: '/chat/organize',
+        name: 'channelOrganizing',
+        builder: (context, state) {
+          final arguments = state.extra as ChannelOrganizeArguments?;
+          return ChannelOrganizeScreen(
+            edit: arguments?.edit,
+            realm: state.uri.queryParameters['realm'],
+          );
+        },
+      ),
     ],
   );
 }

lib/screens/account.dart

@@ -2,7 +2,9 @@ import 'package:flutter/material.dart';
 import 'package:get/get.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/theme.dart';
+import 'package:solian/screens/auth/signin.dart';
+import 'package:solian/screens/auth/signup.dart';
+import 'package:solian/services.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 
 class AccountScreen extends StatefulWidget {
@@ -41,7 +43,14 @@ class _AccountScreenState extends State<AccountScreen> {
                     title: 'signin'.tr,
                     caption: 'signinCaption'.tr,
                     onTap: () {
-                      AppRouter.instance.pushNamed('signin').then((_) {
+                      showModalBottomSheet(
+                        useRootNavigator: true,
+                        isDismissible: false,
+                        isScrollControlled: true,
+                        context: context,
+                        builder: (context) => const SignInPopup(),
+                      ).then((_) async {
+                        await provider.getProfile(noCache: true);
                         setState(() {});
                       });
                     },
@@ -51,7 +60,15 @@ class _AccountScreenState extends State<AccountScreen> {
                     title: 'signup'.tr,
                     caption: 'signupCaption'.tr,
                     onTap: () {
-                      AppRouter.instance.pushNamed('signup');
+                      showModalBottomSheet(
+                        useRootNavigator: true,
+                        isDismissible: false,
+                        isScrollControlled: true,
+                        context: context,
+                        builder: (context) => const SignUpPopup(),
+                      ).then((_) {
+                        setState(() {});
+                      });
                     },
                   ),
                 ],
@@ -68,7 +85,9 @@ class _AccountScreenState extends State<AccountScreen> {
                   leading: x.$1,
                   title: Text(x.$2),
                   onTap: () {
-                    AppRouter.instance.pushNamed(x.$3);
+                    AppRouter.instance
+                        .pushNamed(x.$3)
+                        .then((_) => setState(() {}));
                   },
                 ),
               )),
@@ -100,25 +119,72 @@ class AccountNameCard extends StatelessWidget {
       future: provider.getProfile(),
       builder: (context, snapshot) {
         if (!snapshot.hasData) {
-          return const Center(
-            child: CircularProgressIndicator(),
-          );
+          return Container();
         }
 
+        final prof = snapshot.data!;
         return Material(
+          child: Column(
+            crossAxisAlignment: CrossAxisAlignment.start,
+            children: [
+              AspectRatio(
+                aspectRatio: 16 / 7,
+                child: Container(
+                  color: Theme.of(context).colorScheme.surfaceContainer,
+                  child: Stack(
+                    clipBehavior: Clip.none,
+                    fit: StackFit.expand,
+                    children: [
+                      if (prof.body['banner'] != null)
+                        Image.network(
+                          '${ServiceFinder.services['paperclip']}/api/attachments/${prof.body['banner']}',
+                          fit: BoxFit.cover,
+                        ),
+                      Positioned(
+                        bottom: -30,
+                        left: 18,
+                        child: AccountAvatar(
+                          content: prof.body['avatar'],
+                          radius: 48,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+              Row(
+                crossAxisAlignment: CrossAxisAlignment.baseline,
+                textBaseline: TextBaseline.alphabetic,
+                children: [
+                  Text(
+                    prof.body['nick'],
+                    style: const TextStyle(
+                      fontSize: 17,
+                      fontWeight: FontWeight.bold,
+                    ),
+                  ).paddingOnly(right: 4),
+                  Text(
+                    '@${prof.body['name']}',
+                    style: const TextStyle(
+                      fontSize: 15,
+                    ),
+                  ),
+                ],
+              ).paddingOnly(left: 120, top: 8),
+              SizedBox(
+                width: double.infinity,
                 child: Card(
                   child: ListTile(
-              contentPadding:
-                  const EdgeInsets.only(left: 22, right: 34, top: 4, bottom: 4),
-              leading: AccountAvatar(
-                  content: snapshot.data!.body?['avatar'], radius: 24),
-              title: Text(snapshot.data!.body?['nick']),
-              subtitle: Text(snapshot.data!.body?['email']),
+                    title: Text('description'.tr),
+                    subtitle: Text(
+                      prof.body['description']?.isNotEmpty
+                          ? prof.body['description']
+                          : 'No description yet.',
                     ),
-          ).paddingOnly(
-            left: 16,
-            right: 16,
-            top: SolianTheme.isLargeScreen(context) ? 8 : 0,
+                  ),
+                ),
+              ).paddingOnly(left: 24, right: 24, top: 8),
+            ],
           ),
         );
       },

lib/screens/account/friend.dart

@@ -0,0 +1,212 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:get/get.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/friendship.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/friend.dart';
+import 'package:solian/widgets/account/friend_list.dart';
+
+class FriendScreen extends StatefulWidget {
+  const FriendScreen({super.key});
+
+  @override
+  State<FriendScreen> createState() => _FriendScreenState();
+}
+
+class _FriendScreenState extends State<FriendScreen> {
+  bool _isBusy = false;
+  int? _accountId;
+
+  List<Friendship> _friendships = List.empty();
+
+  List<Friendship> filterWithStatus(int status) {
+    return _friendships.where((x) => x.status == status).toList();
+  }
+
+  Future<void> getFriendship() async {
+    setState(() => _isBusy = true);
+
+    final FriendProvider provider = Get.find();
+    final resp = await provider.listFriendship();
+
+    setState(() {
+      _friendships = resp.body
+          .map((e) => Friendship.fromJson(e))
+          .toList()
+          .cast<Friendship>();
+      _isBusy = false;
+    });
+  }
+
+  void showScopedListPopup(String title, int status) {
+    showModalBottomSheet(
+      useRootNavigator: true,
+      isScrollControlled: true,
+      context: context,
+      builder: (context) {
+        return SizedBox(
+          height: MediaQuery.of(context).size.height * 0.85,
+          child: Column(
+            crossAxisAlignment: CrossAxisAlignment.start,
+            children: [
+              Text(
+                title,
+                style: Theme.of(context).textTheme.headlineSmall,
+              ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+              Expanded(
+                child: CustomScrollView(
+                  slivers: [
+                    SliverFriendList(
+                      accountId: _accountId!,
+                      items: filterWithStatus(status),
+                      onUpdate: () {
+                        getFriendship();
+                      },
+                    ),
+                  ],
+                ),
+              ),
+            ],
+          ),
+        );
+      },
+    );
+  }
+
+  void promptAddFriend() async {
+    final FriendProvider provider = Get.find();
+
+    final controller = TextEditingController();
+    final input = await showDialog(
+      context: context,
+      builder: (context) {
+        return AlertDialog(
+          title: Text('accountFriendNew'.tr),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              Text('accountFriendNewHint'.tr, textAlign: TextAlign.left),
+              const SizedBox(height: 18),
+              TextField(
+                controller: controller,
+                decoration: InputDecoration(
+                  border: const OutlineInputBorder(),
+                  labelText: 'username'.tr,
+                ),
+                onTapOutside: (_) =>
+                    FocusManager.instance.primaryFocus?.unfocus(),
+              ),
+            ],
+          ),
+          actions: <Widget>[
+            TextButton(
+              style: TextButton.styleFrom(
+                foregroundColor:
+                    Theme.of(context).colorScheme.onSurface.withOpacity(0.8),
+              ),
+              onPressed: () => Navigator.pop(context),
+              child: Text('cancel'.tr),
+            ),
+            TextButton(
+              child: Text('next'.tr),
+              onPressed: () {
+                Navigator.pop(context, controller.text);
+              },
+            ),
+          ],
+        );
+      },
+    );
+
+    WidgetsBinding.instance.addPostFrameCallback((_) => controller.dispose());
+
+    if (input == null || input.isEmpty) return;
+
+    try {
+      setState(() => _isBusy = true);
+      await provider.createFriendship(input);
+    } catch (e) {
+      context.showErrorDialog(e);
+    } finally {
+      setState(() => _isBusy = false);
+    }
+  }
+
+  @override
+  void initState() {
+    Get.find<AuthProvider>().getProfile().then((value) {
+      _accountId = value.body['id'];
+    });
+    super.initState();
+
+    Future.delayed(Duration.zero, () => getFriendship());
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: Scaffold(
+        floatingActionButton: FloatingActionButton(
+          child: const Icon(Icons.add),
+          onPressed: () => promptAddFriend(),
+        ),
+        body: RefreshIndicator(
+          onRefresh: () => getFriendship(),
+          child: CustomScrollView(
+            slivers: [
+              if (_isBusy)
+                SliverToBoxAdapter(
+                  child: const LinearProgressIndicator().animate().scaleX(),
+                ),
+              SliverToBoxAdapter(
+                child: ListTile(
+                  tileColor: Theme.of(context).colorScheme.surfaceContainerLow,
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 20),
+                  leading: const Icon(Icons.person_add),
+                  trailing: const Icon(Icons.chevron_right),
+                  title: Text(
+                    '${'accountFriendPending'.tr} (${filterWithStatus(0).length})',
+                  ),
+                  onTap: () =>
+                      showScopedListPopup('accountFriendPending'.tr, 0),
+                ),
+              ),
+              SliverToBoxAdapter(
+                child: ListTile(
+                  tileColor: Theme.of(context).colorScheme.surfaceContainerLow,
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 20),
+                  leading: const Icon(Icons.block),
+                  trailing: const Icon(Icons.chevron_right),
+                  title: Text(
+                    '${'accountFriendBlocked'.tr} (${filterWithStatus(2).length})',
+                  ),
+                  onTap: () =>
+                      showScopedListPopup('accountFriendBlocked'.tr, 2),
+                ),
+              ),
+              SliverFriendList(
+                accountId: _accountId!,
+                items: filterWithStatus(1),
+                onUpdate: () {
+                  getFriendship();
+                },
+              ),
+              const SliverToBoxAdapter(
+                child: Divider(thickness: 0.3, height: 0.3),
+              ),
+              SliverToBoxAdapter(
+                child: Text(
+                  'accountFriendListHint'.tr,
+                  textAlign: TextAlign.center,
+                  style: Theme.of(context).textTheme.bodySmall,
+                ).paddingOnly(top: 16, bottom: 32),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

lib/screens/account/notification.dart

@@ -0,0 +1,210 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:get/get.dart';
+import 'package:solian/providers/account.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/services.dart';
+import 'package:solian/models/notification.dart' as notify;
+import 'package:url_launcher/url_launcher_string.dart';
+import 'package:uuid/uuid.dart';
+
+class NotificationScreen extends StatefulWidget {
+  const NotificationScreen({super.key});
+
+  @override
+  State<NotificationScreen> createState() => _NotificationScreenState();
+}
+
+class _NotificationScreenState extends State<NotificationScreen> {
+  bool _isBusy = false;
+
+  Future<void> markAllRead() async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) return;
+
+    setState(() => _isBusy = true);
+
+    final AccountProvider provider = Get.find();
+
+    List<int> markList = List.empty(growable: true);
+    for (final element in provider.notifications) {
+      if (element.isRealtime) continue;
+      markList.add(element.id);
+    }
+
+    if (markList.isNotEmpty) {
+      final client = GetConnect();
+      client.httpClient.baseUrl = ServiceFinder.services['passport'];
+      client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+      await client.put('/api/notifications/batch/read', {'messages': markList});
+    }
+
+    provider.notifications.clear();
+
+    setState(() => _isBusy = false);
+  }
+
+  Future<void> markOneRead(notify.Notification element, int index) async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) return;
+
+    final AccountProvider provider = Get.find();
+
+    if (element.isRealtime) {
+      provider.notifications.removeAt(index);
+      return;
+    }
+
+    setState(() => _isBusy = true);
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['passport'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    await client.put('/api/notifications/${element.id}/read', {});
+
+    provider.notifications.removeAt(index);
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AccountProvider provider = Get.find();
+
+    return SizedBox(
+      height: MediaQuery.of(context).size.height * 0.85,
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            'notification'.tr,
+            style: Theme.of(context).textTheme.headlineSmall,
+          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+          Expanded(
+            child: Obx(() {
+              return CustomScrollView(
+                slivers: [
+                  if (_isBusy)
+                    SliverToBoxAdapter(
+                      child: const LinearProgressIndicator().animate().scaleX(),
+                    ),
+                  if (provider.notifications.isEmpty)
+                    SliverToBoxAdapter(
+                      child: Container(
+                        padding: const EdgeInsets.symmetric(horizontal: 10),
+                        color:
+                            Theme.of(context).colorScheme.surfaceContainerHigh,
+                        child: ListTile(
+                          leading: const Icon(Icons.check),
+                          title: Text('notifyEmpty'.tr),
+                          subtitle: Text('notifyEmptyCaption'.tr),
+                        ),
+                      ),
+                    ),
+                  if (provider.notifications.isNotEmpty)
+                    SliverToBoxAdapter(
+                      child: ListTile(
+                        tileColor:
+                            Theme.of(context).colorScheme.secondaryContainer,
+                        leading: const Icon(Icons.checklist),
+                        title: Text('notifyAllRead'.tr),
+                        contentPadding:
+                            const EdgeInsets.symmetric(horizontal: 28),
+                        onTap: _isBusy ? null : () => markAllRead(),
+                      ),
+                    ),
+                  SliverList.separated(
+                    itemCount: provider.notifications.length,
+                    itemBuilder: (BuildContext context, int index) {
+                      var element = provider.notifications[index];
+                      return Dismissible(
+                        key: Key(const Uuid().v4()),
+                        background: Container(
+                          color: Colors.lightBlue,
+                          padding: const EdgeInsets.symmetric(horizontal: 20),
+                          alignment: Alignment.centerLeft,
+                          child: const Icon(Icons.check, color: Colors.white),
+                        ),
+                        child: ListTile(
+                          contentPadding: const EdgeInsets.symmetric(
+                            horizontal: 24,
+                            vertical: 8,
+                          ),
+                          title: Text(element.subject),
+                          subtitle: Column(
+                            children: [
+                              Text(element.content),
+                              if (element.links != null)
+                                Row(
+                                  children: element.links!
+                                      .map((e) => InkWell(
+                                            child: Text(
+                                              e.label,
+                                              style: TextStyle(
+                                                color: Theme.of(context)
+                                                    .colorScheme
+                                                    .onSecondaryContainer,
+                                                decoration:
+                                                    TextDecoration.underline,
+                                              ),
+                                            ),
+                                            onTap: () {
+                                              launchUrlString(e.url);
+                                            },
+                                          ).paddingOnly(right: 5))
+                                      .toList(),
+                                ),
+                            ],
+                          ),
+                        ),
+                        onDismissed: (_) => markOneRead(element, index),
+                      );
+                    },
+                    separatorBuilder: (_, __) =>
+                        const Divider(thickness: 0.3, height: 0.3),
+                  ),
+                ],
+              );
+            }),
+          ),
+        ],
+      ),
+    );
+  }
+}
+
+class NotificationButton extends StatelessWidget {
+  const NotificationButton({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    final AccountProvider provider = Get.find();
+
+    final button = IconButton(
+      icon: const Icon(Icons.notifications),
+      onPressed: () {
+        showModalBottomSheet(
+          useRootNavigator: true,
+          isScrollControlled: true,
+          context: context,
+          builder: (context) => const NotificationScreen(),
+        ).then((_) => provider.notificationUnread.value = 0);
+      },
+    );
+
+    return Obx(() {
+      if (provider.notificationUnread.value > 0) {
+        return Badge(
+          isLabelVisible: true,
+          offset: const Offset(-8, 2),
+          label: Text(provider.notificationUnread.value.toString()),
+          child: button,
+        );
+      } else {
+        return button;
+      }
+    });
+  }
+}

lib/screens/account/personalize.dart

@@ -37,15 +37,14 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
   void selectBirthday() async {
     final DateTime? picked = await showDatePicker(
       context: context,
-      initialDate: _birthday,
+      initialDate: _birthday?.toLocal(),
       firstDate: DateTime(DateTime.now().year - 200),
-      lastDate: DateTime(DateTime.now().year + 200),
+      lastDate: DateTime(DateTime.now().year),
     );
     if (picked != null && picked != _birthday) {
       setState(() {
         _birthday = picked;
-        _birthdayController.text =
-            DateFormat('yyyy-MM-dd hh:mm').format(_birthday!);
+        _birthdayController.text = DateFormat('yyyy-MM-dd').format(_birthday!);
       });
     }
   }
@@ -66,7 +65,7 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
       if (prof.body['profile']['birthday'] != null) {
         _birthday = DateTime.parse(prof.body['profile']['birthday']);
         _birthdayController.text =
-            DateFormat('yyyy-MM-dd hh:mm').format(_birthday!);
+            DateFormat('yyyy-MM-dd').format(_birthday!.toLocal());
       }
 
       _isBusy = false;
@@ -101,7 +100,7 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['passport'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     final resp = await client.put(
       '/api/users/me/$position',
@@ -109,7 +108,37 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
     );
     if (resp.statusCode == 200) {
       syncWidget();
+      context.showSnackbar('accountPersonalizeApplied'.tr);
+    } else {
+      context.showErrorDialog(resp.bodyString);
+    }
 
+    setState(() => _isBusy = false);
+  }
+
+  void updatePersonalize() async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) return;
+
+    setState(() => _isBusy = true);
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['passport'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    _birthday?.toIso8601String();
+    final resp = await client.put(
+      '/api/users/me',
+      {
+        'nick': _nicknameController.value.text,
+        'description': _descriptionController.value.text,
+        'first_name': _firstNameController.value.text,
+        'last_name': _lastNameController.value.text,
+        'birthday': _birthday?.toUtc().toIso8601String(),
+      },
+    );
+    if (resp.statusCode == 200) {
+      syncWidget();
       context.showSnackbar('accountPersonalizeApplied'.tr);
     } else {
       context.showErrorDialog(resp.bodyString);
@@ -277,11 +306,11 @@ class _PersonalizeScreenState extends State<PersonalizeScreen> {
               mainAxisAlignment: MainAxisAlignment.end,
               children: [
                 TextButton(
-                  onPressed: null,
+                  onPressed: _isBusy ? null : () => syncWidget(),
                   child: Text('reset'.tr),
                 ),
                 ElevatedButton(
-                  onPressed: null,
+                  onPressed: _isBusy ? null : () => updatePersonalize(),
                   child: Text('apply'.tr),
                 ),
               ],

lib/screens/auth/signin.dart

@@ -2,18 +2,17 @@ import 'package:flutter/material.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/router.dart';
 import 'package:solian/services.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
-class SignInScreen extends StatefulWidget {
-  const SignInScreen({super.key});
+class SignInPopup extends StatefulWidget {
+  const SignInPopup({super.key});
 
   @override
-  State<SignInScreen> createState() => _SignInScreenState();
+  State<SignInPopup> createState() => _SignInPopupState();
 }
 
-class _SignInScreenState extends State<SignInScreen> {
+class _SignInPopupState extends State<SignInPopup> {
   final _usernameController = TextEditingController();
   final _passwordController = TextEditingController();
 
@@ -23,15 +22,16 @@ class _SignInScreenState extends State<SignInScreen> {
     final username = _usernameController.value.text;
     final password = _passwordController.value.text;
     if (username.isEmpty || password.isEmpty) return;
-    provider.signin(context, username, password).then((_) {
-      AppRouter.instance.pop(true);
+    provider.signin(context, username, password).then((_) async {
+      Navigator.pop(context, true);
     }).catchError((e) {
       List<String> messages = e.toString().split('\n');
       if (messages.last.contains('risk')) {
         final ticketId = RegExp(r'ticketId=(\d+)').firstMatch(messages.last);
         if (ticketId == null) {
           context.showErrorDialog(
-              'Requested to multi-factor authenticate, but the ticket id was not found');
+            'Requested to multi-factor authenticate, but the ticket id was not found',
+          );
         }
         showDialog(
           context: context,
@@ -46,9 +46,7 @@ class _SignInScreenState extends State<SignInScreen> {
                     launchUrlString(
                       '${ServiceFinder.services['passport']}/mfa?ticket=${ticketId!.group(1)}',
                     );
-                    if (Navigator.canPop(context)) {
                     Navigator.pop(context);
-                    }
                   },
                 )
               ],
@@ -56,28 +54,32 @@ class _SignInScreenState extends State<SignInScreen> {
           },
         );
       } else {
-        ScaffoldMessenger.of(context).showSnackBar(SnackBar(
-          content: Text(messages.last),
-        ));
+        context.showErrorDialog(messages.last);
       }
     });
   }
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return SizedBox(
+      height: MediaQuery.of(context).size.height * 0.9,
       child: Center(
         child: Container(
           width: MediaQuery.of(context).size.width * 0.6,
           constraints: const BoxConstraints(maxWidth: 360),
           child: Column(
             mainAxisSize: MainAxisSize.min,
+            crossAxisAlignment: CrossAxisAlignment.start,
             children: [
-              Container(
-                padding: const EdgeInsets.symmetric(vertical: 16),
-                child: Image.asset('assets/logo.png', width: 72, height: 72),
+              Image.asset('assets/logo.png', width: 64, height: 64)
+                  .paddingOnly(bottom: 4),
+              Text(
+                'signinGreeting'.tr,
+                style: const TextStyle(
+                  fontSize: 28,
+                  fontWeight: FontWeight.w900,
                 ),
+              ).paddingOnly(left: 4, bottom: 16),
               TextField(
                 autocorrect: false,
                 enableSuggestions: false,
@@ -107,10 +109,19 @@ class _SignInScreenState extends State<SignInScreen> {
                     FocusManager.instance.primaryFocus?.unfocus(),
                 onSubmitted: (_) => performAction(context),
               ),
-              const SizedBox(height: 16),
-              ElevatedButton(
-                child: Text('signin'.tr),
+              const SizedBox(height: 12),
+              Align(
+                alignment: Alignment.centerRight,
+                child: TextButton(
+                  child: Row(
+                    mainAxisSize: MainAxisSize.min,
+                    children: [
+                      Text('next'.tr),
+                      const Icon(Icons.chevron_right),
+                    ],
+                  ),
                   onPressed: () => performAction(context),
+                ),
               )
             ],
           ),

lib/screens/auth/signup.dart

@@ -4,14 +4,14 @@ import 'package:solian/exts.dart';
 import 'package:solian/router.dart';
 import 'package:solian/services.dart';
 
-class SignUpScreen extends StatefulWidget {
-  const SignUpScreen({super.key});
+class SignUpPopup extends StatefulWidget {
+  const SignUpPopup({super.key});
 
   @override
-  State<SignUpScreen> createState() => _SignUpScreenState();
+  State<SignUpPopup> createState() => _SignUpPopupState();
 }
 
-class _SignUpScreenState extends State<SignUpScreen> {
+class _SignUpPopupState extends State<SignUpPopup> {
   final _emailController = TextEditingController();
   final _usernameController = TextEditingController();
   final _nicknameController = TextEditingController();
@@ -61,19 +61,25 @@ class _SignUpScreenState extends State<SignUpScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return Material(
-      color: Theme.of(context).colorScheme.surface,
+    return SizedBox(
+      height: MediaQuery.of(context).size.height * 0.9,
       child: Center(
         child: Container(
           width: MediaQuery.of(context).size.width * 0.6,
           constraints: const BoxConstraints(maxWidth: 360),
           child: Column(
             mainAxisSize: MainAxisSize.min,
+            crossAxisAlignment: CrossAxisAlignment.start,
             children: [
-              Container(
-                padding: const EdgeInsets.symmetric(vertical: 16),
-                child: Image.asset('assets/logo.png', width: 72, height: 72),
+              Image.asset('assets/logo.png', width: 64, height: 64)
+                  .paddingOnly(bottom: 4),
+              Text(
+                'signupGreeting'.tr,
+                style: const TextStyle(
+                  fontSize: 28,
+                  fontWeight: FontWeight.w900,
                 ),
+              ).paddingOnly(left: 4, bottom: 16),
               TextField(
                 autocorrect: false,
                 enableSuggestions: false,
@@ -132,9 +138,18 @@ class _SignUpScreenState extends State<SignUpScreen> {
                 onSubmitted: (_) => performAction(context),
               ),
               const SizedBox(height: 16),
-              ElevatedButton(
-                child: Text('signup'.tr),
+              Align(
+                alignment: Alignment.centerRight,
+                child: TextButton(
+                  child: Row(
+                    mainAxisSize: MainAxisSize.min,
+                    children: [
+                      Text('next'.tr),
+                      const Icon(Icons.chevron_right),
+                    ],
+                  ),
                   onPressed: () => performAction(context),
+                ),
               )
             ],
           ),

lib/screens/channel/channel_organize.dart

@@ -0,0 +1,292 @@
+import 'package:dropdown_button2/dropdown_button2.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:get/get.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/account.dart';
+import 'package:solian/models/channel.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/router.dart';
+import 'package:solian/services.dart';
+import 'package:solian/widgets/account/friend_select.dart';
+import 'package:solian/widgets/prev_page.dart';
+import 'package:uuid/uuid.dart';
+
+class ChannelOrganizeArguments {
+  final Channel? edit;
+
+  ChannelOrganizeArguments({this.edit});
+}
+
+class ChannelOrganizeScreen extends StatefulWidget {
+  final Channel? edit;
+  final String? realm;
+
+  const ChannelOrganizeScreen({super.key, this.edit, this.realm});
+
+  @override
+  State<ChannelOrganizeScreen> createState() => _ChannelOrganizeScreenState();
+}
+
+class _ChannelOrganizeScreenState extends State<ChannelOrganizeScreen> {
+  static Map<int, String> channelTypes = {
+    0: 'channelTypeCommon'.tr,
+    1: 'channelTypeDirect'.tr,
+  };
+
+  bool _isBusy = false;
+
+  final _aliasController = TextEditingController();
+  final _nameController = TextEditingController();
+  final _descriptionController = TextEditingController();
+
+  bool _isEncrypted = false;
+  int _channelType = 0;
+
+  List<Account> _initialMembers = List.empty(growable: true);
+
+  void selectInitialMembers() async {
+    final input = await showModalBottomSheet(
+      useRootNavigator: true,
+      isScrollControlled: true,
+      context: context,
+      builder: (context) => FriendSelect(
+        title: 'channelMember'.tr,
+        trailingBuilder: (item) {
+          if (_initialMembers.any((e) => e.id == item.id)) {
+            return const Icon(Icons.check);
+          } else {
+            return null;
+          }
+        },
+      ),
+    );
+    if (input == null) return;
+
+    setState(() {
+      if (_initialMembers.any((e) => e.id == input.id)) {
+        _initialMembers = _initialMembers
+            .where((e) => e.id != input.id)
+            .toList(growable: true);
+      } else {
+        _initialMembers.add(input as Account);
+      }
+    });
+  }
+
+  void applyChannel() async {
+    final AuthProvider auth = Get.find();
+    if (!await auth.isAuthorized) return;
+
+    if (_aliasController.value.text.isEmpty) randomizeAlias();
+
+    setState(() => _isBusy = true);
+
+    final client = GetConnect();
+    client.httpClient.baseUrl = ServiceFinder.services['messaging'];
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
+
+    final scope = (widget.realm?.isNotEmpty ?? false) ? widget.realm : 'global';
+    final payload = {
+      'alias': _aliasController.value.text.toLowerCase(),
+      'name': _nameController.value.text,
+      'description': _descriptionController.value.text,
+      'is_encrypted': _isEncrypted,
+      if (_channelType == 1)
+        'members': _initialMembers.map((e) => e.id).toList(),
+    };
+
+    Response resp;
+    if (widget.edit != null) {
+      resp = await client.put(
+        '/api/channels/$scope/${widget.edit!.id}',
+        payload,
+      );
+    } else if (_channelType == 1) {
+      resp = await client.post('/api/channels/$scope/dm', payload);
+    } else {
+      resp = await client.post('/api/channels/$scope', payload);
+    }
+    if (resp.statusCode != 200) {
+      context.showErrorDialog(resp.bodyString);
+    } else {
+      AppRouter.instance.pop(resp.body);
+    }
+
+    setState(() => _isBusy = false);
+  }
+
+  void randomizeAlias() {
+    _aliasController.text =
+        const Uuid().v4().replaceAll('-', '').substring(0, 12);
+  }
+
+  void syncWidget() {
+    if (widget.edit != null) {
+      _aliasController.text = widget.edit!.alias;
+      _nameController.text = widget.edit!.name;
+      _descriptionController.text = widget.edit!.description;
+      _isEncrypted = widget.edit!.isEncrypted;
+      _channelType = widget.edit!.type;
+    }
+  }
+
+  void cancelAction() {
+    AppRouter.instance.pop();
+  }
+
+  @override
+  void initState() {
+    syncWidget();
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: Scaffold(
+        appBar: AppBar(
+          title: Text('channelOrganizing'.tr),
+          leading: const PrevPageButton(),
+          actions: [
+            TextButton(
+              onPressed: _isBusy ? null : () => applyChannel(),
+              child: Text('apply'.tr.toUpperCase()),
+            )
+          ],
+        ),
+        body: SafeArea(
+          top: false,
+          child: Column(
+            children: [
+              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+              if (widget.edit != null)
+                MaterialBanner(
+                  leading: const Icon(Icons.edit),
+                  leadingPadding: const EdgeInsets.only(left: 10, right: 20),
+                  dividerColor: Colors.transparent,
+                  content: Text(
+                    'channelEditingNotify'
+                        .trParams({'channel': '#${widget.edit!.alias}'}),
+                  ),
+                  actions: [
+                    TextButton(
+                      onPressed: cancelAction,
+                      child: Text('cancel'.tr),
+                    ),
+                  ],
+                ),
+              Row(
+                children: [
+                  Expanded(
+                    child: TextField(
+                      autofocus: true,
+                      controller: _aliasController,
+                      decoration: InputDecoration.collapsed(
+                        hintText: 'channelAlias'.tr,
+                      ),
+                      onTapOutside: (_) =>
+                          FocusManager.instance.primaryFocus?.unfocus(),
+                    ),
+                  ),
+                  TextButton(
+                    style: TextButton.styleFrom(
+                      shape: const CircleBorder(),
+                      visualDensity:
+                          const VisualDensity(horizontal: -2, vertical: -2),
+                    ),
+                    onPressed: () => randomizeAlias(),
+                    child: const Icon(Icons.refresh),
+                  )
+                ],
+              ).paddingSymmetric(horizontal: 16, vertical: 2),
+              const Divider(thickness: 0.3),
+              TextField(
+                autocorrect: true,
+                controller: _nameController,
+                decoration: InputDecoration.collapsed(
+                  hintText: 'channelName'.tr,
+                ),
+                onTapOutside: (_) =>
+                    FocusManager.instance.primaryFocus?.unfocus(),
+              ).paddingSymmetric(horizontal: 16, vertical: 8),
+              const Divider(thickness: 0.3),
+              Expanded(
+                child: TextField(
+                  minLines: 5,
+                  maxLines: null,
+                  autocorrect: true,
+                  keyboardType: TextInputType.multiline,
+                  controller: _descriptionController,
+                  decoration: InputDecoration.collapsed(
+                    hintText: 'channelDescription'.tr,
+                  ),
+                  onTapOutside: (_) =>
+                      FocusManager.instance.primaryFocus?.unfocus(),
+                ).paddingSymmetric(horizontal: 16, vertical: 12),
+              ),
+              const Divider(thickness: 0.3),
+              if (_channelType == 1)
+                ListTile(
+                  leading: const Icon(Icons.supervisor_account)
+                      .paddingSymmetric(horizontal: 8),
+                  title: Text('channelMember'.tr),
+                  subtitle: _initialMembers.isNotEmpty
+                      ? Text(_initialMembers.map((e) => e.name).join(' '))
+                      : null,
+                  trailing: const Icon(Icons.chevron_right),
+                  onTap: () => selectInitialMembers(),
+                ).animate().fadeIn().slideY(
+                      begin: 1,
+                      end: 0,
+                      curve: Curves.fastEaseInToSlowEaseOut,
+                    ),
+              ListTile(
+                leading: const Icon(Icons.mode).paddingSymmetric(horizontal: 8),
+                title: Text('channelType'.tr),
+                trailing: DropdownButtonHideUnderline(
+                  child: DropdownButton2<int>(
+                    isExpanded: true,
+                    items: channelTypes.entries
+                        .map((item) => DropdownMenuItem<int>(
+                              value: item.key,
+                              child: Text(
+                                item.value,
+                                style: const TextStyle(
+                                  fontSize: 14,
+                                ),
+                              ),
+                            ))
+                        .toList(),
+                    value: _channelType,
+                    onChanged: (int? value) {
+                      setState(() => _channelType = value ?? 0);
+                    },
+                    buttonStyleData: const ButtonStyleData(
+                      padding: EdgeInsets.only(left: 16, right: 1),
+                      height: 40,
+                      width: 140,
+                    ),
+                    menuItemStyleData: const MenuItemStyleData(
+                      height: 40,
+                    ),
+                  ),
+                ),
+              ),
+              CheckboxListTile(
+                title: Text('channelEncrypted'.tr),
+                value: _isEncrypted,
+                onChanged: (widget.edit?.isEncrypted ?? false)
+                    ? null
+                    : (newValue) =>
+                        setState(() => _isEncrypted = newValue ?? false),
+                controlAffinity: ListTileControlAffinity.leading,
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

lib/screens/contact.dart

@@ -0,0 +1,127 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:font_awesome_flutter/font_awesome_flutter.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/channel.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/content/channel.dart';
+import 'package:solian/router.dart';
+import 'package:solian/screens/account/notification.dart';
+import 'package:solian/theme.dart';
+
+class ContactScreen extends StatefulWidget {
+  const ContactScreen({super.key});
+
+  @override
+  State<ContactScreen> createState() => _ContactScreenState();
+}
+
+class _ContactScreenState extends State<ContactScreen> {
+  bool _isBusy = true;
+
+  final List<Channel> _channels = List.empty(growable: true);
+
+  getChannels() async {
+    setState(() => _isBusy = true);
+
+    final ChannelProvider provider = Get.find();
+    final resp = await provider.listAvailableChannel();
+
+    setState(() {
+      _channels.clear();
+      _channels.addAll(
+        resp.body.map((e) => Channel.fromJson(e)).toList().cast<Channel>(),
+      );
+    });
+
+    setState(() => _isBusy = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    getChannels();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final AuthProvider auth = Get.find();
+
+    // TODO Un signed in tip
+
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: SafeArea(
+        child: NestedScrollView(
+          headerSliverBuilder: (context, innerBoxIsScrolled) {
+            return [
+              SliverOverlapAbsorber(
+                handle:
+                    NestedScrollView.sliverOverlapAbsorberHandleFor(context),
+                sliver: SliverAppBar(
+                  title: Text('contact'.tr),
+                  centerTitle: false,
+                  titleSpacing: SolianTheme.isLargeScreen(context) ? null : 24,
+                  forceElevated: innerBoxIsScrolled,
+                  actions: [
+                    const NotificationButton(),
+                    IconButton(
+                      icon: const Icon(Icons.add_circle),
+                      onPressed: () {
+                        AppRouter.instance.pushNamed('channelOrganizing').then(
+                          (value) {
+                            if (value != null) {
+                              getChannels();
+                            }
+                          },
+                        );
+                      },
+                    ),
+                    if (!SolianTheme.isLargeScreen(context))
+                      const SizedBox(width: 16),
+                  ],
+                ),
+              ),
+            ];
+          },
+          body: MediaQuery.removePadding(
+            removeTop: true,
+            context: context,
+            child: Column(
+              children: [
+                if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
+                Expanded(
+                  child: RefreshIndicator(
+                    onRefresh: () => getChannels(),
+                    child: ListView.builder(
+                      itemCount: _channels.length,
+                      itemBuilder: (context, index) {
+                        final element = _channels[index];
+                        return ListTile(
+                          leading: CircleAvatar(
+                            backgroundColor: Colors.indigo,
+                            child: FaIcon(
+                              element.icon,
+                              color: Colors.white,
+                              size: 16,
+                            ),
+                          ),
+                          contentPadding:
+                              const EdgeInsets.symmetric(horizontal: 24),
+                          title: Text(element.name),
+                          subtitle: Text(element.description),
+                          onTap: () {},
+                        );
+                      },
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

lib/screens/posts/post_detail.dart

@@ -0,0 +1,69 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/exts.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/post.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/widgets/posts/post_replies.dart';
+
+class PostDetailScreen extends StatefulWidget {
+  final String alias;
+
+  const PostDetailScreen({super.key, required this.alias});
+
+  @override
+  State<PostDetailScreen> createState() => _PostDetailScreenState();
+}
+
+class _PostDetailScreenState extends State<PostDetailScreen> {
+  Post? item;
+
+  Future<Post?> getDetail() async {
+    final PostProvider provider = Get.find();
+
+    try {
+      final resp = await provider.getPost(widget.alias);
+      item = Post.fromJson(resp.body);
+    } catch (e) {
+      context.showErrorDialog(e).then((_) => Navigator.pop(context));
+    }
+
+    return item;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Theme.of(context).colorScheme.surface,
+      child: FutureBuilder(
+        future: getDetail(),
+        builder: (context, snapshot) {
+          if (!snapshot.hasData || snapshot.data == null) {
+            return const Center(
+              child: CircularProgressIndicator(),
+            );
+          }
+
+          return ListView(
+            children: [
+              PostItem(
+                item: item!,
+                isClickable: true,
+                isShowReply: false,
+              ),
+              const Divider(thickness: 0.3, height: 0.3),
+              Text(
+                'postReplies'.tr,
+                style: Theme.of(context).textTheme.headlineSmall,
+              ).paddingOnly(left: 24, right: 24, top: 16),
+              PostReplyList(
+                item: item!,
+                shrinkWrap: true,
+              ),
+            ],
+          );
+        },
+      ),
+    );
+  }
+}

lib/screens/posts/post_publish.dart

@@ -1,5 +1,6 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
+import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
@@ -40,7 +41,7 @@ class PostPublishingScreen extends StatefulWidget {
 class _PostPublishingScreenState extends State<PostPublishingScreen> {
   final _contentController = TextEditingController();
 
-  bool _isSubmitting = false;
+  bool _isBusy = false;
 
   List<int> _attachments = List.empty();
 
@@ -60,11 +61,11 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
     if (!await auth.isAuthorized) return;
     if (_contentController.value.text.isEmpty) return;
 
-    setState(() => _isSubmitting = true);
+    setState(() => _isBusy = true);
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['interactive'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     final payload = {
       'content': _contentController.value.text,
@@ -86,7 +87,7 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
       AppRouter.instance.pop(resp.body);
     }
 
-    setState(() => _isSubmitting = false);
+    setState(() => _isBusy = false);
   }
 
   void syncWidget() {
@@ -125,8 +126,8 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
           leading: const PrevPageButton(),
           actions: [
             TextButton(
+              onPressed: _isBusy ? null : () => applyPost(),
               child: Text('postAction'.tr.toUpperCase()),
-              onPressed: () => applyPost(),
             )
           ],
         ),
@@ -134,8 +135,7 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
           top: false,
           child: Column(
             children: [
-              if (_isSubmitting)
-                const LinearProgressIndicator().animate().scaleX(),
+              if (_isBusy) const LinearProgressIndicator().animate().scaleX(),
               if (widget.edit != null)
                 MaterialBanner(
                   leading: const Icon(Icons.edit),
@@ -150,7 +150,10 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
                   child: Column(
                     children: [
                       MaterialBanner(
-                        leading: const Icon(Icons.reply),
+                        leading: const FaIcon(
+                          FontAwesomeIcons.reply,
+                          size: 18,
+                        ),
                         leadingPadding:
                             const EdgeInsets.only(left: 10, right: 20),
                         backgroundColor: Colors.transparent,
@@ -181,7 +184,10 @@ class _PostPublishingScreenState extends State<PostPublishingScreen> {
                   child: Column(
                     children: [
                       MaterialBanner(
-                        leading: const Icon(Icons.redo),
+                        leading: const FaIcon(
+                          FontAwesomeIcons.retweet,
+                          size: 18,
+                        ),
                         leadingPadding:
                             const EdgeInsets.only(left: 10, right: 20),
                         dividerColor: Colors.transparent,

lib/screens/social.dart

@@ -4,27 +4,31 @@ import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/content/post_explore.dart';
+import 'package:solian/providers/content/post.dart';
 import 'package:solian/router.dart';
-import 'package:solian/widgets/posts/post_action.dart';
-import 'package:solian/widgets/posts/post_item.dart';
+import 'package:solian/screens/account/notification.dart';
+import 'package:solian/theme.dart';
+import 'package:solian/widgets/posts/post_list.dart';
 
-class HomeScreen extends StatefulWidget {
-  const HomeScreen({super.key});
+class SocialScreen extends StatefulWidget {
+  const SocialScreen({super.key});
 
   @override
-  State<HomeScreen> createState() => _HomeScreenState();
+  State<SocialScreen> createState() => _SocialScreenState();
 }
 
-class _HomeScreenState extends State<HomeScreen> {
+class _SocialScreenState extends State<SocialScreen> {
   final PagingController<int, Post> _pagingController =
       PagingController(firstPageKey: 0);
 
   getPosts(int pageKey) async {
-    final PostExploreProvider provider = Get.find();
-    final resp = await provider.listPost(pageKey);
-    if (resp.statusCode != 200) {
-      _pagingController.error = resp.bodyString;
+    final PostProvider provider = Get.find();
+
+    Response resp;
+    try {
+      resp = await provider.listPost(pageKey);
+    } catch (e) {
+      _pagingController.error = e;
       return;
     }
 
@@ -39,7 +43,6 @@ class _HomeScreenState extends State<HomeScreen> {
 
   @override
   void initState() {
-    Get.lazyPut(() => PostExploreProvider());
     super.initState();
 
     _pagingController.addPageRequestListener(getPosts);
@@ -69,32 +72,36 @@ class _HomeScreenState extends State<HomeScreen> {
           }),
       body: Material(
         color: Theme.of(context).colorScheme.surface,
+        child: SafeArea(
+          child: NestedScrollView(
+            headerSliverBuilder: (context, innerBoxIsScrolled) {
+              return [
+                SliverOverlapAbsorber(
+                  handle:
+                      NestedScrollView.sliverOverlapAbsorberHandleFor(context),
+                  sliver: SliverAppBar(
+                    title: Text('social'.tr),
+                    centerTitle: false,
+                    titleSpacing:
+                        SolianTheme.isLargeScreen(context) ? null : 24,
+                    forceElevated: innerBoxIsScrolled,
+                    actions: [
+                      const NotificationButton(),
+                      if (!SolianTheme.isLargeScreen(context))
+                        const SizedBox(width: 16),
+                    ],
+                  ),
+                ),
+              ];
+            },
+            body: MediaQuery.removePadding(
+              removeTop: true,
+              context: context,
               child: RefreshIndicator(
                 onRefresh: () => Future.sync(() => _pagingController.refresh()),
-          child: PagedListView<int, Post>.separated(
-            pagingController: _pagingController,
-            builderDelegate: PagedChildBuilderDelegate<Post>(
-              itemBuilder: (context, item, index) {
-                return GestureDetector(
-                  child: PostItem(key: Key('p${item.alias}'), item: item)
-                      .paddingSymmetric(
-                    vertical: (item.attachments?.isEmpty ?? false) ? 8 : 0,
+                child: PostListWidget(controller: _pagingController),
               ),
-                  onTap: () {},
-                  onLongPress: () {
-                    showModalBottomSheet(
-                      useRootNavigator: true,
-                      context: context,
-                      builder: (context) => PostAction(item: item),
-                    ).then((value) {
-                      if (value == true) _pagingController.refresh();
-                    });
-                  },
-                );
-              },
             ),
-            separatorBuilder: (_, __) =>
-                const Divider(thickness: 0.3, height: 0.3),
           ),
         ),
       ),

lib/services.dart

@@ -2,9 +2,11 @@ abstract class ServiceFinder {
   static const bool devFlag = true;
 
   static Map<String, String> services = {
-    'paperclip': devFlag ? 'http://localhost:8443' : 'https://usercontent.solsynth.dev',
+    'paperclip':
+        devFlag ? 'http://localhost:8443' : 'https://usercontent.solsynth.dev',
     'passport': devFlag ? 'http://localhost:8444' : 'https://id.solsynth.dev',
-    'interactive': devFlag ? 'http://localhost:8445' : 'https://co.solsynth.dev',
-    'messaging': devFlag ? 'http://localhost:8446' : 'https://im.solsynth.dev',
+    'interactive':
+        devFlag ? 'http://localhost:8445' : 'https://co.solsynth.dev',
+    'messaging': devFlag ? 'http://localhost:8447' : 'https://im.solsynth.dev',
   };
 }

lib/shells/nav_shell.dart

@@ -8,24 +8,32 @@ import 'package:solian/widgets/navigation/app_navigation_bottom_bar.dart';
 import 'package:solian/widgets/navigation/app_navigation_rail.dart';
 
 class NavShell extends StatelessWidget {
+  final bool showAppBar;
   final GoRouterState state;
   final Widget child;
 
-  const NavShell({super.key, required this.child, required this.state});
+  const NavShell({
+    super.key,
+    required this.child,
+    required this.state,
+    this.showAppBar = true,
+  });
 
   @override
   Widget build(BuildContext context) {
     final canPop = AppRouter.instance.canPop();
 
     return Scaffold(
-      appBar: AppBar(
+      appBar: showAppBar
+          ? AppBar(
               title: Text(state.topRoute?.name?.tr ?? 'page'.tr),
               centerTitle: false,
               titleSpacing: canPop ? null : 24,
               elevation: SolianTheme.isLargeScreen(context) ? 1 : 0,
               leading: canPop ? const PrevPageButton() : null,
               automaticallyImplyLeading: false,
-      ),
+            )
+          : null,
       bottomNavigationBar: SolianTheme.isLargeScreen(context)
           ? null
           : const AppNavigationBottomBar(),

lib/translations.dart

@@ -9,14 +9,17 @@ class SolianMessages extends Translations {
           'next': 'Next',
           'reset': 'Reset',
           'page': 'Page',
-          'home': 'Home',
+          'social': 'Social',
+          'contact': 'Contact',
           'apply': 'Apply',
           'cancel': 'Cancel',
           'confirm': 'Confirm',
           'edit': 'Edit',
           'delete': 'Delete',
+          'search': 'Search',
           'reply': 'Reply',
           'repost': 'Repost',
+          'notification': 'Notification',
           'errorHappened': 'An error occurred',
           'email': 'Email',
           'username': 'Username',
@@ -31,16 +34,24 @@ class SolianMessages extends Translations {
           'accountPersonalizeApplied':
               'Account personalize settings has been saved.',
           'accountFriend': 'Friend',
+          'accountFriendNew': 'New friend',
+          'accountFriendNewHint':
+              'Use someone\'s username to send a request of making friends with them!',
+          'accountFriendPending': 'Friend requests',
+          'accountFriendBlocked': 'Friend blocklist',
+          'accountFriendListHint': 'Swipe left to decline, right to approve',
           'aspectRatio': 'Aspect Ratio',
           'aspectRatioSquare': 'Square',
           'aspectRatioPortrait': 'Portrait',
           'aspectRatioLandscape': 'Landscape',
           'signin': 'Sign in',
+          'signinGreeting': 'Welcome back\nSolar Network',
           'signinCaption':
               'Sign in to create post, start a realm, message your friend and more!',
           'signinRiskDetected':
               'Risk detected, click Next to open a webpage and signin through it to pass security check.',
           'signup': 'Sign up',
+          'signupGreeting': 'Welcome onboard',
           'signupCaption':
               'Create an account on Solarpass and then get the access of entire Solar Network!',
           'signout': 'Sign out',
@@ -48,12 +59,18 @@ class SolianMessages extends Translations {
           'matureContent': 'Mature Content',
           'matureContentCaption':
               'The content is rated and may not suitable for everyone to view',
+          'notifyAllRead': 'Mark all as read',
+          'notifyEmpty': 'All notifications read',
+          'notifyEmptyCaption': 'It seems like nothing happened recently',
           'postAction': 'Post',
+          'postDetail': 'Post',
+          'postReplies': 'Replies',
           'postPublishing': 'Post a post',
           'postIdentityNotify': 'You will post this post as',
           'postContentPlaceholder': 'What\'s happened?!',
           'postReaction': 'Reactions of the Post',
           'postActionList': 'Actions of Post',
+          'postReplyAction': 'Make a reply',
           'postRepliedNotify': 'Replied a post from @username.',
           'postRepostedNotify': 'Reposted a post from @username.',
           'postEditingNotify': 'You\'re editing as post from you.',
@@ -73,6 +90,16 @@ class SolianMessages extends Translations {
           'attachmentAddFile': 'Attach file',
           'attachmentSetting': 'Adjust attachment',
           'attachmentAlt': 'Alternative text',
+          'channelOrganizing': 'Organize a channel',
+          'channelEditingNotify': 'You\'re editing channel @channel',
+          'channelAlias': 'Alias (Identifier)',
+          'channelName': 'Name',
+          'channelDescription': 'Description',
+          'channelEncrypted': 'Encrypted Channel',
+          'channelMember': 'Channel member',
+          'channelType': 'Channel type',
+          'channelTypeCommon': 'Regular',
+          'channelTypeDirect': 'DM',
         },
         'zh_CN': {
           'hide': '隐藏',
@@ -84,10 +111,13 @@ class SolianMessages extends Translations {
           'edit': '编辑',
           'delete': '删除',
           'page': '页面',
-          'home': '首页',
+          'social': '社交',
+          'contact': '联系',
           'apply': '应用',
+          'search': '搜索',
           'reply': '回复',
           'repost': '转帖',
+          'notification': '通知',
           'errorHappened': '发生错误了',
           'email': '邮件地址',
           'username': '用户名',
@@ -101,25 +131,38 @@ class SolianMessages extends Translations {
           'accountPersonalize': '个性化',
           'accountPersonalizeApplied': '账户的个性化设置已保存。',
           'accountFriend': '好友',
+          'accountFriendNew': '添加好友',
+          'accountFriendNewHint': '使用他人的用户名来发送一个好友请求吧！',
+          'accountFriendPending': '好友请求',
+          'accountFriendBlocked': '好友黑名单',
+          'accountFriendListHint': '左滑来拒绝，右滑来接受',
           'aspectRatio': '纵横比',
           'aspectRatioSquare': '方型',
           'aspectRatioPortrait': '竖型',
           'aspectRatioLandscape': '横型',
           'signin': '登录',
+          'signinGreeting': '欢迎回来\nSolar Network',
           'signinCaption': '登录以发表帖子、文章、创建领域、和你的朋友聊天，以及获取更多功能！',
           'signinRiskDetected': '检测到风险，点击下一步按钮来打开一个网页，并通过在其上面登录来通过安全检查。',
           'signup': '注册',
+          'signupGreeting': '欢迎加入\nSolar Network',
           'signupCaption': '在 Solarpass 注册一个账号以获得整个 Solar Network 的存取权！',
           'signout': '登出',
           'riskDetection': '检测到风险',
           'matureContent': '评级内容',
           'matureContentCaption': '该内容已被评级为家长指导级或以上，这可能说明内容包含一系列不友好的成分',
+          'notifyAllRead': '已读所有通知',
+          'notifyEmpty': '通知箱为空',
+          'notifyEmptyCaption': '看起来最近没发生什么呢',
           'postAction': '发表',
+          'postDetail': '帖子详情',
+          'postReplies': '帖子回复',
           'postPublishing': '发表帖子',
           'postIdentityNotify': '你将会以本身份发表帖子',
           'postContentPlaceholder': '发生什么事了？！',
           'postReaction': '帖子的反应',
           'postActionList': '帖子的操作',
+          'postReplyAction': '发表一则回复',
           'postRepliedNotify': '回了一个 @username 的帖子',
           'postRepostedNotify': '转了一个 @username 的帖子',
           'postEditingNotify': '你正在编辑一个你发布的帖子',
@@ -138,6 +181,16 @@ class SolianMessages extends Translations {
           'attachmentAddFile': '附加文件',
           'attachmentSetting': '调整附件',
           'attachmentAlt': '替代文字',
+          'channelOrganizing': '组织频道',
+          'channelEditingNotify': '你正在编辑频道 @channel',
+          'channelAlias': '别称（标识符）',
+          'channelName': '显示名称',
+          'channelDescription': '频道简介',
+          'channelEncrypted': '加密频道',
+          'channelMember': '频道成员',
+          'channelType': '频道类型',
+          'channelTypeCommon': '普通频道',
+          'channelTypeDirect': '私信聊天',
         }
       };
 }

lib/widgets/account/account_avatar.dart

@@ -15,7 +15,8 @@ class AccountAvatar extends StatelessWidget {
     bool isEmpty = content == null;
     if (content is String) {
       direct = content.startsWith('http');
-      isEmpty = content.endsWith('/api/attachments/0');
+      if (!isEmpty) isEmpty = content.isEmpty;
+      if (!isEmpty) isEmpty = content.endsWith('/api/attachments/0');
     }
 
     return CircleAvatar(

lib/widgets/account/friend_list.dart

@@ -0,0 +1,73 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/friendship.dart';
+import 'package:solian/providers/friend.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
+
+class SliverFriendList extends StatelessWidget {
+  final int accountId;
+  final List<Friendship> items;
+  final Function onUpdate;
+
+  const SliverFriendList({
+    super.key,
+    required this.accountId,
+    required this.items,
+    required this.onUpdate,
+  });
+
+  DismissDirection getDismissDirection(Friendship relation) {
+    if (relation.status == 2) return DismissDirection.endToStart;
+    if (relation.status == 1) return DismissDirection.startToEnd;
+    if (relation.status == 0 && relation.relatedId != accountId) {
+      return DismissDirection.startToEnd;
+    }
+    return DismissDirection.horizontal;
+  }
+
+  Widget buildItem(context, index) {
+    final element = items[index];
+    final otherside = element.getOtherside(accountId);
+
+    final randomId = DateTime.now().microsecondsSinceEpoch >> 10;
+
+    return Dismissible(
+      key: Key(randomId.toString()),
+      background: Container(
+        color: Colors.red,
+        padding: const EdgeInsets.symmetric(horizontal: 20),
+        alignment: Alignment.centerLeft,
+        child: const Icon(Icons.close, color: Colors.white),
+      ),
+      secondaryBackground: Container(
+        color: Colors.green,
+        padding: const EdgeInsets.symmetric(horizontal: 20),
+        alignment: Alignment.centerRight,
+        child: const Icon(Icons.check, color: Colors.white),
+      ),
+      direction: getDismissDirection(element),
+      child: ListTile(
+        title: Text(otherside.nick),
+        subtitle: Text(otherside.name),
+        leading: AccountAvatar(content: otherside.avatar),
+      ),
+      onDismissed: (direction) {
+        final FriendProvider provider = Get.find();
+        if (direction == DismissDirection.startToEnd) {
+          provider.updateFriendship(element, 2).then((_) => onUpdate());
+        }
+        if (direction == DismissDirection.endToStart) {
+          provider.updateFriendship(element, 1).then((_) => onUpdate());
+        }
+      },
+    );
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return SliverList.builder(
+      itemCount: items.length,
+      itemBuilder: (_, __) => buildItem(_, __),
+    );
+  }
+}

lib/widgets/account/friend_select.dart

@@ -0,0 +1,81 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:solian/models/account.dart';
+import 'package:solian/models/friendship.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/friend.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
+
+class FriendSelect extends StatefulWidget {
+  final String title;
+  final Widget? Function(Account item)? trailingBuilder;
+
+  const FriendSelect({super.key, required this.title, this.trailingBuilder});
+
+  @override
+  State<FriendSelect> createState() => _FriendSelectState();
+}
+
+class _FriendSelectState extends State<FriendSelect> {
+  int _accountId = 0;
+
+  List<Friendship> _friends = List.empty(growable: true);
+
+  getFriends() async {
+    final AuthProvider auth = Get.find();
+    final prof = await auth.getProfile();
+    _accountId = prof.body['id'];
+
+    final FriendProvider provider = Get.find();
+    final resp = await provider.listFriendshipWithStatus(1);
+
+    setState(() {
+      _friends.addAll(resp.body
+          .map((e) => Friendship.fromJson(e))
+          .toList()
+          .cast<Friendship>());
+    });
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    getFriends();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return SizedBox(
+      height: MediaQuery.of(context).size.height * 0.85,
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            widget.title,
+            style: Theme.of(context).textTheme.headlineSmall,
+          ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+          Expanded(
+            child: ListView.builder(
+              itemCount: _friends.length,
+              itemBuilder: (context, index) {
+                var element = _friends[index].getOtherside(_accountId);
+                return ListTile(
+                  title: Text(element.nick),
+                  subtitle: Text(element.name),
+                  leading: AccountAvatar(content: element.avatar),
+                  trailing: widget.trailingBuilder != null
+                      ? widget.trailingBuilder!(element)
+                      : null,
+                  onTap: () {
+                    Navigator.pop(context, element);
+                  },
+                );
+              },
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/widgets/attachments/attachment_item.dart

@@ -4,6 +4,7 @@ import 'package:solian/models/attachment.dart';
 import 'package:solian/services.dart';
 
 class AttachmentItem extends StatelessWidget {
+  final String parentId;
   final Attachment item;
   final bool showBadge;
   final bool showHideButton;
@@ -13,6 +14,7 @@ class AttachmentItem extends StatelessWidget {
 
   const AttachmentItem({
     super.key,
+    required this.parentId,
     required this.item,
     this.badge,
     this.fit = BoxFit.cover,
@@ -24,7 +26,7 @@ class AttachmentItem extends StatelessWidget {
   @override
   Widget build(BuildContext context) {
     return Hero(
-      tag: Key('a${item.uuid}'),
+      tag: Key('a${item.uuid}p$parentId'),
       child: Stack(
         fit: StackFit.expand,
         children: [
@@ -48,8 +50,10 @@ class AttachmentItem extends StatelessWidget {
               child: Material(
                 color: Colors.transparent,
                 child: ActionChip(
-                  visualDensity: const VisualDensity(vertical: -4, horizontal: -4),
-                  avatar: Icon(Icons.visibility_off, color: Theme.of(context).colorScheme.onSurfaceVariant),
+                  visualDensity:
+                      const VisualDensity(vertical: -4, horizontal: -4),
+                  avatar: Icon(Icons.visibility_off,
+                      color: Theme.of(context).colorScheme.onSurfaceVariant),
                   label: Text('hide'.tr),
                   onPressed: () {
                     if (onHide != null) onHide!();

lib/widgets/attachments/attachment_list.dart

@@ -9,9 +9,11 @@ import 'package:solian/providers/content/attachment.dart';
 import 'package:solian/widgets/attachments/attachment_list_fullscreen.dart';
 
 class AttachmentList extends StatefulWidget {
+  final String parentId;
   final List<int> attachmentsId;
 
-  const AttachmentList({super.key, required this.attachmentsId});
+  const AttachmentList(
+      {super.key, required this.parentId, required this.attachmentsId});
 
   @override
   State<AttachmentList> createState() => _AttachmentListState();
@@ -126,6 +128,7 @@ class _AttachmentListState extends State<AttachmentList> {
               fit: StackFit.expand,
               children: [
                 AttachmentItem(
+                  parentId: widget.parentId,
                   key: Key('a${element!.uuid}'),
                   item: element,
                   badge: _attachmentsMeta.length > 1
@@ -180,7 +183,8 @@ class _AttachmentListState extends State<AttachmentList> {
             } else {
               Navigator.of(context, rootNavigator: true).push(
                 MaterialPageRoute(
-                  builder: (context) => AttachmentListFullscreen(
+                  builder: (context) => AttachmentListFullScreen(
+                    parentId: widget.parentId,
                     attachment: element,
                   ),
                 ),

lib/widgets/attachments/attachment_list_fullscreen.dart

@@ -2,17 +2,19 @@ import 'package:flutter/material.dart';
 import 'package:solian/models/attachment.dart';
 import 'package:solian/widgets/attachments/attachment_item.dart';
 
-class AttachmentListFullscreen extends StatefulWidget {
+class AttachmentListFullScreen extends StatefulWidget {
+  final String parentId;
   final Attachment attachment;
 
-  const AttachmentListFullscreen({super.key, required this.attachment});
+  const AttachmentListFullScreen(
+      {super.key, required this.parentId, required this.attachment});
 
   @override
-  State<AttachmentListFullscreen> createState() =>
-      _AttachmentListFullscreenState();
+  State<AttachmentListFullScreen> createState() =>
+      _AttachmentListFullScreenState();
 }
 
-class _AttachmentListFullscreenState extends State<AttachmentListFullscreen> {
+class _AttachmentListFullScreenState extends State<AttachmentListFullScreen> {
   @override
   void initState() {
     super.initState();
@@ -33,6 +35,7 @@ class _AttachmentListFullscreenState extends State<AttachmentListFullscreen> {
             panEnabled: true,
             scaleEnabled: true,
             child: AttachmentItem(
+              parentId: widget.parentId,
               showHideButton: false,
               item: widget.attachment,
               fit: BoxFit.contain,

lib/widgets/navigation/app_navigation.dart

@@ -4,9 +4,14 @@ import 'package:get/utils.dart';
 abstract class AppNavigation {
   static List<AppNavigationDestination> destinations = [
     AppNavigationDestination(
-      icon: const Icon(Icons.home),
-      label: 'home'.tr,
-      page: 'home',
+      icon: const Icon(Icons.public),
+      label: 'social'.tr,
+      page: 'social',
+    ),
+    AppNavigationDestination(
+      icon: const Icon(Icons.contacts),
+      label: 'contact'.tr,
+      page: 'contact',
     ),
     AppNavigationDestination(
       icon: const Icon(Icons.account_circle),
@@ -21,5 +26,6 @@ class AppNavigationDestination {
   final String label;
   final String page;
 
-  AppNavigationDestination({required this.icon, required this.label, required this.page});
+  AppNavigationDestination(
+      {required this.icon, required this.label, required this.page});
 }

lib/widgets/navigation/app_navigation_rail.dart

@@ -15,13 +15,15 @@ class _AppNavigationRailState extends State<AppNavigationRail> {
   @override
   Widget build(BuildContext context) {
     return NavigationRail(
-      destinations: AppNavigation.destinations.map(
+      destinations: AppNavigation.destinations
+          .map(
             (e) => NavigationRailDestination(
               icon: e.icon,
               label: Text(e.label),
             ),
-      ).toList(),
-      labelType: NavigationRailLabelType.selected,
+          )
+          .toList(),
+      labelType: NavigationRailLabelType.all,
       selectedIndex: _selectedIndex,
       onDestinationSelected: (idx) {
         setState(() => _selectedIndex = idx);

lib/widgets/posts/post_action.dart

@@ -2,12 +2,13 @@ import 'dart:math';
 
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
+import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get.dart';
 import 'package:solian/exts.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/screens/posts/publish.dart';
+import 'package:solian/screens/posts/post_publish.dart';
 import 'package:solian/services.dart';
 
 class PostAction extends StatefulWidget {
@@ -68,7 +69,7 @@ class _PostActionState extends State<PostAction> {
               children: [
                 ListTile(
                   contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                  leading: const Icon(Icons.reply),
+                  leading: const FaIcon(FontAwesomeIcons.reply, size: 20),
                   title: Text('reply'.tr),
                   onTap: () async {
                     final value = await AppRouter.instance.pushNamed(
@@ -82,7 +83,7 @@ class _PostActionState extends State<PostAction> {
                 ),
                 ListTile(
                   contentPadding: const EdgeInsets.symmetric(horizontal: 24),
-                  leading: const Icon(Icons.redo),
+                  leading: const FaIcon(FontAwesomeIcons.retweet, size: 20),
                   title: Text('repost'.tr),
                   onTap: () async {
                     final value = await AppRouter.instance.pushNamed(
@@ -155,7 +156,7 @@ class _PostDeletionDialogState extends State<PostDeletionDialog> {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['interactive'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     setState(() => _isBusy = true);
     final resp = await client.delete('/api/posts/${widget.item.id}');

lib/widgets/posts/post_item.dart

@@ -1,8 +1,10 @@
 import 'package:flutter/cupertino.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:font_awesome_flutter/font_awesome_flutter.dart';
 import 'package:get/get_utils/get_utils.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/router.dart';
 import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/attachments/attachment_list.dart';
 import 'package:solian/widgets/posts/post_quick_action.dart';
@@ -10,14 +12,22 @@ import 'package:timeago/timeago.dart' show format;
 
 class PostItem extends StatefulWidget {
   final Post item;
+  final bool isClickable;
   final bool isCompact;
   final bool isReactable;
+  final bool isShowReply;
+  final bool isShowEmbed;
+  final String? overrideAttachmentParent;
 
   const PostItem({
     super.key,
     required this.item,
+    this.isClickable = false,
     this.isCompact = false,
     this.isReactable = true,
+    this.isShowReply = true,
+    this.isShowEmbed = true,
+    this.overrideAttachmentParent,
   });
 
   @override
@@ -38,14 +48,14 @@ class _PostItemState extends State<PostItem> {
       children: [
         Row(
           children: [
-            Icon(
-              Icons.reply,
-              size: 18,
+            FaIcon(
+              FontAwesomeIcons.reply,
+              size: 16,
               color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
             ),
             Text(
               'postRepliedNotify'.trParams(
-                {'username': '@${widget.item.author.name}'},
+                {'username': '@${widget.item.replyTo!.author.name}'},
               ),
               style: TextStyle(
                 color:
@@ -59,6 +69,7 @@ class _PostItemState extends State<PostItem> {
           child: PostItem(
             item: widget.item.replyTo!,
             isCompact: true,
+            overrideAttachmentParent: widget.item.alias,
           ).paddingSymmetric(vertical: 8),
         ),
       ],
@@ -70,14 +81,14 @@ class _PostItemState extends State<PostItem> {
       children: [
         Row(
           children: [
-            Icon(
-              Icons.redo,
-              size: 18,
+            FaIcon(
+              FontAwesomeIcons.retweet,
+              size: 16,
               color: Theme.of(context).colorScheme.onSurface.withOpacity(0.75),
             ),
             Text(
               'postRepostedNotify'.trParams(
-                {'username': '@${widget.item.author.name}'},
+                {'username': '@${widget.item.repostTo!.author.name}'},
               ),
               style: TextStyle(
                 color:
@@ -91,6 +102,7 @@ class _PostItemState extends State<PostItem> {
           child: PostItem(
             item: widget.item.repostTo!,
             isCompact: true,
+            overrideAttachmentParent: widget.item.alias,
           ).paddingSymmetric(vertical: 8),
         ),
       ],
@@ -126,7 +138,10 @@ class _PostItemState extends State<PostItem> {
             top: 2,
             bottom: hasAttachment ? 4 : 0,
           ),
-          AttachmentList(attachmentsId: item.attachments ?? List.empty()),
+          AttachmentList(
+            parentId: widget.overrideAttachmentParent ?? widget.item.alias,
+            attachmentsId: item.attachments ?? List.empty(),
+          ),
         ],
       );
     }
@@ -150,14 +165,38 @@ class _PostItemState extends State<PostItem> {
                           .paddingOnly(left: 4),
                     ],
                   ),
-                  if (widget.item.replyTo != null) buildReply(context),
-                  if (widget.item.repostTo != null) buildRepost(context),
                   Markdown(
                     shrinkWrap: true,
                     physics: const NeverScrollableScrollPhysics(),
                     data: item.content,
                     padding: const EdgeInsets.all(0),
                   ).paddingOnly(left: 12, right: 8),
+                  if (widget.item.replyTo != null && widget.isShowEmbed)
+                    GestureDetector(
+                      child: buildReply(context).paddingOnly(top: 4),
+                      onTap: () {
+                        if (!widget.isClickable) return;
+                        AppRouter.instance.pushNamed(
+                          'postDetail',
+                          pathParameters: {
+                            'alias': widget.item.replyTo!.alias,
+                          },
+                        );
+                      },
+                    ),
+                  if (widget.item.repostTo != null && widget.isShowEmbed)
+                    GestureDetector(
+                      child: buildRepost(context).paddingOnly(top: 4),
+                      onTap: () {
+                        if (!widget.isClickable) return;
+                        AppRouter.instance.pushNamed(
+                          'postDetail',
+                          pathParameters: {
+                            'alias': widget.item.repostTo!.alias,
+                          },
+                        );
+                      },
+                    ),
                 ],
               ),
             )
@@ -168,8 +207,12 @@ class _PostItemState extends State<PostItem> {
           right: 16,
           left: 16,
         ),
-        AttachmentList(attachmentsId: item.attachments ?? List.empty()),
+        AttachmentList(
+          parentId: widget.item.alias,
+          attachmentsId: item.attachments ?? List.empty(),
+        ),
         PostQuickAction(
+          isShowReply: widget.isShowReply,
           isReactable: widget.isReactable,
           item: widget.item,
           onReact: (symbol, changes) {

lib/widgets/posts/post_list.dart

@@ -0,0 +1,63 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/posts/post_action.dart';
+import 'package:solian/widgets/posts/post_item.dart';
+
+class PostListWidget extends StatelessWidget {
+  final bool shrinkWrap;
+  final bool isShowEmbed;
+  final bool isClickable;
+  final bool isNestedClickable;
+  final PagingController<int, Post> controller;
+
+  const PostListWidget({
+    super.key,
+    required this.controller,
+    this.shrinkWrap = false,
+    this.isShowEmbed = true,
+    this.isClickable = true,
+    this.isNestedClickable = true,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return PagedListView<int, Post>.separated(
+      shrinkWrap: shrinkWrap,
+      pagingController: controller,
+      builderDelegate: PagedChildBuilderDelegate<Post>(
+        itemBuilder: (context, item, index) {
+          return GestureDetector(
+            child: PostItem(
+              key: Key('p${item.alias}'),
+              item: item,
+              isShowEmbed: isShowEmbed,
+              isClickable: isNestedClickable,
+            ).paddingSymmetric(
+              vertical: (item.attachments?.isEmpty ?? false) ? 8 : 0,
+            ),
+            onTap: () {
+              if (!isClickable) return;
+              AppRouter.instance.pushNamed(
+                'postDetail',
+                pathParameters: {'alias': item.alias},
+              );
+            },
+            onLongPress: () {
+              showModalBottomSheet(
+                useRootNavigator: true,
+                context: context,
+                builder: (context) => PostAction(item: item),
+              ).then((value) {
+                if (value == true) controller.refresh();
+              });
+            },
+          );
+        },
+      ),
+      separatorBuilder: (_, __) => const Divider(thickness: 0.3, height: 0.3),
+    );
+  }
+}

lib/widgets/posts/post_quick_action.dart

@@ -6,15 +6,18 @@ import 'package:solian/models/reaction.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/services.dart';
 import 'package:solian/widgets/posts/post_reaction.dart';
+import 'package:solian/widgets/posts/post_replies.dart';
 
 class PostQuickAction extends StatefulWidget {
   final Post item;
   final bool isReactable;
+  final bool isShowReply;
   final void Function(String symbol, int num) onReact;
 
   const PostQuickAction({
     super.key,
     required this.item,
+    this.isShowReply = true,
     this.isReactable = true,
     required this.onReact,
   });
@@ -50,7 +53,7 @@ class _PostQuickActionState extends State<PostQuickAction> {
 
     final client = GetConnect();
     client.httpClient.baseUrl = ServiceFinder.services['interactive'];
-    client.httpClient.addAuthenticator(auth.reqAuthenticator);
+    client.httpClient.addAuthenticator(auth.requestAuthenticator);
 
     setState(() => _isSubmitting = true);
 
@@ -93,17 +96,25 @@ class _PostQuickActionState extends State<PostQuickAction> {
         mainAxisAlignment: MainAxisAlignment.start,
         crossAxisAlignment: CrossAxisAlignment.center,
         children: [
-          if (widget.isReactable)
+          if (widget.isReactable && widget.isShowReply)
             ActionChip(
               avatar: const Icon(Icons.comment),
               label: Text(widget.item.replyCount.toString()),
               visualDensity: density,
-              onPressed: () {},
+              onPressed: () {
+                showModalBottomSheet(
+                  useRootNavigator: true,
+                  context: context,
+                  builder: (context) {
+                    return PostReplyListPopup(item: widget.item);
+                  },
+                );
+              },
             ),
-          if (widget.isReactable)
+          if (widget.isReactable && widget.isShowReply)
             const VerticalDivider(
                     thickness: 0.3, width: 0.3, indent: 8, endIndent: 8)
-                .paddingOnly(left: 8),
+                .paddingSymmetric(horizontal: 8),
           Expanded(
             child: ListView(
               shrinkWrap: true,
@@ -132,7 +143,7 @@ class _PostQuickActionState extends State<PostQuickAction> {
                     onPressed: () => showReactMenu(),
                   ),
               ],
-            ).paddingOnly(left: 8),
+            ),
           )
         ],
       ),

lib/widgets/posts/post_replies.dart

@@ -0,0 +1,86 @@
+import 'package:flutter/material.dart';
+import 'package:get/get.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
+import 'package:solian/models/pagination.dart';
+import 'package:solian/models/post.dart';
+import 'package:solian/providers/content/post.dart';
+import 'package:solian/widgets/posts/post_list.dart';
+
+class PostReplyList extends StatefulWidget {
+  final Post item;
+  final bool shrinkWrap;
+
+  const PostReplyList({
+    super.key,
+    required this.item,
+    this.shrinkWrap = false,
+  });
+
+  @override
+  State<PostReplyList> createState() => _PostReplyListState();
+}
+
+class _PostReplyListState extends State<PostReplyList> {
+  final PagingController<int, Post> _pagingController =
+      PagingController(firstPageKey: 0);
+
+  Future<void> getReplies(int pageKey) async {
+    final PostProvider provider = Get.find();
+
+    Response resp;
+    try {
+      resp = await provider.listPostReplies(widget.item.alias, pageKey);
+    } catch (e) {
+      _pagingController.error = e;
+      return;
+    }
+
+    final PaginationResult result = PaginationResult.fromJson(resp.body);
+    final parsed = result.data?.map((e) => Post.fromJson(e)).toList();
+    if (parsed != null && parsed.length >= 10) {
+      _pagingController.appendPage(parsed, pageKey + parsed.length);
+    } else if (parsed != null) {
+      _pagingController.appendLastPage(parsed);
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    _pagingController.addPageRequestListener(getReplies);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return PostListWidget(
+      isShowEmbed: false,
+      shrinkWrap: widget.shrinkWrap,
+      controller: _pagingController,
+    );
+  }
+}
+
+class PostReplyListPopup extends StatelessWidget {
+  final Post item;
+
+  const PostReplyListPopup({super.key, required this.item});
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.start,
+      children: [
+        Text(
+          'postReplies'.tr,
+          style: Theme.of(context).textTheme.headlineSmall,
+        ).paddingOnly(left: 24, right: 24, top: 32, bottom: 16),
+        Expanded(
+          child: PostReplyList(
+            item: item,
+          ),
+        ),
+      ],
+    );
+  }
+}

macos/Flutter/GeneratedPluginRegistrant.swift

@@ -6,12 +6,14 @@ import FlutterMacOS
 import Foundation
 
 import file_selector_macos
+import flutter_local_notifications
 import flutter_secure_storage_macos
 import path_provider_foundation
 import url_launcher_macos
 
 func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
   FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
+  FlutterLocalNotificationsPlugin.register(with: registry.registrar(forPlugin: "FlutterLocalNotificationsPlugin"))
   FlutterSecureStoragePlugin.register(with: registry.registrar(forPlugin: "FlutterSecureStoragePlugin"))
   PathProviderPlugin.register(with: registry.registrar(forPlugin: "PathProviderPlugin"))
   UrlLauncherPlugin.register(with: registry.registrar(forPlugin: "UrlLauncherPlugin"))

macos/Podfile.lock

@@ -0,0 +1,41 @@
+PODS:
+  - file_selector_macos (0.0.1):
+    - FlutterMacOS
+  - flutter_secure_storage_macos (6.1.1):
+    - FlutterMacOS
+  - FlutterMacOS (1.0.0)
+  - path_provider_foundation (0.0.1):
+    - Flutter
+    - FlutterMacOS
+  - url_launcher_macos (0.0.1):
+    - FlutterMacOS
+
+DEPENDENCIES:
+  - file_selector_macos (from `Flutter/ephemeral/.symlinks/plugins/file_selector_macos/macos`)
+  - flutter_secure_storage_macos (from `Flutter/ephemeral/.symlinks/plugins/flutter_secure_storage_macos/macos`)
+  - FlutterMacOS (from `Flutter/ephemeral`)
+  - path_provider_foundation (from `Flutter/ephemeral/.symlinks/plugins/path_provider_foundation/darwin`)
+  - url_launcher_macos (from `Flutter/ephemeral/.symlinks/plugins/url_launcher_macos/macos`)
+
+EXTERNAL SOURCES:
+  file_selector_macos:
+    :path: Flutter/ephemeral/.symlinks/plugins/file_selector_macos/macos
+  flutter_secure_storage_macos:
+    :path: Flutter/ephemeral/.symlinks/plugins/flutter_secure_storage_macos/macos
+  FlutterMacOS:
+    :path: Flutter/ephemeral
+  path_provider_foundation:
+    :path: Flutter/ephemeral/.symlinks/plugins/path_provider_foundation/darwin
+  url_launcher_macos:
+    :path: Flutter/ephemeral/.symlinks/plugins/url_launcher_macos/macos
+
+SPEC CHECKSUMS:
+  file_selector_macos: 54fdab7caa3ac3fc43c9fac4d7d8d231277f8cf2
+  flutter_secure_storage_macos: 59459653abe1adb92abbc8ea747d79f8d19866c9
+  FlutterMacOS: 8f6f14fa908a6fb3fba0cd85dbd81ec4b251fb24
+  path_provider_foundation: 2b6b4c569c0fb62ec74538f866245ac84301af46
+  url_launcher_macos: 5f437abeda8c85500ceb03f5c1938a8c5a705399
+
+PODFILE CHECKSUM: 236401fc2c932af29a9fcf0e97baeeb2d750d367
+
+COCOAPODS: 1.15.2

macos/Runner.xcodeproj/project.pbxproj

@@ -21,12 +21,14 @@
 /* End PBXAggregateTarget section */
 
 /* Begin PBXBuildFile section */
+		32E4047D78077CA8C6FE31E6 /* Pods_Runner.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 2738AEB242CF49091607FEDA /* Pods_Runner.framework */; };
 		331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C80D7294CF71000263BE5 /* RunnerTests.swift */; };
 		335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */ = {isa = PBXBuildFile; fileRef = 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */; };
 		33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC10F02044A3C60003C045 /* AppDelegate.swift */; };
 		33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F22044A3C60003C045 /* Assets.xcassets */; };
 		33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F42044A3C60003C045 /* MainMenu.xib */; };
 		33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */; };
+		7EA791CAE9710BE5D384F1BB /* Pods_RunnerTests.framework in Frameworks */ = {isa = PBXBuildFile; fileRef = 55FB45492936527B3666668F /* Pods_RunnerTests.framework */; };
 /* End PBXBuildFile section */
 
 /* Begin PBXContainerItemProxy section */
@@ -60,11 +62,13 @@
 /* End PBXCopyFilesBuildPhase section */
 
 /* Begin PBXFileReference section */
+		1B3B8DF79807852D828EBE0C /* Pods-RunnerTests.release.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.release.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.release.xcconfig"; sourceTree = "<group>"; };
+		2738AEB242CF49091607FEDA /* Pods_Runner.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; includeInIndex = 0; path = Pods_Runner.framework; sourceTree = BUILT_PRODUCTS_DIR; };
 		331C80D5294CF71000263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; };
 		331C80D7294CF71000263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = "<group>"; };
 		333000ED22D3DE5D00554162 /* Warnings.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Warnings.xcconfig; sourceTree = "<group>"; };
 		335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = GeneratedPluginRegistrant.swift; sourceTree = "<group>"; };
-		33CC10ED2044A3C60003C045 /* solian.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = "solian.app"; sourceTree = BUILT_PRODUCTS_DIR; };
+		33CC10ED2044A3C60003C045 /* solian.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = solian.app; sourceTree = BUILT_PRODUCTS_DIR; };
 		33CC10F02044A3C60003C045 /* AppDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = "<group>"; };
 		33CC10F22044A3C60003C045 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Assets.xcassets; path = Runner/Assets.xcassets; sourceTree = "<group>"; };
 		33CC10F52044A3C60003C045 /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.xib; name = Base; path = Base.lproj/MainMenu.xib; sourceTree = "<group>"; };
@@ -76,8 +80,14 @@
 		33E51913231747F40026EE4D /* DebugProfile.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = DebugProfile.entitlements; sourceTree = "<group>"; };
 		33E51914231749380026EE4D /* Release.entitlements */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.entitlements; path = Release.entitlements; sourceTree = "<group>"; };
 		33E5194F232828860026EE4D /* AppInfo.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AppInfo.xcconfig; sourceTree = "<group>"; };
+		3793F8988B03A8D2EAECDCBD /* Pods-RunnerTests.debug.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.debug.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.debug.xcconfig"; sourceTree = "<group>"; };
+		4BD0A28F73121D6B6DD462AF /* Pods-Runner.release.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.release.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.release.xcconfig"; sourceTree = "<group>"; };
+		55FB45492936527B3666668F /* Pods_RunnerTests.framework */ = {isa = PBXFileReference; explicitFileType = wrapper.framework; includeInIndex = 0; path = Pods_RunnerTests.framework; sourceTree = BUILT_PRODUCTS_DIR; };
 		7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Release.xcconfig; sourceTree = "<group>"; };
+		8AB030F50C089DAB14480DBD /* Pods-Runner.profile.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.profile.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.profile.xcconfig"; sourceTree = "<group>"; };
 		9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Debug.xcconfig; sourceTree = "<group>"; };
+		A9258CF6356D15783726DC84 /* Pods-Runner.debug.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-Runner.debug.xcconfig"; path = "Target Support Files/Pods-Runner/Pods-Runner.debug.xcconfig"; sourceTree = "<group>"; };
+		BA5247A2B03173FDFDFCFF93 /* Pods-RunnerTests.profile.xcconfig */ = {isa = PBXFileReference; includeInIndex = 1; lastKnownFileType = text.xcconfig; name = "Pods-RunnerTests.profile.xcconfig"; path = "Target Support Files/Pods-RunnerTests/Pods-RunnerTests.profile.xcconfig"; sourceTree = "<group>"; };
 /* End PBXFileReference section */
 
 /* Begin PBXFrameworksBuildPhase section */
@@ -85,6 +95,7 @@
 			isa = PBXFrameworksBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				7EA791CAE9710BE5D384F1BB /* Pods_RunnerTests.framework in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
@@ -92,12 +103,27 @@
 			isa = PBXFrameworksBuildPhase;
 			buildActionMask = 2147483647;
 			files = (
+				32E4047D78077CA8C6FE31E6 /* Pods_Runner.framework in Frameworks */,
 			);
 			runOnlyForDeploymentPostprocessing = 0;
 		};
 /* End PBXFrameworksBuildPhase section */
 
 /* Begin PBXGroup section */
+		27286574DE31F9C9A78B355D /* Pods */ = {
+			isa = PBXGroup;
+			children = (
+				A9258CF6356D15783726DC84 /* Pods-Runner.debug.xcconfig */,
+				4BD0A28F73121D6B6DD462AF /* Pods-Runner.release.xcconfig */,
+				8AB030F50C089DAB14480DBD /* Pods-Runner.profile.xcconfig */,
+				3793F8988B03A8D2EAECDCBD /* Pods-RunnerTests.debug.xcconfig */,
+				1B3B8DF79807852D828EBE0C /* Pods-RunnerTests.release.xcconfig */,
+				BA5247A2B03173FDFDFCFF93 /* Pods-RunnerTests.profile.xcconfig */,
+			);
+			name = Pods;
+			path = Pods;
+			sourceTree = "<group>";
+		};
 		331C80D6294CF71000263BE5 /* RunnerTests */ = {
 			isa = PBXGroup;
 			children = (
@@ -125,6 +151,7 @@
 				331C80D6294CF71000263BE5 /* RunnerTests */,
 				33CC10EE2044A3C60003C045 /* Products */,
 				D73912EC22F37F3D000D13A0 /* Frameworks */,
+				27286574DE31F9C9A78B355D /* Pods */,
 			);
 			sourceTree = "<group>";
 		};
@@ -175,6 +202,8 @@
 		D73912EC22F37F3D000D13A0 /* Frameworks */ = {
 			isa = PBXGroup;
 			children = (
+				2738AEB242CF49091607FEDA /* Pods_Runner.framework */,
+				55FB45492936527B3666668F /* Pods_RunnerTests.framework */,
 			);
 			name = Frameworks;
 			sourceTree = "<group>";
@@ -186,6 +215,7 @@
 			isa = PBXNativeTarget;
 			buildConfigurationList = 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */;
 			buildPhases = (
+				291CAD95BC748648C4154147 /* [CP] Check Pods Manifest.lock */,
 				331C80D1294CF70F00263BE5 /* Sources */,
 				331C80D2294CF70F00263BE5 /* Frameworks */,
 				331C80D3294CF70F00263BE5 /* Resources */,
@@ -204,11 +234,13 @@
 			isa = PBXNativeTarget;
 			buildConfigurationList = 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */;
 			buildPhases = (
+				C1C3653094F6B3FFFFCFD12B /* [CP] Check Pods Manifest.lock */,
 				33CC10E92044A3C60003C045 /* Sources */,
 				33CC10EA2044A3C60003C045 /* Frameworks */,
 				33CC10EB2044A3C60003C045 /* Resources */,
 				33CC110E2044A8840003C045 /* Bundle Framework */,
 				3399D490228B24CF009A79C7 /* ShellScript */,
+				C5DDC734703B72E778163C68 /* [CP] Embed Pods Frameworks */,
 			);
 			buildRules = (
 			);
@@ -291,6 +323,28 @@
 /* End PBXResourcesBuildPhase section */
 
 /* Begin PBXShellScriptBuildPhase section */
+		291CAD95BC748648C4154147 /* [CP] Check Pods Manifest.lock */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+			);
+			inputPaths = (
+				"${PODS_PODFILE_DIR_PATH}/Podfile.lock",
+				"${PODS_ROOT}/Manifest.lock",
+			);
+			name = "[CP] Check Pods Manifest.lock";
+			outputFileListPaths = (
+			);
+			outputPaths = (
+				"$(DERIVED_FILE_DIR)/Pods-RunnerTests-checkManifestLockResult.txt",
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "diff \"${PODS_PODFILE_DIR_PATH}/Podfile.lock\" \"${PODS_ROOT}/Manifest.lock\" > /dev/null\nif [ $? != 0 ] ; then\n    # print error to STDERR\n    echo \"error: The sandbox is not in sync with the Podfile.lock. Run 'pod install' or update your CocoaPods installation.\" >&2\n    exit 1\nfi\n# This output is used by Xcode 'outputs' to avoid re-running this script phase.\necho \"SUCCESS\" > \"${SCRIPT_OUTPUT_FILE_0}\"\n";
+			showEnvVarsInLog = 0;
+		};
 		3399D490228B24CF009A79C7 /* ShellScript */ = {
 			isa = PBXShellScriptBuildPhase;
 			alwaysOutOfDate = 1;
@@ -329,6 +383,45 @@
 			shellPath = /bin/sh;
 			shellScript = "\"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh && touch Flutter/ephemeral/tripwire";
 		};
+		C1C3653094F6B3FFFFCFD12B /* [CP] Check Pods Manifest.lock */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+			);
+			inputPaths = (
+				"${PODS_PODFILE_DIR_PATH}/Podfile.lock",
+				"${PODS_ROOT}/Manifest.lock",
+			);
+			name = "[CP] Check Pods Manifest.lock";
+			outputFileListPaths = (
+			);
+			outputPaths = (
+				"$(DERIVED_FILE_DIR)/Pods-Runner-checkManifestLockResult.txt",
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "diff \"${PODS_PODFILE_DIR_PATH}/Podfile.lock\" \"${PODS_ROOT}/Manifest.lock\" > /dev/null\nif [ $? != 0 ] ; then\n    # print error to STDERR\n    echo \"error: The sandbox is not in sync with the Podfile.lock. Run 'pod install' or update your CocoaPods installation.\" >&2\n    exit 1\nfi\n# This output is used by Xcode 'outputs' to avoid re-running this script phase.\necho \"SUCCESS\" > \"${SCRIPT_OUTPUT_FILE_0}\"\n";
+			showEnvVarsInLog = 0;
+		};
+		C5DDC734703B72E778163C68 /* [CP] Embed Pods Frameworks */ = {
+			isa = PBXShellScriptBuildPhase;
+			buildActionMask = 2147483647;
+			files = (
+			);
+			inputFileListPaths = (
+				"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks-${CONFIGURATION}-input-files.xcfilelist",
+			);
+			name = "[CP] Embed Pods Frameworks";
+			outputFileListPaths = (
+				"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks-${CONFIGURATION}-output-files.xcfilelist",
+			);
+			runOnlyForDeploymentPostprocessing = 0;
+			shellPath = /bin/sh;
+			shellScript = "\"${PODS_ROOT}/Target Support Files/Pods-Runner/Pods-Runner-frameworks.sh\"\n";
+			showEnvVarsInLog = 0;
+		};
 /* End PBXShellScriptBuildPhase section */
 
 /* Begin PBXSourcesBuildPhase section */
@@ -380,6 +473,7 @@
 /* Begin XCBuildConfiguration section */
 		331C80DB294CF71000263BE5 /* Debug */ = {
 			isa = XCBuildConfiguration;
+			baseConfigurationReference = 3793F8988B03A8D2EAECDCBD /* Pods-RunnerTests.debug.xcconfig */;
 			buildSettings = {
 				BUNDLE_LOADER = "$(TEST_HOST)";
 				CURRENT_PROJECT_VERSION = 1;
@@ -394,6 +488,7 @@
 		};
 		331C80DC294CF71000263BE5 /* Release */ = {
 			isa = XCBuildConfiguration;
+			baseConfigurationReference = 1B3B8DF79807852D828EBE0C /* Pods-RunnerTests.release.xcconfig */;
 			buildSettings = {
 				BUNDLE_LOADER = "$(TEST_HOST)";
 				CURRENT_PROJECT_VERSION = 1;
@@ -408,6 +503,7 @@
 		};
 		331C80DD294CF71000263BE5 /* Profile */ = {
 			isa = XCBuildConfiguration;
+			baseConfigurationReference = BA5247A2B03173FDFDFCFF93 /* Pods-RunnerTests.profile.xcconfig */;
 			buildSettings = {
 				BUNDLE_LOADER = "$(TEST_HOST)";
 				CURRENT_PROJECT_VERSION = 1;

macos/Runner.xcworkspace/contents.xcworkspacedata

@@ -4,4 +4,7 @@
    <FileRef
       location = "group:Runner.xcodeproj">
    </FileRef>
+   <FileRef
+      location = "group:Pods/Pods.xcodeproj">
+   </FileRef>
 </Workspace>

pubspec.lock

@@ -89,6 +89,22 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "1.0.8"
+  dbus:
+    dependency: transitive
+    description:
+      name: dbus
+      sha256: "365c771ac3b0e58845f39ec6deebc76e3276aa9922b0cc60840712094d9047ac"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.7.10"
+  dropdown_button2:
+    dependency: "direct main"
+    description:
+      name: dropdown_button2
+      sha256: b0fe8d49a030315e9eef6c7ac84ca964250155a6224d491c1365061bc974a9e1
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.9"
   fake_async:
     dependency: transitive
     description:
@@ -145,6 +161,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "0.9.3+1"
+  fixnum:
+    dependency: transitive
+    description:
+      name: fixnum
+      sha256: "25517a4deb0c03aa0f32fd12db525856438902d9c16536311e76cdc57b31d7d1"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.1.0"
   flutter:
     dependency: "direct main"
     description: flutter
@@ -166,6 +190,30 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.0.2"
+  flutter_local_notifications:
+    dependency: "direct main"
+    description:
+      name: flutter_local_notifications
+      sha256: "40e6fbd2da7dcc7ed78432c5cdab1559674b4af035fddbfb2f9a8f9c2112fcef"
+      url: "https://pub.dev"
+    source: hosted
+    version: "17.1.2"
+  flutter_local_notifications_linux:
+    dependency: transitive
+    description:
+      name: flutter_local_notifications_linux
+      sha256: "33f741ef47b5f63cc7f78fe75eeeac7e19f171ff3c3df054d84c1e38bedb6a03"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.0+1"
+  flutter_local_notifications_platform_interface:
+    dependency: transitive
+    description:
+      name: flutter_local_notifications_platform_interface
+      sha256: "340abf67df238f7f0ef58f4a26d2a83e1ab74c77ab03cd2b2d5018ac64db30b7"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.1.0"
   flutter_markdown:
     dependency: "direct main"
     description:
@@ -186,10 +234,10 @@ packages:
     dependency: "direct main"
     description:
       name: flutter_secure_storage
-      sha256: "8496a89eea74e23f92581885f876455d9d460e71201405dffe5f55dfe1155864"
+      sha256: "165164745e6afb5c0e3e3fcc72a012fb9e58496fb26ffb92cf22e16a821e85d0"
       url: "https://pub.dev"
     source: hosted
-    version: "9.2.1"
+    version: "9.2.2"
   flutter_secure_storage_linux:
     dependency: transitive
     description:
@@ -202,10 +250,10 @@ packages:
     dependency: transitive
     description:
       name: flutter_secure_storage_macos
-      sha256: b768a7dab26d6186b68e2831b3104f8968154f0f4fdbf66e7c2dd7bdf299daaf
+      sha256: "1693ab11121a5f925bbea0be725abfcfbbcf36c1e29e571f84a0c0f436147a81"
       url: "https://pub.dev"
     source: hosted
-    version: "3.1.1"
+    version: "3.1.2"
   flutter_secure_storage_platform_interface:
     dependency: transitive
     description:
@@ -256,6 +304,14 @@ packages:
     description: flutter
     source: sdk
     version: "0.0.0"
+  font_awesome_flutter:
+    dependency: "direct main"
+    description:
+      name: font_awesome_flutter
+      sha256: "275ff26905134bcb59417cf60ad979136f1f8257f2f449914b2c3e05bbb4cd6f"
+      url: "https://pub.dev"
+    source: hosted
+    version: "10.7.0"
   get:
     dependency: "direct main"
     description:
@@ -268,10 +324,10 @@ packages:
     dependency: "direct main"
     description:
       name: go_router
-      sha256: "7685acd06244ba4be60f455c5cafe5790c63dc91fc03f7385b1e922a6b85b17c"
+      sha256: "6ad5662b014c06c20fa46ab78715c96b2222a7fe4f87bf77e0289592c2539e86"
       url: "https://pub.dev"
     source: hosted
-    version: "14.1.1"
+    version: "14.1.3"
   http:
     dependency: transitive
     description:
@@ -292,10 +348,10 @@ packages:
     dependency: "direct main"
     description:
       name: image
-      sha256: "4c68bfd5ae83e700b5204c1e74451e7bf3cf750e6843c6e158289cf56bda018e"
+      sha256: "2237616a36c0d69aef7549ab439b833fb7f9fb9fc861af2cc9ac3eedddd69ca8"
       url: "https://pub.dev"
     source: hosted
-    version: "4.1.7"
+    version: "4.2.0"
   image_picker:
     dependency: "direct main"
     description:
@@ -528,6 +584,54 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.2.1"
+  permission_handler:
+    dependency: "direct main"
+    description:
+      name: permission_handler
+      sha256: "18bf33f7fefbd812f37e72091a15575e72d5318854877e0e4035a24ac1113ecb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "11.3.1"
+  permission_handler_android:
+    dependency: transitive
+    description:
+      name: permission_handler_android
+      sha256: "8bb852cd759488893805c3161d0b2b5db55db52f773dbb014420b304055ba2c5"
+      url: "https://pub.dev"
+    source: hosted
+    version: "12.0.6"
+  permission_handler_apple:
+    dependency: transitive
+    description:
+      name: permission_handler_apple
+      sha256: e9ad66020b89ff1b63908f247c2c6f931c6e62699b756ef8b3c4569350cd8662
+      url: "https://pub.dev"
+    source: hosted
+    version: "9.4.4"
+  permission_handler_html:
+    dependency: transitive
+    description:
+      name: permission_handler_html
+      sha256: "54bf176b90f6eddd4ece307e2c06cf977fb3973719c35a93b85cc7093eb6070d"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.1.1"
+  permission_handler_platform_interface:
+    dependency: transitive
+    description:
+      name: permission_handler_platform_interface
+      sha256: "48d4fcf201a1dad93ee869ab0d4101d084f49136ec82a8a06ed9cfeacab9fd20"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.2.1"
+  permission_handler_windows:
+    dependency: transitive
+    description:
+      name: permission_handler_windows
+      sha256: "1a790728016f79a41216d88672dbc5df30e686e811ad4e698bfc51f76ad91f1e"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.2.1"
   petitparser:
     dependency: transitive
     description:
@@ -573,6 +677,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "1.10.0"
+  sprintf:
+    dependency: transitive
+    description:
+      name: sprintf
+      sha256: "1fc9ffe69d4df602376b52949af107d8f5703b77cda567c4d7d86a0693120f23"
+      url: "https://pub.dev"
+    source: hosted
+    version: "7.0.0"
   stack_trace:
     dependency: transitive
     description:
@@ -621,6 +733,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.6.1"
+  timezone:
+    dependency: transitive
+    description:
+      name: timezone
+      sha256: a6ccda4a69a442098b602c44e61a1e2b4bf6f5516e875bbf0f427d5df14745d5
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.9.3"
   typed_data:
     dependency: transitive
     description:
@@ -641,10 +761,10 @@ packages:
     dependency: transitive
     description:
       name: url_launcher_android
-      sha256: "360a6ed2027f18b73c8d98e159dda67a61b7f2e0f6ec26e86c3ada33b0621775"
+      sha256: "17cd5e205ea615e2c6ea7a77323a11712dffa0720a8a90540db57a01347f9ad9"
       url: "https://pub.dev"
     source: hosted
-    version: "6.3.1"
+    version: "6.3.2"
   url_launcher_ios:
     dependency: transitive
     description:
@@ -693,6 +813,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.1.1"
+  uuid:
+    dependency: "direct main"
+    description:
+      name: uuid
+      sha256: "814e9e88f21a176ae1359149021870e87f7cddaf633ab678a5d2b0bff7fd1ba8"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.4.0"
   vector_math:
     dependency: transitive
     description:
@@ -717,14 +845,30 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "0.5.1"
+  web_socket:
+    dependency: transitive
+    description:
+      name: web_socket
+      sha256: "217f49b5213796cb508d6a942a5dc604ce1cb6a0a6b3d8cb3f0c314f0ecea712"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.1.4"
+  web_socket_channel:
+    dependency: "direct main"
+    description:
+      name: web_socket_channel
+      sha256: a2d56211ee4d35d9b344d9d4ce60f362e4f5d1aafb988302906bd732bc731276
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.0.0"
   win32:
     dependency: transitive
     description:
       name: win32
-      sha256: "0eaf06e3446824099858367950a813472af675116bf63f008a4c2a75ae13e9cb"
+      sha256: a79dbe579cb51ecd6d30b17e0cae4e0ea15e2c0e66f69ad4198f22a6789e94f4
       url: "https://pub.dev"
     source: hosted
-    version: "5.5.0"
+    version: "5.5.1"
   xdg_directories:
     dependency: transitive
     description:
@@ -742,5 +886,5 @@ packages:
     source: hosted
     version: "6.5.0"
 sdks:
-  dart: ">=3.3.4 <4.0.0"
+  dart: ">=3.4.0 <4.0.0"
   flutter: ">=3.19.0"

pubspec.yaml

@@ -51,6 +51,12 @@ dependencies:
   path: ^1.9.0
   intl: ^0.19.0
   image: ^4.1.7
+  font_awesome_flutter: ^10.7.0
+  web_socket_channel: ^3.0.0
+  flutter_local_notifications: ^17.1.2
+  permission_handler: ^11.3.1
+  uuid: ^4.4.0
+  dropdown_button2: ^2.3.9
 
 dev_dependencies:
   flutter_test:

windows/flutter/generated_plugin_registrant.cc

@@ -8,6 +8,7 @@
 
 #include <file_selector_windows/file_selector_windows.h>
 #include <flutter_secure_storage_windows/flutter_secure_storage_windows_plugin.h>
+#include <permission_handler_windows/permission_handler_windows_plugin.h>
 #include <url_launcher_windows/url_launcher_windows.h>
 
 void RegisterPlugins(flutter::PluginRegistry* registry) {
@@ -15,6 +16,8 @@ void RegisterPlugins(flutter::PluginRegistry* registry) {
       registry->GetRegistrarForPlugin("FileSelectorWindows"));
   FlutterSecureStorageWindowsPluginRegisterWithRegistrar(
       registry->GetRegistrarForPlugin("FlutterSecureStorageWindowsPlugin"));
+  PermissionHandlerWindowsPluginRegisterWithRegistrar(
+      registry->GetRegistrarForPlugin("PermissionHandlerWindowsPlugin"));
   UrlLauncherWindowsRegisterWithRegistrar(
       registry->GetRegistrarForPlugin("UrlLauncherWindows"));
 }

windows/flutter/generated_plugins.cmake

@@ -5,6 +5,7 @@
 list(APPEND FLUTTER_PLUGIN_LIST
   file_selector_windows
   flutter_secure_storage_windows
+  permission_handler_windows
   url_launcher_windows
 )