🐛 Bug fixes and optimization

💄 Better large screen support in chat

android/settings.gradle

@@ -20,7 +20,7 @@ pluginManagement {
 plugins {
     id "dev.flutter.flutter-plugin-loader" version "1.0.0"
     id "com.android.application" version "7.3.0" apply false
-    id "org.jetbrains.kotlin.android" version "1.7.10" apply false
+    id "org.jetbrains.kotlin.android" version "1.9.23" apply false
 }
 
 include ":app"

ios/Podfile.lock

@@ -69,6 +69,9 @@ PODS:
   - SDWebImage (5.19.1):
     - SDWebImage/Core (= 5.19.1)
   - SDWebImage/Core (5.19.1)
+  - sqflite (0.0.3):
+    - Flutter
+    - FlutterMacOS
   - SwiftyGif (5.4.5)
   - url_launcher_ios (0.0.1):
     - Flutter
@@ -97,6 +100,7 @@ DEPENDENCIES:
   - path_provider_foundation (from `.symlinks/plugins/path_provider_foundation/darwin`)
   - permission_handler_apple (from `.symlinks/plugins/permission_handler_apple/ios`)
   - screen_brightness_ios (from `.symlinks/plugins/screen_brightness_ios/ios`)
+  - sqflite (from `.symlinks/plugins/sqflite/darwin`)
   - url_launcher_ios (from `.symlinks/plugins/url_launcher_ios/ios`)
   - volume_controller (from `.symlinks/plugins/volume_controller/ios`)
   - wakelock_plus (from `.symlinks/plugins/wakelock_plus/ios`)
@@ -143,6 +147,8 @@ EXTERNAL SOURCES:
     :path: ".symlinks/plugins/permission_handler_apple/ios"
   screen_brightness_ios:
     :path: ".symlinks/plugins/screen_brightness_ios/ios"
+  sqflite:
+    :path: ".symlinks/plugins/sqflite/darwin"
   url_launcher_ios:
     :path: ".symlinks/plugins/url_launcher_ios/ios"
   volume_controller:
@@ -172,6 +178,7 @@ SPEC CHECKSUMS:
   permission_handler_apple: 9878588469a2b0d0fc1e048d9f43605f92e6cec2
   screen_brightness_ios: 715ca807df953bf676d339f11464e438143ee625
   SDWebImage: 40b0b4053e36c660a764958bff99eed16610acbb
+  sqflite: 673a0e54cc04b7d6dba8d24fb8095b31c3a99eec
   SwiftyGif: 706c60cf65fa2bc5ee0313beece843c8eb8194d4
   url_launcher_ios: 6116280ddcfe98ab8820085d8d76ae7449447586
   volume_controller: 531ddf792994285c9b17f9d8a7e4dcdd29b3eae9

lib/i18n/app_en.arb

@@ -2,6 +2,7 @@
   "appName": "Solar Network",
   "explore": "Explore",
   "chat": "Chat",
+  "realm": "Realm",
   "account": "Account",
   "riskDetection": "Risk Detection",
   "signIn": "Sign In",
@@ -27,6 +28,7 @@
   "birthday": "Birthday",
   "password": "Password",
   "next": "Next",
+  "join": "Join",
   "edit": "Edit",
   "apply": "Apply",
   "delete": "Delete",
@@ -36,12 +38,16 @@
   "cancel": "Cancel",
   "report": "Report",
   "reply": "Reply",
+  "export": "Export",
+  "import": "Import",
   "settings": "Settings",
   "errorHappened": "An Error Occurred",
   "notification": "Notification",
   "notifyDone": "You're done!",
   "notifyDoneCaption": "There are no notifications unread for you.",
   "notifyListHint": "Pull to refresh, swipe to dismiss",
+  "notifyMarkAllRead": "Mark all as read",
+  "notifyMarkAllReadDone": "Marked all notifications as read",
   "friend": "Friend",
   "friendPending": "Pending",
   "friendActive": "Active",
@@ -52,6 +58,11 @@
   "friendAddDone": "Friend request sent, go reach your friend!",
   "personalize": "Personalize",
   "personalizeApplied": "Your account information has been updated, some fields may take a while to fully applied.",
+  "keypair": "Keypair",
+  "keypairGenerated": "A new set of keypair has been generated. Automatically set it to active.",
+  "keypairSecretCode": "Secret Code",
+  "keypairImportHint": "You can paste the exported secret code here to import all keys in it.",
+  "keypairExportHint": "You can copy the exported secret code to other device to import all keys into it. Do not share it with anybody else!",
   "reaction": "Reaction",
   "reactVerb": "React",
   "post": "Post",
@@ -72,12 +83,30 @@
   "postEditNotify": "You are about editing a post that already published.",
   "reactionAdded": "Your reaction has been added.",
   "reactionRemoved": "Your reaction has been removed.",
+  "shortcutsEmpty": "Shortcuts are empty, looks like you didn't go anywhere recently...",
+  "realmNew": "New Realm",
+  "realmNewCreate": "Create a realm",
+  "realmNewJoin": "Join a exists realm",
+  "realmUsage": "Realm",
+  "realmUsageCaption": "Realm is a place to organize your posts, channels and more. It will be much easier if you build community with realm!",
+  "realmEstablish": "Establish a realm",
+  "realmEditNotify": "You are about editing a existing realm.",
+  "realmAliasLabel": "Realm Alias",
+  "realmNameLabel": "Realm Name",
+  "realmDescriptionLabel": "Realm Description",
+  "realmPublicLabel": "It's public",
+  "realmCommunityLabel": "It's community realm",
+  "realmMember": "Member",
+  "realmManage": "Realm Manage",
   "chatNew": "New Chat",
   "chatNewCreate": "Create a channel",
   "chatNewJoin": "Join a exists channel",
-  "chatManage": "Manage Chat",
+  "chatDetail": "Chat Details",
   "chatMember": "Member",
   "chatNotifySetting": "Notify Settings",
+  "chatChannelUnavailable": "Channel Unavailable",
+  "chatChannelUnavailableCaptionWithRealm": "You didn't join the channel, but looks like you able to join to, would you want to have a try?",
+  "chatChannelUnavailableCaption": "You didn't join the channel, so you cannot access the information of this channel.",
   "chatChannelUsage": "Channel",
   "chatChannelUsageCaption": "Channel is place to talk with people, one or a lot.",
   "chatChannelOrganize": "Organize a channel",
@@ -85,6 +114,7 @@
   "chatChannelAliasLabel": "Channel Alias",
   "chatChannelNameLabel": "Channel Name",
   "chatChannelDescriptionLabel": "Channel Description",
+  "chatChannelEncryptedLabel": "Encrypted Channel",
   "chatChannelLeaveConfirm": "Are you sure you want to leave this channel? Your message will be stored, but if you rejoin this channel later, you will lose your control of your previous messages.",
   "chatChannelDeleteConfirm": "Are you sure you want to delete this channel? All messages in this channel will be gone forever. This operation cannot be revert!",
   "chatCall": "Call",
@@ -102,7 +132,13 @@
   "chatCallDisconnectConfirm": "Are you sure you want to disconnect? You can reconnect after this if you want.",
   "chatCallChangeSpeaker": "Change Speaker",
   "chatMessagePlaceholder": "Write a message...",
+  "chatMessageEncryptedPlaceholder": "Write a encrypted message...",
+  "chatMessageSending": "Now delivering your messages...",
   "chatMessageEditNotify": "You are about editing a message.",
   "chatMessageReplyNotify": "You are about replying a message.",
-  "chatMessageDeleteConfirm": "Are you sure you want to delete this message? This operation cannot be revert and no local history is saved!"
+  "chatMessageDeleteConfirm": "Are you sure you want to delete this message? This operation cannot be revert and no local history is saved!",
+  "chatMessageViewSource": "View source",
+  "chatMessageUnableDecryptWaiting": "Waiting for encryption key...",
+  "chatMessageUnableDecryptUnsupported": "Unable to decrypt the message, encryption algorithm unsupported",
+  "chatMessageUnableDecryptMissing": "Unable to decrypt the message, missing encryption key"
 }

lib/i18n/app_zh.arb

@@ -2,6 +2,7 @@
   "appName": "Solar Network",
   "explore": "探索",
   "chat": "聊天",
+  "realm": "领域",
   "account": "账号",
   "riskDetection": "风险监测",
   "signIn": "登录",
@@ -27,6 +28,7 @@
   "birthday": "生日",
   "password": "密码",
   "next": "下一步",
+  "join": "加入",
   "edit": "编辑",
   "delete": "删除",
   "action": "操作",
@@ -36,12 +38,16 @@
   "exit": "离开",
   "report": "举报",
   "reply": "回复",
+  "export": "导出",
+  "import": "导入",
   "settings": "设置",
   "errorHappened": "发生了错误",
   "notification": "通知",
   "notifyDone": "所有通知已读！",
   "notifyDoneCaption": "这里没有什么东西可以给你看的了～",
   "notifyListHint": "下拉以刷新，左滑来已读",
+  "notifyMarkAllRead": "将所有标记为已读",
+  "notifyMarkAllReadDone": "已将所有通知标记为已读",
   "friend": "好友",
   "friendPending": "请求中",
   "friendActive": "活跃的好友",
@@ -52,6 +58,11 @@
   "friendAddDone": "好友请求已发送，快告诉你的朋友吧！",
   "personalize": "个性化",
   "personalizeApplied": "您的账号信息已被更新，部分信息可能需要一段时间来同步。",
+  "keypair": "密钥对",
+  "keypairGenerated": "已生成一套新的密钥对，并且设为活跃的密钥。",
+  "keypairSecretCode": "神秘代码",
+  "keypairImportHint": "你可以将别的设备导出的神秘代码粘贴到这里来导入其中的所有密钥。",
+  "keypairExportHint": "你可以将这个导出的神秘代码到你的别的设备来导入这个设备所包含的密钥，但绝对不要发送给其他人！",
   "reaction": "反应",
   "reactVerb": "作出反应",
   "post": "帖子",
@@ -72,10 +83,28 @@
   "postEditNotify": "你正在修改一个已经发布了的帖子。",
   "reactionAdded": "你的反应已被添加。",
   "reactionRemoved": "你的反应已被移除。",
+  "shortcutsEmpty": "快捷方式空空如也，看起来最近你没去哪里呀～",
+  "realmNew": "新领域",
+  "realmNewCreate": "创建新领域",
+  "realmNewJoin": "加入现有领域",
+  "realmUsage": "领域",
+  "realmUsageCaption": "领域是一个地方给你来组织帖子、文章、聊天频道的，好好利用领域打造一个绝妙的专属于你的社区吧！",
+  "realmEstablish": "部署领域",
+  "realmEditNotify": "你正在修改一个现有领域……",
+  "realmAliasLabel": "领域别名",
+  "realmNameLabel": "领域名称",
+  "realmDescriptionLabel": "领域简介",
+  "realmPublicLabel": "公共领域",
+  "realmCommunityLabel": "社区领域（任何人均可加入）",
+  "realmMember": "成员",
+  "realmManage": "领域管理",
   "chatNew": "新聊天",
-  "chatManage": "管理聊天",
+  "chatDetail": "聊天详情",
   "chatMember": "成员",
   "chatNotifySetting": "通知设定",
+  "chatChannelUnavailable": "频道不可用",
+  "chatChannelUnavailableCaptionWithRealm": "你没加入该频道，但是看起来你能加入本频道，你想加入吗？",
+  "chatChannelUnavailableCaption": "你没加入该频道，所以你无法读取本频道的信息。",
   "chatNewCreate": "新建频道",
   "chatNewJoin": "加入已有频道",
   "chatChannelUsage": "频道",
@@ -85,6 +114,7 @@
   "chatChannelAliasLabel": "频道别名",
   "chatChannelNameLabel": "频道名称",
   "chatChannelDescriptionLabel": "频道简介",
+  "chatChannelEncryptedLabel": "加密频道",
   "chatChannelLeaveConfirm": "你确定你要离开这个频道吗？你在这个频道里的消息将被存储下来，但是当你重新加入本频道后你将会失去对你之前消息的权限。",
   "chatChannelDeleteConfirm": "你确定你要删除这个频道吗？这个频道里的所有消息都将消失，并且不可被反转！",
   "chatCall": "通话",
@@ -102,7 +132,13 @@
   "chatCallDisconnect": "断开连接",
   "chatCallDisconnectConfirm": "你确定你要断开连接吗？你可以之后在任何时候重新连接。",
   "chatMessagePlaceholder": "发条消息……",
+  "chatMessageEncryptedPlaceholder": "发条加密信息……",
+  "chatMessageSending": "正在送出你的信息……",
   "chatMessageEditNotify": "你正在编辑信息中……",
   "chatMessageReplyNotify": "你正在回复消息中……",
-  "chatMessageDeleteConfirm": "你确定要删除这条消息吗？这条消息将永远的从所有人的视图中消失，并且不会有本地消息记录保存！"
+  "chatMessageDeleteConfirm": "你确定要删除这条消息吗？这条消息将永远的从所有人的视图中消失，并且不会有本地消息记录保存！",
+  "chatMessageViewSource": "查看原始信息",
+  "chatMessageUnableDecryptWaiting": "正在等待解密密钥……",
+  "chatMessageUnableDecryptUnsupported": "无法解密信息，不支持加密的算法",
+  "chatMessageUnableDecryptMissing": "无法解密信息，缺失解密密钥"
 }

lib/main.dart

@@ -3,14 +3,17 @@ import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/chat.dart';
 import 'package:solian/providers/friend.dart';
+import 'package:solian/providers/keypair.dart';
 import 'package:solian/providers/navigation.dart';
 import 'package:solian/providers/notify.dart';
+import 'package:solian/providers/realm.dart';
 import 'package:solian/router.dart';
+import 'package:solian/utils/theme.dart';
 import 'package:solian/utils/timeago.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/utils/video_player.dart';
 import 'package:solian/widgets/chat/call/call_overlay.dart';
-import 'package:solian/widgets/notification_notifier.dart';
+import 'package:solian/widgets/provider_init.dart';
 
 void main() {
   WidgetsFlutterBinding.ensureInitialized();
@@ -24,25 +27,16 @@ void main() {
 class SolianApp extends StatelessWidget {
   const SolianApp({super.key});
 
-  // This widget is the root of your application.
   @override
   Widget build(BuildContext context) {
     return MaterialApp.router(
       title: 'Solian',
-      theme: ThemeData(
+      theme: SolianTheme.build(Brightness.light),
-        brightness: Brightness.light,
+      darkTheme: SolianTheme.build(Brightness.dark),
-        colorScheme: ColorScheme.fromSeed(brightness: Brightness.light, seedColor: Colors.indigo),
-        useMaterial3: true,
-      ),
-      darkTheme: ThemeData(
-        brightness: Brightness.dark,
-        colorScheme: ColorScheme.fromSeed(brightness: Brightness.dark, seedColor: Colors.indigo),
-        useMaterial3: true,
-      ),
       themeMode: ThemeMode.system,
       localizationsDelegates: AppLocalizations.localizationsDelegates,
       supportedLocales: AppLocalizations.supportedLocales,
-      routerConfig: router,
+      routerConfig: SolianRouter.router,
       builder: (context, child) {
         return MultiProvider(
           providers: [
@@ -51,11 +45,19 @@ class SolianApp extends StatelessWidget {
             ChangeNotifierProvider(create: (_) => ChatProvider()),
             ChangeNotifierProvider(create: (_) => NotifyProvider()),
             ChangeNotifierProvider(create: (_) => FriendProvider()),
+            ChangeNotifierProvider(create: (_) => RealmProvider()),
+            ChangeNotifierProvider(create: (_) => KeypairProvider()),
           ],
           child: Overlay(
             initialEntries: [
               OverlayEntry(builder: (context) {
-                return NotificationNotifier(child: child ?? Container());
+                return ScaffoldMessenger(
+                  child: Scaffold(
+                    body: ProviderInitializer(
+                      child: child ?? Container(),
+                    ),
+                  ),
+                );
               }),
               OverlayEntry(builder: (context) => const CallOverlay()),
             ],

lib/models/channel.dart

@@ -8,12 +8,13 @@ class Channel {
   String alias;
   String name;
   String description;
-  dynamic members;
-  dynamic calls;
   int type;
   Account account;
   int accountId;
-  int realmId;
+  int? realmId;
+  bool isEncrypted;
+
+  bool isAvailable = false;
 
   Channel({
     required this.id,
@@ -23,12 +24,11 @@ class Channel {
     required this.alias,
     required this.name,
     required this.description,
-    this.members,
-    this.calls,
     required this.type,
     required this.account,
     required this.accountId,
-    required this.realmId,
+    required this.isEncrypted,
+    this.realmId,
   });
 
   factory Channel.fromJson(Map<String, dynamic> json) => Channel(
@@ -39,12 +39,11 @@ class Channel {
         alias: json['alias'],
         name: json['name'],
         description: json['description'],
-        members: json['members'],
-        calls: json['calls'],
         type: json['type'],
         account: Account.fromJson(json['account']),
         accountId: json['account_id'],
         realmId: json['realm_id'],
+        isEncrypted: json['is_encrypted'],
       );
 
   Map<String, dynamic> toJson() => {
@@ -55,12 +54,11 @@ class Channel {
         'alias': alias,
         'name': name,
         'description': description,
-        'members': members,
-        'calls': calls,
         'type': type,
         'account': account,
         'account_id': accountId,
         'realm_id': realmId,
+        'is_encrypted': isEncrypted,
       };
 }
 

lib/models/keypair.dart

@@ -0,0 +1,32 @@
+class Keypair {
+  final String id;
+  final String algorithm;
+  final String publicKey;
+  final String? privateKey;
+
+  final bool isOwned;
+
+  Keypair({
+    required this.id,
+    required this.algorithm,
+    required this.publicKey,
+    required this.privateKey,
+    this.isOwned = false,
+  });
+
+  factory Keypair.fromJson(Map<String, dynamic> json) => Keypair(
+        id: json['id'],
+        algorithm: json['algorithm'],
+        publicKey: json['public_key'],
+        privateKey: json['private_key'],
+        isOwned: json['is_owned'],
+      );
+
+  Map<String, dynamic> toJson() => {
+        'id': id,
+        'algorithm': algorithm,
+        'public_key': publicKey,
+        'private_key': privateKey,
+        'is_owned': isOwned,
+      };
+}

lib/models/message.dart

@@ -1,3 +1,5 @@
+import 'dart:convert';
+
 import 'package:solian/models/account.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/models/post.dart';
@@ -7,9 +9,9 @@ class Message {
   DateTime createdAt;
   DateTime updatedAt;
   DateTime? deletedAt;
-  String content;
+  String rawContent;
-  dynamic metadata;
+  Map<String, dynamic>? metadata;
-  int type;
+  String type;
   List<Attachment>? attachments;
   Channel? channel;
   Sender sender;
@@ -18,12 +20,18 @@ class Message {
   int channelId;
   int senderId;
 
+  bool isSending = false;
+
+  Map<String, dynamic> get decodedContent {
+    return jsonDecode(utf8.fuse(base64).decode(rawContent));
+  }
+
   Message({
     required this.id,
     required this.createdAt,
     required this.updatedAt,
     this.deletedAt,
-    required this.content,
+    required this.rawContent,
     required this.metadata,
     required this.type,
     this.attachments,
@@ -40,18 +48,14 @@ class Message {
         createdAt: DateTime.parse(json['created_at']),
         updatedAt: DateTime.parse(json['updated_at']),
         deletedAt: json['deleted_at'],
-        content: json['content'],
+        rawContent: json['content'],
         metadata: json['metadata'],
         type: json['type'],
-        attachments: List<Attachment>.from(
+        attachments: List<Attachment>.from(json['attachments']?.map((x) => Attachment.fromJson(x)) ?? List.empty()),
-            json['attachments']?.map((x) => Attachment.fromJson(x)) ??
-                List.empty()),
         channel: Channel.fromJson(json['channel']),
         sender: Sender.fromJson(json['sender']),
         replyId: json['reply_id'],
-        replyTo: json['reply_to'] != null
+        replyTo: json['reply_to'] != null ? Message.fromJson(json['reply_to']) : null,
-            ? Message.fromJson(json['reply_to'])
-            : null,
         channelId: json['channel_id'],
         senderId: json['sender_id'],
       );
@@ -61,11 +65,10 @@ class Message {
         'created_at': createdAt.toIso8601String(),
         'updated_at': updatedAt.toIso8601String(),
         'deleted_at': deletedAt,
-        'content': content,
+        'content': rawContent,
         'metadata': metadata,
         'type': type,
-        'attachments': List<dynamic>.from(
+        'attachments': List<dynamic>.from(attachments?.map((x) => x.toJson()) ?? List.empty()),
-            attachments?.map((x) => x.toJson()) ?? List.empty()),
         'channel': channel?.toJson(),
         'sender': sender.toJson(),
         'reply_id': replyId,

lib/models/notification.dart

@@ -9,7 +9,7 @@ class Notification {
   bool isImportant;
   bool isRealtime;
   DateTime? readAt;
-  int senderId;
+  int? senderId;
   int recipientId;
 
   Notification({
@@ -23,20 +23,18 @@ class Notification {
     required this.isImportant,
     required this.isRealtime,
     this.readAt,
-    required this.senderId,
+    this.senderId,
     required this.recipientId,
   });
 
   factory Notification.fromJson(Map<String, dynamic> json) => Notification(
-        id: json['id'],
+        id: json['id'] ?? 0,
-        createdAt: DateTime.parse(json['created_at']),
+        createdAt: json['created_at'] == null ? DateTime.now() : DateTime.parse(json['created_at']),
-        updatedAt: DateTime.parse(json['updated_at']),
+        updatedAt: json['updated_at'] == null ? DateTime.now() : DateTime.parse(json['updated_at']),
         deletedAt: json['deleted_at'],
         subject: json['subject'],
         content: json['content'],
-        links: json['links'] != null
+        links: json['links'] != null ? List<Link>.from(json['links'].map((x) => Link.fromJson(x))) : List.empty(),
-            ? List<Link>.from(json['links'].map((x) => Link.fromJson(x)))
-            : List.empty(),
         isImportant: json['is_important'],
         isRealtime: json['is_realtime'],
         readAt: json['read_at'],
@@ -51,9 +49,7 @@ class Notification {
         'deleted_at': deletedAt,
         'subject': subject,
         'content': content,
-        'links': links != null
+        'links': links != null ? List<dynamic>.from(links!.map((x) => x.toJson())) : List.empty(),
-            ? List<dynamic>.from(links!.map((x) => x.toJson()))
-            : List.empty(),
         'is_important': isImportant,
         'is_realtime': isRealtime,
         'read_at': readAt,

lib/models/personal_page.dart

@@ -0,0 +1,47 @@
+class PersonalPage {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String content;
+  String script;
+  String style;
+  Map<String, String>? links;
+  int accountId;
+
+  PersonalPage({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.content,
+    required this.script,
+    required this.style,
+    this.links,
+    required this.accountId,
+  });
+
+  factory PersonalPage.fromJson(Map<String, dynamic> json) => PersonalPage(
+        id: json['id'],
+        createdAt: DateTime.parse(json['created_at']),
+        updatedAt: DateTime.parse(json['updated_at']),
+        deletedAt: json['deleted_at'] != null ? DateTime.parse(json['deleted_at']) : null,
+        content: json['content'],
+        script: json['script'],
+        style: json['style'],
+        links: json['links'],
+        accountId: json['account_id'],
+      );
+
+  Map<String, dynamic> toJson() => {
+        'id': id,
+        'created_at': createdAt.toIso8601String(),
+        'updated_at': updatedAt.toIso8601String(),
+        'deleted_at': deletedAt?.toIso8601String(),
+        'content': content,
+        'script': script,
+        'style': style,
+        'links': links,
+        'account_id': accountId,
+      };
+}

lib/models/realm.dart

@@ -0,0 +1,97 @@
+import 'package:solian/models/account.dart';
+
+class Realm {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  String alias;
+  String name;
+  String description;
+  bool isPublic;
+  bool isCommunity;
+  int accountId;
+
+  Realm({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.alias,
+    required this.name,
+    required this.description,
+    required this.isPublic,
+    required this.isCommunity,
+    required this.accountId,
+  });
+
+  factory Realm.fromJson(Map<String, dynamic> json) => Realm(
+        id: json['id'],
+        createdAt: DateTime.parse(json['created_at']),
+        updatedAt: DateTime.parse(json['updated_at']),
+        deletedAt: json['deleted_at'] != null ? DateTime.parse(json['deleted_at']) : null,
+        alias: json['alias'],
+        name: json['name'],
+        description: json['description'],
+        isPublic: json['is_public'],
+        isCommunity: json['is_community'],
+        accountId: json['account_id'],
+      );
+
+  Map<String, dynamic> toJson() => {
+        'id': id,
+        'created_at': createdAt.toIso8601String(),
+        'updated_at': updatedAt.toIso8601String(),
+        'deleted_at': deletedAt,
+        'alias': alias,
+        'name': name,
+        'description': description,
+        'is_public': isPublic,
+        'is_community': isCommunity,
+        'account_id': accountId,
+      };
+}
+
+class RealmMember {
+  int id;
+  DateTime createdAt;
+  DateTime updatedAt;
+  DateTime? deletedAt;
+  int realmId;
+  int accountId;
+  Account account;
+  int powerLevel;
+
+  RealmMember({
+    required this.id,
+    required this.createdAt,
+    required this.updatedAt,
+    this.deletedAt,
+    required this.realmId,
+    required this.accountId,
+    required this.account,
+    required this.powerLevel,
+  });
+
+  factory RealmMember.fromJson(Map<String, dynamic> json) => RealmMember(
+        id: json['id'],
+        createdAt: DateTime.parse(json['created_at']),
+        updatedAt: DateTime.parse(json['updated_at']),
+        deletedAt: json['deleted_at'] != null ? DateTime.parse(json['deleted_at']) : null,
+        realmId: json['realm_id'],
+        accountId: json['account_id'],
+        account: Account.fromJson(json['account']),
+        powerLevel: json['power_level'],
+      );
+
+  Map<String, dynamic> toJson() => {
+        'id': id,
+        'created_at': createdAt.toIso8601String(),
+        'updated_at': updatedAt.toIso8601String(),
+        'deleted_at': deletedAt,
+        'realm_id': realmId,
+        'account_id': accountId,
+        'account': account.toJson(),
+        'power_level': powerLevel,
+      };
+}

lib/providers/auth.dart

@@ -4,7 +4,7 @@ import 'package:flutter/material.dart';
 import 'package:flutter_secure_storage/flutter_secure_storage.dart';
 import 'package:oauth2/oauth2.dart' as oauth2;
 import 'package:solian/utils/http.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 
 class AuthProvider extends ChangeNotifier {
   AuthProvider() {

lib/providers/chat.dart

@@ -3,56 +3,173 @@ import 'dart:convert';
 
 import 'package:flutter/material.dart';
 import 'package:http/http.dart';
+import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:livekit_client/livekit_client.dart';
 import 'package:permission_handler/permission_handler.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/call.dart';
 import 'package:solian/models/channel.dart';
+import 'package:solian/models/message.dart';
+import 'package:solian/models/packet.dart';
+import 'package:solian/models/pagination.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/chat/call/exts.dart';
 import 'package:solian/widgets/exts.dart';
 import 'package:wakelock_plus/wakelock_plus.dart';
-import 'package:web_socket_channel/web_socket_channel.dart';
+import 'package:web_socket_channel/io.dart';
+import 'package:web_socket_channel/status.dart' as status;
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class ChatProvider extends ChangeNotifier {
-  bool isOpened = false;
   bool isCallShown = false;
 
   Call? ongoingCall;
   Channel? focusChannel;
+  String? focusChannelRealm;
   ChatCallInstance? currentCall;
 
-  Future<WebSocketChannel?> connect(AuthProvider auth) async {
+  PagingController<int, Message>? historyPagingController;
+
+  IOWebSocketChannel? _channel;
+
+  Future<IOWebSocketChannel?> connect(
+    AuthProvider auth, {
+    Function(bool status)? onStateUpdated,
+    noRetry = false,
+  }) async {
     if (auth.client == null) await auth.loadClient();
     if (!await auth.isAuthorized()) return null;
 
-    await auth.client!.refreshToken(auth.client!.currentRefreshToken!);
+    if (_channel != null && (_channel!.innerWebSocket?.readyState ?? 0) < 2) {
+      return _channel;
+    }
 
     var ori = getRequestUri('messaging', '/api/ws');
     var uri = Uri(
       scheme: ori.scheme.replaceFirst('http', 'ws'),
       host: ori.host,
+      port: ori.port,
       path: ori.path,
       queryParameters: {'tk': Uri.encodeComponent(auth.client!.currentToken!)},
     );
 
-    final channel = WebSocketChannel.connect(uri);
+    try {
-    await channel.ready;
+      _channel = IOWebSocketChannel.connect(uri);
+      if (onStateUpdated != null) onStateUpdated(true);
+      await _channel!.ready;
+      if (onStateUpdated != null) onStateUpdated(false);
+    } catch (e) {
+      if (!noRetry) {
+        await auth.client!.refreshToken(auth.client!.currentRefreshToken!);
+        connect(auth, noRetry: true);
+      } else {
+        rethrow;
+      }
+    }
 
-    return channel;
+    _channel!.stream.listen(
+      (event) {
+        final result = NetworkPackage.fromJson(jsonDecode(event));
+        if (focusChannel == null || historyPagingController == null) return;
+        switch (result.method) {
+          case 'messages.new':
+            final payload = Message.fromJson(result.payload!);
+            if (payload.channelId == focusChannel?.id) {
+              historyPagingController?.itemList?.insert(0, payload);
+            }
+            break;
+          case 'messages.update':
+            final payload = Message.fromJson(result.payload!);
+            if (payload.channelId == focusChannel?.id) {
+              historyPagingController?.itemList =
+                  historyPagingController?.itemList?.map((x) => x.id == payload.id ? payload : x).toList();
+            }
+            break;
+          case 'messages.burnt':
+            final payload = Message.fromJson(result.payload!);
+            if (payload.channelId == focusChannel?.id) {
+              historyPagingController?.itemList =
+                  historyPagingController?.itemList?.where((x) => x.id != payload.id).toList();
+            }
+            break;
+          case 'calls.new':
+            final payload = Call.fromJson(result.payload!);
+            if (payload.channelId == focusChannel?.id) {
+              setOngoingCall(payload);
+            }
+            break;
+          case 'calls.end':
+            final payload = Call.fromJson(result.payload!);
+            if (payload.channelId == focusChannel?.id) {
+              setOngoingCall(null);
+            }
+            break;
+        }
+        notifyListeners();
+      },
+      onError: (_, __) => Future.delayed(const Duration(seconds: 3), () => connect(auth)),
+      onDone: () => Future.delayed(const Duration(seconds: 1), () => connect(auth)),
+    );
+
+    return _channel!;
   }
 
-  Future<Channel> fetchChannel(String alias) async {
+  void disconnect() {
-    final Client client = Client();
+    _channel?.sink.close(status.goingAway);
+  }
 
-    var uri = getRequestUri('messaging', '/api/channels/$alias');
+  Future<void> fetchMessages(int pageKey, BuildContext context) async {
-    var res = await client.get(uri);
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) return;
+    if (focusChannel == null || focusChannelRealm == null) return;
+
+    final offset = pageKey;
+    const take = 10;
+
+    var uri = getRequestUri(
+      'messaging',
+      '/api/channels/$focusChannelRealm/${focusChannel!.alias}/messages?take=$take&offset=$offset',
+    );
+
+    var res = await auth.client!.get(uri);
     if (res.statusCode == 200) {
+      final result = PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+      final items = result.data?.map((x) => Message.fromJson(x)).toList() ?? List.empty();
+      final isLastPage = (result.count - pageKey) < take;
+      if (isLastPage || result.data == null) {
+        historyPagingController!.appendLastPage(items);
+      } else {
+        final nextPageKey = pageKey + items.length;
+        historyPagingController!.appendPage(items, nextPageKey);
+      }
+    } else if (res.statusCode == 403) {
+      historyPagingController!.appendLastPage([]);
+    } else {
+      historyPagingController!.error = utf8.decode(res.bodyBytes);
+    }
+  }
+
+  Future<Channel> fetchChannel(BuildContext context, AuthProvider auth, String alias, String realm) async {
+    if (focusChannel != null) {
+      unFocus();
+    }
+
+    var uri = getRequestUri('messaging', '/api/channels/$realm/$alias/availability');
+    var res = await auth.client!.get(uri);
+    if (res.statusCode == 200 || res.statusCode == 403) {
       final result = jsonDecode(utf8.decode(res.bodyBytes));
       focusChannel = Channel.fromJson(result);
+      focusChannel?.isAvailable = res.statusCode == 200;
+      focusChannelRealm = realm;
+
+      if (historyPagingController == null) {
+        historyPagingController = PagingController(firstPageKey: 0);
+        historyPagingController?.addPageRequestListener((pageKey) => fetchMessages(pageKey, context));
+      }
+
       notifyListeners();
+
       return focusChannel!;
     } else {
       var message = utf8.decode(res.bodyBytes);
@@ -60,10 +177,10 @@ class ChatProvider extends ChangeNotifier {
     }
   }
 
-  Future<Call?> fetchOngoingCall(String alias) async {
+  Future<Call?> fetchOngoingCall(String alias, String realm) async {
     final Client client = Client();
 
-    var uri = getRequestUri('messaging', '/api/channels/$alias/calls/ongoing');
+    var uri = getRequestUri('messaging', '/api/channels/$realm/$alias/calls/ongoing');
     var res = await client.get(uri);
     if (res.statusCode == 200) {
       final result = jsonDecode(utf8.decode(res.bodyBytes));
@@ -111,6 +228,8 @@ class ChatProvider extends ChangeNotifier {
   void unFocus() {
     currentCall = null;
     focusChannel = null;
+    historyPagingController?.dispose();
+    historyPagingController = null;
     notifyListeners();
   }
 }
@@ -181,7 +300,7 @@ class ChatCallInstance {
       throw Exception('unauthorized');
     }
 
-    var uri = getRequestUri('messaging', '/api/channels/${channel.alias}/calls/ongoing/token');
+    var uri = getRequestUri('messaging', '/api/channels/global/${channel.alias}/calls/ongoing/token');
 
     var res = await auth.client!.post(uri);
     if (res.statusCode == 200) {

lib/providers/friend.dart

@@ -3,7 +3,7 @@ import 'dart:convert';
 import 'package:flutter/material.dart';
 import 'package:solian/models/friendship.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 
 class FriendProvider extends ChangeNotifier {
   List<Friendship> friends = List.empty();

lib/providers/keypair.dart

@@ -0,0 +1,151 @@
+import 'dart:convert';
+import 'dart:math';
+import 'dart:typed_data';
+
+import 'package:encrypt/encrypt.dart' as encrypt;
+import 'package:flutter/material.dart';
+import 'package:flutter_secure_storage/flutter_secure_storage.dart';
+import 'package:solian/models/keypair.dart';
+import 'package:solian/models/packet.dart';
+import 'package:uuid/uuid.dart';
+import 'package:web_socket_channel/web_socket_channel.dart';
+
+class KeypairProvider extends ChangeNotifier {
+  static const storage = FlutterSecureStorage();
+  static const encryptIV = 'WT7s~><Ae?YrJd)D';
+
+  WebSocketChannel? channel;
+
+  String? activeKeyId;
+  Map<String, Keypair> keys = {};
+  List<String> requestingKeys = List.empty(growable: true);
+
+  KeypairProvider() {
+    loadKeys();
+  }
+
+  void loadKeys() async {
+    final result = await storage.read(key: 'keypair');
+    if (result != null) {
+      jsonDecode(result).values.forEach((x) {
+        keys[x['id']] = Keypair.fromJson(x);
+      });
+      activeKeyId = await storage.read(key: 'keypairActive');
+    }
+    notifyListeners();
+  }
+
+  void saveKeys() async {
+    await storage.write(key: 'keypair', value: jsonEncode(keys));
+    if (activeKeyId != null) {
+      await storage.write(key: 'keypairActive', value: activeKeyId);
+    }
+  }
+
+  void receiveKeypair(Keypair kp) {
+    print('received ${kp.id}');
+    keys[kp.id] = kp;
+    requestingKeys.remove(kp.id);
+    notifyListeners();
+    saveKeys();
+  }
+
+  Keypair? provideKeypair(String id) {
+    return keys[id];
+  }
+
+  void importKeys(String code) {
+    final result = jsonDecode(utf8.fuse(base64).decode(code)).map((x) => Keypair.fromJson(x)).toList();
+    for (final item in result) {
+      if (item is Keypair) {
+        keys[item.id] = item;
+      }
+    }
+    saveKeys();
+    notifyListeners();
+  }
+
+  void setActiveKey(String id) {
+    if (keys[id] == null) return;
+    activeKeyId = id;
+    saveKeys();
+    notifyListeners();
+  }
+
+  void clearKeys() {
+    keys = {};
+    storage.delete(key: 'keypairActive');
+    saveKeys();
+  }
+
+  void requestKey(String id, String algorithm, int uid) {
+    if (channel == null) return;
+    if (requestingKeys.contains(id)) return;
+
+    print('requested $id');
+
+    channel!.sink.add(jsonEncode(
+      NetworkPackage(method: 'kex.request', payload: {
+        'request_id': const Uuid().v4(),
+        'keypair_id': id,
+        'algorithm': algorithm,
+        'owner_id': uid,
+        'deadline': 3,
+      }).toJson(),
+    ));
+
+    requestingKeys.add(id);
+    Future.delayed(const Duration(seconds: 3), () {
+      requestingKeys.remove(id);
+      notifyListeners();
+    });
+
+    notifyListeners();
+  }
+
+  String? encodeViaAESKey(String keypairId, String content) {
+    if (keys[keypairId] == null) {
+      return null;
+    } else if (keys[keypairId]?.algorithm != 'aes') {
+      throw Exception('invalid algorithm');
+    }
+
+    final kp = keys[keypairId]!;
+    final iv = encrypt.IV.fromUtf8(encryptIV);
+    final key = encrypt.Key.fromBase64(kp.publicKey);
+    final encryptor = encrypt.Encrypter(encrypt.AES(key, mode: encrypt.AESMode.sic, padding: null));
+    return encryptor.encryptBytes(utf8.encode(content), iv: iv).base64;
+  }
+
+  String? decodeViaAESKey(String keypairId, String encrypted) {
+    if (keys[keypairId] == null) {
+      return null;
+    } else if (keys[keypairId]?.algorithm != 'aes') {
+      throw Exception('invalid algorithm');
+    }
+
+    final kp = keys[keypairId]!;
+    final iv = encrypt.IV.fromUtf8(encryptIV);
+    final key = encrypt.Key.fromBase64(kp.publicKey);
+    final encryptor = encrypt.Encrypter(encrypt.AES(key, mode: encrypt.AESMode.sic, padding: null));
+    return utf8.decode(encryptor.decryptBytes(encrypt.Encrypted.fromBase64(encrypted), iv: iv));
+  }
+
+  Keypair generateAESKey() {
+    final random = Random.secure();
+    final values = List<int>.generate(32, (i) => random.nextInt(256));
+    final key = Uint8List.fromList(values);
+
+    final kp = Keypair(
+      id: const Uuid().v4(),
+      algorithm: 'aes',
+      publicKey: base64.encode(key),
+      privateKey: null,
+      isOwned: true,
+    );
+
+    keys[kp.id] = kp;
+
+    return kp;
+  }
+}

lib/providers/notify.dart

@@ -4,21 +4,22 @@ import 'package:flutter/material.dart';
 import 'package:flutter_local_notifications/flutter_local_notifications.dart';
 import 'package:livekit_client/livekit_client.dart';
 import 'package:permission_handler/permission_handler.dart';
+import 'package:solian/models/keypair.dart';
+import 'package:solian/models/packet.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/models/notification.dart' as model;
-import 'package:web_socket_channel/web_socket_channel.dart';
+import 'package:web_socket_channel/io.dart';
+import 'package:web_socket_channel/status.dart' as status;
 import 'dart:math' as math;
 
 class NotifyProvider extends ChangeNotifier {
-  bool isOpened = false;
   int unreadAmount = 0;
 
   List<model.Notification> notifications = List.empty(growable: true);
 
-  final FlutterLocalNotificationsPlugin localNotify =
+  final FlutterLocalNotificationsPlugin localNotify = FlutterLocalNotificationsPlugin();
-      FlutterLocalNotificationsPlugin();
 
   NotifyProvider() {
     initNotify();
@@ -32,10 +33,8 @@ class NotifyProvider extends ChangeNotifier {
         DarwinNotificationCategory('general'),
       ],
     );
-    const linuxSettings =
+    const linuxSettings = LinuxInitializationSettings(defaultActionName: 'Open notification');
-        LinuxInitializationSettings(defaultActionName: 'Open notification');
+    const InitializationSettings initializationSettings = InitializationSettings(
-    const InitializationSettings initializationSettings =
-        InitializationSettings(
       android: androidSettings,
       iOS: darwinSettings,
       macOS: darwinSettings,
@@ -58,42 +57,96 @@ class NotifyProvider extends ChangeNotifier {
     var uri = getRequestUri('passport', '/api/notifications?skip=0&take=25');
     var res = await auth.client!.get(uri);
     if (res.statusCode == 200) {
-      final result =
+      final result = PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
-          PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+      notifications = result.data?.map((x) => model.Notification.fromJson(x)).toList() ?? List.empty(growable: true);
-      notifications =
-          result.data?.map((x) => model.Notification.fromJson(x)).toList() ??
-              List.empty(growable: true);
     }
 
     notifyListeners();
   }
 
-  Future<WebSocketChannel?> connect(AuthProvider auth) async {
+  IOWebSocketChannel? _channel;
+
+  Future<IOWebSocketChannel?> connect(
+    AuthProvider auth, {
+    Keypair? Function(String id)? onKexRequest,
+    Function(Keypair kp)? onKexProvide,
+    Function(bool status)? onStateUpdated,
+    bool noRetry = false,
+  }) async {
     if (auth.client == null) await auth.loadClient();
     if (!await auth.isAuthorized()) return null;
 
-    await auth.client!.refreshToken(auth.client!.currentRefreshToken!);
+    if (_channel != null && (_channel!.innerWebSocket?.readyState ?? 0) < 2) {
-
+      return _channel;
-    var ori = getRequestUri('passport', '/api/notifications/listen');
+    }
+    var ori = getRequestUri('passport', '/api/ws');
     var uri = Uri(
       scheme: ori.scheme.replaceFirst('http', 'ws'),
       host: ori.host,
+      port: ori.port,
       path: ori.path,
-      queryParameters: {
+      queryParameters: {'tk': Uri.encodeComponent(auth.client!.currentToken!)},
-        'tk': Uri.encodeComponent(auth.client!.currentToken!)
-      },
     );
 
-    final channel = WebSocketChannel.connect(uri);
+    try {
-    await channel.ready;
+      _channel = IOWebSocketChannel.connect(uri);
+      if (onStateUpdated != null) onStateUpdated(true);
+      await _channel!.ready;
+      if (onStateUpdated != null) onStateUpdated(false);
+    } catch (e) {
+      if (!noRetry) {
+        await auth.client!.refreshToken(auth.client!.currentRefreshToken!);
+        connect(auth, noRetry: true);
+      } else {
+        rethrow;
+      }
+    }
 
-    return channel;
+    _channel!.stream.listen(
+      (event) {
+        final result = NetworkPackage.fromJson(jsonDecode(event));
+        switch (result.method) {
+          case 'notifications.new':
+            if (result.payload == null) break;
+            final notification = model.Notification.fromJson(result.payload!);
+            unreadAmount++;
+            notifications.add(notification);
+            notifyListeners();
+            notifyMessage(notification.subject, notification.content);
+            break;
+          case 'kex.request':
+            if (onKexRequest == null || result.payload == null) break;
+            final resp = onKexRequest(result.payload!['keypair_id']);
+            if (resp == null) break;
+            _channel!.sink.add(jsonEncode(
+              NetworkPackage(method: 'kex.provide', payload: {
+                'request_id': result.payload!['request_id'],
+                'keypair_id': resp.id,
+                'public_key': resp.publicKey,
+                'algorithm': resp.algorithm,
+              }).toJson(),
+            ));
+            break;
+          case 'kex.provide':
+            if (onKexProvide == null || result.payload == null) break;
+            onKexProvide(Keypair(
+              id: result.payload!['keypair_id'],
+              algorithm: result.payload?['algorithm'] ?? 'aes',
+              publicKey: result.payload!['public_key'],
+              privateKey: result.payload?['private_key'],
+            ));
+            break;
+        }
+      },
+      onError: (_, __) => Future.delayed(const Duration(seconds: 3), () => connect(auth)),
+      onDone: () => Future.delayed(const Duration(seconds: 1), () => connect(auth)),
+    );
+
+    return _channel!;
   }
 
-  void onRemoteMessage(model.Notification item) {
+  void disconnect() {
-    unreadAmount++;
+    _channel?.sink.close(status.goingAway);
-    notifications.add(item);
-    notifyListeners();
   }
 
   void notifyMessage(String title, String body) {
@@ -130,7 +183,7 @@ class NotifyProvider extends ChangeNotifier {
     notifyListeners();
   }
 
-  void clearRealtime() {
+  void clearRealtimeNotifications() {
     notifications = notifications.where((x) => !x.isRealtime).toList();
     notifyListeners();
   }

lib/providers/realm.dart

@@ -0,0 +1,47 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/utils/services_url.dart';
+
+class RealmProvider with ChangeNotifier {
+  List<Realm> realms = List.empty();
+
+  Realm? focusRealm;
+
+  Future<void> fetch(AuthProvider auth) async {
+    if (!await auth.isAuthorized()) return;
+
+    var uri = getRequestUri('passport', '/api/realms/me/available');
+
+    var res = await auth.client!.get(uri);
+    if (res.statusCode == 200) {
+      final result = jsonDecode(utf8.decode(res.bodyBytes)) as List<dynamic>;
+      realms = result.map((x) => Realm.fromJson(x)).toList();
+      notifyListeners();
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      throw Exception(message);
+    }
+  }
+
+  Future<Realm> fetchSingle(AuthProvider auth, String alias) async {
+    var uri = getRequestUri('passport', '/api/realms/$alias');
+    var res = await auth.client!.get(uri);
+    if (res.statusCode == 200) {
+      final result = jsonDecode(utf8.decode(res.bodyBytes));
+      focusRealm = Realm.fromJson(result);
+      notifyListeners();
+      return focusRealm!;
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      throw Exception(message);
+    }
+  }
+
+  void clearFocus() {
+    focusRealm = null;
+    notifyListeners();
+  }
+}

lib/router.dart

@@ -1,117 +1,281 @@
+import 'package:flutter/material.dart';
 import 'package:go_router/go_router.dart';
 import 'package:solian/models/call.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/models/post.dart';
+import 'package:solian/models/realm.dart';
 import 'package:solian/screens/account.dart';
 import 'package:solian/screens/account/friend.dart';
+import 'package:solian/screens/account/keypair.dart';
 import 'package:solian/screens/account/personalize.dart';
 import 'package:solian/screens/auth/signup.dart';
 import 'package:solian/screens/chat/call.dart';
 import 'package:solian/screens/chat/chat.dart';
-import 'package:solian/screens/chat/index.dart';
+import 'package:solian/screens/chat/chat_list.dart';
-import 'package:solian/screens/chat/manage.dart';
+import 'package:solian/screens/chat/chat_detail.dart';
-import 'package:solian/screens/chat/channel/editor.dart';
+import 'package:solian/screens/chat/channel/channel_editor.dart';
-import 'package:solian/screens/chat/channel/member.dart';
+import 'package:solian/screens/chat/channel/channel_member.dart';
 import 'package:solian/screens/explore.dart';
 import 'package:solian/screens/notification.dart';
 import 'package:solian/screens/posts/comment_editor.dart';
 import 'package:solian/screens/posts/moment_editor.dart';
 import 'package:solian/screens/posts/screen.dart';
 import 'package:solian/screens/auth/signin.dart';
+import 'package:solian/screens/realms/realm.dart';
+import 'package:solian/screens/realms/realm_manage.dart';
+import 'package:solian/screens/realms/realm_editor.dart';
+import 'package:solian/screens/realms/realm_list.dart';
+import 'package:solian/screens/realms/realm_member.dart';
+import 'package:solian/screens/users/userinfo.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/empty.dart';
+import 'package:solian/widgets/layouts/two_column.dart';
 
-final router = GoRouter(
+abstract class SolianRouter {
-  routes: [
+  static final router = GoRouter(
-    GoRoute(
+    routes: [
-      path: '/',
+      GoRoute(
-      name: 'explore',
+        path: '/notification',
-      builder: (context, state) => const ExploreScreen(),
+        name: 'notification',
-    ),
+        builder: (context, state) => const NotificationScreen(),
-    GoRoute(
-      path: '/notification',
-      name: 'notification',
-      builder: (context, state) => const NotificationScreen(),
-    ),
-    GoRoute(
-      path: '/chat',
-      name: 'chat',
-      builder: (context, state) => const ChatIndexScreen(),
-    ),
-    GoRoute(
-      path: '/chat/create',
-      name: 'chat.channel.editor',
-      builder: (context, state) =>
-          ChannelEditorScreen(editing: state.extra as Channel?),
-    ),
-    GoRoute(
-      path: '/chat/c/:channel',
-      name: 'chat.channel',
-      builder: (context, state) =>
-          ChatScreen(alias: state.pathParameters['channel'] as String),
-    ),
-    GoRoute(
-      path: '/chat/c/:channel/call',
-      name: 'chat.channel.call',
-      builder: (context, state) => ChatCall(call: state.extra as Call),
-    ),
-    GoRoute(
-      path: '/chat/c/:channel/manage',
-      name: 'chat.channel.manage',
-      builder: (context, state) =>
-          ChatManageScreen(channel: state.extra as Channel),
-    ),
-    GoRoute(
-      path: '/chat/c/:channel/member',
-      name: 'chat.channel.member',
-      builder: (context, state) =>
-          ChatMemberScreen(channel: state.extra as Channel),
-    ),
-    GoRoute(
-      path: '/account',
-      name: 'account',
-      builder: (context, state) => const AccountScreen(),
-    ),
-    GoRoute(
-      path: '/posts/publish/moments',
-      name: 'posts.moments.editor',
-      builder: (context, state) =>
-          MomentEditorScreen(editing: state.extra as Post?),
-    ),
-    GoRoute(
-      path: '/posts/publish/comments',
-      name: 'posts.comments.editor',
-      builder: (context, state) {
-        final args = state.extra as CommentPostArguments;
-        return CommentEditorScreen(
-            editing: args.editing, related: args.related);
-      },
-    ),
-    GoRoute(
-      path: '/posts/:dataset/:alias',
-      name: 'posts.screen',
-      builder: (context, state) => PostScreen(
-        alias: state.pathParameters['alias'] as String,
-        dataset: state.pathParameters['dataset'] as String,
       ),
-    ),
+      ShellRoute(
-    GoRoute(
+        pageBuilder: (context, state, child) => defaultPageBuilder(
-      path: '/auth/sign-in',
+          context,
-      name: 'auth.sign-in',
+          state,
-      builder: (context, state) => SignInScreen(),
+          SolianTheme.isLargeScreen(context)
-    ),
+              ? TwoColumnLayout(
-    GoRoute(
+                  sideChild: const ExplorePostScreen(),
-      path: '/auth/sign-up',
+                  mainChild: child,
-      name: 'auth.sign-up',
+                )
-      builder: (context, state) => SignUpScreen(),
+              : child,
-    ),
+        ),
-    GoRoute(
+        routes: [
-      path: '/account/friend',
+          GoRoute(
-      name: 'account.friend',
+            path: '/',
-      builder: (context, state) => const FriendScreen(),
+            name: 'explore',
-    ),
+            builder: (context, state) =>
-    GoRoute(
+                !SolianTheme.isLargeScreen(context) ? const ExplorePostScreen() : const PageEmptyWidget(),
-      path: '/account/personalize',
+          ),
-      name: 'account.personalize',
+          GoRoute(
-      builder: (context, state) => const PersonalizeScreen(),
+            path: '/posts/publish/moments',
-    ),
+            name: 'posts.moments.editor',
-  ],
+            builder: (context, state) => MomentEditorScreen(editing: state.extra as Post?),
-);
+          ),
+          GoRoute(
+            path: '/posts/publish/comments',
+            name: 'posts.comments.editor',
+            builder: (context, state) {
+              final args = state.extra as CommentPostArguments;
+              return CommentEditorScreen(editing: args.editing, related: args.related);
+            },
+          ),
+          GoRoute(
+            path: '/posts/:dataset/:alias',
+            name: 'posts.details',
+            builder: (context, state) => PostScreen(
+              alias: state.pathParameters['alias'] as String,
+              dataset: state.pathParameters['dataset'] as String,
+            ),
+          ),
+        ],
+      ),
+      ShellRoute(
+        pageBuilder: (context, state, child) => defaultPageBuilder(
+          context,
+          state,
+          SolianTheme.isLargeScreen(context)
+              ? TwoColumnLayout(
+                  sideChild: const RealmListScreen(),
+                  mainChild: child,
+                )
+              : child,
+        ),
+        routes: [
+          GoRoute(
+            path: '/realms',
+            name: 'realms',
+            builder: (context, state) =>
+                !SolianTheme.isLargeScreen(context) ? const RealmListScreen() : const PageEmptyWidget(),
+          ),
+          GoRoute(
+            path: '/realms/editor',
+            name: 'realms.editor',
+            builder: (context, state) => RealmEditorScreen(
+              editing: state.extra as Realm?,
+              realm: state.uri.queryParameters['realm'],
+            ),
+          ),
+          GoRoute(
+            path: '/realms/:realm/manage',
+            name: 'realms.manage',
+            builder: (context, state) => RealmManageScreen(realm: state.extra as Realm),
+          ),
+          GoRoute(
+            path: '/realms/:realm/member',
+            name: 'realms.member',
+            builder: (context, state) => RealmMemberScreen(realm: state.extra as Realm),
+          ),
+          GoRoute(
+            path: '/realms/:realm/posts/publish/moments',
+            name: 'realms.posts.moments.editor',
+            builder: (context, state) => MomentEditorScreen(
+              editing: state.extra as Post?,
+              realm: state.pathParameters['realm']
+            ),
+          ),
+          GoRoute(
+            path: '/realms/:realm/posts/:dataset/:alias',
+            name: 'realms.posts.details',
+            builder: (context, state) => PostScreen(
+              alias: state.pathParameters['alias'] as String,
+              dataset: state.pathParameters['dataset'] as String,
+            ),
+          ),
+          GoRoute(
+            path: '/realms/:realm',
+            name: 'realms.details',
+            builder: (context, state) => !SolianTheme.isLargeScreen(context)
+                ? RealmScreen(alias: state.pathParameters['realm'] as String)
+                : const PageEmptyWidget(),
+          ),
+          GoRoute(
+            path: '/realms/:realm/chat/:channel',
+            name: 'realms.chat.channel',
+            builder: (context, state) => ChatScreen(
+              alias: state.pathParameters['channel'] as String,
+              realm: state.pathParameters['realm'] as String,
+            ),
+          ),
+          GoRoute(
+            path: '/realms/:realm/chat/:channel/manage',
+            name: 'realms.chat.channel.manage',
+            builder: (context, state) => ChatDetailScreen(
+              channel: state.extra as Channel,
+              realm: state.pathParameters['realm'] as String,
+            ),
+          ),
+          GoRoute(
+            path: '/realms/:realm/chat/:channel/member',
+            name: 'realms.chat.channel.member',
+            builder: (context, state) => ChatMemberScreen(
+              channel: state.extra as Channel,
+              realm: state.pathParameters['realm'] as String,
+            ),
+          ),
+        ],
+      ),
+      ShellRoute(
+        pageBuilder: (context, state, child) => defaultPageBuilder(
+          context,
+          state,
+          SolianTheme.isLargeScreen(context)
+              ? TwoColumnLayout(
+                  sideChild: const ChatListScreen(),
+                  mainChild: child,
+                )
+              : child,
+        ),
+        routes: [
+          GoRoute(
+            path: '/chat',
+            name: 'chat',
+            builder: (context, state) =>
+                !SolianTheme.isLargeScreen(context) ? const ChatListScreen() : const PageEmptyWidget(),
+          ),
+          GoRoute(
+            path: '/chat/editor',
+            name: 'chat.channel.editor',
+            builder: (context, state) => ChannelEditorScreen(
+              editing: state.extra as Channel?,
+              realm: state.uri.queryParameters['realm'] ?? 'global',
+            ),
+          ),
+          GoRoute(
+            path: '/chat/:channel',
+            name: 'chat.channel',
+            builder: (context, state) => ChatScreen(alias: state.pathParameters['channel'] as String),
+          ),
+          GoRoute(
+            path: '/chat/:channel/manage',
+            name: 'chat.channel.manage',
+            builder: (context, state) => ChatDetailScreen(channel: state.extra as Channel),
+          ),
+          GoRoute(
+            path: '/chat/:channel/member',
+            name: 'chat.channel.member',
+            builder: (context, state) => ChatMemberScreen(channel: state.extra as Channel),
+          ),
+        ],
+      ),
+      GoRoute(
+        path: '/chat/:channel/call',
+        name: 'chat.channel.call',
+        builder: (context, state) => ChatCall(call: state.extra as Call),
+      ),
+      ShellRoute(
+        pageBuilder: (context, state, child) => defaultPageBuilder(
+          context,
+          state,
+          SolianTheme.isLargeScreen(context)
+              ? TwoColumnLayout(
+                  sideChild: const AccountScreen(),
+                  mainChild: child,
+                )
+              : child,
+        ),
+        routes: [
+          GoRoute(
+            path: '/account',
+            name: 'account',
+            builder: (context, state) =>
+                !SolianTheme.isLargeScreen(context) ? const AccountScreen() : const PageEmptyWidget(),
+          ),
+          GoRoute(
+            path: '/auth/sign-in',
+            name: 'auth.sign-in',
+            builder: (context, state) => SignInScreen(),
+          ),
+          GoRoute(
+            path: '/auth/sign-up',
+            name: 'auth.sign-up',
+            builder: (context, state) => SignUpScreen(),
+          ),
+          GoRoute(
+            path: '/account/friend',
+            name: 'account.friend',
+            builder: (context, state) => const FriendScreen(),
+          ),
+          GoRoute(
+            path: '/account/personalize',
+            name: 'account.personalize',
+            builder: (context, state) => const PersonalizeScreen(),
+          ),
+          GoRoute(
+            path: '/account/keypair',
+            name: 'account.keypair',
+            builder: (context, state) => const KeypairScreen(),
+          ),
+        ],
+      ),
+      GoRoute(
+        path: '/users/:user',
+        name: 'users.info',
+        builder: (context, state) => UserInfoScreen(name: state.pathParameters['user'] as String),
+      ),
+    ],
+  );
+
+  static GoRoute get currentRoute => SolianRouter.router.routerDelegate.currentConfiguration.last.route;
+
+  static Page defaultPageBuilder(
+    BuildContext context,
+    GoRouterState state,
+    Widget child,
+  ) =>
+      MaterialPage(
+        key: state.pageKey,
+        restorationId: state.pageKey.value,
+        child: child,
+      );
+}

lib/screens/account.dart

@@ -1,74 +1,34 @@
 import 'package:flutter/material.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/chat.dart';
+import 'package:solian/providers/keypair.dart';
+import 'package:solian/providers/notify.dart';
 import 'package:solian/router.dart';
-import 'package:solian/screens/account/friend.dart';
+import 'package:solian/utils/theme.dart';
-import 'package:solian/screens/account/personalize.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/account/avatar.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-import 'package:solian/widgets/empty.dart';
+import 'package:solian/widgets/scaffold.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
 
-class AccountScreen extends StatefulWidget {
+class AccountScreen extends StatelessWidget {
   const AccountScreen({super.key});
 
-  @override
-  State<AccountScreen> createState() => _AccountScreenState();
-}
-
-class _AccountScreenState extends State<AccountScreen> {
-  String? _title;
-  String? _selectedTab;
-
   @override
   Widget build(BuildContext context) {
-    final screenWidth = MediaQuery.of(context).size.width;
+    return IndentScaffold(
-    final isLargeScreen = screenWidth >= 600;
+      title: AppLocalizations.of(context)!.account,
-
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
-    Widget renderContent() {
+      body: AccountScreenWidget(
-      switch (_selectedTab) {
+        onSelect: (item) {
-        case 'account.friend':
+          SolianRouter.router.pushNamed(item);
-          return const FriendScreenWidget();
+        },
-        case 'account.personalize':
+      ),
-          return const PersonalizeScreenWidget();
-        default:
-          return const SelectionEmptyWidget();
-      }
-    }
-
-    return IndentWrapper(
-      title: _title ?? AppLocalizations.of(context)!.account,
-      noSafeArea: true,
-      fixedAppBarColor: true,
-      child: isLargeScreen
-          ? Row(
-              children: [
-                Flexible(
-                  flex: 2,
-                  child: AccountScreenWidget(
-                    onSelect: (item, title) {
-                      setState(() {
-                        _selectedTab = item;
-                        _title = title;
-                      });
-                    },
-                  ),
-                ),
-                const VerticalDivider(thickness: 0.3, width: 0.3),
-                Flexible(flex: 4, child: renderContent()),
-              ],
-            )
-          : AccountScreenWidget(
-              onSelect: (item, _) {
-                router.pushNamed(item);
-              },
-            ),
     );
   }
 }
 
 class AccountScreenWidget extends StatefulWidget {
-  final Function(String item, String title) onSelect;
+  final Function(String item) onSelect;
 
   const AccountScreenWidget({super.key, required this.onSelect});
 
@@ -92,6 +52,13 @@ class _AccountScreenWidgetState extends State<AccountScreenWidget> {
   @override
   Widget build(BuildContext context) {
     final auth = context.watch<AuthProvider>();
+    final keypair = context.read<KeypairProvider>();
+
+    final actionItems = [
+      (const Icon(Icons.color_lens), AppLocalizations.of(context)!.personalize, 'account.personalize'),
+      (const Icon(Icons.diversity_1), AppLocalizations.of(context)!.friend, 'account.friend'),
+      (const Icon(Icons.key), AppLocalizations.of(context)!.keypair, 'account.keypair'),
+    ];
 
     if (_isAuthorized) {
       return Column(
@@ -100,28 +67,25 @@ class _AccountScreenWidgetState extends State<AccountScreenWidget> {
             padding: EdgeInsets.only(top: 16, bottom: 8, left: 24, right: 24),
             child: NameCard(),
           ),
-          ListTile(
+          ...(actionItems.map(
-            contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+            (x) => ListTile(
-            leading: const Icon(Icons.color_lens),
+              contentPadding: const EdgeInsets.symmetric(horizontal: 34),
-            title: Text(AppLocalizations.of(context)!.personalize),
+              leading: x.$1,
-            onTap: () {
+              title: Text(x.$2),
-              widget.onSelect('account.personalize', AppLocalizations.of(context)!.personalize);
+              onTap: () {
-            },
+                widget.onSelect(x.$3);
-          ),
+              },
-          ListTile(
+            ),
-            contentPadding: const EdgeInsets.symmetric(horizontal: 34),
+          )),
-            leading: const Icon(Icons.diversity_1),
-            title: Text(AppLocalizations.of(context)!.friend),
-            onTap: () {
-              widget.onSelect('account.friend', AppLocalizations.of(context)!.friend);
-            },
-          ),
           ListTile(
             contentPadding: const EdgeInsets.symmetric(horizontal: 34),
             leading: const Icon(Icons.logout),
             title: Text(AppLocalizations.of(context)!.signOut),
             onTap: () {
               auth.signoff();
+              keypair.clearKeys();
+              context.read<NotifyProvider>().disconnect();
+              context.read<ChatProvider>().disconnect();
               setState(() {
                 _isAuthorized = false;
               });
@@ -139,7 +103,7 @@ class _AccountScreenWidgetState extends State<AccountScreenWidget> {
               title: AppLocalizations.of(context)!.signIn,
               caption: AppLocalizations.of(context)!.signInCaption,
               onTap: () {
-                router.pushNamed('auth.sign-in').then((did) {
+                SolianRouter.router.pushNamed('auth.sign-in').then((did) {
                   auth.isAuthorized().then((value) {
                     setState(() => _isAuthorized = value);
                   });
@@ -151,7 +115,7 @@ class _AccountScreenWidgetState extends State<AccountScreenWidget> {
               title: AppLocalizations.of(context)!.signUp,
               caption: AppLocalizations.of(context)!.signUpCaption,
               onTap: () {
-                router.pushNamed('auth.sign-up');
+                SolianRouter.router.pushNamed('auth.sign-up');
               },
             ),
           ],

lib/screens/account/friend.dart

@@ -5,10 +5,10 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/friendship.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class FriendScreen extends StatelessWidget {
@@ -16,11 +16,10 @@ class FriendScreen extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.friend,
-      noSafeArea: true,
       hideDrawer: true,
-      child: const FriendScreenWidget(),
+      body: const FriendScreenWidget(),
     );
   }
 }

lib/screens/account/keypair.dart

@@ -0,0 +1,191 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/keypair.dart';
+import 'package:solian/providers/keypair.dart';
+import 'package:solian/widgets/scaffold.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+
+class KeypairScreen extends StatelessWidget {
+  const KeypairScreen({super.key});
+
+  Widget getIcon(KeypairProvider provider, Keypair item) {
+    if (item.id == provider.activeKeyId) {
+      return const Icon(Icons.check_box);
+    } else if (item.isOwned) {
+      return const Icon(Icons.check_box_outlined);
+    } else {
+      return const Icon(Icons.key);
+    }
+  }
+
+  void importKeys(BuildContext context) async {
+    final controller = TextEditingController();
+    final input = await showDialog(
+      context: context,
+      builder: (context) {
+        return AlertDialog(
+          title: Text(AppLocalizations.of(context)!.import),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              Text(AppLocalizations.of(context)!.keypairImportHint),
+              const SizedBox(height: 18),
+              TextField(
+                controller: controller,
+                decoration: InputDecoration(
+                  isDense: true,
+                  border: const OutlineInputBorder(),
+                  labelText: AppLocalizations.of(context)!.keypairSecretCode,
+                ),
+                onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+              ),
+            ],
+          ),
+          actions: <Widget>[
+            TextButton(
+              style: TextButton.styleFrom(
+                foregroundColor: Theme.of(context).colorScheme.onSurface.withOpacity(0.8),
+              ),
+              onPressed: () => Navigator.pop(context),
+              child: Text(AppLocalizations.of(context)!.cancel),
+            ),
+            TextButton(
+              child: Text(AppLocalizations.of(context)!.next),
+              onPressed: () {
+                Navigator.pop(context, controller.text);
+              },
+            ),
+          ],
+        );
+      },
+    );
+
+    WidgetsBinding.instance.addPostFrameCallback((_) => controller.dispose());
+
+    if (input == null || input.isEmpty) return;
+
+    context.read<KeypairProvider>().importKeys(input);
+  }
+
+  void exportKeys(BuildContext context) {
+    showModalBottomSheet(context: context, builder: (context) => const KeypairExportWidget());
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final keypair = context.watch<KeypairProvider>();
+    final keys = keypair.keys.values.toList();
+
+    return IndentScaffold(
+      title: AppLocalizations.of(context)!.keypair,
+      hideDrawer: true,
+      floatingActionButton: FloatingActionButton(
+        child: const Icon(Icons.generating_tokens),
+        onPressed: () {
+          final result = keypair.generateAESKey();
+          keypair.setActiveKey(result.id);
+          ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+            content: Text(AppLocalizations.of(context)!.keypairGenerated),
+          ));
+        },
+      ),
+      appBarActions: [
+        IconButton(
+          icon: const Icon(Icons.upload),
+          tooltip: AppLocalizations.of(context)!.import,
+          onPressed: () => importKeys(context),
+        ),
+        IconButton(
+          icon: const Icon(Icons.download),
+          tooltip: AppLocalizations.of(context)!.export,
+          onPressed: () => exportKeys(context),
+        ),
+      ],
+      body: ListView.builder(
+        itemCount: keys.length,
+        itemBuilder: (context, index) {
+          final element = keys[index];
+          final randomId = DateTime.now().microsecondsSinceEpoch >> 10;
+          return Dismissible(
+            key: Key(randomId.toString()),
+            background: Container(
+              color: Colors.teal,
+              padding: const EdgeInsets.symmetric(horizontal: 20),
+              alignment: Alignment.centerLeft,
+              child: const Icon(Icons.check, color: Colors.white),
+            ),
+            direction: keypair.activeKeyId != element.id && element.isOwned
+                ? DismissDirection.horizontal
+                : DismissDirection.none,
+            child: ListTile(
+              leading: getIcon(keypair, element),
+              title: Text('${element.algorithm.toUpperCase()} Key'),
+              subtitle: Text(element.id.toUpperCase()),
+            ),
+            onDismissed: (_) {
+              keypair.setActiveKey(element.id);
+            },
+          );
+        },
+      ),
+    );
+  }
+}
+
+class KeypairExportWidget extends StatelessWidget {
+  const KeypairExportWidget({super.key});
+
+  String getEncodedContent(BuildContext context) {
+    final keypair = context.read<KeypairProvider>();
+    return utf8.fuse(base64).encode(jsonEncode(
+          keypair.keys.values.map((x) => x.toJson()).toList(),
+        ));
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return ClipRRect(
+      borderRadius: const BorderRadius.all(Radius.circular(32)),
+      child: SizedBox(
+        width: double.infinity,
+        height: 640,
+        child: ListView(
+          children: [
+            Container(
+              padding: const EdgeInsets.only(left: 20, top: 20),
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
+                children: [
+                  Text(
+                    AppLocalizations.of(context)!.export,
+                    style: Theme.of(context).textTheme.headlineSmall,
+                  ),
+                ],
+              ),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(left: 20, right: 20, top: 20, bottom: 20),
+              child: Text(
+                AppLocalizations.of(context)!.keypairExportHint,
+                style: Theme.of(context).textTheme.bodyMedium,
+              ),
+            ),
+            Markdown(
+              selectable: true,
+              shrinkWrap: true,
+              physics: const NeverScrollableScrollPhysics(),
+              data: '```\n${getEncodedContent(context)}\n```',
+              padding: const EdgeInsets.all(0),
+              styleSheet: MarkdownStyleSheet(
+                codeblockPadding: const EdgeInsets.symmetric(vertical: 20, horizontal: 8),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/screens/account/personalize.dart

@@ -1,13 +1,17 @@
 import 'dart:convert';
+import 'dart:io';
 
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
+import 'package:http/http.dart';
+import 'package:image_picker/image_picker.dart';
 import 'package:intl/intl.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class PersonalizeScreen extends StatelessWidget {
@@ -15,10 +19,10 @@ class PersonalizeScreen extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.personalize,
       hideDrawer: true,
-      child: const PersonalizeScreenWidget(),
+      body: const PersonalizeScreenWidget(),
     );
   }
 }
@@ -31,6 +35,8 @@ class PersonalizeScreenWidget extends StatefulWidget {
 }
 
 class _PersonalizeScreenWidgetState extends State<PersonalizeScreenWidget> {
+  final _imagePicker = ImagePicker();
+
   final _usernameController = TextEditingController();
   final _nicknameController = TextEditingController();
   final _firstNameController = TextEditingController();
@@ -38,6 +44,8 @@ class _PersonalizeScreenWidgetState extends State<PersonalizeScreenWidget> {
   final _descriptionController = TextEditingController();
   final _birthdayController = TextEditingController();
 
+  String? _avatar;
+  String? _banner;
   DateTime? _birthday;
 
   bool _isSubmitting = false;
@@ -60,15 +68,23 @@ class _PersonalizeScreenWidgetState extends State<PersonalizeScreenWidget> {
   void resetInputs() async {
     final auth = context.read<AuthProvider>();
     final prof = await auth.getProfiles();
-    _usernameController.text = prof['name'];
+    setState(() {
-    _nicknameController.text = prof['nick'];
+      _usernameController.text = prof['name'];
-    _descriptionController.text = prof['description'];
+      _nicknameController.text = prof['nick'];
-    _firstNameController.text = prof['profile']['first_name'];
+      _descriptionController.text = prof['description'];
-    _lastNameController.text = prof['profile']['last_name'];
+      _firstNameController.text = prof['profile']['first_name'];
-    if (prof['profile']['birthday'] != null) {
+      _lastNameController.text = prof['profile']['last_name'];
-      _birthday = DateTime.parse(prof['profile']['birthday']);
+      if (prof['avatar'] != null && prof['avatar'].isNotEmpty) {
-      _birthdayController.text = DateFormat('yyyy-MM-dd hh:mm').format(_birthday!);
+        _avatar = getRequestUri('passport', '/api/avatar/${prof['avatar']}').toString();
-    }
+      }
+      if (prof['banner'] != null && prof['banner'].isNotEmpty) {
+        _banner = getRequestUri('passport', '/api/avatar/${prof['banner']}').toString();
+      }
+      if (prof['profile']['birthday'] != null) {
+        _birthday = DateTime.parse(prof['profile']['birthday']);
+        _birthdayController.text = DateFormat('yyyy-MM-dd hh:mm').format(_birthday!);
+      }
+    });
   }
 
   void applyChanges() async {
@@ -106,20 +122,113 @@ class _PersonalizeScreenWidgetState extends State<PersonalizeScreenWidget> {
     setState(() => _isSubmitting = false);
   }
 
+  Future<void> applyImage(String position) async {
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) return;
+
+    final image = await _imagePicker.pickImage(source: ImageSource.gallery);
+    if (image == null) return;
+
+    setState(() => _isSubmitting = true);
+
+    final file = File(image.path);
+    try {
+      final req = MultipartRequest('PUT', getRequestUri('passport', '/api/users/me/$position'));
+      req.files.add(await MultipartFile.fromPath(position, file.path));
+
+      var res = await auth.client!.send(req);
+      if (res.statusCode == 200) {
+        await auth.fetchProfiles();
+        resetInputs();
+
+        ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+          content: Text(AppLocalizations.of(context)!.personalizeApplied),
+        ));
+      } else {
+        throw Exception(utf8.decode(await res.stream.toBytes()));
+      }
+    } catch (err) {
+      context.showErrorDialog(err);
+    }
+
+    setState(() => _isSubmitting = false);
+  }
+
   @override
   void initState() {
     super.initState();
 
-    Future.delayed(Duration.zero, () => resetInputs());
+    Future.delayed(Duration.zero, () {
+      resetInputs();
+    });
   }
 
   @override
   Widget build(BuildContext context) {
     return Container(
-      padding: const EdgeInsets.symmetric(vertical: 28, horizontal: 32),
+      padding: const EdgeInsets.symmetric(horizontal: 32),
-      child: Column(
+      child: ListView(
         children: [
           _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
+          const SizedBox(height: 24),
+          Stack(
+            children: [
+              AccountAvatar(source: _avatar ?? '', radius: 40, direct: true),
+              Positioned(
+                bottom: 0,
+                left: 40,
+                child: FloatingActionButton.small(
+                  heroTag: const Key('avatar-editor'),
+                  onPressed: () => applyImage('avatar'),
+                  child: const Icon(
+                    Icons.camera,
+                  ),
+                ),
+              ),
+            ],
+          ),
+          const SizedBox(height: 16),
+          Stack(
+            children: [
+              ClipRRect(
+                borderRadius: const BorderRadius.all(Radius.circular(8)),
+                child: AspectRatio(
+                  aspectRatio: 16 / 9,
+                  child: Container(
+                    color: Theme.of(context).colorScheme.surfaceVariant,
+                    child: _banner != null
+                        ? Image.network(
+                            _banner!,
+                            fit: BoxFit.cover,
+                            loadingBuilder: (BuildContext context, Widget child, ImageChunkEvent? loadingProgress) {
+                              if (loadingProgress == null) return child;
+                              return Center(
+                                child: CircularProgressIndicator(
+                                  value: loadingProgress.expectedTotalBytes != null
+                                      ? loadingProgress.cumulativeBytesLoaded / loadingProgress.expectedTotalBytes!
+                                      : null,
+                                ),
+                              );
+                            },
+                          )
+                        : Container(),
+                  ),
+                ),
+              ),
+              Positioned(
+                bottom: 16,
+                right: 16,
+                child: FloatingActionButton(
+                  heroTag: const Key('banner-editor'),
+                  onPressed: () => applyImage('banner'),
+                  child: const Icon(
+                    Icons.camera_alt,
+                  ),
+                ),
+              ),
+            ],
+          ),
+          const SizedBox(height: 24),
           Row(
             children: [
               Flexible(

lib/screens/auth/signin.dart

@@ -2,10 +2,12 @@ import 'package:flutter/material.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/chat.dart';
+import 'package:solian/providers/notify.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
 class SignInScreen extends StatelessWidget {
@@ -21,7 +23,9 @@ class SignInScreen extends StatelessWidget {
     final password = _passwordController.value.text;
     if (username.isEmpty || password.isEmpty) return;
     auth.signin(context, username, password).then((_) {
-      router.pop(true);
+      context.read<ChatProvider>().connect(auth);
+      context.read<NotifyProvider>().connect(auth);
+      SolianRouter.router.pop(true);
     }).catchError((e) {
       List<String> messages = e.toString().split('\n');
       if (messages.last.contains('risk')) {
@@ -61,10 +65,10 @@ class SignInScreen extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.signIn,
       hideDrawer: true,
-      child: Center(
+      body: Center(
         child: Container(
           width: MediaQuery.of(context).size.width * 0.6,
           constraints: const BoxConstraints(maxWidth: 360),

lib/screens/auth/signup.dart

@@ -3,9 +3,9 @@ import 'dart:convert';
 import 'package:flutter/material.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:http/http.dart' as http;
 
 class SignUpScreen extends StatelessWidget {
@@ -58,7 +58,7 @@ class SignUpScreen extends StatelessWidget {
           );
         },
       ).then((_) {
-        router.replaceNamed('auth.sign-in');
+        SolianRouter.router.replaceNamed('auth.sign-in');
       });
     } else {
       var message = utf8.decode(res.bodyBytes);
@@ -68,10 +68,10 @@ class SignUpScreen extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.signUp,
       hideDrawer: true,
-      child: Center(
+      body: Center(
         child: Container(
           width: MediaQuery.of(context).size.width * 0.6,
           constraints: const BoxConstraints(maxWidth: 360),

lib/screens/chat/call.dart

@@ -3,10 +3,11 @@ import 'package:livekit_client/livekit_client.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/call.dart';
 import 'package:solian/providers/chat.dart';
-import 'package:solian/widgets/chat/call/controls.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/chat/call/call_controls.dart';
 import 'package:solian/widgets/chat/call/participant.dart';
 import 'package:solian/widgets/chat/call/participant_menu.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'dart:math' as math;
 
@@ -127,10 +128,11 @@ class _ChatCallState extends State<ChatCall> {
       );
     }
 
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.chatCall,
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
       hideDrawer: true,
-      child: content,
+      body: content,
     );
   }
 

lib/screens/chat/channel/channel_editor.dart

@@ -7,16 +7,17 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:uuid/uuid.dart';
 
 class ChannelEditorScreen extends StatefulWidget {
   final Channel? editing;
+  final String realm;
 
-  const ChannelEditorScreen({super.key, this.editing});
+  const ChannelEditorScreen({super.key, this.editing, this.realm = 'global'});
 
   @override
   State<ChannelEditorScreen> createState() => _ChannelEditorScreenState();
@@ -27,6 +28,8 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
   final _nameController = TextEditingController();
   final _descriptionController = TextEditingController();
 
+  bool _isEncrypted = false;
+
   bool _isSubmitting = false;
 
   Future<void> applyChannel(BuildContext context) async {
@@ -38,9 +41,10 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
       return;
     }
 
+    final scope = widget.realm.isNotEmpty ? widget.realm : 'global';
     final uri = widget.editing == null
-        ? getRequestUri('messaging', '/api/channels')
+        ? getRequestUri('messaging', '/api/channels/$scope')
-        : getRequestUri('messaging', '/api/channels/${widget.editing!.id}');
+        : getRequestUri('messaging', '/api/channels/$scope/${widget.editing!.id}');
 
     final req = Request(widget.editing == null ? 'POST' : 'PUT', uri);
     req.headers['Content-Type'] = 'application/json';
@@ -48,6 +52,7 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
       'alias': _aliasController.value.text.toLowerCase(),
       'name': _nameController.value.text,
       'description': _descriptionController.value.text,
+      'is_encrypted': _isEncrypted,
     });
 
     var res = await Response.fromStream(await auth.client!.send(req));
@@ -55,8 +60,8 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
       var message = utf8.decode(res.bodyBytes);
       context.showErrorDialog(message);
     } else {
-      if (router.canPop()) {
+      if (SolianRouter.router.canPop()) {
-        router.pop(true);
+        SolianRouter.router.pop(_aliasController.value.text.toLowerCase());
       }
     }
     setState(() => _isSubmitting = false);
@@ -67,8 +72,8 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
   }
 
   void cancelEditing() {
-    if (router.canPop()) {
+    if (SolianRouter.router.canPop()) {
-      router.pop(false);
+      SolianRouter.router.pop(false);
     }
   }
 
@@ -78,6 +83,7 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
       _aliasController.text = widget.editing!.alias;
       _nameController.text = widget.editing!.name;
       _descriptionController.text = widget.editing!.description;
+      _isEncrypted = widget.editing!.isEncrypted;
     }
 
     super.initState();
@@ -99,8 +105,9 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
       ],
     );
 
-    return IndentWrapper(
+    return IndentScaffold(
       hideDrawer: true,
+      showSafeArea: true,
       title: AppLocalizations.of(context)!.chatChannelOrganize,
       appBarActions: <Widget>[
         TextButton(
@@ -108,7 +115,7 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
           child: Text(AppLocalizations.of(context)!.apply.toUpperCase()),
         ),
       ],
-      child: Column(
+      body: Column(
         children: [
           _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
           widget.editing != null ? editingBanner : Container(),
@@ -175,6 +182,15 @@ class _ChannelEditorScreenState extends State<ChannelEditorScreen> {
               ),
             ),
           ),
+          const Divider(thickness: 0.3),
+          CheckboxListTile(
+            title: Text(AppLocalizations.of(context)!.chatChannelEncryptedLabel),
+            value: _isEncrypted,
+            onChanged: (widget.editing?.isEncrypted ?? false) ? null : (newValue) {
+              setState(() => _isEncrypted = newValue ?? false);
+            },
+            controlAffinity: ListTileControlAffinity.leading,
+          ),
         ],
       ),
     );

lib/screens/chat/channel/channel_member.dart

@@ -6,17 +6,18 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/account.dart';
 import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/account/friend_picker.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class ChatMemberScreen extends StatefulWidget {
   final Channel channel;
+  final String realm;
 
-  const ChatMemberScreen({super.key, required this.channel});
+  const ChatMemberScreen({super.key, required this.channel, this.realm = 'global'});
 
   @override
   State<ChatMemberScreen> createState() => _ChatMemberScreenState();
@@ -36,8 +37,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
 
     _selfId = prof['id'];
 
-    var uri = getRequestUri(
+    var uri = getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/members');
-        'messaging', '/api/channels/${widget.channel.alias}/members');
 
     var res = await auth.client!.get(uri);
     if (res.statusCode == 200) {
@@ -51,7 +51,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
     }
   }
 
-  Future<void> kickMember(ChannelMember item) async {
+  Future<void> removeMember(ChannelMember item) async {
     setState(() => _isSubmitting = true);
 
     final auth = context.read<AuthProvider>();
@@ -60,16 +60,15 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
       return;
     }
 
-    var uri = getRequestUri(
+    var uri = getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/members');
-        'messaging', '/api/channels/${widget.channel.alias}/kick');
 
-    var res = await auth.client!.post(
+    var res = await auth.client!.delete(
       uri,
       headers: {
         'Content-Type': 'application/json',
       },
       body: jsonEncode({
-        'account_name': item.account.name,
+        'target': item.account.name,
       }),
     );
     if (res.statusCode == 200) {
@@ -82,7 +81,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
     setState(() => _isSubmitting = false);
   }
 
-  Future<void> inviteMember(String username) async {
+  Future<void> addMember(String username) async {
     setState(() => _isSubmitting = true);
 
     final auth = context.read<AuthProvider>();
@@ -91,8 +90,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
       return;
     }
 
-    var uri = getRequestUri(
+    var uri = getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/members');
-        'messaging', '/api/channels/${widget.channel.alias}/invite');
 
     var res = await auth.client!.post(
       uri,
@@ -100,7 +98,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
         'Content-Type': 'application/json',
       },
       body: jsonEncode({
-        'account_name': username,
+        'target': username,
       }),
     );
     if (res.statusCode == 200) {
@@ -113,7 +111,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
     setState(() => _isSubmitting = false);
   }
 
-  void promptInviteMember() async {
+  void promptAddMember() async {
     final input = await showModalBottomSheet(
       context: context,
       builder: (context) {
@@ -122,10 +120,10 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
     );
     if (input == null) return;
 
-    await inviteMember((input as Account).name);
+    await addMember((input as Account).name);
   }
 
-  bool getKickable(ChannelMember item) {
+  bool getRemovable(ChannelMember item) {
     if (_selfId != widget.channel.account.externalId) return false;
     if (item.accountId == widget.channel.accountId) return false;
     if (item.account.externalId == _selfId) return false;
@@ -141,24 +139,21 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.chatMember,
-      noSafeArea: true,
       hideDrawer: true,
       appBarActions: [
         IconButton(
           icon: const Icon(Icons.add),
-          onPressed: () => promptInviteMember(),
+          onPressed: () => promptAddMember(),
         ),
       ],
-      child: RefreshIndicator(
+      body: RefreshIndicator(
         onRefresh: () => fetchMemberships(),
         child: CustomScrollView(
           slivers: [
             SliverToBoxAdapter(
-              child: _isSubmitting
+              child: _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
-                  ? const LinearProgressIndicator().animate().scaleX()
-                  : Container(),
             ),
             SliverList.builder(
               itemCount: _members.length,
@@ -169,9 +164,7 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
 
                 return Dismissible(
                   key: Key(randomId.toString()),
-                  direction: getKickable(element)
+                  direction: getRemovable(element) ? DismissDirection.startToEnd : DismissDirection.none,
-                      ? DismissDirection.startToEnd
-                      : DismissDirection.none,
                   background: Container(
                     color: Colors.red,
                     padding: const EdgeInsets.symmetric(horizontal: 20),
@@ -179,13 +172,12 @@ class _ChatMemberScreenState extends State<ChatMemberScreen> {
                     child: const Icon(Icons.remove, color: Colors.white),
                   ),
                   child: ListTile(
-                    leading: AccountAvatar(
+                    leading: AccountAvatar(source: element.account.avatar, direct: true),
-                        source: element.account.avatar, direct: true),
                     title: Text(element.account.nick),
                     subtitle: Text(element.account.name),
                   ),
                   onDismissed: (_) {
-                    kickMember(element);
+                    removeMember(element);
                   },
                 );
               },

lib/screens/chat/chat.dart

@@ -5,92 +5,91 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/message.dart';
-import 'package:solian/models/pagination.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/chat.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/utils/theme.dart';
 import 'package:solian/widgets/chat/channel_action.dart';
-import 'package:solian/widgets/chat/maintainer.dart';
 import 'package:solian/widgets/chat/message.dart';
 import 'package:solian/widgets/chat/message_action.dart';
 import 'package:solian/widgets/chat/message_editor.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/exts.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class ChatScreen extends StatelessWidget {
   final String alias;
+  final String realm;
 
-  const ChatScreen({super.key, required this.alias});
+  const ChatScreen({super.key, required this.alias, this.realm = 'global'});
 
   @override
   Widget build(BuildContext context) {
+    final auth = context.read<AuthProvider>();
     final chat = context.watch<ChatProvider>();
 
-    return IndentWrapper(
+    return IndentScaffold(
       title: chat.focusChannel?.name ?? 'Loading...',
       hideDrawer: true,
+      showSafeArea: true,
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
       appBarActions: chat.focusChannel != null
           ? [
               ChannelCallAction(
                 call: chat.ongoingCall,
                 channel: chat.focusChannel!,
-                onUpdate: () => chat.fetchChannel(chat.focusChannel!.alias),
+                realm: realm,
+                onUpdate: () => chat.fetchChannel(context, auth, chat.focusChannel!.alias, realm),
               ),
               ChannelManageAction(
                 channel: chat.focusChannel!,
-                onUpdate: () => chat.fetchChannel(chat.focusChannel!.alias),
+                realm: realm,
+                onUpdate: () => chat.fetchChannel(context, auth, chat.focusChannel!.alias, realm),
               ),
             ]
           : [],
-      child: ChatScreenWidget(
+      body: ChatWidget(
         alias: alias,
+        realm: realm,
       ),
     );
   }
 }
 
-class ChatScreenWidget extends StatefulWidget {
+class ChatWidget extends StatefulWidget {
   final String alias;
+  final String realm;
 
-  const ChatScreenWidget({super.key, required this.alias});
+  const ChatWidget({super.key, required this.alias, required this.realm});
 
   @override
-  State<ChatScreenWidget> createState() => _ChatScreenWidgetState();
+  State<ChatWidget> createState() => _ChatWidgetState();
 }
 
-class _ChatScreenWidgetState extends State<ChatScreenWidget> {
+class _ChatWidgetState extends State<ChatWidget> {
   bool _isReady = false;
 
-  final PagingController<int, Message> _pagingController = PagingController(firstPageKey: 0);
-
   late final ChatProvider _chat;
 
-  Future<void> fetchMessages(int pageKey, BuildContext context) async {
+  Future<void> joinChannel() async {
     final auth = context.read<AuthProvider>();
     if (!await auth.isAuthorized()) return;
 
-    final offset = pageKey;
-    const take = 10;
-
     var uri = getRequestUri(
       'messaging',
-      '/api/channels/${widget.alias}/messages?take=$take&offset=$offset',
+      '/api/channels/${widget.realm}/${widget.alias}/members/me',
     );
 
-    var res = await auth.client!.get(uri);
+    var res = await auth.client!.post(uri);
     if (res.statusCode == 200) {
-      final result = PaginationResult.fromJson(jsonDecode(utf8.decode(res.bodyBytes)));
+      setState(() {});
-      final items = result.data?.map((x) => Message.fromJson(x)).toList() ?? List.empty();
+      _chat.historyPagingController?.refresh();
-      final isLastPage = (result.count - pageKey) < take;
-      if (isLastPage || result.data == null) {
-        _pagingController.appendLastPage(items);
-      } else {
-        final nextPageKey = pageKey + items.length;
-        _pagingController.appendPage(items, nextPageKey);
-      }
     } else {
-      _pagingController.error = utf8.decode(res.bodyBytes);
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message).then((_) {
+        SolianRouter.router.pop();
+      });
     }
   }
 
@@ -98,25 +97,7 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
     if (a?.replyTo != null) return false;
     if (a == null || b == null) return false;
     if (a.senderId != b.senderId) return false;
-    return a.createdAt.difference(b.createdAt).inMinutes <= 5;
+    return a.createdAt.difference(b.createdAt).inMinutes <= 3;
-  }
-
-  void addMessage(Message item) {
-    setState(() {
-      _pagingController.itemList?.insert(0, item);
-    });
-  }
-
-  void updateMessage(Message item) {
-    setState(() {
-      _pagingController.itemList = _pagingController.itemList?.map((x) => x.id == item.id ? item : x).toList();
-    });
-  }
-
-  void deleteMessage(Message item) {
-    setState(() {
-      _pagingController.itemList = _pagingController.itemList?.where((x) => x.id != item.id).toList();
-    });
   }
 
   Message? _editingItem;
@@ -127,6 +108,7 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
       context: context,
       builder: (context) => ChatMessageAction(
         channel: widget.alias,
+        realm: widget.realm,
         item: item,
         onEdit: () => setState(() {
           _editingItem = item;
@@ -138,15 +120,56 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
     );
   }
 
+  void showUnavailableDialog() {
+    final content = widget.realm == 'global'
+        ? AppLocalizations.of(context)!.chatChannelUnavailableCaption
+        : AppLocalizations.of(context)!.chatChannelUnavailableCaptionWithRealm;
+
+    showDialog(
+      context: context,
+      barrierDismissible: false,
+      builder: (context) => AlertDialog(
+        title: Text(AppLocalizations.of(context)!.chatChannelUnavailable),
+        content: Text(content),
+        actions: <Widget>[
+          TextButton(
+            child: Text(AppLocalizations.of(context)!.cancel),
+            onPressed: () {
+              Navigator.of(context).pop();
+              SolianRouter.router.pop();
+            },
+          ),
+          ...(widget.realm != 'global'
+              ? [
+                  TextButton(
+                    child: Text(AppLocalizations.of(context)!.join),
+                    onPressed: () {
+                      Navigator.of(context).pop();
+                      joinChannel();
+                    },
+                  ),
+                ]
+              : [])
+        ],
+      ),
+    );
+  }
+
   @override
   void initState() {
-    _pagingController.addPageRequestListener((pageKey) => fetchMessages(pageKey, context));
-
     super.initState();
 
-    Future.delayed(Duration.zero, () {
+    Future.delayed(Duration.zero, () async {
-      _chat.fetchOngoingCall(widget.alias);
+      final auth = context.read<AuthProvider>();
-      _chat.fetchChannel(widget.alias);
+
+      await _chat.connect(auth);
+
+      _chat.fetchOngoingCall(widget.alias, widget.realm);
+      _chat.fetchChannel(context, auth, widget.alias, widget.realm).then((result) {
+        if (result.isAvailable == false) {
+          showUnavailableDialog();
+        }
+      });
     });
   }
 
@@ -155,10 +178,10 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
     Widget chatHistoryBuilder(context, item, index) {
       bool isMerged = false, hasMerged = false;
       if (index > 0) {
-        hasMerged = getMessageMergeable(_pagingController.itemList?[index - 1], item);
+        hasMerged = getMessageMergeable(_chat.historyPagingController?.itemList?[index - 1], item);
       }
-      if (index + 1 < (_pagingController.itemList?.length ?? 0)) {
+      if (index + 1 < (_chat.historyPagingController?.itemList?.length ?? 0)) {
-        isMerged = getMessageMergeable(item, _pagingController.itemList?[index + 1]);
+        isMerged = getMessageMergeable(item, _chat.historyPagingController?.itemList?[index + 1]);
       }
       return InkWell(
         child: Container(
@@ -197,7 +220,7 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
         TextButton(
           child: Text(AppLocalizations.of(context)!.chatCallJoin),
           onPressed: () {
-            router.pushNamed(
+            SolianRouter.router.pushNamed(
               'chat.channel.call',
               extra: _chat.ongoingCall,
               pathParameters: {'channel': widget.alias},
@@ -207,53 +230,41 @@ class _ChatScreenWidgetState extends State<ChatScreenWidget> {
       ],
     );
 
-    if (_chat.focusChannel == null) {
+    if (_chat.focusChannel == null || _chat.historyPagingController == null) {
       return const Center(child: CircularProgressIndicator());
     }
 
-    return ChatMaintainer(
+    return Stack(
-      channel: _chat.focusChannel!,
+      children: [
-      child: Stack(
+        Column(
-        children: [
+          children: [
-          Column(
+            Expanded(
-            children: [
+              child: PagedListView<int, Message>(
-              Expanded(
+                reverse: true,
-                child: PagedListView<int, Message>(
+                pagingController: _chat.historyPagingController!,
-                  reverse: true,
+                builderDelegate: PagedChildBuilderDelegate<Message>(
-                  pagingController: _pagingController,
+                  animateTransitions: true,
-                  builderDelegate: PagedChildBuilderDelegate<Message>(
+                  transitionDuration: 350.ms,
-                    animateTransitions: true,
+                  itemBuilder: chatHistoryBuilder,
-                    transitionDuration: 350.ms,
+                  noItemsFoundIndicatorBuilder: (_) => Container(),
-                    itemBuilder: chatHistoryBuilder,
-                    noItemsFoundIndicatorBuilder: (_) => Container(),
-                  ),
                 ),
               ),
-              ChatMessageEditor(
+            ),
-                channel: widget.alias,
+            ChatMessageEditor(
-                editing: _editingItem,
+              realm: widget.realm,
-                replying: _replyingItem,
+              channel: widget.alias,
-                onReset: () => setState(() {
+              editing: _editingItem,
-                  _editingItem = null;
+              replying: _replyingItem,
-                  _replyingItem = null;
+              isEncrypted: _chat.focusChannel?.isEncrypted ?? false,
-                }),
+              onReset: () => setState(() {
-              ),
+                _editingItem = null;
-            ],
+                _replyingItem = null;
-          ),
+              }),
-          _chat.ongoingCall != null ? callBanner.animate().slideY() : Container(),
+            ),
-        ],
+          ],
-      ),
+        ),
-      onInsertMessage: (message) => addMessage(message),
+        _chat.ongoingCall != null ? callBanner.animate().slideY() : Container(),
-      onUpdateMessage: (message) => updateMessage(message),
+      ],
-      onDeleteMessage: (message) => deleteMessage(message),
-      onCallStarted: (call) => _chat.setOngoingCall(call),
-      onCallEnded: () => _chat.setOngoingCall(null),
     );
   }
-
-  @override
-  void deactivate() {
-    _chat.unFocus();
-    super.deactivate();
-  }
 }

lib/screens/chat/chat_detail.dart

@@ -0,0 +1,145 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/channel.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/chat.dart';
+import 'package:solian/router.dart';
+import 'package:solian/widgets/chat/channel_deletion.dart';
+import 'package:solian/widgets/scaffold.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+
+class ChatDetailScreen extends StatefulWidget {
+  final Channel channel;
+  final String realm;
+
+  const ChatDetailScreen({super.key, required this.channel, this.realm = 'global'});
+
+  @override
+  State<ChatDetailScreen> createState() => _ChatDetailScreenState();
+}
+
+class _ChatDetailScreenState extends State<ChatDetailScreen> {
+  bool _isOwned = false;
+
+  void promptLeaveChannel() async {
+    final did = await showDialog(
+      context: context,
+      builder: (context) =>
+          ChannelDeletion(
+            channel: widget.channel,
+            realm: widget.realm,
+            isOwned: _isOwned,
+          ),
+    );
+    if (did == true && SolianRouter.router.canPop()) {
+      SolianRouter.router.pop('disposed');
+    }
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    Future.delayed(Duration.zero, () async {
+      final auth = context.read<AuthProvider>();
+      final prof = await auth.getProfiles();
+
+      setState(() {
+        _isOwned = prof['id'] == widget.channel.account.externalId;
+      });
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final auth = context.read<AuthProvider>();
+    final chat = context.read<ChatProvider>();
+
+    final authorizedItems = [
+      ListTile(
+        leading: const Icon(Icons.settings),
+        title: Text(AppLocalizations.of(context)!.settings),
+        onTap: () async {
+          SolianRouter.router
+              .pushNamed(
+            'chat.channel.editor',
+            extra: widget.channel,
+            queryParameters: widget.realm != 'global' ? {'realm': widget.realm} : {},
+          )
+              .then((resp) {
+            if (resp != null) {
+              chat.fetchChannel(context, auth, resp as String, widget.realm);
+            }
+          });
+        },
+      ),
+    ];
+
+    return IndentScaffold(
+      title: AppLocalizations.of(context)!.chatDetail,
+      hideDrawer: true,
+      body: Column(
+        children: [
+          Padding(
+            padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
+            child: Row(
+              children: [
+                const CircleAvatar(
+                  radius: 24,
+                  backgroundColor: Colors.teal,
+                  child: Icon(Icons.tag, color: Colors.white),
+                ),
+                const SizedBox(width: 16),
+                Expanded(
+                  child: Column(crossAxisAlignment: CrossAxisAlignment.start, children: [
+                    Text(widget.channel.name, style: Theme
+                        .of(context)
+                        .textTheme
+                        .bodyLarge),
+                    Text(widget.channel.description, style: Theme
+                        .of(context)
+                        .textTheme
+                        .bodySmall),
+                  ]),
+                )
+              ],
+            ),
+          ),
+          const Divider(thickness: 0.3),
+          Expanded(
+            child: ListView(
+              children: [
+                ListTile(
+                  leading: const Icon(Icons.edit_notifications),
+                  title: Text(AppLocalizations.of(context)!.chatNotifySetting),
+                  onTap: () {},
+                ),
+                ListTile(
+                  leading: const Icon(Icons.supervisor_account),
+                  title: Text(AppLocalizations.of(context)!.chatMember),
+                  onTap: () {
+                    SolianRouter.router.pushNamed(
+                      widget.realm == 'global' ? 'chat.channel.member' : 'realms.chat.channel.member',
+                      extra: widget.channel,
+                      pathParameters: {
+                        'channel': widget.channel.alias,
+                        ...(widget.realm == 'global' ? {} : {'realm': widget.realm}),
+                      },
+                    );
+                  },
+                ),
+                ...(_isOwned ? authorizedItems : List.empty()),
+                const Divider(thickness: 0.3),
+                ListTile(
+                  leading: _isOwned ? const Icon(Icons.delete) : const Icon(Icons.exit_to_app),
+                  title: Text(_isOwned ? AppLocalizations.of(context)!.delete : AppLocalizations.of(context)!.exit),
+                  onTap: () => promptLeaveChannel(),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/screens/chat/chat_list.dart

@@ -6,95 +6,51 @@ import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/chat.dart';
 import 'package:solian/router.dart';
-import 'package:solian/screens/chat/chat.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/theme.dart';
-import 'package:solian/widgets/chat/channel_action.dart';
 import 'package:solian/widgets/chat/chat_new.dart';
-import 'package:solian/widgets/empty.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/widgets/notification_notifier.dart';
 import 'package:solian/widgets/signin_required.dart';
 
-class ChatIndexScreen extends StatefulWidget {
+class ChatListScreen extends StatelessWidget {
-  const ChatIndexScreen({super.key});
+  const ChatListScreen({super.key});
-
-  @override
-  State<ChatIndexScreen> createState() => _ChatIndexScreenState();
-}
-
-class _ChatIndexScreenState extends State<ChatIndexScreen> {
-  Channel? _selectedChannel;
 
   @override
   Widget build(BuildContext context) {
-    final chat = context.watch<ChatProvider>();
+    return IndentScaffold(
-
-    final screenWidth = MediaQuery.of(context).size.width;
-    final isLargeScreen = screenWidth >= 600;
-
-    return IndentWrapper(
       title: AppLocalizations.of(context)!.chat,
-      appBarActions: chat.focusChannel != null
+      appBarActions: const [NotificationButton()],
-          ? [
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
-              ChannelCallAction(
+      body: const ChatListWidget(),
-                call: chat.ongoingCall,
-                channel: chat.focusChannel!,
-                onUpdate: () => chat.fetchChannel(chat.focusChannel!.alias),
-              ),
-              ChannelManageAction(
-                channel: chat.focusChannel!,
-                onUpdate: () => chat.fetchChannel(chat.focusChannel!.alias),
-              ),
-            ]
-          : [const NotificationButton()],
-      fixedAppBarColor: isLargeScreen,
-      child: isLargeScreen
-          ? Row(
-              children: [
-                Flexible(
-                  flex: 2,
-                  child: ChatIndexScreenWidget(
-                    onSelect: (item) {
-                      setState(() => _selectedChannel = item);
-                    },
-                  ),
-                ),
-                const VerticalDivider(thickness: 0.3, width: 0.3),
-                Flexible(
-                  flex: 4,
-                  child: _selectedChannel == null
-                      ? const SelectionEmptyWidget()
-                      : ChatScreenWidget(
-                          key: Key('c${_selectedChannel!.id}'),
-                          alias: _selectedChannel!.alias,
-                        ),
-                ),
-              ],
-            )
-          : const ChatIndexScreenWidget(),
     );
   }
 }
 
-class ChatIndexScreenWidget extends StatefulWidget {
+class ChatListWidget extends StatefulWidget {
-  final Function(Channel item)? onSelect;
+  final String? realm;
 
-  const ChatIndexScreenWidget({super.key, this.onSelect});
+  const ChatListWidget({super.key, this.realm});
 
   @override
-  State<ChatIndexScreenWidget> createState() => _ChatIndexScreenWidgetState();
+  State<ChatListWidget> createState() => _ChatListWidgetState();
 }
 
-class _ChatIndexScreenWidgetState extends State<ChatIndexScreenWidget> {
+class _ChatListWidgetState extends State<ChatListWidget> {
   List<Channel> _channels = List.empty();
 
   Future<void> fetchChannels() async {
     final auth = context.read<AuthProvider>();
     if (!await auth.isAuthorized()) return;
 
-    var uri = getRequestUri('messaging', '/api/channels/me/available');
+    Uri uri;
+    if (widget.realm == null) {
+      uri = getRequestUri('messaging', '/api/channels/global/me/available');
+    } else {
+      uri = getRequestUri('messaging', '/api/channels/${widget.realm}');
+    }
 
     var res = await auth.client!.get(uri);
     if (res.statusCode == 200) {
@@ -111,7 +67,10 @@ class _ChatIndexScreenWidgetState extends State<ChatIndexScreenWidget> {
   void viewNewChatAction() {
     showModalBottomSheet(
       context: context,
-      builder: (context) => ChatNewAction(onUpdate: () => fetchChannels()),
+      builder: (context) => ChatNewAction(
+        onUpdate: () => fetchChannels(),
+        realm: widget.realm,
+      ),
     );
   }
 
@@ -127,6 +86,7 @@ class _ChatIndexScreenWidgetState extends State<ChatIndexScreenWidget> {
   @override
   Widget build(BuildContext context) {
     final auth = context.read<AuthProvider>();
+    final chat = context.watch<ChatProvider>();
 
     return Scaffold(
       floatingActionButton: FutureBuilder(
@@ -164,20 +124,16 @@ class _ChatIndexScreenWidgetState extends State<ChatIndexScreenWidget> {
                   title: Text(element.name),
                   subtitle: Text(element.description),
                   onTap: () async {
-                    if (widget.onSelect != null) {
+                    if (['chat.channel', 'realms.chat.channel'].contains(SolianRouter.currentRoute.name)) {
-                      widget.onSelect!(element);
+                      chat.fetchChannel(context, auth, element.alias, widget.realm!);
-                      return;
+                    } else {
-                    }
+                      SolianRouter.router.pushNamed(
-
+                        widget.realm == null ? 'chat.channel' : 'realms.chat.channel',
-                    final result = await router.pushNamed(
+                        pathParameters: {
-                      'chat.channel',
+                          'channel': element.alias,
-                      pathParameters: {
+                          ...(widget.realm == null ? {} : {'realm': widget.realm!}),
-                        'channel': element.alias,
+                        },
-                      },
+                      );
-                    );
-                    switch (result) {
-                      case 'refresh':
-                        fetchChannels();
                     }
                   },
                 );

lib/screens/explore.dart

@@ -1,90 +1,52 @@
 import 'dart:convert';
 
 import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/pagination.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/realm.dart';
 import 'package:solian/router.dart';
-import 'package:solian/screens/posts/screen.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/utils/service_url.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:http/http.dart' as http;
-import 'package:solian/widgets/empty.dart';
+import 'package:solian/utils/theme.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/realms/realm_shortcuts.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:solian/widgets/notification_notifier.dart';
-import 'package:solian/widgets/posts/item.dart';
+import 'package:solian/widgets/posts/post.dart';
 
-class ExploreScreen extends StatefulWidget {
+class ExplorePostScreen extends StatelessWidget {
-  const ExploreScreen({super.key});
+  const ExplorePostScreen({super.key});
-
-  @override
-  State<ExploreScreen> createState() => _ExploreScreenState();
-}
-
-class _ExploreScreenState extends State<ExploreScreen> {
-  Post? _selectedPost;
 
   @override
   Widget build(BuildContext context) {
-    final screenWidth = MediaQuery.of(context).size.width;
+    return IndentScaffold(
-    final isLargeScreen = screenWidth >= 600;
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
-
-    return IndentWrapper(
-      noSafeArea: true,
-      fixedAppBarColor: isLargeScreen,
       appBarActions: const [NotificationButton()],
       title: AppLocalizations.of(context)!.explore,
-      child: isLargeScreen
+      body: const ExplorePostWidget(showRealmShortcuts: true),
-          ? Row(
-              children: [
-                Flexible(
-                  flex: 2,
-                  child: ExploreScreenWidget(
-                    onSelect: (item) {
-                      setState(() => _selectedPost = item);
-                    },
-                  ),
-                ),
-                const VerticalDivider(thickness: 0.3, width: 0.3),
-                Flexible(
-                  flex: 4,
-                  child: _selectedPost == null
-                      ? const SelectionEmptyWidget()
-                      : PostScreenWidget(
-                          key: Key('p${_selectedPost!.id}'),
-                          dataset: _selectedPost!.dataset,
-                          alias: _selectedPost!.alias,
-                        ),
-                ),
-              ],
-            )
-          : ExploreScreenWidget(
-              onSelect: (item) {
-                router.pushNamed(
-                  'posts.screen',
-                  pathParameters: {
-                    'alias': item.alias,
-                    'dataset': item.dataset,
-                  },
-                );
-              },
-            ),
     );
   }
 }
 
-class ExploreScreenWidget extends StatefulWidget {
+class ExplorePostWidget extends StatefulWidget {
-  final Function(Post item) onSelect;
+  final String? realm;
+  final bool showRealmShortcuts;
 
-  const ExploreScreenWidget({super.key, required this.onSelect});
+  const ExplorePostWidget({
+    super.key,
+    this.realm,
+    this.showRealmShortcuts = false,
+  });
 
   @override
-  State<ExploreScreenWidget> createState() => _ExploreScreenWidgetState();
+  State<ExplorePostWidget> createState() => _ExplorePostWidgetState();
 }
 
-class _ExploreScreenWidgetState extends State<ExploreScreenWidget> {
+class _ExplorePostWidgetState extends State<ExplorePostWidget> {
   final PagingController<int, Post> _pagingController = PagingController(firstPageKey: 0);
 
   final http.Client _client = http.Client();
@@ -93,7 +55,12 @@ class _ExploreScreenWidgetState extends State<ExploreScreenWidget> {
     final offset = pageKey;
     const take = 5;
 
-    var uri = getRequestUri('interactive', '/api/feed?take=$take&offset=$offset');
+    Uri uri;
+    if (widget.realm == null) {
+      uri = getRequestUri('interactive', '/api/feed?take=$take&offset=$offset');
+    } else {
+      uri = getRequestUri('interactive', '/api/feed?realm=${widget.realm}&take=$take&offset=$offset');
+    }
 
     var res = await _client.get(uri);
     if (res.statusCode == 200) {
@@ -115,6 +82,16 @@ class _ExploreScreenWidgetState extends State<ExploreScreenWidget> {
   void initState() {
     super.initState();
 
+    Future.delayed(Duration.zero, () async {
+      if (widget.showRealmShortcuts) {
+        final auth = context.read<AuthProvider>();
+        if (auth.client == null) {
+          await auth.loadClient();
+        }
+        context.read<RealmProvider>().fetch(auth);
+      }
+    });
+
     _pagingController.addPageRequestListener((pageKey) => fetchFeed(pageKey));
   }
 
@@ -130,7 +107,10 @@ class _ExploreScreenWidgetState extends State<ExploreScreenWidget> {
             return FloatingActionButton(
               child: const Icon(Icons.edit),
               onPressed: () async {
-                final did = await router.pushNamed('posts.moments.editor');
+                final did = await SolianRouter.router.pushNamed(
+                  widget.realm == null ? 'posts.moments.editor' : 'realms.posts.moments.editor',
+                  pathParameters: widget.realm == null ? {} : {'realm': widget.realm!},
+                );
                 if (did == true) _pagingController.refresh();
               },
             );
@@ -143,15 +123,48 @@ class _ExploreScreenWidgetState extends State<ExploreScreenWidget> {
         onRefresh: () => Future.sync(
           () => _pagingController.refresh(),
         ),
-        child: PagedListView<int, Post>(
+        child: CustomScrollView(
-          pagingController: _pagingController,
+          slivers: [
-          builderDelegate: PagedChildBuilderDelegate<Post>(
+            widget.showRealmShortcuts
-            itemBuilder: (context, item, index) => PostItem(
+                ? SliverToBoxAdapter(
-              item: item,
+                    child: FutureBuilder(
-              onUpdate: () => _pagingController.refresh(),
+                      future: auth.isAuthorized(),
-              onTap: () => widget.onSelect(item),
+                      builder: (context, snapshot) {
+                        if (!snapshot.hasData || snapshot.data != true) {
+                          return Container();
+                        }
+
+                        return Padding(
+                          padding: const EdgeInsets.only(bottom: 8),
+                          child: const Material(
+                            elevation: 8,
+                            child: SizedBox(height: 120, child: RealmShortcuts()),
+                          ).animate().fade().slideY(begin: -1, end: 0, curve: Curves.fastEaseInToSlowEaseOut),
+                        );
+                      },
+                    ),
+                  )
+                : SliverToBoxAdapter(child: Container()),
+            PagedSliverList<int, Post>(
+              pagingController: _pagingController,
+              builderDelegate: PagedChildBuilderDelegate<Post>(
+                itemBuilder: (context, item, index) => PostItem(
+                  item: item,
+                  onUpdate: () => _pagingController.refresh(),
+                  onTap: () {
+                    SolianRouter.router.pushNamed(
+                      widget.realm == null ? 'posts.details' : 'realms.posts.details',
+                      pathParameters: {
+                        'alias': item.alias,
+                        'dataset': item.dataset,
+                        ...(widget.realm == null ? {} : {'realm': widget.realm!}),
+                      },
+                    );
+                  },
+                ),
+              ),
             ),
-          ),
+          ],
         ),
       ),
     );

lib/screens/notification.dart

@@ -1,9 +1,12 @@
+import 'dart:convert';
+
 import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/notify.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 import 'package:solian/models/notification.dart' as model;
@@ -16,23 +19,79 @@ class NotificationScreen extends StatefulWidget {
 }
 
 class _NotificationScreenState extends State<NotificationScreen> {
+  bool _isSubmitting = false;
+
+  Future<void> markAllRead() async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    final nty = context.read<NotifyProvider>();
+    List<int> markList = List.empty(growable: true);
+    for (final element in nty.notifications) {
+      if (element.isRealtime) continue;
+      markList.add(element.id);
+    }
+
+    nty.clearRealtimeNotifications();
+
+    if(markList.isNotEmpty) {
+      var uri = getRequestUri('passport', '/api/notifications/batch/read');
+      await auth.client!.put(
+        uri,
+        headers: {'Content-Type': 'application/json'},
+        body: jsonEncode({'messages': markList}),
+      );
+    }
+
+    ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+      content: Text(AppLocalizations.of(context)!.notifyMarkAllReadDone),
+    ));
+
+    await nty.fetch(auth);
+
+    setState(() => _isSubmitting = false);
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    Future.delayed(Duration.zero, () {
+      final nty = context.read<NotifyProvider>();
+      nty.allRead();
+    });
+  }
+
   @override
   Widget build(BuildContext context) {
     final auth = context.read<AuthProvider>();
     final nty = context.watch<NotifyProvider>();
 
-    WidgetsBinding.instance.addPostFrameCallback((_) {
+    return IndentScaffold(
-      nty.allRead();
-    });
-
-    return IndentWrapper(
-      noSafeArea: true,
       hideDrawer: true,
       title: AppLocalizations.of(context)!.notification,
-      child: RefreshIndicator(
+      body: RefreshIndicator(
         onRefresh: () => nty.fetch(auth),
         child: CustomScrollView(
           slivers: [
+            SliverToBoxAdapter(
+              child: _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
+            ),
+            if (nty.notifications.isNotEmpty)
+              SliverToBoxAdapter(
+                child: ListTile(
+                  tileColor: Theme.of(context).colorScheme.secondaryContainer,
+                  leading: const Icon(Icons.checklist),
+                  title: Text(AppLocalizations.of(context)!.notifyMarkAllRead),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 28),
+                  onTap: _isSubmitting ? null : markAllRead,
+                ),
+              ),
             nty.notifications.isEmpty
                 ? SliverToBoxAdapter(
                     child: Container(
@@ -41,8 +100,7 @@ class _NotificationScreenState extends State<NotificationScreen> {
                       child: ListTile(
                         leading: const Icon(Icons.check),
                         title: Text(AppLocalizations.of(context)!.notifyDone),
-                        subtitle: Text(
+                        subtitle: Text(AppLocalizations.of(context)!.notifyDoneCaption),
-                            AppLocalizations.of(context)!.notifyDoneCaption),
                       ),
                     ),
                   )
@@ -79,13 +137,12 @@ class NotificationItem extends StatelessWidget {
   final model.Notification item;
   final void Function()? onDismiss;
 
-  const NotificationItem(
+  const NotificationItem({super.key, required this.index, required this.item, this.onDismiss});
-      {super.key, required this.index, required this.item, this.onDismiss});
 
-  bool hasLinks() => item.links != null && item.links!.isNotEmpty;
+  bool get hasLinks => item.links != null && item.links!.isNotEmpty;
 
   void showLinks(BuildContext context) {
-    if (!hasLinks()) return;
+    if (!hasLinks) return;
 
     showModalBottomSheet<void>(
       context: context,
@@ -94,8 +151,7 @@ class NotificationItem extends StatelessWidget {
           crossAxisAlignment: CrossAxisAlignment.start,
           children: [
             Padding(
-              padding: const EdgeInsets.only(
+              padding: const EdgeInsets.only(left: 16, right: 16, top: 34, bottom: 12),
-                  left: 16, right: 16, top: 34, bottom: 12),
               child: Text(
                 'Links',
                 style: Theme.of(context).textTheme.headlineSmall,
@@ -124,8 +180,7 @@ class NotificationItem extends StatelessWidget {
     );
   }
 
-  Future<void> markAsRead(
+  Future<void> markAsRead(model.Notification element, BuildContext context) async {
-      model.Notification element, BuildContext context) async {
     if (element.isRealtime) return;
 
     final auth = context.read<AuthProvider>();
@@ -139,23 +194,11 @@ class NotificationItem extends StatelessWidget {
   @override
   Widget build(BuildContext context) {
     return Dismissible(
-      key: Key((DateTime.now().millisecondsSinceEpoch << 10).toString()),
+      key: Key('n${item.id}'),
       onDismissed: (direction) {
         markAsRead(item, context).then((value) {
           ScaffoldMessenger.of(context).showSnackBar(
-            SnackBar(
+            SnackBar(content: Text('${item.subject} is marked as read')),
-              content: RichText(
-                text: TextSpan(
-                  children: [
-                    TextSpan(
-                      text: item.subject,
-                      style: const TextStyle(fontWeight: FontWeight.bold),
-                    ),
-                    const TextSpan(text: ' is marked as read')
-                  ],
-                ),
-              ),
-            ),
           );
         });
         if (onDismiss != null) {
@@ -170,7 +213,7 @@ class NotificationItem extends StatelessWidget {
         child: ListTile(
           title: Text(item.subject),
           subtitle: Text(item.content),
-          trailing: hasLinks()
+          trailing: hasLinks
               ? TextButton(
                   onPressed: () => showLinks(context),
                   style: TextButton.styleFrom(shape: const CircleBorder()),

lib/screens/posts/comment_editor.dart

@@ -7,11 +7,11 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:solian/widgets/posts/attachment_editor.dart';
 
 class CommentPostArguments {
@@ -78,16 +78,16 @@ class _CommentEditorScreenState extends State<CommentEditorScreen> {
       var message = utf8.decode(res.bodyBytes);
       context.showErrorDialog(message);
     } else {
-      if (router.canPop()) {
+      if (SolianRouter.router.canPop()) {
-        router.pop(true);
+        SolianRouter.router.pop(true);
       }
     }
     setState(() => _isSubmitting = false);
   }
 
   void cancelEditing() {
-    if (router.canPop()) {
+    if (SolianRouter.router.canPop()) {
-      router.pop(false);
+      SolianRouter.router.pop(false);
     }
   }
 
@@ -120,8 +120,9 @@ class _CommentEditorScreenState extends State<CommentEditorScreen> {
       ],
     );
 
-    return IndentWrapper(
+    return IndentScaffold(
       hideDrawer: true,
+      showSafeArea: true,
       title: AppLocalizations.of(context)!.newComment,
       appBarActions: <Widget>[
         TextButton(
@@ -129,7 +130,7 @@ class _CommentEditorScreenState extends State<CommentEditorScreen> {
           child: Text(AppLocalizations.of(context)!.postVerb.toUpperCase()),
         ),
       ],
-      child: Column(
+      body: Column(
         children: [
           _isSubmitting
               ? const LinearProgressIndicator().animate().scaleX()

lib/screens/posts/moment_editor.dart

@@ -7,17 +7,18 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:solian/widgets/posts/attachment_editor.dart';
 
 class MomentEditorScreen extends StatefulWidget {
   final Post? editing;
+  final String? realm;
 
-  const MomentEditorScreen({super.key, this.editing});
+  const MomentEditorScreen({super.key, this.editing, this.realm});
 
   @override
   State<MomentEditorScreen> createState() => _MomentEditorScreenState();
@@ -61,6 +62,7 @@ class _MomentEditorScreenState extends State<MomentEditorScreen> {
       'alias': _alias,
       'content': _textController.value.text,
       'attachments': _attachments,
+      'realm': widget.realm,
     });
 
     var res = await Response.fromStream(await auth.client!.send(req));
@@ -68,16 +70,16 @@ class _MomentEditorScreenState extends State<MomentEditorScreen> {
       var message = utf8.decode(res.bodyBytes);
       context.showErrorDialog(message);
     } else {
-      if (router.canPop()) {
+      if (SolianRouter.router.canPop()) {
-        router.pop(true);
+        SolianRouter.router.pop(true);
       }
     }
     setState(() => _isSubmitting = false);
   }
 
   void cancelEditing() {
-    if (router.canPop()) {
+    if (SolianRouter.router.canPop()) {
-      router.pop(false);
+      SolianRouter.router.pop(false);
     }
   }
 
@@ -110,7 +112,8 @@ class _MomentEditorScreenState extends State<MomentEditorScreen> {
       ],
     );
 
-    return IndentWrapper(
+    return IndentScaffold(
+      showSafeArea: true,
       hideDrawer: true,
       title: AppLocalizations.of(context)!.newMoment,
       appBarActions: <Widget>[
@@ -119,7 +122,7 @@ class _MomentEditorScreenState extends State<MomentEditorScreen> {
           child: Text(AppLocalizations.of(context)!.postVerb.toUpperCase()),
         ),
       ],
-      child: Column(
+      body: Column(
         children: [
           _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
           FutureBuilder(

lib/screens/posts/screen.dart

@@ -4,11 +4,11 @@ import 'package:flutter/material.dart';
 import 'package:http/http.dart' as http;
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:solian/models/post.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:solian/widgets/posts/comment_list.dart';
-import 'package:solian/widgets/posts/item.dart';
+import 'package:solian/widgets/posts/post.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class PostScreen extends StatelessWidget {
@@ -19,11 +19,10 @@ class PostScreen extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    return IndentWrapper(
+    return IndentScaffold(
       title: AppLocalizations.of(context)!.post,
-      noSafeArea: true,
       hideDrawer: true,
-      child: PostScreenWidget(
+      body: PostScreenWidget(
         dataset: dataset,
         alias: alias,
       ),

lib/screens/realms/realm.dart

@@ -0,0 +1,131 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/realm.dart';
+import 'package:solian/router.dart';
+import 'package:solian/screens/chat/chat_list.dart';
+import 'package:solian/screens/explore.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/scaffold.dart';
+
+class RealmScreen extends StatelessWidget {
+  final String alias;
+
+  const RealmScreen({super.key, required this.alias});
+
+  @override
+  Widget build(BuildContext context) {
+    final auth = context.read<AuthProvider>();
+    final realm = context.watch<RealmProvider>();
+
+    return IndentScaffold(
+      title: realm.focusRealm?.name ?? 'Loading...',
+      hideDrawer: true,
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
+      appBarActions: realm.focusRealm != null
+          ? [
+              RealmManageAction(
+                realm: realm.focusRealm!,
+                onUpdate: () => realm.fetchSingle(auth, alias),
+              ),
+            ]
+          : [],
+      appBarLeading: SolianTheme.isLargeScreen(context)
+          ? IconButton(
+              icon: const Icon(Icons.arrow_back),
+              onPressed: () {
+                realm.clearFocus();
+              },
+            )
+          : null,
+      body: RealmWidget(
+        alias: alias,
+      ),
+    );
+  }
+}
+
+class RealmWidget extends StatefulWidget {
+  final String alias;
+
+  const RealmWidget({super.key, required this.alias});
+
+  @override
+  State<RealmWidget> createState() => _RealmWidgetState();
+}
+
+class _RealmWidgetState extends State<RealmWidget> {
+  bool _isReady = false;
+
+  late RealmProvider _realm;
+
+  @override
+  void initState() {
+    super.initState();
+
+    Future.delayed(Duration.zero, () {
+      final auth = context.read<AuthProvider>();
+      if (_realm.focusRealm?.alias != widget.alias) {
+        _realm.fetchSingle(auth, widget.alias);
+      }
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    if (!_isReady) {
+      _realm = context.watch<RealmProvider>();
+      _isReady = true;
+    }
+
+    return DefaultTabController(
+      length: 2,
+      child: Column(
+        children: [
+          TabBar(
+            isScrollable: !SolianTheme.isLargeScreen(context),
+            tabs: const [
+              Tab(icon: Icon(Icons.newspaper)),
+              Tab(icon: Icon(Icons.message)),
+            ],
+          ),
+          Expanded(
+            child: TabBarView(
+              children: [
+                ExplorePostWidget(realm: widget.alias),
+                ChatListWidget(realm: widget.alias),
+              ],
+            ),
+          )
+        ],
+      ),
+    );
+  }
+}
+
+class RealmManageAction extends StatelessWidget {
+  final Realm realm;
+  final Function onUpdate;
+
+  const RealmManageAction({
+    super.key,
+    required this.realm,
+    required this.onUpdate,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return IconButton(
+      onPressed: () async {
+        final did = await SolianRouter.router.pushNamed(
+          'realms.manage',
+          extra: realm,
+          pathParameters: {'realm': realm.alias},
+        );
+        if (did == true) onUpdate();
+      },
+      icon: const Icon(Icons.settings),
+    );
+  }
+}

lib/screens/realms/realm_editor.dart

@@ -0,0 +1,211 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:http/http.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/router.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/exts.dart';
+import 'package:solian/widgets/scaffold.dart';
+import 'package:uuid/uuid.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+
+class RealmEditorScreen extends StatefulWidget {
+  final Realm? editing;
+  final String? realm;
+
+  const RealmEditorScreen({super.key, this.editing, this.realm});
+
+  @override
+  State<RealmEditorScreen> createState() => _RealmEditorScreenState();
+}
+
+class _RealmEditorScreenState extends State<RealmEditorScreen> {
+  final _aliasController = TextEditingController();
+  final _nameController = TextEditingController();
+  final _descriptionController = TextEditingController();
+
+  bool _isPublic = false;
+  bool _isCommunity = false;
+
+  bool _isSubmitting = false;
+
+  Future<void> applyChannel(BuildContext context) async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    final uri = widget.editing == null
+        ? getRequestUri('passport', '/api/realms')
+        : getRequestUri('passport', '/api/realms/${widget.editing!.id}');
+
+    final req = Request(widget.editing == null ? 'POST' : 'PUT', uri);
+    req.headers['Content-Type'] = 'application/json';
+    req.body = jsonEncode(<String, dynamic>{
+      'alias': _aliasController.value.text.toLowerCase(),
+      'name': _nameController.value.text,
+      'description': _descriptionController.value.text,
+      'is_public': _isPublic,
+      'is_community': _isCommunity,
+      'realm': widget.realm,
+    });
+
+    var res = await Response.fromStream(await auth.client!.send(req));
+    if (res.statusCode != 200) {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    } else {
+      if (SolianRouter.router.canPop()) {
+        SolianRouter.router.pop(true);
+      }
+    }
+    setState(() => _isSubmitting = false);
+  }
+
+  void randomizeAlias() {
+    _aliasController.text = const Uuid().v4().replaceAll('-', '').substring(0, 16);
+  }
+
+  void cancelEditing() {
+    if (SolianRouter.router.canPop()) {
+      SolianRouter.router.pop(false);
+    }
+  }
+
+  @override
+  void initState() {
+    if (widget.editing != null) {
+      _aliasController.text = widget.editing!.alias;
+      _nameController.text = widget.editing!.name;
+      _descriptionController.text = widget.editing!.description;
+      _isPublic = widget.editing!.isPublic;
+      _isCommunity = widget.editing!.isCommunity;
+    }
+
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final editingBanner = MaterialBanner(
+      padding: const EdgeInsets.only(top: 4, bottom: 4, left: 20),
+      leading: const Icon(Icons.edit_note),
+      backgroundColor: Theme.of(context).colorScheme.surfaceVariant.withOpacity(0.9),
+      dividerColor: const Color.fromARGB(1, 0, 0, 0),
+      content: Text(AppLocalizations.of(context)!.realmEditNotify),
+      actions: [
+        TextButton(
+          child: Text(AppLocalizations.of(context)!.cancel),
+          onPressed: () => cancelEditing(),
+        ),
+      ],
+    );
+
+    return IndentScaffold(
+      hideDrawer: true,
+      showSafeArea: true,
+      title: AppLocalizations.of(context)!.realmEstablish,
+      appBarActions: <Widget>[
+        TextButton(
+          onPressed: !_isSubmitting ? () => applyChannel(context) : null,
+          child: Text(AppLocalizations.of(context)!.apply.toUpperCase()),
+        ),
+      ],
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
+      body: Column(
+        children: [
+          _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
+          widget.editing != null ? editingBanner : Container(),
+          ListTile(
+            title: Text(AppLocalizations.of(context)!.realmUsage),
+            subtitle: Text(AppLocalizations.of(context)!.realmUsageCaption),
+            leading: const CircleAvatar(
+              backgroundColor: Colors.teal,
+              child: Icon(Icons.supervised_user_circle, color: Colors.white),
+            ),
+          ),
+          const Divider(thickness: 0.3),
+          Container(
+            padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 2),
+            child: Row(
+              children: [
+                Expanded(
+                  child: TextField(
+                    autofocus: true,
+                    controller: _aliasController,
+                    decoration: InputDecoration.collapsed(
+                      hintText: AppLocalizations.of(context)!.realmAliasLabel,
+                    ),
+                    onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+                  ),
+                ),
+                TextButton(
+                  style: TextButton.styleFrom(
+                    shape: const CircleBorder(),
+                    visualDensity: const VisualDensity(horizontal: -2, vertical: -2),
+                  ),
+                  onPressed: () => randomizeAlias(),
+                  child: const Icon(Icons.refresh),
+                )
+              ],
+            ),
+          ),
+          const Divider(thickness: 0.3),
+          Container(
+            padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 8),
+            child: TextField(
+              autocorrect: true,
+              controller: _nameController,
+              decoration: InputDecoration.collapsed(
+                hintText: AppLocalizations.of(context)!.realmNameLabel,
+              ),
+              onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+            ),
+          ),
+          const Divider(thickness: 0.3),
+          Expanded(
+            child: Container(
+              padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
+              child: TextField(
+                minLines: 5,
+                maxLines: null,
+                autocorrect: true,
+                keyboardType: TextInputType.multiline,
+                controller: _descriptionController,
+                decoration: InputDecoration.collapsed(
+                  hintText: AppLocalizations.of(context)!.realmDescriptionLabel,
+                ),
+                onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
+              ),
+            ),
+          ),
+          const Divider(thickness: 0.3),
+          CheckboxListTile(
+            title: Text(AppLocalizations.of(context)!.realmPublicLabel),
+            value: _isPublic,
+            onChanged: (newValue) {
+              setState(() => _isPublic = newValue ?? false);
+            },
+            controlAffinity: ListTileControlAffinity.leading,
+          ),
+          CheckboxListTile(
+            title: Text(AppLocalizations.of(context)!.realmCommunityLabel),
+            value: _isCommunity,
+            onChanged: (newValue) {
+              setState(() => _isCommunity = newValue ?? false);
+            },
+            controlAffinity: ListTileControlAffinity.leading,
+          )
+        ],
+      ),
+    );
+  }
+}

lib/screens/realms/realm_list.dart

@@ -0,0 +1,132 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/realm.dart';
+import 'package:solian/router.dart';
+import 'package:solian/screens/realms/realm.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/notification_notifier.dart';
+import 'package:solian/widgets/realms/realm_new.dart';
+import 'package:solian/widgets/scaffold.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/widgets/signin_required.dart';
+
+class RealmListScreen extends StatelessWidget {
+  const RealmListScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    final realm = context.watch<RealmProvider>();
+
+    return realm.focusRealm == null || !SolianTheme.isLargeScreen(context)
+        ? IndentScaffold(
+            title: AppLocalizations.of(context)!.realm,
+            appBarActions: const [NotificationButton()],
+            fixedAppBarColor: SolianTheme.isLargeScreen(context),
+            body: const RealmListWidget(),
+          )
+        : RealmScreen(alias: realm.focusRealm!.alias);
+  }
+}
+
+class RealmListWidget extends StatefulWidget {
+  const RealmListWidget({super.key});
+
+  @override
+  State<RealmListWidget> createState() => _RealmListWidgetState();
+}
+
+class _RealmListWidgetState extends State<RealmListWidget> {
+  void viewNewRealmAction() {
+    final auth = context.read<AuthProvider>();
+    final realms = context.read<RealmProvider>();
+
+    showModalBottomSheet(
+      context: context,
+      builder: (context) => RealmNewAction(onUpdate: () => realms.fetch(auth)),
+    );
+  }
+
+  @override
+  void initState() {
+    Future.delayed(Duration.zero, () {
+      final auth = context.read<AuthProvider>();
+      final realms = context.read<RealmProvider>();
+      realms.fetch(auth);
+    });
+
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final auth = context.read<AuthProvider>();
+    final realms = context.watch<RealmProvider>();
+
+    return Scaffold(
+      floatingActionButton: FutureBuilder(
+        future: auth.isAuthorized(),
+        builder: (context, snapshot) {
+          if (snapshot.hasData && snapshot.data!) {
+            return FloatingActionButton.extended(
+              icon: const Icon(Icons.add),
+              label: Text(AppLocalizations.of(context)!.realmNew),
+              onPressed: () => viewNewRealmAction(),
+            );
+          } else {
+            return Container();
+          }
+        },
+      ),
+      body: FutureBuilder(
+        future: auth.isAuthorized(),
+        builder: (context, snapshot) {
+          if (!snapshot.hasData || !snapshot.data!) {
+            return const SignInRequiredScreen();
+          }
+
+          return RefreshIndicator(
+            onRefresh: () => realms.fetch(auth),
+            child: ListView.builder(
+              itemCount: realms.realms.length,
+              itemBuilder: (context, index) {
+                final element = realms.realms[index];
+                return ListTile(
+                  leading: const CircleAvatar(
+                    backgroundColor: Colors.indigo,
+                    child: Icon(Icons.supervisor_account, color: Colors.white),
+                  ),
+                  title: Text(element.name),
+                  subtitle: Text(element.description),
+                  onTap: () async {
+                    realms.fetchSingle(auth, element.alias);
+                    String? result;
+                    if (SolianRouter.currentRoute.name == 'chat.channel') {
+                      result = await SolianRouter.router.pushReplacementNamed(
+                        'realms.details',
+                        pathParameters: {
+                          'realm': element.alias,
+                        },
+                      );
+                    } else {
+                      result = await SolianRouter.router.pushNamed(
+                        'realms.details',
+                        pathParameters: {
+                          'realm': element.alias,
+                        },
+                      );
+                    }
+                    switch (result) {
+                      case 'refresh':
+                        realms.fetch(auth);
+                    }
+                  },
+                );
+              },
+            ),
+          );
+        },
+      ),
+    );
+  }
+}

lib/screens/realms/realm_manage.dart

@@ -1,34 +1,34 @@
 import 'package:flutter/material.dart';
 import 'package:provider/provider.dart';
-import 'package:solian/models/channel.dart';
+import 'package:solian/models/realm.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
-import 'package:solian/widgets/chat/channel_deletion.dart';
+import 'package:solian/widgets/realms/realm_deletion.dart';
-import 'package:solian/widgets/indent_wrapper.dart';
+import 'package:solian/widgets/scaffold.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
-class ChatManageScreen extends StatefulWidget {
+class RealmManageScreen extends StatefulWidget {
-  final Channel channel;
+  final Realm realm;
 
-  const ChatManageScreen({super.key, required this.channel});
+  const RealmManageScreen({super.key, required this.realm});
 
   @override
-  State<ChatManageScreen> createState() => _ChatManageScreenState();
+  State<RealmManageScreen> createState() => _RealmManageScreenState();
 }
 
-class _ChatManageScreenState extends State<ChatManageScreen> {
+class _RealmManageScreenState extends State<RealmManageScreen> {
   bool _isOwned = false;
 
   void promptLeaveChannel() async {
     final did = await showDialog(
       context: context,
-      builder: (context) => ChannelDeletion(
+      builder: (context) => RealmDeletion(
-        channel: widget.channel,
+        realm: widget.realm,
         isOwned: _isOwned,
       ),
     );
-    if (did == true && router.canPop()) {
+    if (did == true && SolianRouter.router.canPop()) {
-      router.pop('disposed');
+      SolianRouter.router.pop('disposed');
     }
   }
 
@@ -41,7 +41,7 @@ class _ChatManageScreenState extends State<ChatManageScreen> {
       final prof = await auth.getProfiles();
 
       setState(() {
-        _isOwned = prof['id'] == widget.channel.account.externalId;
+        _isOwned = prof['id'] == widget.realm.accountId;
       });
     });
   }
@@ -53,20 +53,19 @@ class _ChatManageScreenState extends State<ChatManageScreen> {
         leading: const Icon(Icons.settings),
         title: Text(AppLocalizations.of(context)!.settings),
         onTap: () async {
-          router.pushNamed('chat.channel.editor', extra: widget.channel).then((did) {
+          SolianRouter.router.pushNamed('realms.editor', extra: widget.realm).then((did) {
             if (did == true) {
-              if (router.canPop()) router.pop('refresh');
+              if (SolianRouter.router.canPop()) SolianRouter.router.pop('refresh');
             }
           });
         },
       ),
     ];
 
-    return IndentWrapper(
+    return IndentScaffold(
-      title: AppLocalizations.of(context)!.chatManage,
+      title: AppLocalizations.of(context)!.realmManage,
       hideDrawer: true,
-      noSafeArea: true,
+      body: Column(
-      child: Column(
         children: [
           Padding(
             padding: const EdgeInsets.symmetric(horizontal: 16, vertical: 12),
@@ -80,8 +79,8 @@ class _ChatManageScreenState extends State<ChatManageScreen> {
                 const SizedBox(width: 16),
                 Expanded(
                   child: Column(crossAxisAlignment: CrossAxisAlignment.start, children: [
-                    Text(widget.channel.name, style: Theme.of(context).textTheme.bodyLarge),
+                    Text(widget.realm.name, style: Theme.of(context).textTheme.bodyLarge),
-                    Text(widget.channel.description, style: Theme.of(context).textTheme.bodySmall),
+                    Text(widget.realm.description, style: Theme.of(context).textTheme.bodySmall),
                   ]),
                 )
               ],
@@ -91,19 +90,14 @@ class _ChatManageScreenState extends State<ChatManageScreen> {
           Expanded(
             child: ListView(
               children: [
-                ListTile(
-                  leading: const Icon(Icons.edit_notifications),
-                  title: Text(AppLocalizations.of(context)!.chatNotifySetting),
-                  onTap: () {},
-                ),
                 ListTile(
                   leading: const Icon(Icons.supervisor_account),
                   title: Text(AppLocalizations.of(context)!.chatMember),
                   onTap: () {
-                    router.pushNamed(
+                    SolianRouter.router.pushNamed(
-                      'chat.channel.member',
+                      'realms.member',
-                      extra: widget.channel,
+                      extra: widget.realm,
-                      pathParameters: {'channel': widget.channel.alias},
+                      pathParameters: {'realm': widget.realm.alias},
                     );
                   },
                 ),

lib/screens/realms/realm_member.dart

@@ -0,0 +1,191 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/account.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:solian/widgets/account/friend_picker.dart';
+import 'package:solian/widgets/exts.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/widgets/scaffold.dart';
+
+class RealmMemberScreen extends StatefulWidget {
+  final Realm realm;
+
+  const RealmMemberScreen({super.key, required this.realm});
+
+  @override
+  State<RealmMemberScreen> createState() => _RealmMemberScreenState();
+}
+
+class _RealmMemberScreenState extends State<RealmMemberScreen> {
+  bool _isSubmitting = false;
+
+  List<RealmMember> _members = List.empty();
+
+  int _selfId = 0;
+
+  Future<void> fetchMemberships() async {
+    final auth = context.read<AuthProvider>();
+    final prof = await auth.getProfiles();
+    if (!await auth.isAuthorized()) return;
+
+    _selfId = prof['id'];
+
+    var uri = getRequestUri('passport', '/api/realms/${widget.realm.alias}/members');
+
+    var res = await auth.client!.get(uri);
+    if (res.statusCode == 200) {
+      final result = jsonDecode(utf8.decode(res.bodyBytes)) as List<dynamic>;
+      setState(() {
+        _members = result.map((x) => RealmMember.fromJson(x)).toList();
+      });
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    }
+  }
+
+  Future<void> removeMember(RealmMember item) async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    var uri = getRequestUri('passport', '/api/realms/${widget.realm.alias}/members');
+
+    var res = await auth.client!.delete(
+      uri,
+      headers: {
+        'Content-Type': 'application/json',
+      },
+      body: jsonEncode({
+        'target': item.account.name,
+      }),
+    );
+    if (res.statusCode == 200) {
+      await fetchMemberships();
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    }
+
+    setState(() => _isSubmitting = false);
+  }
+
+  Future<void> addMember(String username) async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    var uri = getRequestUri('passport', '/api/realms/${widget.realm.alias}/members');
+
+    var res = await auth.client!.post(
+      uri,
+      headers: {
+        'Content-Type': 'application/json',
+      },
+      body: jsonEncode({
+        'target': username,
+      }),
+    );
+    if (res.statusCode == 200) {
+      await fetchMemberships();
+    } else {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    }
+
+    setState(() => _isSubmitting = false);
+  }
+
+  void promptAddMember() async {
+    final input = await showModalBottomSheet(
+      context: context,
+      builder: (context) {
+        return const FriendPicker();
+      },
+    );
+    if (input == null) return;
+
+    await addMember((input as Account).name);
+  }
+
+  bool getRemovable(RealmMember item) {
+    if (_selfId != widget.realm.accountId) return false;
+    if (item.accountId == widget.realm.accountId) return false;
+    if (item.account.id == _selfId) return false;
+    return true;
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    Future.delayed(Duration.zero, () => fetchMemberships());
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return IndentScaffold(
+      title: AppLocalizations.of(context)!.realmMember,
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
+      hideDrawer: true,
+      appBarActions: [
+        IconButton(
+          icon: const Icon(Icons.add),
+          onPressed: () => promptAddMember(),
+        ),
+      ],
+      body: RefreshIndicator(
+        onRefresh: () => fetchMemberships(),
+        child: CustomScrollView(
+          slivers: [
+            SliverToBoxAdapter(
+              child: _isSubmitting ? const LinearProgressIndicator().animate().scaleX() : Container(),
+            ),
+            SliverList.builder(
+              itemCount: _members.length,
+              itemBuilder: (context, index) {
+                final element = _members[index];
+
+                final randomId = DateTime.now().microsecondsSinceEpoch >> 10;
+
+                return Dismissible(
+                  key: Key(randomId.toString()),
+                  direction: getRemovable(element) ? DismissDirection.startToEnd : DismissDirection.none,
+                  background: Container(
+                    color: Colors.red,
+                    padding: const EdgeInsets.symmetric(horizontal: 20),
+                    alignment: Alignment.centerLeft,
+                    child: const Icon(Icons.remove, color: Colors.white),
+                  ),
+                  child: ListTile(
+                    leading: AccountAvatar(source: element.account.avatar),
+                    title: Text(element.account.nick),
+                    subtitle: Text(element.account.name),
+                  ),
+                  onDismissed: (_) {
+                    removeMember(element);
+                  },
+                );
+              },
+            )
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/screens/users/userinfo.dart

@@ -0,0 +1,170 @@
+import 'dart:convert';
+
+import 'package:cached_network_image/cached_network_image.dart';
+import 'package:flutter/material.dart';
+import 'package:http/http.dart';
+import 'package:solian/models/account.dart';
+import 'package:solian/models/personal_page.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
+import 'package:solian/widgets/account/personal_page_content.dart';
+import 'package:solian/widgets/exts.dart';
+import 'package:solian/widgets/scaffold.dart';
+
+class UserInfoScreen extends StatefulWidget {
+  final String name;
+
+  const UserInfoScreen({super.key, required this.name});
+
+  @override
+  State<UserInfoScreen> createState() => _UserInfoScreenState();
+}
+
+class _UserInfoScreenState extends State<UserInfoScreen> {
+  final _client = Client();
+
+  Account? _userinfo;
+  PersonalPage? _page;
+
+  Future<Account> fetchUserinfo() async {
+    final res = await Future.wait([
+      _client.get(getRequestUri('passport', '/api/users/${widget.name}')),
+      _client.get(getRequestUri('passport', '/api/users/${widget.name}/page'))
+    ], eagerError: true);
+    final mistakeRes = res.indexWhere((x) => x.statusCode != 200 && x.statusCode != 400);
+    if (mistakeRes > -1) {
+      var message = utf8.decode(res[mistakeRes].bodyBytes);
+      context.showErrorDialog(message);
+      throw Exception(message);
+    } else {
+      final info = Account.fromJson(jsonDecode(utf8.decode(res[0].bodyBytes)));
+      final page = res[1].statusCode == 200 ? PersonalPage.fromJson(jsonDecode(utf8.decode(res[1].bodyBytes))) : null;
+      setState(() {
+        _userinfo = info;
+        _page = page ??
+            PersonalPage(
+              id: 0,
+              createdAt: DateTime.now(),
+              updatedAt: DateTime.now(),
+              content: '',
+              script: '',
+              style: '',
+              accountId: info.id,
+            );
+      });
+      return info;
+    }
+  }
+
+  String getAuthorDescribe() => _userinfo!.description.isNotEmpty ? _userinfo!.description : 'No description yet.';
+
+  @override
+  Widget build(BuildContext context) {
+    return IndentScaffold(
+      title: _userinfo?.nick ?? 'Loading...',
+      fixedAppBarColor: SolianTheme.isLargeScreen(context),
+      hideDrawer: true,
+      body: FutureBuilder(
+        future: fetchUserinfo(),
+        builder: (context, snapshot) {
+          if (!snapshot.hasData || snapshot.data == null) {
+            return const Center(child: CircularProgressIndicator());
+          }
+
+          return ListView(
+            padding: const EdgeInsets.symmetric(horizontal: 24),
+            children: [
+              const SizedBox(height: 8),
+              ClipRRect(
+                borderRadius: const BorderRadius.all(Radius.circular(8)),
+                child: AspectRatio(
+                  aspectRatio: 16 / 5,
+                  child: Container(
+                    color: Theme.of(context).colorScheme.surfaceVariant,
+                    child: _userinfo?.banner != null
+                        ? CachedNetworkImage(
+                            imageUrl: getRequestUri('passport', '/api/avatar/${_userinfo!.banner}').toString(),
+                            fit: BoxFit.cover,
+                            progressIndicatorBuilder: (_, __, DownloadProgress loadingProgress) {
+                              return Center(
+                                child: CircularProgressIndicator(
+                                  value: loadingProgress.totalSize != null
+                                      ? loadingProgress.downloaded / loadingProgress.totalSize!
+                                      : null,
+                                ),
+                              );
+                            },
+                          )
+                        : Container(),
+                  ),
+                ),
+              ),
+              Padding(
+                padding: const EdgeInsets.only(left: 16, right: 16, top: 20),
+                child: Row(
+                  children: [
+                    AccountAvatar(source: _userinfo!.avatar, radius: 32),
+                    const SizedBox(width: 12),
+                    Expanded(
+                      child: Column(
+                        mainAxisSize: MainAxisSize.min,
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Row(
+                            textBaseline: TextBaseline.alphabetic,
+                            crossAxisAlignment: CrossAxisAlignment.baseline,
+                            children: [
+                              Text(
+                                _userinfo!.nick,
+                                maxLines: 1,
+                                style: const TextStyle(
+                                  fontSize: 20,
+                                  fontWeight: FontWeight.bold,
+                                  overflow: TextOverflow.ellipsis,
+                                ),
+                              ),
+                              const SizedBox(width: 6),
+                              Text(
+                                '@${_userinfo!.name}',
+                                maxLines: 1,
+                                style: const TextStyle(
+                                  fontSize: 16,
+                                  fontWeight: FontWeight.w400,
+                                  overflow: TextOverflow.ellipsis,
+                                ),
+                              ),
+                            ],
+                          ),
+                          Text(
+                            _userinfo!.description,
+                            maxLines: 3,
+                            style: const TextStyle(
+                              fontSize: 14,
+                              overflow: TextOverflow.ellipsis,
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                  ],
+                ),
+              ),
+              const Padding(
+                padding: EdgeInsets.symmetric(vertical: 8),
+                child: Divider(thickness: 0.3, indent: 4, endIndent: 4),
+              ),
+              ClipRRect(
+                borderRadius: const BorderRadius.all(Radius.circular(8)),
+                child: Padding(
+                  padding: const EdgeInsets.symmetric(horizontal: 16),
+                  child: PersonalPageContent(item: _page!),
+                ),
+              ),
+            ],
+          );
+        },
+      ),
+    );
+  }
+}

lib/utils/file.dart

@@ -0,0 +1,9 @@
+import 'dart:io';
+
+import 'package:crypto/crypto.dart';
+
+Future<String> calculateFileSha256(File file) async {
+  final bytes = await file.readAsBytes();
+  final digest = sha256.convert(bytes);
+  return digest.toString();
+}

lib/utils/http.dart

@@ -1,7 +1,7 @@
 import 'dart:convert';
 
 import 'package:http/http.dart' as http;
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 
 class HttpClient extends http.BaseClient {
   final bool isUnauthorizedRetry;

lib/utils/platform.dart

@@ -0,0 +1,39 @@
+import 'dart:io';
+
+import 'package:flutter/foundation.dart';
+import 'package:package_info_plus/package_info_plus.dart';
+
+abstract class PlatformInfo {
+  static bool get isWeb => kIsWeb;
+
+  static bool get isLinux => !kIsWeb && Platform.isLinux;
+
+  static bool get isWindows => !kIsWeb && Platform.isWindows;
+
+  static bool get isMacOS => !kIsWeb && Platform.isMacOS;
+
+  static bool get isIOS => !kIsWeb && Platform.isIOS;
+
+  static bool get isAndroid => !kIsWeb && Platform.isAndroid;
+
+  static bool get isMobile => isAndroid || isIOS;
+
+  // Not first tier supported platform
+  static bool get isBetaDesktop => isWindows || isLinux;
+
+  static bool get isDesktop => isLinux || isWindows || isMacOS;
+
+  static bool get useTouchscreen => !isMobile;
+
+  static bool get canCacheImage => isAndroid || isIOS || isMacOS;
+
+  static bool get canRecord => (isMobile || isMacOS);
+
+  static Future<String> getVersion() async {
+    var version = kIsWeb ? 'Web' : 'Unknown';
+    try {
+      version = (await PackageInfo.fromPlatform()).version;
+    } catch (_) {}
+    return version;
+  }
+}

lib/utils/theme.dart

@@ -0,0 +1,14 @@
+import 'package:flutter/material.dart';
+
+abstract class SolianTheme {
+  static bool isLargeScreen(BuildContext context) =>
+      MediaQuery.of(context).size.width > 640;
+
+  static ThemeData build(Brightness brightness) {
+    return ThemeData(
+      brightness: brightness,
+      useMaterial3: true,
+      colorScheme: ColorScheme.fromSeed(brightness: brightness, seedColor: Colors.indigo),
+    );
+  }
+}

lib/widgets/account/account_avatar.dart

@@ -1,5 +1,7 @@
+import 'package:cached_network_image/cached_network_image.dart';
 import 'package:flutter/material.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/platform.dart';
+import 'package:solian/utils/services_url.dart';
 
 class AccountAvatar extends StatelessWidget {
   final String source;
@@ -27,17 +29,19 @@ class AccountAvatar extends StatelessWidget {
       );
     }
     if (direct == true) {
+      final image = PlatformInfo.canCacheImage ? CachedNetworkImageProvider(source) : NetworkImage(source);
       return CircleAvatar(
         radius: radius,
         backgroundColor: backgroundColor,
-        backgroundImage: NetworkImage(source),
+        backgroundImage: image as ImageProvider,
       );
     } else {
       final url = getRequestUri('passport', '/api/avatar/$source').toString();
+      final image = PlatformInfo.canCacheImage ? CachedNetworkImageProvider(url) : NetworkImage(url);
       return CircleAvatar(
         radius: radius,
         backgroundColor: backgroundColor,
-        backgroundImage: NetworkImage(url),
+        backgroundImage: image as ImageProvider,
       );
     }
   }

lib/widgets/account/friend_picker.dart

@@ -3,7 +3,7 @@ import 'package:provider/provider.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/friend.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 
 class FriendPicker extends StatefulWidget {
   const FriendPicker({super.key});

lib/widgets/account/personal_page_content.dart

@@ -1,19 +1,19 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
-import 'package:solian/models/message.dart';
+import 'package:solian/models/personal_page.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
-class ChatMessageContent extends StatelessWidget {
+class PersonalPageContent extends StatelessWidget {
-  final Message item;
+  final PersonalPage item;
 
-  const ChatMessageContent({super.key, required this.item});
+  const PersonalPageContent({super.key, required this.item});
 
   @override
   Widget build(BuildContext context) {
     return Markdown(
+      selectable: true,
       data: item.content,
       shrinkWrap: true,
-      selectable: true,
       physics: const NeverScrollableScrollPhysics(),
       padding: const EdgeInsets.all(0),
       onTapLink: (text, href, title) async {

lib/widgets/chat/call/call_controls.dart

@@ -76,7 +76,7 @@ class _ControlsWidgetState extends State<ControlsWidget> {
     if (chat.currentCall != null) {
       chat.currentCall!.deactivate();
       chat.currentCall!.dispose();
-      router.pop();
+      SolianRouter.router.pop();
     }
   }
 

lib/widgets/chat/call/call_overlay.dart

@@ -52,7 +52,7 @@ class CallOverlay extends StatelessWidget {
         ),
       ),
       onTap: () {
-        router.pushNamed(
+        SolianRouter.router.pushNamed(
           'chat.channel.call',
           extra: chat.currentCall!.info,
           pathParameters: {'channel': chat.currentCall!.channel.alias},

lib/widgets/chat/call/participant.dart

@@ -5,7 +5,7 @@ import 'package:flutter_webrtc/flutter_webrtc.dart';
 import 'package:livekit_client/livekit_client.dart';
 import 'package:solian/models/account.dart';
 import 'package:solian/models/call.dart';
-import 'package:solian/widgets/chat/call/no_content.dart';
+import 'package:solian/widgets/chat/call/participant_no_content.dart';
 import 'package:solian/widgets/chat/call/participant_info.dart';
 import 'package:solian/widgets/chat/call/participant_stats.dart';
 

lib/widgets/chat/call/participant_no_content.dart

@@ -1,7 +1,7 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
 import 'package:solian/models/account.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'dart:math' as math;
 
 class NoContentWidget extends StatefulWidget {

lib/widgets/chat/channel_action.dart

@@ -7,15 +7,22 @@ import 'package:solian/models/channel.dart';
 import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/chat.dart';
 import 'package:solian/router.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
 
 class ChannelCallAction extends StatefulWidget {
   final Call? call;
   final Channel channel;
+  final String realm;
   final Function onUpdate;
 
-  const ChannelCallAction({super.key, this.call, required this.channel, required this.onUpdate});
+  const ChannelCallAction({
+    super.key,
+    this.call,
+    required this.channel,
+    required this.onUpdate,
+    this.realm = 'global',
+  });
 
   @override
   State<ChannelCallAction> createState() => _ChannelCallActionState();
@@ -33,7 +40,7 @@ class _ChannelCallActionState extends State<ChannelCallAction> {
       return;
     }
 
-    var uri = getRequestUri('messaging', '/api/channels/${widget.channel.alias}/calls');
+    var uri = getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/calls');
 
     var res = await auth.client!.post(uri);
     if (res.statusCode != 200) {
@@ -54,7 +61,7 @@ class _ChannelCallActionState extends State<ChannelCallAction> {
       return;
     }
 
-    var uri = getRequestUri('messaging', '/api/channels/${widget.channel.alias}/calls/ongoing');
+    var uri = getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/calls/ongoing');
 
     var res = await auth.client!.delete(uri);
     if (res.statusCode != 200) {
@@ -90,21 +97,30 @@ class _ChannelCallActionState extends State<ChannelCallAction> {
 class ChannelManageAction extends StatelessWidget {
   final Channel channel;
   final Function onUpdate;
+  final String realm;
 
-  const ChannelManageAction({super.key, required this.channel, required this.onUpdate});
+  const ChannelManageAction({
+    super.key,
+    required this.channel,
+    required this.onUpdate,
+    this.realm = 'global',
+  });
 
   @override
   Widget build(BuildContext context) {
     return IconButton(
       onPressed: () async {
-        final result = await router.pushNamed(
+        final result = await SolianRouter.router.pushNamed(
-          'chat.channel.manage',
+          realm == 'global' ? 'chat.channel.manage' : 'realms.chat.channel.manage',
           extra: channel,
-          pathParameters: {'channel': channel.alias},
+          pathParameters: {
+            'channel': channel.alias,
+            ...(realm == 'global' ? {} : {'realm': realm}),
+          },
         );
         switch (result) {
           case 'disposed':
-            if (router.canPop()) router.pop('refresh');
+            if (SolianRouter.router.canPop()) SolianRouter.router.pop('refresh');
           case 'refresh':
             onUpdate();
         }

lib/widgets/chat/channel_deletion.dart

@@ -5,15 +5,20 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/channel.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
 
 class ChannelDeletion extends StatefulWidget {
   final Channel channel;
+  final String realm;
   final bool isOwned;
 
-  const ChannelDeletion(
+  const ChannelDeletion({
-      {super.key, required this.channel, required this.isOwned});
+    super.key,
+    required this.channel,
+    required this.realm,
+    required this.isOwned,
+  });
 
   @override
   State<ChannelDeletion> createState() => _ChannelDeletionState();
@@ -32,7 +37,7 @@ class _ChannelDeletionState extends State<ChannelDeletion> {
     }
 
     var res = await auth.client!.delete(
-      getRequestUri('messaging', '/api/channels/${widget.channel.id}'),
+      getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.id}'),
     );
     if (res.statusCode != 200) {
       var message = utf8.decode(res.bodyBytes);
@@ -53,8 +58,8 @@ class _ChannelDeletionState extends State<ChannelDeletion> {
       return;
     }
 
-    var res = await auth.client!.post(
+    var res = await auth.client!.delete(
-      getRequestUri('messaging', '/api/channels/${widget.channel.alias}/leave'),
+      getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel.alias}/members/me'),
     );
     if (res.statusCode != 200) {
       var message = utf8.decode(res.bodyBytes);

lib/widgets/chat/chat_new.dart

@@ -4,8 +4,9 @@ import 'package:solian/router.dart';
 
 class ChatNewAction extends StatelessWidget {
   final Function onUpdate;
+  final String? realm;
 
-  const ChatNewAction({super.key, required this.onUpdate});
+  const ChatNewAction({super.key, required this.onUpdate, this.realm});
 
   @override
   Widget build(BuildContext context) {
@@ -29,7 +30,10 @@ class ChatNewAction extends StatelessWidget {
                   leading: const Icon(Icons.add),
                   title: Text(AppLocalizations.of(context)!.chatNewCreate),
                   onTap: () {
-                    router.pushNamed('chat.channel.editor').then((did) {
+                    SolianRouter.router.pushNamed(
+                      'chat.channel.editor',
+                      queryParameters: {'realm': realm},
+                    ).then((did) {
                       if (did == true) {
                         onUpdate();
                         if (Navigator.canPop(context)) {

lib/widgets/chat/maintainer.dart

@@ -1,99 +0,0 @@
-import 'dart:convert';
-
-import 'package:flutter/material.dart';
-import 'package:provider/provider.dart';
-import 'package:solian/models/call.dart';
-import 'package:solian/models/channel.dart';
-import 'package:solian/models/message.dart';
-import 'package:solian/models/packet.dart';
-import 'package:solian/providers/auth.dart';
-import 'package:solian/providers/chat.dart';
-import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-
-class ChatMaintainer extends StatefulWidget {
-  final Widget child;
-  final Channel channel;
-  final Function(Message val) onInsertMessage;
-  final Function(Message val) onUpdateMessage;
-  final Function(Message val) onDeleteMessage;
-  final Function(Call val) onCallStarted;
-  final Function() onCallEnded;
-
-  const ChatMaintainer({
-    super.key,
-    required this.child,
-    required this.channel,
-    required this.onInsertMessage,
-    required this.onUpdateMessage,
-    required this.onDeleteMessage,
-    required this.onCallStarted,
-    required this.onCallEnded,
-  });
-
-  @override
-  State<ChatMaintainer> createState() => _ChatMaintainerState();
-}
-
-class _ChatMaintainerState extends State<ChatMaintainer> {
-  void connect() {
-    ScaffoldMessenger.of(context).clearSnackBars();
-
-    final notify = ScaffoldMessenger.of(context).showSnackBar(
-      SnackBar(
-        content: Text(AppLocalizations.of(context)!.connectingServer),
-        duration: const Duration(minutes: 1),
-      ),
-    );
-
-    final auth = context.read<AuthProvider>();
-    final chat = context.read<ChatProvider>();
-
-    chat.connect(auth).then((snapshot) {
-      snapshot!.stream.listen(
-        (event) {
-          final result = NetworkPackage.fromJson(jsonDecode(event));
-          switch (result.method) {
-            case 'messages.new':
-              final payload = Message.fromJson(result.payload!);
-              if (payload.channelId == widget.channel.id) widget.onInsertMessage(payload);
-              break;
-            case 'messages.update':
-              final payload = Message.fromJson(result.payload!);
-              if (payload.channelId == widget.channel.id) widget.onUpdateMessage(payload);
-              break;
-            case 'messages.burnt':
-              final payload = Message.fromJson(result.payload!);
-              if (payload.channelId == widget.channel.id) widget.onDeleteMessage(payload);
-              break;
-            case 'calls.new':
-              final payload = Call.fromJson(result.payload!);
-              if (payload.channelId == widget.channel.id) widget.onCallStarted(payload);
-              break;
-            case 'calls.end':
-              final payload = Call.fromJson(result.payload!);
-              if (payload.channelId == widget.channel.id) widget.onCallEnded();
-              break;
-          }
-        },
-        onError: (_, __) => connect(),
-        onDone: () => connect(),
-      );
-
-      notify.close();
-    });
-  }
-
-  @override
-  void initState() {
-    Future.delayed(Duration.zero, () {
-      connect();
-    });
-
-    super.initState();
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return widget.child;
-  }
-}

lib/widgets/chat/message.dart

@@ -1,7 +1,7 @@
 import 'package:flutter/material.dart';
 import 'package:solian/models/message.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
-import 'package:solian/widgets/chat/content.dart';
+import 'package:solian/widgets/chat/message_content.dart';
 import 'package:solian/widgets/posts/content/attachment.dart';
 import 'package:timeago/timeago.dart' as timeago;
 import 'dart:math' as math;

lib/widgets/chat/message_action.dart

@@ -1,4 +1,8 @@
+import 'dart:convert';
+
 import 'package:flutter/material.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:google_fonts/google_fonts.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/message.dart';
 import 'package:solian/providers/auth.dart';
@@ -7,6 +11,7 @@ import 'package:solian/widgets/chat/message_deletion.dart';
 
 class ChatMessageAction extends StatelessWidget {
   final String channel;
+  final String realm;
   final Message item;
   final Function? onEdit;
   final Function? onReply;
@@ -15,6 +20,7 @@ class ChatMessageAction extends StatelessWidget {
     super.key,
     required this.channel,
     required this.item,
+    this.realm = 'global',
     this.onEdit,
     this.onReply,
   });
@@ -24,7 +30,7 @@ class ChatMessageAction extends StatelessWidget {
     final auth = context.read<AuthProvider>();
 
     return SizedBox(
-      height: 320,
+      height: 400,
       child: Column(
         crossAxisAlignment: CrossAxisAlignment.start,
         children: [
@@ -38,7 +44,7 @@ class ChatMessageAction extends StatelessWidget {
                   style: Theme.of(context).textTheme.headlineSmall,
                 ),
                 Text(
-                  'Message ID #${item.id.toString().padLeft(8, '0')}',
+                  '#${item.id.toString().padLeft(8, '0')}',
                   style: Theme.of(context).textTheme.bodySmall,
                 ),
               ],
@@ -67,6 +73,7 @@ class ChatMessageAction extends StatelessWidget {
                           builder: (context) => ChatMessageDeletionDialog(
                             item: item,
                             channel: channel,
+                            realm: realm,
                           ),
                         ).then((did) {
                           if (did == true && Navigator.canPop(context)) {
@@ -79,9 +86,7 @@ class ChatMessageAction extends StatelessWidget {
 
                   return ListView(
                     children: [
-                      ...(snapshot.data['id'] == item.sender.account.externalId
+                      ...(snapshot.data['id'] == item.sender.account.externalId ? authorizedItems : List.empty()),
-                          ? authorizedItems
-                          : List.empty()),
                       ListTile(
                         leading: const Icon(Icons.reply),
                         title: Text(AppLocalizations.of(context)!.reply),
@@ -89,6 +94,17 @@ class ChatMessageAction extends StatelessWidget {
                           if (onReply != null) onReply!();
                           if (Navigator.canPop(context)) Navigator.pop(context);
                         },
+                      ),
+                      ListTile(
+                        leading: const Icon(Icons.code),
+                        title: Text(AppLocalizations.of(context)!.chatMessageViewSource),
+                        onTap: () {
+                          if (Navigator.canPop(context)) Navigator.pop(context);
+                          showModalBottomSheet(
+                            context: context,
+                            builder: (context) => ChatMessageSourceWidget(item: item),
+                          );
+                        },
                       )
                     ],
                   );
@@ -105,3 +121,90 @@ class ChatMessageAction extends StatelessWidget {
     );
   }
 }
+
+class ChatMessageSourceWidget extends StatelessWidget {
+  final Message item;
+
+  const ChatMessageSourceWidget({super.key, required this.item});
+
+  @override
+  Widget build(BuildContext context) {
+    return ClipRRect(
+      borderRadius: const BorderRadius.all(Radius.circular(32)),
+      child: SizedBox(
+        width: double.infinity,
+        height: 640,
+        child: ListView(
+          children: [
+            Container(
+              padding: const EdgeInsets.only(left: 20, top: 20),
+              child: Column(
+                crossAxisAlignment: CrossAxisAlignment.start,
+                children: [
+                  Text(
+                    AppLocalizations.of(context)!.chatMessageViewSource,
+                    style: Theme.of(context).textTheme.headlineSmall,
+                  ),
+                ],
+              ),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(left: 20, top: 20, bottom: 8),
+              child: Text(
+                'Raw content',
+                style: Theme.of(context).textTheme.titleMedium,
+              ),
+            ),
+            Markdown(
+              selectable: true,
+              shrinkWrap: true,
+              physics: const NeverScrollableScrollPhysics(),
+              data: '```\n${item.rawContent}\n```',
+              padding: const EdgeInsets.all(0),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(left: 20, top: 20, bottom: 8),
+              child: Text(
+                'Decoded content',
+                style: Theme.of(context).textTheme.titleMedium,
+              ),
+            ),
+            Markdown(
+              selectable: true,
+              shrinkWrap: true,
+              physics: const NeverScrollableScrollPhysics(),
+              data: '```\n${const JsonEncoder.withIndent('    ').convert(item.decodedContent)}\n```',
+              padding: const EdgeInsets.all(0),
+              styleSheet: MarkdownStyleSheet(
+                code: GoogleFonts.robotoMono(
+                  backgroundColor: Theme.of(context).cardTheme.color ?? Theme.of(context).cardColor,
+                  fontSize: Theme.of(context).textTheme.bodyMedium!.fontSize! * 0.85,
+                ),
+              ),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(left: 20, top: 20, bottom: 8),
+              child: Text(
+                'Entire message',
+                style: Theme.of(context).textTheme.titleMedium,
+              ),
+            ),
+            Markdown(
+              selectable: true,
+              shrinkWrap: true,
+              physics: const NeverScrollableScrollPhysics(),
+              data: '```\n${const JsonEncoder.withIndent('    ').convert(item)}\n```',
+              padding: const EdgeInsets.all(0),
+              styleSheet: MarkdownStyleSheet(
+                code: GoogleFonts.robotoMono(
+                  backgroundColor: Theme.of(context).cardTheme.color ?? Theme.of(context).cardColor,
+                  fontSize: Theme.of(context).textTheme.bodyMedium!.fontSize! * 0.85,
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+}

lib/widgets/chat/message_content.dart

@@ -0,0 +1,110 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
+import 'package:flutter_markdown/flutter_markdown.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/models/message.dart';
+import 'package:solian/providers/keypair.dart';
+import 'package:url_launcher/url_launcher_string.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+
+class ChatMessageContent extends StatefulWidget {
+  final Message item;
+
+  const ChatMessageContent({super.key, required this.item});
+
+  @override
+  State<ChatMessageContent> createState() => _ChatMessageContentState();
+}
+
+class _ChatMessageContentState extends State<ChatMessageContent> {
+  @override
+  Widget build(BuildContext context) {
+    final feColor = Theme.of(context).colorScheme.onSurface.withOpacity(0.65);
+
+    final waitingKeyHint = Row(
+      children: [
+        Icon(Icons.key, color: feColor, size: 16),
+        const SizedBox(width: 4),
+        Expanded(
+          child: Text(
+            AppLocalizations.of(context)!.chatMessageUnableDecryptWaiting,
+            style: TextStyle(color: feColor),
+          ),
+        ),
+      ],
+    );
+    final missingKeyHint = Row(
+      children: [
+        Icon(Icons.key_off_outlined, color: feColor, size: 16),
+        const SizedBox(width: 4),
+        Expanded(
+          child: Text(
+            AppLocalizations.of(context)!.chatMessageUnableDecryptMissing,
+            style: TextStyle(color: feColor),
+          ),
+        ),
+      ],
+    );
+
+    if (widget.item.type == 'm.text') {
+      String? content;
+      switch (widget.item.decodedContent['algorithm']) {
+        case 'plain':
+          content = widget.item.decodedContent['value'];
+        case 'aes':
+          final keypair = context.watch<KeypairProvider>();
+          if (keypair.keys[widget.item.decodedContent['keypair_id']] == null) {
+            WidgetsBinding.instance.addPostFrameCallback((_) {
+              keypair.requestKey(
+                widget.item.decodedContent['keypair_id'],
+                widget.item.decodedContent['algorithm'],
+                widget.item.sender.account.externalId!,
+              );
+            });
+          } else {
+            content = keypair.decodeViaAESKey(
+              widget.item.decodedContent['keypair_id'],
+              widget.item.decodedContent['value'],
+            )!;
+            break;
+          }
+
+          if (keypair.requestingKeys.contains(widget.item.decodedContent['keypair_id'])) {
+            return waitingKeyHint.animate().swap(builder: (context, _) {
+              return missingKeyHint;
+            }, delay: 3000.ms);
+          }
+      }
+
+      if (content == null) {
+        return Row(
+          children: [
+            Icon(Icons.key_off, color: feColor, size: 16),
+            const SizedBox(width: 4),
+            Text(
+              AppLocalizations.of(context)!.chatMessageUnableDecryptUnsupported,
+              style: TextStyle(color: feColor),
+            ),
+          ],
+        );
+      }
+
+      return Markdown(
+        data: content,
+        shrinkWrap: true,
+        selectable: true,
+        physics: const NeverScrollableScrollPhysics(),
+        padding: const EdgeInsets.all(0),
+        onTapLink: (text, href, title) async {
+          if (href == null) return;
+          await launchUrlString(
+            href,
+            mode: LaunchMode.externalApplication,
+          );
+        },
+      );
+    }
+
+    return Container();
+  }
+}

lib/widgets/chat/message_deletion.dart

@@ -5,22 +5,23 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/message.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
 
 class ChatMessageDeletionDialog extends StatefulWidget {
   final String channel;
+  final String realm;
   final Message item;
 
   const ChatMessageDeletionDialog({
     super.key,
     required this.item,
     required this.channel,
+    this.realm = 'global'
   });
 
   @override
-  State<ChatMessageDeletionDialog> createState() =>
+  State<ChatMessageDeletionDialog> createState() => _ChatMessageDeletionDialogState();
-      _ChatMessageDeletionDialogState();
 }
 
 class _ChatMessageDeletionDialogState extends State<ChatMessageDeletionDialog> {
@@ -30,8 +31,8 @@ class _ChatMessageDeletionDialogState extends State<ChatMessageDeletionDialog> {
     final auth = context.read<AuthProvider>();
     if (!await auth.isAuthorized()) return;
 
-    final uri = getRequestUri('messaging',
+    final uri =
-        '/api/channels/${widget.channel}/messages/${widget.item.id}');
+        getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel}/messages/${widget.item.id}');
 
     setState(() => _isSubmitting = true);
     final res = await auth.client!.delete(uri);

lib/widgets/chat/message_editor.dart

@@ -1,24 +1,37 @@
 import 'dart:convert';
 
+import 'package:easy_debounce/easy_debounce.dart';
 import 'package:flutter/material.dart';
+import 'package:flutter_animate/flutter_animate.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:http/http.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/message.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/providers/keypair.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
 import 'package:solian/widgets/posts/attachment_editor.dart';
 import 'package:badges/badges.dart' as badge;
 
 class ChatMessageEditor extends StatefulWidget {
   final String channel;
+  final String realm;
   final Message? editing;
   final Message? replying;
+  final bool isEncrypted;
   final Function? onReset;
 
-  const ChatMessageEditor({super.key, required this.channel, this.editing, this.replying, this.onReset});
+  const ChatMessageEditor({
+    super.key,
+    required this.channel,
+    required this.isEncrypted,
+    this.realm = 'global',
+    this.editing,
+    this.replying,
+    this.onReset,
+  });
 
   @override
   State<ChatMessageEditor> createState() => _ChatMessageEditorState();
@@ -28,7 +41,8 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
   final _textController = TextEditingController();
   final _focusNode = FocusNode();
 
-  bool _isSubmitting = false;
+  final List<int> _pendingMessages = List.empty(growable: true);
+
   int? _prevEditingId;
 
   List<Attachment> _attachments = List.empty(growable: true);
@@ -44,35 +58,59 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
     );
   }
 
-  Future<void> sendMessage(BuildContext context) async {
+  Map<String, dynamic> buildContentBody(String content) {
-    if (_isSubmitting) return;
+    final keypair = context.read<KeypairProvider>();
+    if (keypair.activeKeyId == null || keypair.keys[keypair.activeKeyId] == null) {
+      final kp = keypair.generateAESKey();
+      keypair.setActiveKey(kp.id);
+      return buildContentBody(content);
+    }
 
+    return {
+      'value': widget.isEncrypted ? keypair.encodeViaAESKey(keypair.activeKeyId!, content) : content,
+      'keypair_id': widget.isEncrypted ? keypair.activeKeyId : null,
+      'algorithm': widget.isEncrypted ? 'aes' : 'plain',
+    };
+  }
+
+  Future<void> sendMessage(BuildContext context) async {
     _focusNode.requestFocus();
 
     final auth = context.read<AuthProvider>();
     if (!await auth.isAuthorized()) return;
 
     final uri = widget.editing == null
-        ? getRequestUri('messaging', '/api/channels/${widget.channel}/messages')
+        ? getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel}/messages')
-        : getRequestUri('messaging', '/api/channels/${widget.channel}/messages/${widget.editing!.id}');
+        : getRequestUri('messaging', '/api/channels/${widget.realm}/${widget.channel}/messages/${widget.editing!.id}');
 
     final req = Request(widget.editing == null ? 'POST' : 'PUT', uri);
     req.headers['Content-Type'] = 'application/json';
     req.body = jsonEncode(<String, dynamic>{
-      'content': _textController.value.text,
+      'type': 'm.text',
+      'content': buildContentBody(_textController.value.text),
       'attachments': _attachments,
       'reply_to': widget.replying?.id,
     });
 
-    setState(() => _isSubmitting = true);
+    reset();
+
+    final messageMarkId = DateTime.now().microsecondsSinceEpoch >> 10;
+    final messageDebounceId = 'm-pending$messageMarkId';
+
+    EasyDebounce.debounce(messageDebounceId, 350.ms, () {
+      setState(() => _pendingMessages.add(messageMarkId));
+    });
+
     var res = await Response.fromStream(await auth.client!.send(req));
     if (res.statusCode != 200) {
       var message = utf8.decode(res.bodyBytes);
       context.showErrorDialog(message);
-    } else {
-      reset();
     }
-    setState(() => _isSubmitting = false);
+
+    EasyDebounce.cancel(messageDebounceId);
+    if (_pendingMessages.isNotEmpty) {
+      setState(() => _pendingMessages.remove(messageMarkId));
+    }
   }
 
   void reset() {
@@ -86,8 +124,11 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
     if (widget.editing != null && _prevEditingId != widget.editing!.id) {
       setState(() {
         _prevEditingId = widget.editing!.id;
-        _textController.text = widget.editing!.content;
         _attachments = widget.editing!.attachments ?? List.empty(growable: true);
+
+        if (widget.editing!.type == 'm.text') {
+          _textController.text = widget.editing!.decodedContent['value'];
+        }
       });
     }
   }
@@ -105,6 +146,15 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
 
   @override
   Widget build(BuildContext context) {
+    final sendingBanner = MaterialBanner(
+      padding: const EdgeInsets.only(top: 4, bottom: 4, left: 20),
+      leading: const Icon(Icons.schedule_send),
+      backgroundColor: Theme.of(context).colorScheme.surfaceVariant.withOpacity(0.9),
+      dividerColor: const Color.fromARGB(1, 0, 0, 0),
+      content: Text('${AppLocalizations.of(context)!.chatMessageSending} (${_pendingMessages.length})'),
+      actions: const [SizedBox()],
+    );
+
     final editingBanner = MaterialBanner(
       padding: const EdgeInsets.only(top: 4, bottom: 4, left: 20),
       leading: const Icon(Icons.edit_note),
@@ -135,6 +185,18 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
 
     return Column(
       children: [
+        _pendingMessages.isNotEmpty
+            ? sendingBanner
+                .animate()
+                .scaleY(
+                  begin: 0,
+                  curve: Curves.fastEaseInToSlowEaseOut,
+                )
+                .slideY(
+                  begin: 1,
+                  curve: Curves.fastEaseInToSlowEaseOut,
+                )
+            : Container(),
         widget.editing != null ? editingBanner : Container(),
         widget.replying != null ? replyingBanner : Container(),
         Container(
@@ -154,7 +216,7 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
                 position: badge.BadgePosition.custom(top: -2, end: 8),
                 child: TextButton(
                   style: TextButton.styleFrom(shape: const CircleBorder(), padding: const EdgeInsets.all(4)),
-                  onPressed: !_isSubmitting ? () => viewAttachments(context) : null,
+                  onPressed: () => viewAttachments(context),
                   child: const Icon(Icons.attach_file),
                 ),
               ),
@@ -166,7 +228,9 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
                   autocorrect: true,
                   keyboardType: TextInputType.text,
                   decoration: InputDecoration.collapsed(
-                    hintText: AppLocalizations.of(context)!.chatMessagePlaceholder,
+                    hintText: widget.isEncrypted
+                        ? AppLocalizations.of(context)!.chatMessageEncryptedPlaceholder
+                        : AppLocalizations.of(context)!.chatMessagePlaceholder,
                   ),
                   onSubmitted: (_) => sendMessage(context),
                   onTapOutside: (_) => FocusManager.instance.primaryFocus?.unfocus(),
@@ -174,7 +238,7 @@ class _ChatMessageEditorState extends State<ChatMessageEditor> {
               ),
               TextButton(
                 style: TextButton.styleFrom(shape: const CircleBorder(), padding: const EdgeInsets.all(4)),
-                onPressed: !_isSubmitting ? () => sendMessage(context) : null,
+                onPressed: () => sendMessage(context),
                 child: const Icon(Icons.send),
               )
             ],

lib/widgets/common_wrapper.dart

@@ -1,35 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:solian/widgets/navigation_drawer.dart';
-
-class LayoutWrapper extends StatelessWidget {
-  final Widget? child;
-  final Widget? floatingActionButton;
-  final List<Widget>? appBarActions;
-  final bool noSafeArea;
-  final String title;
-
-  const LayoutWrapper({
-    super.key,
-    this.child,
-    required this.title,
-    this.floatingActionButton,
-    this.appBarActions,
-    this.noSafeArea = false,
-  });
-
-  @override
-  Widget build(BuildContext context) {
-    final content = child ?? Container();
-
-    return Scaffold(
-      appBar: AppBar(
-        title: Text(title),
-        actions: appBarActions,
-        centerTitle: false,
-      ),
-      floatingActionButton: floatingActionButton,
-      drawer: const SolianNavigationDrawer(),
-      body: noSafeArea ? content : SafeArea(child: content),
-    );
-  }
-}

lib/widgets/empty.dart

@@ -1,22 +1,24 @@
 import 'package:flutter/material.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
-class SelectionEmptyWidget extends StatelessWidget {
+class PageEmptyWidget extends StatelessWidget {
-  const SelectionEmptyWidget({super.key});
+  const PageEmptyWidget({super.key});
 
   @override
   Widget build(BuildContext context) {
-    return Center(
+    return Material(
-      child: Column(
+      child: Center(
-        mainAxisSize: MainAxisSize.min,
+        child: Column(
-        children: [
+          mainAxisSize: MainAxisSize.min,
-          Image.asset('assets/logo.png', width: 64, height: 64),
+          children: [
-          const SizedBox(height: 2),
+            Image.asset('assets/logo.png', width: 64, height: 64),
-          Text(
+            const SizedBox(height: 2),
-            AppLocalizations.of(context)!.appName,
+            Text(
-            style: const TextStyle(fontSize: 18, fontWeight: FontWeight.w900),
+              AppLocalizations.of(context)!.appName,
-          ),
+              style: const TextStyle(fontSize: 18, fontWeight: FontWeight.w900),
-        ],
+            ),
+          ],
+        ),
       ),
     );
   }

lib/widgets/indent_wrapper.dart

@@ -1,43 +0,0 @@
-import 'package:flutter/material.dart';
-import 'package:solian/router.dart';
-import 'package:solian/widgets/common_wrapper.dart';
-import 'package:solian/widgets/navigation_drawer.dart';
-
-class IndentWrapper extends LayoutWrapper {
-  final bool hideDrawer;
-  final bool fixedAppBarColor;
-
-  const IndentWrapper({
-    super.key,
-    super.child,
-    required super.title,
-    super.floatingActionButton,
-    super.appBarActions,
-    this.hideDrawer = false,
-    this.fixedAppBarColor = false,
-    super.noSafeArea = false,
-  }) : super();
-
-  @override
-  Widget build(BuildContext context) {
-    final content = child ?? Container();
-
-    return Scaffold(
-      appBar: AppBar(
-        leading: hideDrawer
-            ? IconButton(
-                icon: const Icon(Icons.arrow_back),
-                onPressed: () => router.pop(),
-              )
-            : null,
-        title: Text(title),
-        actions: appBarActions,
-        centerTitle: false,
-        elevation: fixedAppBarColor ? 4 : null,
-      ),
-      floatingActionButton: floatingActionButton,
-      drawer: const SolianNavigationDrawer(),
-      body: noSafeArea ? content : SafeArea(child: content),
-    );
-  }
-}

lib/widgets/layouts/two_column.dart

@@ -0,0 +1,27 @@
+import 'package:flutter/material.dart';
+import 'package:solian/widgets/empty.dart';
+
+class TwoColumnLayout extends StatelessWidget {
+  final Widget sideChild;
+  final Widget? mainChild;
+
+  const TwoColumnLayout({
+    super.key,
+    required this.sideChild,
+    required this.mainChild,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    return Row(
+      children: [
+        SizedBox(
+          width: 400,
+          child: sideChild,
+        ),
+        const VerticalDivider(width: 0.3, thickness: 0.3),
+        Expanded(child: mainChild ?? const PageEmptyWidget()),
+      ],
+    );
+  }
+}

lib/widgets/navigation_drawer.dart

@@ -3,6 +3,7 @@ import 'package:provider/provider.dart';
 import 'package:solian/providers/navigation.dart';
 import 'package:solian/router.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/utils/theme.dart';
 
 class SolianNavigationDrawer extends StatefulWidget {
   const SolianNavigationDrawer({super.key});
@@ -17,7 +18,7 @@ class _SolianNavigationDrawerState extends State<SolianNavigationDrawer> {
   void _onSelect(String name, int idx) {
     setState(() => _selectedIndex = idx);
     context.read<NavigationProvider>().selectedIndex = idx;
-    router.goNamed(name);
+    SolianRouter.router.goNamed(name);
   }
 
   @override
@@ -41,6 +42,13 @@ class _SolianNavigationDrawerState extends State<SolianNavigationDrawer> {
         ),
         'explore',
       ),
+      (
+        NavigationDrawerDestination(
+          icon: const Icon(Icons.supervised_user_circle),
+          label: Text(AppLocalizations.of(context)!.realm),
+        ),
+        'realms',
+      ),
       (
         NavigationDrawerDestination(
           icon: const Icon(Icons.send),
@@ -59,6 +67,9 @@ class _SolianNavigationDrawerState extends State<SolianNavigationDrawer> {
 
     return NavigationDrawer(
       selectedIndex: _selectedIndex,
+      elevation: SolianTheme.isLargeScreen(context) ? 20 : 0,
+      shadowColor: SolianTheme.isLargeScreen(context) ? Theme.of(context).shadowColor : null,
+      surfaceTintColor: Theme.of(context).colorScheme.background,
       onDestinationSelected: (int idx) {
         final element = navigationItems[idx];
         _onSelect(element.$2, idx);

lib/widgets/notification_notifier.dart

@@ -1,76 +1,12 @@
-import 'dart:convert';
-
 import 'package:flutter/material.dart';
 import 'package:provider/provider.dart';
-import 'package:solian/providers/auth.dart';
 import 'package:solian/providers/notify.dart';
 import 'package:solian/router.dart';
-import 'package:flutter_gen/gen_l10n/app_localizations.dart';
-import 'package:solian/models/notification.dart' as model;
 import 'package:badges/badges.dart' as badge;
 
-class NotificationNotifier extends StatefulWidget {
+class NotificationButton extends StatelessWidget {
-  final Widget child;
-
-  const NotificationNotifier({super.key, required this.child});
-
-  @override
-  State<NotificationNotifier> createState() => _NotificationNotifierState();
-}
-
-class _NotificationNotifierState extends State<NotificationNotifier> {
-  void connect() async {
-    final notify = ScaffoldMessenger.of(context).showSnackBar(
-      SnackBar(
-        content: Text(AppLocalizations.of(context)!.connectingServer),
-        duration: const Duration(minutes: 1),
-      ),
-    );
-
-    final auth = context.read<AuthProvider>();
-    final nty = context.read<NotifyProvider>();
-
-    if (await auth.isAuthorized()) {
-      nty.fetch(auth);
-      nty.connect(auth).then((snapshot) {
-        snapshot!.stream.listen(
-          (event) {
-            final result = model.Notification.fromJson(jsonDecode(event));
-            nty.onRemoteMessage(result);
-            nty.notifyMessage(result.subject, result.content);
-          },
-          onError: (_, __) => connect(),
-          onDone: () => connect(),
-        );
-      });
-    }
-
-    notify.close();
-  }
-
-  @override
-  void initState() {
-    Future.delayed(Duration.zero, () {
-      connect();
-    });
-
-    super.initState();
-  }
-
-  @override
-  Widget build(BuildContext context) {
-    return widget.child;
-  }
-}
-
-class NotificationButton extends StatefulWidget {
   const NotificationButton({super.key});
 
-  @override
-  State<NotificationButton> createState() => _NotificationButtonState();
-}
-
-class _NotificationButtonState extends State<NotificationButton> {
   @override
   Widget build(BuildContext context) {
     final nty = context.watch<NotifyProvider>();
@@ -85,7 +21,7 @@ class _NotificationButtonState extends State<NotificationButton> {
       child: IconButton(
         icon: const Icon(Icons.notifications),
         onPressed: () {
-          router.pushNamed('notification');
+          SolianRouter.router.pushNamed('notification');
         },
       ),
     );

lib/widgets/posts/attachment_editor.dart

@@ -2,7 +2,6 @@ import 'dart:convert';
 import 'dart:io';
 import 'dart:math' as math;
 
-import 'package:crypto/crypto.dart';
 import 'package:file_picker/file_picker.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_animate/flutter_animate.dart';
@@ -11,7 +10,8 @@ import 'package:image_picker/image_picker.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/post.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/file.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/widgets/exts.dart';
 
@@ -62,7 +62,7 @@ class _AttachmentEditorState extends State<AttachmentEditor> {
     bool isPopped = false;
     for (final media in medias) {
       final file = File(media.path);
-      final hashcode = await calculateSha256(file);
+      final hashcode = await calculateFileSha256(file);
       try {
         await uploadAttachment(file, hashcode);
       } catch (err) {
@@ -90,7 +90,7 @@ class _AttachmentEditorState extends State<AttachmentEditor> {
 
     bool isPopped = false;
     for (final file in files) {
-      final hashcode = await calculateSha256(file);
+      final hashcode = await calculateFileSha256(file);
       try {
         await uploadAttachment(file, hashcode);
       } catch (err) {
@@ -120,7 +120,7 @@ class _AttachmentEditorState extends State<AttachmentEditor> {
     setState(() => _isSubmitting = true);
 
     final file = File(media.path);
-    final hashcode = await calculateSha256(file);
+    final hashcode = await calculateFileSha256(file);
 
     if (Navigator.canPop(context)) {
       Navigator.pop(context);
@@ -171,12 +171,6 @@ class _AttachmentEditorState extends State<AttachmentEditor> {
     setState(() => _isSubmitting = false);
   }
 
-  Future<String> calculateSha256(File file) async {
-    final bytes = await file.readAsBytes();
-    final digest = sha256.convert(bytes);
-    return digest.toString();
-  }
-
   String getFileName(Attachment item) {
     return item.filename.replaceAll(RegExp(r'\.[^/.]+$'), '');
   }

lib/widgets/posts/attachment_screen.dart

@@ -1,4 +1,6 @@
+import 'package:cached_network_image/cached_network_image.dart';
 import 'package:flutter/material.dart';
+import 'package:solian/utils/platform.dart';
 
 class AttachmentScreen extends StatelessWidget {
   final String url;
@@ -17,7 +19,7 @@ class AttachmentScreen extends StatelessWidget {
         maxScale: 16,
         panEnabled: true,
         scaleEnabled: true,
-        child: Image.network(url, fit: BoxFit.contain),
+        child: PlatformInfo.canCacheImage ? CachedNetworkImage(imageUrl: url, fit: BoxFit.contain) : Image.network(url),
       ),
     );
 

lib/widgets/posts/comment_list.dart

@@ -9,8 +9,8 @@ import 'package:http/http.dart' as http;
 import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
 import 'package:solian/screens/posts/comment_editor.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
-import 'package:solian/widgets/posts/item.dart';
+import 'package:solian/widgets/posts/post.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 
 class CommentList extends StatefulWidget {
@@ -120,7 +120,7 @@ class CommentListHeader extends StatelessWidget {
               if (snapshot.hasData && snapshot.data == true) {
                 return TextButton(
                   onPressed: () async {
-                    final did = await router.pushNamed(
+                    final did = await SolianRouter.router.pushNamed(
                       'posts.comments.editor',
                       extra: CommentPostArguments(related: related),
                     );

lib/widgets/posts/content/article.dart

@@ -1,9 +1,10 @@
+import 'package:cached_network_image/cached_network_image.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_markdown/flutter_markdown.dart';
 import 'package:solian/models/post.dart';
 import 'package:markdown/markdown.dart' as markdown;
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/platform.dart';
-import 'package:solian/widgets/posts/content/attachment.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:url_launcher/url_launcher_string.dart';
 
 class ArticleContent extends StatelessWidget {
@@ -61,10 +62,9 @@ class ArticleContent extends StatelessWidget {
                     uri = url;
                   }
 
-                  return AttachmentItem(
+                  return PlatformInfo.canCacheImage
-                    type: 1,
+                      ? CachedNetworkImage(imageUrl: uri.toString())
-                    url: uri.toString(),
+                      : Image.network(uri.toString());
-                  );
                 },
               ),
             ],

lib/widgets/posts/content/attachment.dart

@@ -1,8 +1,10 @@
+import 'package:cached_network_image/cached_network_image.dart';
 import 'package:flutter/material.dart';
 import 'package:media_kit/media_kit.dart';
 import 'package:media_kit_video/media_kit_video.dart';
 import 'package:solian/models/post.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/platform.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:flutter_carousel_widget/flutter_carousel_widget.dart';
 import 'package:solian/widgets/posts/attachment_screen.dart';
 import 'package:uuid/uuid.dart';
@@ -57,6 +59,7 @@ class _AttachmentItemState extends State<AttachmentItem> {
     Widget content;
 
     if (widget.type == 1) {
+      final image = PlatformInfo.canCacheImage ? CachedNetworkImageProvider(widget.url) : NetworkImage(widget.url);
       content = GestureDetector(
         child: ClipRRect(
           borderRadius: const BorderRadius.all(borderRadius),
@@ -64,8 +67,8 @@ class _AttachmentItemState extends State<AttachmentItem> {
             tag: tag,
             child: Stack(
               children: [
-                Image.network(
+                Image(
-                  widget.url,
+                  image: image as ImageProvider,
                   key: Key(getTag()),
                   width: double.infinity,
                   height: double.infinity,

lib/widgets/posts/post.dart

@@ -1,12 +1,14 @@
 import 'package:flutter/material.dart';
 import 'package:infinite_scroll_pagination/infinite_scroll_pagination.dart';
 import 'package:solian/models/post.dart';
-import 'package:solian/widgets/account/avatar.dart';
+import 'package:solian/router.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/account/account_avatar.dart';
 import 'package:solian/widgets/posts/comment_list.dart';
 import 'package:solian/widgets/posts/content/article.dart';
 import 'package:solian/widgets/posts/content/attachment.dart';
 import 'package:solian/widgets/posts/content/moment.dart';
-import 'package:solian/widgets/posts/item_action.dart';
+import 'package:solian/widgets/posts/post_action.dart';
 import 'package:solian/widgets/posts/reaction_list.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:timeago/timeago.dart' as timeago;
@@ -87,16 +89,13 @@ class _PostItemState extends State<PostItem> {
   Widget renderAttachments() {
     if (widget.item.modelType == 'article') return Container();
 
-    final screenWidth = MediaQuery.of(context).size.width;
-    final isLargeScreen = screenWidth >= 600;
-
     if (widget.item.attachments != null && widget.item.attachments!.isNotEmpty) {
       return Padding(
         padding: const EdgeInsets.only(top: 8),
         child: AttachmentList(
           items: widget.item.attachments!,
           provider: 'interactive',
-          noTag: isLargeScreen && widget.brief,
+          noTag: SolianTheme.isLargeScreen(context) && widget.brief,
         ),
       );
     } else {
@@ -174,9 +173,17 @@ class _PostItemState extends State<PostItem> {
             Row(
               crossAxisAlignment: CrossAxisAlignment.start,
               children: [
-                AccountAvatar(
+                GestureDetector(
-                  source: widget.item.author.avatar,
+                  child: AccountAvatar(
-                  direct: true,
+                    source: widget.item.author.avatar,
+                    direct: true,
+                  ),
+                  onTap: () {
+                    SolianRouter.router.pushNamed(
+                      'users.info',
+                      pathParameters: {'user': widget.item.author.name},
+                    );
+                  },
                 ),
                 Expanded(
                   child: Column(
@@ -205,9 +212,17 @@ class _PostItemState extends State<PostItem> {
             child: Row(
               crossAxisAlignment: CrossAxisAlignment.start,
               children: [
-                AccountAvatar(
+                GestureDetector(
-                  source: widget.item.author.avatar,
+                  child: AccountAvatar(
-                  direct: true,
+                    source: widget.item.author.avatar,
+                    direct: true,
+                  ),
+                  onTap: () {
+                    SolianRouter.router.pushNamed(
+                      'users.info',
+                      pathParameters: {'user': widget.item.author.name},
+                    );
+                  },
                 ),
                 Expanded(
                   child: Column(

lib/widgets/posts/post_action.dart

@@ -5,7 +5,7 @@ import 'package:solian/providers/auth.dart';
 import 'package:solian/router.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/screens/posts/comment_editor.dart';
-import 'package:solian/widgets/posts/item_deletion.dart';
+import 'package:solian/widgets/posts/post_deletion.dart';
 
 class PostItemAction extends StatelessWidget {
   final Post item;
@@ -23,17 +23,17 @@ class PostItemAction extends StatelessWidget {
     bool ok = false;
     switch (item.modelType) {
       case 'article':
-        ok = await router.pushNamed(
+        ok = await SolianRouter.router.pushNamed(
           'posts.articles.editor',
           extra: item,
         ) as bool;
       case 'moment':
-        ok = await router.pushNamed(
+        ok = await SolianRouter.router.pushNamed(
           'posts.moments.editor',
           extra: item,
         ) as bool;
       case 'comment':
-        ok = await router.pushNamed(
+        ok = await SolianRouter.router.pushNamed(
           'posts.comments.editor',
           extra: CommentPostArguments(editing: item),
         ) as bool;
@@ -54,10 +54,19 @@ class PostItemAction extends StatelessWidget {
         crossAxisAlignment: CrossAxisAlignment.start,
         children: [
           Container(
-            padding: const EdgeInsets.only(left: 20, top: 20, bottom: 12),
+            padding: const EdgeInsets.only(left: 20, top: 20, bottom: 8),
-            child: Text(
+            child: Column(
-              AppLocalizations.of(context)!.action,
+              crossAxisAlignment: CrossAxisAlignment.start,
-              style: Theme.of(context).textTheme.headlineSmall,
+              children: [
+                Text(
+                  AppLocalizations.of(context)!.action,
+                  style: Theme.of(context).textTheme.headlineSmall,
+                ),
+                Text(
+                  '#${item.id.toString().padLeft(8, '0')}',
+                  style: Theme.of(context).textTheme.bodySmall,
+                ),
+              ],
             ),
           ),
           Expanded(

lib/widgets/posts/post_deletion.dart

@@ -5,7 +5,7 @@ import 'package:provider/provider.dart';
 import 'package:solian/models/post.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:solian/widgets/exts.dart';
 
 class ItemDeletionDialog extends StatefulWidget {
@@ -29,8 +29,7 @@ class _ItemDeletionDialogState extends State<ItemDeletionDialog> {
     final auth = context.read<AuthProvider>();
     if (!await auth.isAuthorized()) return;
 
-    final uri =
+    final uri = getRequestUri('interactive', '/api/p/${widget.item.modelType}s/${widget.item.id}');
-        getRequestUri('interactive', '/api/p/moments/${widget.item.id}');
 
     setState(() => _isSubmitting = true);
     final res = await auth.client!.delete(uri);

lib/widgets/posts/reaction_action.dart

@@ -5,7 +5,7 @@ import 'package:flutter_animate/flutter_animate.dart';
 import 'package:provider/provider.dart';
 import 'package:solian/models/reaction.dart';
 import 'package:solian/providers/auth.dart';
-import 'package:solian/utils/service_url.dart';
+import 'package:solian/utils/services_url.dart';
 import 'package:flutter_gen/gen_l10n/app_localizations.dart';
 import 'package:solian/widgets/exts.dart';
 

lib/widgets/provider_init.dart

@@ -0,0 +1,90 @@
+import 'dart:async';
+
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/chat.dart';
+import 'package:solian/providers/keypair.dart';
+import 'package:solian/providers/notify.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/widgets/exts.dart';
+
+class ProviderInitializer extends StatefulWidget {
+  final Widget child;
+
+  const ProviderInitializer({super.key, required this.child});
+
+  @override
+  State<ProviderInitializer> createState() => _ProviderInitializerState();
+}
+
+class _ProviderInitializerState extends State<ProviderInitializer> {
+  void showConnectionStatus(bool status) {
+    if (status) {
+      showConnectionSnackbar();
+    } else {
+      ScaffoldMessenger.of(context).clearSnackBars();
+    }
+  }
+
+  void showConnectionSnackbar() {
+    ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+      content: Text(AppLocalizations.of(context)!.connectingServer),
+      duration: const Duration(minutes: 1),
+    ));
+  }
+
+  void connect() async {
+    final auth = context.read<AuthProvider>();
+    final nty = context.read<NotifyProvider>();
+    final chat = context.read<ChatProvider>();
+    final keypair = context.read<KeypairProvider>();
+
+    final notify = ScaffoldMessenger.of(context).showSnackBar(
+      SnackBar(
+        content: Text(AppLocalizations.of(context)!.connectingServer),
+        duration: const Duration(seconds: 3),
+      ),
+    );
+
+    try {
+      if (await auth.isAuthorized()) {
+        if (auth.client == null) {
+          await auth.loadClient();
+        }
+
+        nty.connect(
+          auth,
+          onKexRequest: keypair.provideKeypair,
+          onKexProvide: keypair.receiveKeypair,
+            onStateUpdated: showConnectionStatus
+        ).then((value) {
+          keypair.channel = value;
+        });
+        chat.connect(auth, onStateUpdated: showConnectionStatus);
+
+        nty.fetch(auth);
+
+        Timer.periodic(const Duration(seconds: 1), (timer) {
+          nty.connect(auth, onStateUpdated: showConnectionStatus);
+          chat.connect(auth, onStateUpdated: showConnectionStatus);
+        });
+      }
+    } catch (e) {
+      context.showErrorDialog(e);
+    }
+
+    notify.close();
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    Future.delayed(Duration.zero, () => connect());
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return widget.child;
+  }
+}

lib/widgets/realms/realm_deletion.dart

@@ -0,0 +1,101 @@
+import 'dart:convert';
+
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/models/realm.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/utils/services_url.dart';
+import 'package:solian/widgets/exts.dart';
+
+class RealmDeletion extends StatefulWidget {
+  final Realm realm;
+  final bool isOwned;
+
+  const RealmDeletion({
+    super.key,
+    required this.realm,
+    required this.isOwned,
+  });
+
+  @override
+  State<RealmDeletion> createState() => _RealmDeletionState();
+}
+
+class _RealmDeletionState extends State<RealmDeletion> {
+  bool _isSubmitting = false;
+
+  Future<void> deleteChannel() async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    var res = await auth.client!.delete(
+      getRequestUri('passport', '/api/realms/${widget.realm.alias}'),
+    );
+    if (res.statusCode != 200) {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    } else if (Navigator.canPop(context)) {
+      Navigator.pop(context, true);
+    }
+
+    setState(() => _isSubmitting = false);
+  }
+
+  Future<void> leaveChannel() async {
+    setState(() => _isSubmitting = true);
+
+    final auth = context.read<AuthProvider>();
+    if (!await auth.isAuthorized()) {
+      setState(() => _isSubmitting = false);
+      return;
+    }
+
+    var res = await auth.client!.delete(
+      getRequestUri('passport', '/api/realms/${widget.realm.alias}/members/me'),
+    );
+    if (res.statusCode != 200) {
+      var message = utf8.decode(res.bodyBytes);
+      context.showErrorDialog(message);
+    } else if (Navigator.canPop(context)) {
+      Navigator.pop(context, true);
+    }
+
+    setState(() => _isSubmitting = false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    final content = widget.isOwned
+        ? AppLocalizations.of(context)!.chatChannelDeleteConfirm
+        : AppLocalizations.of(context)!.chatChannelLeaveConfirm;
+
+    return AlertDialog(
+      title: Text(AppLocalizations.of(context)!.confirmation),
+      content: Text(content),
+      actions: <Widget>[
+        TextButton(
+          onPressed: _isSubmitting ? null : () => Navigator.pop(context),
+          child: Text(AppLocalizations.of(context)!.confirmCancel),
+        ),
+        TextButton(
+          onPressed: _isSubmitting
+              ? null
+              : () {
+                  if (widget.isOwned) {
+                    deleteChannel();
+                  } else {
+                    leaveChannel();
+                  }
+                },
+          child: Text(AppLocalizations.of(context)!.confirmOkay),
+        ),
+      ],
+    );
+  }
+}

lib/widgets/realms/realm_new.dart

@@ -0,0 +1,53 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+import 'package:solian/router.dart';
+
+class RealmNewAction extends StatelessWidget {
+  final Function onUpdate;
+
+  const RealmNewAction({super.key, required this.onUpdate});
+
+  @override
+  Widget build(BuildContext context) {
+    return SizedBox(
+      height: 320,
+      width: double.infinity,
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Container(
+            padding: const EdgeInsets.only(left: 20, top: 20, bottom: 8),
+            child: Text(
+              AppLocalizations.of(context)!.realmNew,
+              style: Theme.of(context).textTheme.headlineSmall,
+            ),
+          ),
+          Expanded(
+            child: ListView(
+              children: [
+                ListTile(
+                  leading: const Icon(Icons.add),
+                  title: Text(AppLocalizations.of(context)!.realmNewCreate),
+                  onTap: () {
+                    SolianRouter.router.pushNamed('realms.editor').then((did) {
+                      if (did == true) {
+                        onUpdate();
+                        if (Navigator.canPop(context)) {
+                          Navigator.pop(context);
+                        }
+                      }
+                    });
+                  },
+                ),
+                ListTile(
+                  leading: const Icon(Icons.travel_explore),
+                  title: Text(AppLocalizations.of(context)!.realmNewJoin),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

lib/widgets/realms/realm_shortcuts.dart

@@ -0,0 +1,72 @@
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:solian/providers/auth.dart';
+import 'package:solian/providers/realm.dart';
+import 'package:solian/router.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:flutter_gen/gen_l10n/app_localizations.dart';
+
+class RealmShortcuts extends StatelessWidget {
+  const RealmShortcuts({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    final auth = context.read<AuthProvider>();
+    final realm = context.watch<RealmProvider>();
+
+    if (realm.realms.isEmpty) {
+      return Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        children: [
+          SizedBox(
+            width: 280,
+            child: Text(
+              AppLocalizations.of(context)!.shortcutsEmpty,
+              style: const TextStyle(fontWeight: FontWeight.normal, fontSize: 16),
+              textAlign: TextAlign.center,
+            ),
+          )
+        ],
+      );
+    }
+
+    return ListView.builder(
+      itemCount: realm.realms.length,
+      scrollDirection: Axis.horizontal,
+      itemBuilder: (context, index) {
+        final element = realm.realms[index];
+
+        return InkWell(
+          child: SizedBox(
+            width: 80,
+            child: Column(
+              mainAxisSize: MainAxisSize.max,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                const Padding(
+                  padding: EdgeInsets.only(top: 16, bottom: 8),
+                  child: CircleAvatar(
+                    backgroundColor: Colors.teal,
+                    child: Icon(Icons.supervised_user_circle, color: Colors.white),
+                  ),
+                ),
+                Text(element.name, textAlign: TextAlign.center),
+              ],
+            ),
+          ),
+          onTap: () async {
+            if (SolianTheme.isLargeScreen(context)) {
+              await realm.fetchSingle(auth, element.alias);
+              SolianRouter.router.pushNamed('realms');
+            } else {
+              SolianRouter.router.pushNamed(
+                'realms.details',
+                pathParameters: {'realm': element.alias},
+              );
+            }
+          },
+        );
+      },
+    );
+  }
+}

lib/widgets/scaffold.dart

@@ -0,0 +1,67 @@
+import 'package:flutter/material.dart';
+import 'package:solian/router.dart';
+import 'package:solian/utils/theme.dart';
+import 'package:solian/widgets/navigation_drawer.dart';
+
+class IndentScaffold extends StatelessWidget {
+  final Widget? body;
+  final Widget? floatingActionButton;
+  final Widget? appBarLeading;
+  final List<Widget>? appBarActions;
+  final bool hideDrawer;
+  final bool showSafeArea;
+  final bool fixedAppBarColor;
+  final String title;
+
+  const IndentScaffold({
+    super.key,
+    this.body,
+    required this.title,
+    this.floatingActionButton,
+    this.appBarLeading,
+    this.appBarActions,
+    this.hideDrawer = false,
+    this.showSafeArea = false,
+    this.fixedAppBarColor = false,
+  });
+
+  @override
+  Widget build(BuildContext context) {
+    final backButton = IconButton(
+      icon: const Icon(Icons.arrow_back),
+      tooltip: MaterialLocalizations.of(context).backButtonTooltip,
+      onPressed: () {
+        if (SolianRouter.router.canPop()) {
+          SolianRouter.router.pop();
+        }
+      },
+    );
+
+    final drawerButton = Builder(
+      builder: (context) {
+        return IconButton(
+          icon: const Icon(Icons.menu),
+          tooltip: MaterialLocalizations.of(context).openAppDrawerTooltip,
+          onPressed: () {
+            Scaffold.of(context).openDrawer();
+          },
+        );
+      }
+    );
+
+    return Scaffold(
+      appBar: AppBar(
+        title: Text(title),
+        leading: appBarLeading ?? (hideDrawer ? backButton : drawerButton),
+        actions: appBarActions,
+        centerTitle: false,
+        elevation: fixedAppBarColor ? 4 : null,
+        automaticallyImplyLeading: false,
+      ),
+      floatingActionButton: floatingActionButton,
+      drawer: !hideDrawer ? const SolianNavigationDrawer() : null,
+      drawerScrimColor: SolianTheme.isLargeScreen(context) ? Colors.transparent : null,
+      body: showSafeArea ? SafeArea(child: body ?? Container()) : body,
+    );
+  }
+}

lib/widgets/signin_required.dart

@@ -32,7 +32,7 @@ class SignInRequiredScreen extends StatelessWidget {
         ),
       ),
       onTap: () {
-        router.goNamed('account');
+        SolianRouter.router.goNamed('account');
       },
     );
   }

linux/flutter/generated_plugin_registrant.cc

@@ -6,6 +6,7 @@
 
 #include "generated_plugin_registrant.h"
 
+#include <desktop_drop/desktop_drop_plugin.h>
 #include <file_selector_linux/file_selector_plugin.h>
 #include <flutter_secure_storage_linux/flutter_secure_storage_linux_plugin.h>
 #include <flutter_webrtc/flutter_web_r_t_c_plugin.h>
@@ -14,6 +15,9 @@
 #include <url_launcher_linux/url_launcher_plugin.h>
 
 void fl_register_plugins(FlPluginRegistry* registry) {
+  g_autoptr(FlPluginRegistrar) desktop_drop_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "DesktopDropPlugin");
+  desktop_drop_plugin_register_with_registrar(desktop_drop_registrar);
   g_autoptr(FlPluginRegistrar) file_selector_linux_registrar =
       fl_plugin_registry_get_registrar_for_plugin(registry, "FileSelectorPlugin");
   file_selector_plugin_register_with_registrar(file_selector_linux_registrar);

linux/flutter/generated_plugins.cmake

@@ -3,6 +3,7 @@
 #
 
 list(APPEND FLUTTER_PLUGIN_LIST
+  desktop_drop
   file_selector_linux
   flutter_secure_storage_linux
   flutter_webrtc

macos/Flutter/GeneratedPluginRegistrant.swift

@@ -6,6 +6,7 @@ import FlutterMacOS
 import Foundation
 
 import connectivity_plus
+import desktop_drop
 import device_info_plus
 import file_selector_macos
 import flutter_local_notifications
@@ -17,11 +18,13 @@ import media_kit_video
 import package_info_plus
 import path_provider_foundation
 import screen_brightness_macos
+import sqflite
 import url_launcher_macos
 import wakelock_plus
 
 func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
   ConnectivityPlusPlugin.register(with: registry.registrar(forPlugin: "ConnectivityPlusPlugin"))
+  DesktopDropPlugin.register(with: registry.registrar(forPlugin: "DesktopDropPlugin"))
   DeviceInfoPlusMacosPlugin.register(with: registry.registrar(forPlugin: "DeviceInfoPlusMacosPlugin"))
   FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
   FlutterLocalNotificationsPlugin.register(with: registry.registrar(forPlugin: "FlutterLocalNotificationsPlugin"))
@@ -33,6 +36,7 @@ func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
   FPPPackageInfoPlusPlugin.register(with: registry.registrar(forPlugin: "FPPPackageInfoPlusPlugin"))
   PathProviderPlugin.register(with: registry.registrar(forPlugin: "PathProviderPlugin"))
   ScreenBrightnessMacosPlugin.register(with: registry.registrar(forPlugin: "ScreenBrightnessMacosPlugin"))
+  SqflitePlugin.register(with: registry.registrar(forPlugin: "SqflitePlugin"))
   UrlLauncherPlugin.register(with: registry.registrar(forPlugin: "UrlLauncherPlugin"))
   WakelockPlusMacosPlugin.register(with: registry.registrar(forPlugin: "WakelockPlusMacosPlugin"))
 }

macos/Podfile.lock

@@ -2,6 +2,8 @@ PODS:
   - connectivity_plus (0.0.1):
     - Flutter
     - FlutterMacOS
+  - desktop_drop (0.0.1):
+    - FlutterMacOS
   - device_info_plus (0.0.1):
     - FlutterMacOS
   - file_selector_macos (0.0.1):
@@ -30,6 +32,9 @@ PODS:
     - FlutterMacOS
   - screen_brightness_macos (0.1.0):
     - FlutterMacOS
+  - sqflite (0.0.3):
+    - Flutter
+    - FlutterMacOS
   - url_launcher_macos (0.0.1):
     - FlutterMacOS
   - wakelock_plus (0.0.1):
@@ -38,6 +43,7 @@ PODS:
 
 DEPENDENCIES:
   - connectivity_plus (from `Flutter/ephemeral/.symlinks/plugins/connectivity_plus/darwin`)
+  - desktop_drop (from `Flutter/ephemeral/.symlinks/plugins/desktop_drop/macos`)
   - device_info_plus (from `Flutter/ephemeral/.symlinks/plugins/device_info_plus/macos`)
   - file_selector_macos (from `Flutter/ephemeral/.symlinks/plugins/file_selector_macos/macos`)
   - flutter_local_notifications (from `Flutter/ephemeral/.symlinks/plugins/flutter_local_notifications/macos`)
@@ -51,6 +57,7 @@ DEPENDENCIES:
   - package_info_plus (from `Flutter/ephemeral/.symlinks/plugins/package_info_plus/macos`)
   - path_provider_foundation (from `Flutter/ephemeral/.symlinks/plugins/path_provider_foundation/darwin`)
   - screen_brightness_macos (from `Flutter/ephemeral/.symlinks/plugins/screen_brightness_macos/macos`)
+  - sqflite (from `Flutter/ephemeral/.symlinks/plugins/sqflite/darwin`)
   - url_launcher_macos (from `Flutter/ephemeral/.symlinks/plugins/url_launcher_macos/macos`)
   - wakelock_plus (from `Flutter/ephemeral/.symlinks/plugins/wakelock_plus/macos`)
 
@@ -61,6 +68,8 @@ SPEC REPOS:
 EXTERNAL SOURCES:
   connectivity_plus:
     :path: Flutter/ephemeral/.symlinks/plugins/connectivity_plus/darwin
+  desktop_drop:
+    :path: Flutter/ephemeral/.symlinks/plugins/desktop_drop/macos
   device_info_plus:
     :path: Flutter/ephemeral/.symlinks/plugins/device_info_plus/macos
   file_selector_macos:
@@ -87,6 +96,8 @@ EXTERNAL SOURCES:
     :path: Flutter/ephemeral/.symlinks/plugins/path_provider_foundation/darwin
   screen_brightness_macos:
     :path: Flutter/ephemeral/.symlinks/plugins/screen_brightness_macos/macos
+  sqflite:
+    :path: Flutter/ephemeral/.symlinks/plugins/sqflite/darwin
   url_launcher_macos:
     :path: Flutter/ephemeral/.symlinks/plugins/url_launcher_macos/macos
   wakelock_plus:
@@ -94,6 +105,7 @@ EXTERNAL SOURCES:
 
 SPEC CHECKSUMS:
   connectivity_plus: ddd7f30999e1faaef5967c23d5b6d503d10434db
+  desktop_drop: 69eeff437544aa619c8db7f4481b3a65f7696898
   device_info_plus: ce1b7762849d3ec103d0e0517299f2db7ad60720
   file_selector_macos: 468fb6b81fac7c0e88d71317f3eec34c3b008ff9
   flutter_local_notifications: 3805ca215b2fb7f397d78b66db91f6a747af52e4
@@ -107,6 +119,7 @@ SPEC CHECKSUMS:
   package_info_plus: fa739dd842b393193c5ca93c26798dff6e3d0e0c
   path_provider_foundation: 3784922295ac71e43754bd15e0653ccfd36a147c
   screen_brightness_macos: 2d6d3af2165592d9a55ffcd95b7550970e41ebda
+  sqflite: 673a0e54cc04b7d6dba8d24fb8095b31c3a99eec
   url_launcher_macos: d2691c7dd33ed713bf3544850a623080ec693d95
   wakelock_plus: 4783562c9a43d209c458cb9b30692134af456269
   WebRTC-SDK: efc3e67e0355b1ee14bfe3c91188cada6000cb94

pubspec.lock

@@ -17,6 +17,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.5.0"
+  asn1lib:
+    dependency: transitive
+    description:
+      name: asn1lib
+      sha256: "58082b3f0dca697204dbab0ef9ff208bfaea7767ea771076af9a343488428dda"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.5.3"
   async:
     dependency: transitive
     description:
@@ -33,6 +41,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "3.1.2"
+  basic_utils:
+    dependency: "direct main"
+    description:
+      name: basic_utils
+      sha256: "2064b21d3c41ed7654bc82cc476fd65542e04d60059b74d5eed490a4da08fc6c"
+      url: "https://pub.dev"
+    source: hosted
+    version: "5.7.0"
   boolean_selector:
     dependency: transitive
     description:
@@ -41,6 +57,30 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.1.1"
+  cached_network_image:
+    dependency: "direct main"
+    description:
+      name: cached_network_image
+      sha256: "28ea9690a8207179c319965c13cd8df184d5ee721ae2ce60f398ced1219cea1f"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.3.1"
+  cached_network_image_platform_interface:
+    dependency: transitive
+    description:
+      name: cached_network_image_platform_interface
+      sha256: "9e90e78ae72caa874a323d78fa6301b3fb8fa7ea76a8f96dc5b5bf79f283bf2f"
+      url: "https://pub.dev"
+    source: hosted
+    version: "4.0.0"
+  cached_network_image_web:
+    dependency: transitive
+    description:
+      name: cached_network_image_web
+      sha256: "205d6a9f1862de34b93184f22b9d2d94586b2f05c581d546695e3d8f6a805cd7"
+      url: "https://pub.dev"
+    source: hosted
+    version: "1.2.0"
   characters:
     dependency: transitive
     description:
@@ -153,6 +193,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "0.7.10"
+  desktop_drop:
+    dependency: "direct main"
+    description:
+      name: desktop_drop
+      sha256: d55a010fe46c8e8fcff4ea4b451a9ff84a162217bdb3b2a0aa1479776205e15d
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.4.4"
   device_info_plus:
     dependency: transitive
     description:
@@ -177,6 +225,22 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "0.1.0"
+  easy_debounce:
+    dependency: "direct main"
+    description:
+      name: easy_debounce
+      sha256: f082609cfb8f37defb9e37fc28bc978c6712dedf08d4c5a26f820fa10165a236
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.3"
+  encrypt:
+    dependency: "direct main"
+    description:
+      name: encrypt
+      sha256: "62d9aa4670cc2a8798bab89b39fc71b6dfbacf615de6cf5001fb39f7e4a996a2"
+      url: "https://pub.dev"
+    source: hosted
+    version: "5.0.3"
   fake_async:
     dependency: transitive
     description:
@@ -270,6 +334,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "1.2.0"
+  flutter_cache_manager:
+    dependency: transitive
+    description:
+      name: flutter_cache_manager
+      sha256: "395d6b7831f21f3b989ebedbb785545932adb9afe2622c1ffacf7f4b53a7e544"
+      url: "https://pub.dev"
+    source: hosted
+    version: "3.3.2"
   flutter_carousel_widget:
     dependency: "direct main"
     description:
@@ -429,6 +501,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "13.2.4"
+  google_fonts:
+    dependency: "direct main"
+    description:
+      name: google_fonts
+      sha256: b1ac0fe2832c9cc95e5e88b57d627c5e68c223b9657f4b96e1487aa9098c7b82
+      url: "https://pub.dev"
+    source: hosted
+    version: "6.2.1"
   hive:
     dependency: transitive
     description:
@@ -749,8 +829,16 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.0.2"
-  package_info_plus:
+  octo_image:
     dependency: transitive
+    description:
+      name: octo_image
+      sha256: "45b40f99622f11901238e18d48f5f12ea36426d8eced9f4cbf58479c7aa2430d"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.0.0"
+  package_info_plus:
+    dependency: "direct main"
     description:
       name: package_info_plus
       sha256: "2c582551839386fa7ddbc7770658be7c0f87f388a4bff72066478f597c34d17f"
@@ -905,10 +993,10 @@ packages:
     dependency: transitive
     description:
       name: pointycastle
-      sha256: "79fbafed02cfdbe85ef3fd06c7f4bc2cbcba0177e61b765264853d4253b21744"
+      sha256: "4be0097fcf3fd3e8449e53730c631200ebc7b88016acecab2b0da2f0149222fe"
       url: "https://pub.dev"
     source: hosted
-    version: "3.9.0"
+    version: "3.9.1"
   protobuf:
     dependency: transitive
     description:
@@ -933,6 +1021,14 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "2.1.4"
+  rxdart:
+    dependency: transitive
+    description:
+      name: rxdart
+      sha256: "0c7c0cedd93788d996e33041ffecda924cc54389199cde4e6a34b440f50044cb"
+      url: "https://pub.dev"
+    source: hosted
+    version: "0.27.7"
   safe_local_storage:
     dependency: transitive
     description:
@@ -1026,6 +1122,22 @@ packages:
       url: "https://pub.dev"
     source: hosted
     version: "7.0.0"
+  sqflite:
+    dependency: transitive
+    description:
+      name: sqflite
+      sha256: a43e5a27235518c03ca238e7b4732cf35eabe863a369ceba6cbefa537a66f16d
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.3.3+1"
+  sqflite_common:
+    dependency: transitive
+    description:
+      name: sqflite_common
+      sha256: "3da423ce7baf868be70e2c0976c28a1bb2f73644268b7ffa7d2e08eab71f16a4"
+      url: "https://pub.dev"
+    source: hosted
+    version: "2.5.4"
   stack_trace:
     dependency: transitive
     description:
@@ -1324,4 +1436,4 @@ packages:
     version: "3.1.2"
 sdks:
   dart: ">=3.3.3 <4.0.0"
-  flutter: ">=3.19.0"
+  flutter: ">=3.19.2"

pubspec.yaml

@@ -68,6 +68,13 @@ dependencies:
   flutter_local_notifications: ^17.1.0
   draggable_float_widget: ^0.1.0
   file_picker: ^8.0.3
+  package_info_plus: ^7.0.0
+  cached_network_image: ^3.3.1
+  desktop_drop: ^0.4.4
+  easy_debounce: ^2.0.3
+  google_fonts: ^6.2.1
+  basic_utils: ^5.7.0
+  encrypt: ^5.0.3
 
 dev_dependencies:
   flutter_test:

web/index.html

@@ -41,6 +41,8 @@
 </head>
 <body>
   <script>
+    window.flutterWebRenderer = "html";
+
     window.addEventListener('load', function(ev) {
       // Download main.dart.js
       _flutter.loader.loadEntrypoint({

windows/flutter/generated_plugin_registrant.cc

@@ -7,6 +7,7 @@
 #include "generated_plugin_registrant.h"
 
 #include <connectivity_plus/connectivity_plus_windows_plugin.h>
+#include <desktop_drop/desktop_drop_plugin.h>
 #include <file_selector_windows/file_selector_windows.h>
 #include <flutter_secure_storage_windows/flutter_secure_storage_windows_plugin.h>
 #include <flutter_webrtc/flutter_web_r_t_c_plugin.h>
@@ -20,6 +21,8 @@
 void RegisterPlugins(flutter::PluginRegistry* registry) {
   ConnectivityPlusWindowsPluginRegisterWithRegistrar(
       registry->GetRegistrarForPlugin("ConnectivityPlusWindowsPlugin"));
+  DesktopDropPluginRegisterWithRegistrar(
+      registry->GetRegistrarForPlugin("DesktopDropPlugin"));
   FileSelectorWindowsRegisterWithRegistrar(
       registry->GetRegistrarForPlugin("FileSelectorWindows"));
   FlutterSecureStorageWindowsPluginRegisterWithRegistrar(

windows/flutter/generated_plugins.cmake

@@ -4,6 +4,7 @@
 
 list(APPEND FLUTTER_PLUGIN_LIST
   connectivity_plus
+  desktop_drop
   file_selector_windows
   flutter_secure_storage_windows
   flutter_webrtc